DE1118004B - Elektrophotographisches Verfahren mit elektrolytischer Bildentwicklung - Google Patents
Elektrophotographisches Verfahren mit elektrolytischer BildentwicklungInfo
- Publication number
- DE1118004B DE1118004B DEM33719A DEM0033719A DE1118004B DE 1118004 B DE1118004 B DE 1118004B DE M33719 A DEM33719 A DE M33719A DE M0033719 A DEM0033719 A DE M0033719A DE 1118004 B DE1118004 B DE 1118004B
- Authority
- DE
- Germany
- Prior art keywords
- layer
- image
- light
- exposed
- conductive
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 23
- 230000008569 process Effects 0.000 title claims description 8
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 61
- 239000011787 zinc oxide Substances 0.000 claims description 31
- 229910052751 metal Inorganic materials 0.000 claims description 18
- 239000002184 metal Substances 0.000 claims description 18
- 239000003792 electrolyte Substances 0.000 claims description 15
- 239000011230 binding agent Substances 0.000 claims description 14
- 239000000463 material Substances 0.000 claims description 12
- 239000002245 particle Substances 0.000 claims description 7
- 229920000159 gelatin Polymers 0.000 claims description 6
- 235000019322 gelatine Nutrition 0.000 claims description 6
- 239000000758 substrate Substances 0.000 claims description 6
- 229910052782 aluminium Inorganic materials 0.000 claims description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 239000000843 powder Substances 0.000 claims 2
- 239000001828 Gelatine Substances 0.000 claims 1
- 230000002101 lytic effect Effects 0.000 claims 1
- 239000004014 plasticizer Substances 0.000 claims 1
- 238000000576 coating method Methods 0.000 description 38
- 239000011248 coating agent Substances 0.000 description 30
- 239000010408 film Substances 0.000 description 29
- 239000010410 layer Substances 0.000 description 27
- 239000000243 solution Substances 0.000 description 19
- 230000018109 developmental process Effects 0.000 description 17
- 239000000975 dye Substances 0.000 description 15
- 239000011888 foil Substances 0.000 description 13
- 238000005868 electrolysis reaction Methods 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 9
- 229910052802 copper Inorganic materials 0.000 description 8
- 239000010949 copper Substances 0.000 description 8
- 230000033458 reproduction Effects 0.000 description 8
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 7
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 239000002344 surface layer Substances 0.000 description 7
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 6
- 229920005989 resin Polymers 0.000 description 6
- 239000011347 resin Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 108010010803 Gelatin Proteins 0.000 description 5
- 239000002250 absorbent Substances 0.000 description 5
- 230000002745 absorbent Effects 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 229910000365 copper sulfate Inorganic materials 0.000 description 5
- 239000008273 gelatin Substances 0.000 description 5
- 235000011852 gelatine desserts Nutrition 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 239000000049 pigment Substances 0.000 description 5
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- CXKWCBBOMKCUKX-UHFFFAOYSA-M methylene blue Chemical compound [Cl-].C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 CXKWCBBOMKCUKX-UHFFFAOYSA-M 0.000 description 4
- 229960000907 methylthioninium chloride Drugs 0.000 description 4
- 230000035945 sensitivity Effects 0.000 description 4
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- MQRWBMAEBQOWAF-UHFFFAOYSA-N acetic acid;nickel Chemical compound [Ni].CC(O)=O.CC(O)=O MQRWBMAEBQOWAF-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000001004 diazonium dye Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229940078494 nickel acetate Drugs 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- 230000001680 brushing effect Effects 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(i) oxide Chemical compound [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 230000009089 cytolysis Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000004070 electrodeposition Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- QTWZICCBKBYHDM-UHFFFAOYSA-N leucomethylene blue Chemical compound C1=C(N(C)C)C=C2SC3=CC(N(C)C)=CC=C3NC2=C1 QTWZICCBKBYHDM-UHFFFAOYSA-N 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 2
- 239000004584 polyacrylic acid Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229910001961 silver nitrate Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- JRBJSXQPQWSCCF-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine Chemical compound C1=C(N)C(OC)=CC(C=2C=C(OC)C(N)=CC=2)=C1 JRBJSXQPQWSCCF-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 230000001914 calming effect Effects 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- DCYOBGZUOMKFPA-UHFFFAOYSA-N iron(2+);iron(3+);octadecacyanide Chemical compound [Fe+2].[Fe+2].[Fe+2].[Fe+3].[Fe+3].[Fe+3].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCYOBGZUOMKFPA-UHFFFAOYSA-N 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 239000013081 microcrystal Substances 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- GTWJETSWSUWSEJ-UHFFFAOYSA-N n-benzylaniline Chemical compound C=1C=CC=CC=1CNC1=CC=CC=C1 GTWJETSWSUWSEJ-UHFFFAOYSA-N 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- XYKIUTSFQGXHOW-UHFFFAOYSA-N propan-2-one;toluene Chemical compound CC(C)=O.CC1=CC=CC=C1 XYKIUTSFQGXHOW-UHFFFAOYSA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 229960003351 prussian blue Drugs 0.000 description 1
- 239000013225 prussian blue Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 238000010405 reoxidation reaction Methods 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- 238000010023 transfer printing Methods 0.000 description 1
- 238000002834 transmittance Methods 0.000 description 1
- -1 triphenylmethane compound Chemical class 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G17/00—Electrographic processes using patterns other than charge patterns, e.g. an electric conductivity pattern; Processes involving a migration, e.g. photoelectrophoresis, photoelectrosolography; Processes involving a selective transfer, e.g. electrophoto-adhesive processes; Apparatus essentially involving a single such process
- G03G17/02—Electrographic processes using patterns other than charge patterns, e.g. an electric conductivity pattern; Processes involving a migration, e.g. photoelectrophoresis, photoelectrosolography; Processes involving a selective transfer, e.g. electrophoto-adhesive processes; Apparatus essentially involving a single such process with electrolytic development
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S101/00—Printing
- Y10S101/37—Printing employing electrostatic force
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Molecular Biology (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
- Electrophotography Using Other Than Carlson'S Method (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US575070A US3010883A (en) | 1956-03-30 | 1956-03-30 | Electrolytic electrophotography |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1118004B true DE1118004B (de) | 1961-11-23 |
Family
ID=24298809
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEM67357A Pending DE1287006B (de) | 1956-03-30 | 1957-03-29 | Elektrophotographisches Kopiergeraet |
| DEM33719A Pending DE1118004B (de) | 1956-03-30 | 1957-03-29 | Elektrophotographisches Verfahren mit elektrolytischer Bildentwicklung |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEM67357A Pending DE1287006B (de) | 1956-03-30 | 1957-03-29 | Elektrophotographisches Kopiergeraet |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3010883A (show.php) |
| BE (1) | BE561403A (show.php) |
| CH (2) | CH366450A (show.php) |
| DE (2) | DE1287006B (show.php) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1293593B (de) * | 1960-11-08 | 1969-04-24 | Gevaert Photo Prod Nv | Verfahren zur Entwicklung eines Leitfaehigkeitsbildes |
| DE2436940A1 (de) * | 1973-07-31 | 1975-02-27 | Awramenko | Verfahren zur wiedergabe eines sichtbaren bildes |
Families Citing this family (58)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3127332A (en) * | 1964-03-31 | Reproduction process | ||
| US3127333A (en) * | 1964-03-31 | bonrud | ||
| US3140175A (en) * | 1957-07-03 | 1964-07-07 | Edward K Kaprelian | Color electrophotography |
| US3096198A (en) * | 1958-12-22 | 1963-07-02 | Ibm | Method for developing latent field images with liquid inks |
| US3127331A (en) * | 1959-06-15 | 1964-03-31 | Reverse current electrolytic process | |
| US3418217A (en) * | 1959-07-23 | 1968-12-24 | Minnesota Mining & Mfg | Electrolytic image formation |
| US3085051A (en) * | 1959-10-23 | 1963-04-09 | Minnesota Mining & Mfg | Novel developer and process for the use thereof in electrolytic image reproduction |
| US3252874A (en) * | 1959-10-23 | 1966-05-24 | Minnesota Mining & Mfg | Photosensitive sheets, the preparation and use thereof |
| NL262411A (show.php) * | 1960-03-18 | |||
| NL263729A (show.php) * | 1960-04-18 | |||
| US3154414A (en) * | 1960-04-18 | 1964-10-27 | Minnesota Mining & Mfg | Image removal |
| US3172826A (en) * | 1960-04-18 | 1965-03-09 | Minnesota Mining & Mfg | Photoconductography employing organic onium cation |
| GB1016693A (en) * | 1960-07-05 | 1966-01-12 | Sony Corp | Recording process and recording material for use with the said process |
| US3106518A (en) * | 1960-07-28 | 1963-10-08 | Eastman Kodak Co | Photoconductography employing spongy hydroxide images |
| US3178362A (en) * | 1960-07-28 | 1965-04-13 | Eastman Kodak Co | Photoconductography employing quaternary salts |
| US3227076A (en) * | 1960-07-28 | 1966-01-04 | Eastman Kodak Co | Photoconductography employing reducing agents |
| US3432406A (en) * | 1960-07-28 | 1969-03-11 | Eastman Kodak Co | Photoconductographic material and process of preparation |
| US3152969A (en) * | 1960-07-28 | 1964-10-13 | Eastman Kodak Co | Photoconductolithography employing hydrophobic images |
| US3106156A (en) * | 1960-07-28 | 1963-10-08 | Eastman Kodak Co | Photoconductography employing molybdenum or ferrous oxide |
| US3057788A (en) * | 1960-07-28 | 1962-10-09 | Eastman Kodak Co | Photoconductography employing cobaltous or nickelous hydroxide |
| US3194748A (en) * | 1960-10-25 | 1965-07-13 | Eastman Kodak Co | Reversal photoconductographic processing |
| US3232852A (en) * | 1960-10-25 | 1966-02-01 | Eastman Kodak Co | Dry photoconductographic process |
| US3265595A (en) * | 1960-10-25 | 1966-08-09 | Eastman Kodak Co | Visually controlled photoconductographic process |
| US3165456A (en) * | 1960-11-21 | 1965-01-12 | Minnesota Mining & Mfg | Developer |
| US3152012A (en) * | 1960-12-19 | 1964-10-06 | Ibm | Apparatus for the development of electrostatic images |
| US3122489A (en) * | 1960-12-27 | 1964-02-25 | Hogan Faximile Corp | Electrolytic recording medium |
| DE1219328B (de) * | 1961-04-19 | 1966-06-16 | Agfa Ag | Verfahren zur Entwicklung von Ladungsbildern |
| DE1164829B (de) * | 1961-04-26 | 1964-03-05 | Bayer Ag | Verfahren zur elektrophotographischen Herstellung von Bildern mit Fluessigkeitsaerosolen |
| US3165457A (en) * | 1961-05-15 | 1965-01-12 | Eastman Kodak Co | Direct positive photoconductography |
| US3172828A (en) * | 1961-05-29 | 1965-03-09 | Radiation-responsive element | |
| US3410767A (en) * | 1961-05-29 | 1968-11-12 | Minnesota Mining & Mfg | Electrographic reproduction process |
| US3213003A (en) * | 1961-08-01 | 1965-10-19 | Minnesota Mining & Mfg | Electrophotosensitive copy sheet and method of use thereof |
| US3343956A (en) * | 1961-09-29 | 1967-09-26 | Rca Corp | Electrostatic printing process wherein development is achieved by sequenctial application of carrier liquid and developer particles |
| BE624738A (show.php) * | 1961-11-15 | |||
| US3257304A (en) * | 1961-11-27 | 1966-06-21 | Minnesota Mining & Mfg | Process of electrodepositing insulative material on photoconductive copysheet |
| US3236749A (en) * | 1962-02-13 | 1966-02-22 | Eastman Kodak Co | Single-step direct image-forming electrolytic developer and process for photoconductographic processing |
| US3130655A (en) * | 1963-01-21 | 1964-04-28 | Minnesota Mining & Mfg | Photographic apparatus |
| US3355290A (en) * | 1962-06-27 | 1967-11-28 | Jean J Robillard | Electro-catalytic photography |
| US3272121A (en) * | 1963-02-14 | 1966-09-13 | Plastic Coating Corp | Lithographic printing plate prepared by photoelectrostatic reproduction, a method for its production and a method for lithographic printing |
| US3317409A (en) * | 1963-04-16 | 1967-05-02 | Minnesota Mining & Mfg | Electrolytic electrophotography |
| US3384565A (en) * | 1964-07-23 | 1968-05-21 | Xerox Corp | Process of photoelectrophoretic color imaging |
| US3247081A (en) * | 1964-08-07 | 1966-04-19 | Eastman Kodak Co | Electrolytic deposition of charged dyes for photoconductographic processes |
| US3402111A (en) * | 1965-01-22 | 1968-09-17 | Eastman Kodak Co | Emulsion developers for photoconductography |
| US3384560A (en) * | 1966-02-17 | 1968-05-21 | Eastman Kodak Co | Photoconductive developing solutions containing quaternary ammonium salt anti-shorting agents |
| US3537847A (en) * | 1966-05-10 | 1970-11-03 | Gen Dynamics Corp | Method of vapor plating |
| US3380823A (en) * | 1966-06-20 | 1968-04-30 | Itek Corp | Photocopying method |
| US3436321A (en) * | 1966-09-13 | 1969-04-01 | Minnesota Mining & Mfg | Developer compositions and their use in electrolytic electrophotography |
| US3547631A (en) * | 1967-10-26 | 1970-12-15 | Hughes Aircraft Co | Pacification of image recording media comprising applying a thin polymer film over the image surface |
| JPS4925505B1 (show.php) * | 1969-06-10 | 1974-07-01 | ||
| US3954462A (en) * | 1972-04-07 | 1976-05-04 | Keuffel & Esser Company | Electrolytically induced polymerization utilizing diazotization of primary aromatic amines |
| US3892645A (en) * | 1973-06-06 | 1975-07-01 | Adrien Castegnier | Printing method and system by gelatin coagulation |
| US4324622A (en) * | 1974-09-26 | 1982-04-13 | American Cyanamid Company | Multilayered electroplatographic element comprising ion conductive and electrochromic layers |
| US4002475A (en) * | 1975-05-05 | 1977-01-11 | Eastman Kodak Company | Photoconductive process for making electrographic masters |
| US4408215A (en) * | 1980-12-29 | 1983-10-04 | Electromark, Division Of Mohawk International Inc. | Electrochemical marking apparatus |
| JPS6433536A (en) * | 1987-07-29 | 1989-02-03 | Sony Corp | Electrochromic display device |
| US5690801A (en) * | 1997-01-21 | 1997-11-25 | Elcorsy Technology Inc. | Method of rendering an electrocoagulation printed image water-fast |
| US5690803A (en) * | 1997-01-27 | 1997-11-25 | Elcorsy Technology Inc. | Method of enhancing transfer of coagulated colloid onto a substrate during electrocoagulation printing |
| JPH1148609A (ja) * | 1997-08-04 | 1999-02-23 | Fuji Xerox Co Ltd | 画像記録方法及び画像記録装置 |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US168465A (en) * | 1875-10-05 | Improvement in solutions for chemical telegraphs | ||
| US1902213A (en) * | 1929-02-28 | 1933-03-21 | Bowman Ab | Process of reproducing images on metallic surfaces |
| BE411766A (show.php) * | 1934-10-13 | |||
| US2083249A (en) * | 1935-12-20 | 1937-06-08 | Joseph B Thomson | Photographic method and product resulting therefrom |
| US2297691A (en) * | 1939-04-04 | 1942-10-06 | Chester F Carlson | Electrophotography |
| US2319765A (en) * | 1939-12-14 | 1943-05-18 | Radio Inventions Inc | Electrolytic recording |
| US2433632A (en) * | 1942-12-23 | 1947-12-30 | Rca Corp | Fibrous sheet material for the electrolytic formation of azo dye image records thereon |
| US2551582A (en) * | 1943-08-27 | 1951-05-08 | Chester F Carlson | Method of printing and developing solvent images |
| US2690394A (en) * | 1943-08-27 | 1954-09-28 | Chester F Carlson | Electrophotography |
| US2633796A (en) * | 1944-04-05 | 1953-04-07 | Hoe & Co R | Printing means using electric fields |
| US2541488A (en) * | 1946-03-14 | 1951-02-13 | Eastman Kodak Co | Electrolytic diazo process |
| FR1008598A (fr) * | 1948-04-30 | 1952-05-19 | Onera (Off Nat Aerospatiale) | Procédé pour l'enregistrement graphique ou l'inscription dirccte en matériaux pour la mise en oeuvre de ce procédé |
| US2808328A (en) * | 1950-07-15 | 1957-10-01 | Carlyle W Jacob | Method and apparatus for xerographic reproduction |
| US2744859A (en) * | 1951-02-20 | 1956-05-08 | Robert H Rines | Electroplating method and system |
| US2735785A (en) * | 1953-07-30 | 1956-02-21 | Process of electrostatic printing | |
| US2798959A (en) * | 1953-10-01 | 1957-07-09 | Rca Corp | Photoconductive thermography |
| US2798960A (en) * | 1953-10-01 | 1957-07-09 | Rca Corp | Photoconductive thermography |
| US2758939A (en) * | 1953-12-30 | 1956-08-14 | Rca Corp | Electrostatic printing |
| US2837471A (en) * | 1955-12-30 | 1958-06-03 | Bell Telephone Labor Inc | Method of locating pn junctions in semiconductive bodies |
-
0
- BE BE561403D patent/BE561403A/xx unknown
-
1956
- 1956-03-30 US US575070A patent/US3010883A/en not_active Expired - Lifetime
-
1957
- 1957-03-29 DE DEM67357A patent/DE1287006B/de active Pending
- 1957-03-29 DE DEM33719A patent/DE1118004B/de active Pending
- 1957-03-29 CH CH4441457A patent/CH366450A/de unknown
- 1957-03-29 CH CH741862A patent/CH370965A/de unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1293593B (de) * | 1960-11-08 | 1969-04-24 | Gevaert Photo Prod Nv | Verfahren zur Entwicklung eines Leitfaehigkeitsbildes |
| DE2436940A1 (de) * | 1973-07-31 | 1975-02-27 | Awramenko | Verfahren zur wiedergabe eines sichtbaren bildes |
Also Published As
| Publication number | Publication date |
|---|---|
| CH370965A (de) | 1963-07-31 |
| DE1287006B (de) | 1970-05-27 |
| US3010883A (en) | 1961-11-28 |
| BE561403A (show.php) | |
| CH366450A (de) | 1962-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1118004B (de) | Elektrophotographisches Verfahren mit elektrolytischer Bildentwicklung | |
| DE1497219C3 (de) | Verfahren und Aufzeichnungsmaterial zur elektrophoretischen Bilderzeugung | |
| NO125887B (show.php) | ||
| DE1020235B (de) | Photoelektrisches Verfahren und Einrichtung zur Erzeugung photographischer oder radiographischer Bilder | |
| DE2047099A1 (de) | Photoelektrophoretische Bildwieder gabevorrichtung | |
| DE1146750B (de) | Elektrophotographisches Verfahren zur Reproduktion eines Lichtbildes mit Hilfe der Elektrolyse einer Indiumverbindung | |
| DE1295373B (de) | Elektrophotographisches Verfahren zur Herstellung von Bildern | |
| DE1522745C3 (de) | Elektrophoretophotographisches Verfahren | |
| DE2110553A1 (de) | Elektrofotografisches Abbildungsverfahren und Vorrichtung zur Durchfuehrung des Verfahrens | |
| DE2165665A1 (de) | Verfahren zur Herstellung von Bildern | |
| DE1497011A1 (de) | Elektrophotographisches Verfahren | |
| DE1622954A1 (de) | Elektrophoretisches Verfahren | |
| DE2702947A1 (de) | Verfahren zum elektrostatischen drucken | |
| DE1017911B (de) | Material und Verfahren fuer die elektrostatische Bildherstellung und eine Einrichtung zur Durchfuehrung des Verfahrens | |
| US3492206A (en) | Printing method utilizing electrolysis | |
| DE2328067A1 (de) | Verfahren zur verwendung eines fotografischen elements, das einen aktivator fuer eine physikalische entwicklung enthaelt | |
| DE1810079C3 (de) | Verfahren zur Herstellung eines elektrographischen Aufzeichnungsmaterials | |
| DE1964201C3 (de) | Elektrophotographisehes Aufzeichnungsverfahren | |
| US3213003A (en) | Electrophotosensitive copy sheet and method of use thereof | |
| DE2020726C3 (de) | Elektrophoretsches photographisches Verfahren zur Bildwiedergabe | |
| DE1483294B2 (de) | Verwendung eines Stoffes als photoleitender Werkstoff | |
| AT332898B (de) | Photographisches verfahren zur herstellung von druckplatten und bildregistrierfolie zur durchfuhrung des verfahrens | |
| DE1764864C3 (de) | Verfahren zum Herstellen eines lichtempfindlichen Pulvers aus CdS-Kristallen | |
| DE2538995C3 (de) | Verfahren zur Herstellung von Bildern und Aufzeichnungsmaterial hierfür | |
| AT241266B (de) | Verfahren und Vorrichtung zum Registriern und photoleitendes Material zur Durchführung des Verfahrens |