DE1063246B - Lichtbogenloeschkammer fuer Schalter grosser Abschaltleistung - Google Patents
Lichtbogenloeschkammer fuer Schalter grosser AbschaltleistungInfo
- Publication number
- DE1063246B DE1063246B DEC15454A DEC0015454A DE1063246B DE 1063246 B DE1063246 B DE 1063246B DE C15454 A DEC15454 A DE C15454A DE C0015454 A DEC0015454 A DE C0015454A DE 1063246 B DE1063246 B DE 1063246B
- Authority
- DE
- Germany
- Prior art keywords
- arc
- plates
- cooling
- extinguishing chamber
- arc extinguishing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000007789 gas Substances 0.000 claims description 24
- 238000001816 cooling Methods 0.000 claims description 22
- 238000002242 deionisation method Methods 0.000 claims description 12
- 239000002184 metal Substances 0.000 claims description 12
- 239000000696 magnetic material Substances 0.000 claims description 7
- 238000013508 migration Methods 0.000 claims description 6
- 230000005012 migration Effects 0.000 claims description 6
- 230000005520 electrodynamics Effects 0.000 claims description 4
- 239000011248 coating agent Substances 0.000 claims description 3
- 238000000576 coating method Methods 0.000 claims description 3
- 238000005452 bending Methods 0.000 claims 1
- 230000000694 effects Effects 0.000 description 5
- 239000011810 insulating material Substances 0.000 description 5
- 125000006850 spacer group Chemical group 0.000 description 4
- 210000001520 comb Anatomy 0.000 description 3
- PCTMTFRHKVHKIS-BMFZQQSSSA-N (1s,3r,4e,6e,8e,10e,12e,14e,16e,18s,19r,20r,21s,25r,27r,30r,31r,33s,35r,37s,38r)-3-[(2r,3s,4s,5s,6r)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-19,25,27,30,31,33,35,37-octahydroxy-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10 Chemical compound C1C=C2C[C@@H](OS(O)(=O)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2.O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 PCTMTFRHKVHKIS-BMFZQQSSSA-N 0.000 description 2
- 238000003780 insertion Methods 0.000 description 2
- 230000037431 insertion Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000007257 malfunction Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H9/00—Details of switching devices, not covered by groups H01H1/00 - H01H7/00
- H01H9/30—Means for extinguishing or preventing arc between current-carrying parts
- H01H9/34—Stationary parts for restricting or subdividing the arc, e.g. barrier plate
- H01H9/36—Metal parts
Landscapes
- Arc-Extinguishing Devices That Are Switches (AREA)
- Elimination Of Static Electricity (AREA)
- Linear Motors (AREA)
- Cooling Or The Like Of Electrical Apparatus (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR1063246X | 1956-09-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1063246B true DE1063246B (de) | 1959-08-13 |
Family
ID=9601036
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC15454A Pending DE1063246B (de) | 1956-09-10 | 1957-09-09 | Lichtbogenloeschkammer fuer Schalter grosser Abschaltleistung |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2934629A (enExample) |
| BE (1) | BE560671A (enExample) |
| CH (1) | CH344465A (enExample) |
| DE (1) | DE1063246B (enExample) |
| FR (2) | FR1157951A (enExample) |
| GB (1) | GB820250A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1290219B (de) * | 1964-09-11 | 1969-03-06 | Siemens Ag | Lichtbogenkammer fuer Niederspannungsschaltgeraete |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3073936A (en) * | 1958-10-01 | 1963-01-15 | Gen Electric | Electric circuit interrupter |
| US3031552A (en) * | 1959-05-28 | 1962-04-24 | Gen Electric | Electric circuit interrupter |
| US3126464A (en) * | 1960-06-16 | 1964-03-24 | Stettner | |
| US3495056A (en) * | 1965-07-22 | 1970-02-10 | Ite Imperial Corp | Current limiting interrupter with arc-inserted non-linear resistors |
| US3440378A (en) * | 1966-04-05 | 1969-04-22 | Gen Electric | Metal plate type of arc-extinguishing device |
| US3641294A (en) * | 1970-01-08 | 1972-02-08 | Allis Chalmers Mfg Co | Arc chute for air circuit breaker |
| GB1258375A (enExample) * | 1970-02-12 | 1971-12-30 | ||
| US4143256A (en) * | 1977-03-17 | 1979-03-06 | General Electric Company | Arc chute having plates coated with weld deterent material |
| US4405847A (en) * | 1980-12-23 | 1983-09-20 | Whipp & Bourme (1975) Limited | Arc chutes |
| GB8302615D0 (en) * | 1983-01-31 | 1983-03-02 | Whipp And Bourne 1975 Ltd | Arc splitter plates |
| DE102008017868B3 (de) * | 2008-04-09 | 2009-12-24 | Abb Ag | Lichtbogenlöschblechanordnung für einen elektrischen Schalter |
| US9087654B2 (en) * | 2012-12-04 | 2015-07-21 | Larsen & Toubro Limited | Arc chute arrangement for arc quenching in electrical switching device |
| CN118098900B (zh) * | 2024-04-28 | 2024-07-23 | 瑞睿电气(浙江)有限公司 | 一种交直流断路器灭弧装置 |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE767769C (de) * | 1942-01-24 | 1953-05-18 | Aeg | Funkenkammer aus keramischem Werkstoff |
| DE885741C (de) * | 1944-01-15 | 1953-08-06 | Aeg | Lichtbogenkammer fuer elektrische Schaltgeraete |
| DE915358C (de) * | 1939-01-04 | 1954-07-19 | Siemens Ag | Stromunterbrecher |
| DE919722C (de) * | 1940-10-29 | 1954-11-02 | Siemens Ag | Elektrischer Stromunterbrecher |
| DE957409C (de) * | 1953-04-23 | 1957-01-31 | Licentia Gmbh | Lichtbogenloeschkammer mit den Lichtbogen maeanderfoermig laengenden Querwaenden |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1840292A (en) * | 1928-06-29 | 1932-01-05 | Westinghouse Electric & Mfg Co | Electrical contactor |
| US1888707A (en) * | 1928-07-14 | 1932-11-22 | Westinghouse Electric & Mfg Co | Circuit interrupter |
| US1966316A (en) * | 1929-01-10 | 1934-07-10 | Westinghouse Electric & Mfg Co | Arc chute |
| US1963643A (en) * | 1933-02-23 | 1934-06-19 | Westinghouse Electric & Mfg Co | Circuit interrupter |
| BE431420A (enExample) * | 1937-12-14 | |||
| US2353729A (en) * | 1941-08-14 | 1944-07-18 | Ite Circuit Breaker Ltd | Air blast arc chute |
| GB618749A (en) * | 1946-11-30 | 1949-02-25 | Whipp And Bourne Ltd | Improvements in electric circuit breakers having arc extinguishing chambers |
| US2639353A (en) * | 1950-01-24 | 1953-05-19 | Allis Chalmers Mfg Co | Circuit breaker with arc chute short circuiting sections of the arc |
| US2632074A (en) * | 1950-06-29 | 1953-03-17 | Allis Chalmers Mfg Co | Arc chute utilizing interleaved u-shaped conductive members |
| US2596865A (en) * | 1950-07-03 | 1952-05-13 | Allis Chalmers Mfg Co | Arc chute utilizing staggered u-shaped conductive members |
| US2734970A (en) * | 1951-09-28 | 1956-02-14 | Circuit interrupters |
-
0
- BE BE560671D patent/BE560671A/xx unknown
-
1956
- 1956-09-10 FR FR1157951D patent/FR1157951A/fr not_active Expired
-
1957
- 1957-06-07 FR FR71713D patent/FR71713E/fr not_active Expired
- 1957-09-04 US US682051A patent/US2934629A/en not_active Expired - Lifetime
- 1957-09-06 CH CH344465D patent/CH344465A/fr unknown
- 1957-09-09 DE DEC15454A patent/DE1063246B/de active Pending
- 1957-09-10 GB GB28531/57A patent/GB820250A/en not_active Expired
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE915358C (de) * | 1939-01-04 | 1954-07-19 | Siemens Ag | Stromunterbrecher |
| DE919722C (de) * | 1940-10-29 | 1954-11-02 | Siemens Ag | Elektrischer Stromunterbrecher |
| DE767769C (de) * | 1942-01-24 | 1953-05-18 | Aeg | Funkenkammer aus keramischem Werkstoff |
| DE885741C (de) * | 1944-01-15 | 1953-08-06 | Aeg | Lichtbogenkammer fuer elektrische Schaltgeraete |
| DE957409C (de) * | 1953-04-23 | 1957-01-31 | Licentia Gmbh | Lichtbogenloeschkammer mit den Lichtbogen maeanderfoermig laengenden Querwaenden |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1290219B (de) * | 1964-09-11 | 1969-03-06 | Siemens Ag | Lichtbogenkammer fuer Niederspannungsschaltgeraete |
Also Published As
| Publication number | Publication date |
|---|---|
| CH344465A (fr) | 1960-02-15 |
| US2934629A (en) | 1960-04-26 |
| BE560671A (enExample) | |
| GB820250A (en) | 1959-09-16 |
| FR71713E (fr) | 1960-01-19 |
| FR1157951A (fr) | 1958-06-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE975815C (de) | Lichtbogenloeschvorrichtung | |
| DE728612C (de) | Schalter mit Lichtbogenkammer | |
| DE767738C (de) | Elektrischer Leistungsluftschalter mit Lichtbogenkammer | |
| DE1063246B (de) | Lichtbogenloeschkammer fuer Schalter grosser Abschaltleistung | |
| EP0752153B2 (de) | Lichtbogenlöschkammer mit drei barrieren für den durchtritt von lichtbogengasen | |
| DE3034149C2 (de) | Lichtbogenlöscheinrichtung für Strombegrenzungs-Stromkreisunterbrecher | |
| DE1963216A1 (de) | Luftschalter mit nachfolgend angeordneter Lichtbogenloeschkammer | |
| DE741695C (de) | Stromunterbrecher | |
| DE1185269C2 (de) | Einpoliger selbstschalter in schmalbauform | |
| DE1005153B (de) | Lichtbogenloeschvorrichtung fuer elektrische Schalter | |
| DE1415944B2 (enExample) | ||
| DE969297C (de) | Elektrischer Trennschalter | |
| DE1042072B (de) | Stromkreisunterbrecher mit Lichtbogenloeschkammer | |
| DD297532A5 (de) | Selbstschalter, insbesondere leitungsschutzschalter | |
| DE1031866B (de) | Lichtbogenloescheinrichtung fuer elektrische Schalter | |
| DE1025967B (de) | Lichtbogenloeschkammer mit im Wege des Lichtbogens angeordneten Platten aus Isolierstoff | |
| DE1232644B (de) | Schaltgeraet mit einer eine Loeschblechanordnung enthaltenden Lichtbogenkammer | |
| DE1135984B (de) | Elektrischer Leistungsschalter | |
| DE1007409B (de) | Lichtbogenloeschkammer | |
| DE1126010B (de) | Loeschblechanordnung fuer Niederspannungsschaltgeraete | |
| DE1182323B (de) | Elektrischer Schalter mit einem zur Lichtbogenloeschung dienenden Kamin | |
| EP0387761A2 (de) | Selbstschalter, insbesondere Leitungsschutzschalter | |
| DE1027280B (de) | Stromunterbrecher mit einem Schacht zum Aufnehmen und Loeschen des Schaltlichtbogens | |
| DE2912146A1 (de) | Loeschkammer vom magnetischen ausblastyp fuer einen lichtbogen | |
| AT235385B (de) | Schaltgerät mit Löschblechanordnung |