DE1021891C2 - Halbleiterdiode fuer Schaltstromkreise - Google Patents
Halbleiterdiode fuer SchaltstromkreiseInfo
- Publication number
- DE1021891C2 DE1021891C2 DE1956W0019922 DEW0019922A DE1021891C2 DE 1021891 C2 DE1021891 C2 DE 1021891C2 DE 1956W0019922 DE1956W0019922 DE 1956W0019922 DE W0019922 A DEW0019922 A DE W0019922A DE 1021891 C2 DE1021891 C2 DE 1021891C2
- Authority
- DE
- Germany
- Prior art keywords
- zones
- current
- critical
- diode
- voltage
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004065 semiconductor Substances 0.000 title claims description 38
- 239000002800 charge carrier Substances 0.000 claims description 17
- 230000002441 reversible effect Effects 0.000 claims description 14
- 229910052710 silicon Inorganic materials 0.000 claims description 10
- 239000010703 silicon Substances 0.000 claims description 10
- 238000002347 injection Methods 0.000 claims description 4
- 239000007924 injection Substances 0.000 claims description 4
- 238000002485 combustion reaction Methods 0.000 claims 1
- 239000000446 fuel Substances 0.000 claims 1
- 238000000034 method Methods 0.000 description 16
- 230000008569 process Effects 0.000 description 11
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 9
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 9
- 229910052782 aluminium Inorganic materials 0.000 description 8
- 229910052787 antimony Inorganic materials 0.000 description 8
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 8
- 230000005540 biological transmission Effects 0.000 description 7
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 5
- 229910052796 boron Inorganic materials 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 230000007704 transition Effects 0.000 description 5
- 238000004804 winding Methods 0.000 description 5
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- 238000009792 diffusion process Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229910021421 monocrystalline silicon Inorganic materials 0.000 description 4
- 239000010453 quartz Substances 0.000 description 4
- 230000006798 recombination Effects 0.000 description 4
- 238000005215 recombination Methods 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 229910000838 Al alloy Inorganic materials 0.000 description 3
- 238000005275 alloying Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229910052734 helium Inorganic materials 0.000 description 3
- 239000001307 helium Substances 0.000 description 3
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000035515 penetration Effects 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 229910000410 antimony oxide Inorganic materials 0.000 description 2
- 238000004891 communication Methods 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 2
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229910001245 Sb alloy Inorganic materials 0.000 description 1
- 229910000676 Si alloy Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- LEVVHYCKPQWKOP-UHFFFAOYSA-N [Si].[Ge] Chemical compound [Si].[Ge] LEVVHYCKPQWKOP-UHFFFAOYSA-N 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- 239000002140 antimony alloy Substances 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 229910021419 crystalline silicon Inorganic materials 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229910001651 emery Inorganic materials 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910021478 group 5 element Inorganic materials 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 238000009958 sewing Methods 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04Q—SELECTING
- H04Q3/00—Selecting arrangements
- H04Q3/42—Circuit arrangements for indirect selecting controlled by common circuits, e.g. register controller, marker
- H04Q3/52—Circuit arrangements for indirect selecting controlled by common circuits, e.g. register controller, marker using static devices in switching stages, e.g. electronic switching arrangements
- H04Q3/521—Circuit arrangements for indirect selecting controlled by common circuits, e.g. register controller, marker using static devices in switching stages, e.g. electronic switching arrangements using semiconductors in the switching stages
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K17/00—Electronic switching or gating, i.e. not by contact-making and –breaking
- H03K17/51—Electronic switching or gating, i.e. not by contact-making and –breaking characterised by the components used
- H03K17/56—Electronic switching or gating, i.e. not by contact-making and –breaking characterised by the components used by the use, as active elements, of semiconductor devices
- H03K17/70—Electronic switching or gating, i.e. not by contact-making and –breaking characterised by the components used by the use, as active elements, of semiconductor devices the devices having only two electrodes and exhibiting negative resistance
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10D—INORGANIC ELECTRIC SEMICONDUCTOR DEVICES
- H10D8/00—Diodes
- H10D8/80—PNPN diodes, e.g. Shockley diodes or break-over diodes
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10F—INORGANIC SEMICONDUCTOR DEVICES SENSITIVE TO INFRARED RADIATION, LIGHT, ELECTROMAGNETIC RADIATION OF SHORTER WAVELENGTH OR CORPUSCULAR RADIATION
- H10F30/00—Individual radiation-sensitive semiconductor devices in which radiation controls the flow of current through the devices, e.g. photodetectors
- H10F30/20—Individual radiation-sensitive semiconductor devices in which radiation controls the flow of current through the devices, e.g. photodetectors the devices having potential barriers, e.g. phototransistors
- H10F30/21—Individual radiation-sensitive semiconductor devices in which radiation controls the flow of current through the devices, e.g. photodetectors the devices having potential barriers, e.g. phototransistors the devices being sensitive to infrared, visible or ultraviolet radiation
- H10F30/26—Individual radiation-sensitive semiconductor devices in which radiation controls the flow of current through the devices, e.g. photodetectors the devices having potential barriers, e.g. phototransistors the devices being sensitive to infrared, visible or ultraviolet radiation the devices having three or more potential barriers, e.g. photothyristors
- H10F30/263—Photothyristors
Landscapes
- Engineering & Computer Science (AREA)
- Computer Networks & Wireless Communication (AREA)
- Thyristors (AREA)
- Photovoltaic Devices (AREA)
- Crystals, And After-Treatments Of Crystals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US548330A US2855524A (en) | 1955-11-22 | 1955-11-22 | Semiconductive switch |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1021891B DE1021891B (de) | 1958-01-02 |
| DE1021891C2 true DE1021891C2 (de) | 1958-06-12 |
Family
ID=24188389
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1956W0019922 Expired DE1021891C2 (de) | 1955-11-22 | 1956-10-16 | Halbleiterdiode fuer Schaltstromkreise |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2855524A (esLanguage) |
| BE (1) | BE551952A (esLanguage) |
| CH (1) | CH349299A (esLanguage) |
| DE (1) | DE1021891C2 (esLanguage) |
| FR (1) | FR1157540A (esLanguage) |
| GB (1) | GB813862A (esLanguage) |
| NL (1) | NL99632C (esLanguage) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3141119A (en) * | 1957-03-28 | 1964-07-14 | Westinghouse Electric Corp | Hyperconductive transistor switches |
| US2980810A (en) * | 1957-12-30 | 1961-04-18 | Bell Telephone Labor Inc | Two-terminal semiconductive switch having five successive zones |
| DE1072714B (de) * | 1958-02-13 | 1960-01-07 | Westinghouse Electric Corporation, East Pittsburgh, Pa. (V. St. A.) | Stromversorgungsschutzschaltung |
| US3027427A (en) * | 1958-06-06 | 1962-03-27 | Bell Telephone Labor Inc | Electronic switching network |
| NL240386A (esLanguage) * | 1958-06-25 | 1900-01-01 | ||
| NL240820A (esLanguage) * | 1958-07-03 | |||
| NL241053A (esLanguage) * | 1958-07-10 | |||
| DE1142411B (de) * | 1958-08-08 | 1963-01-17 | Siemens Ag | Einrichtung zur Umformung von Wechselstrom konstanter Frequenz in solchen veraenderbarer Frequenz und gegebenenfalls anderer Phasenzahl |
| NL246349A (esLanguage) * | 1958-12-15 | |||
| US2997604A (en) * | 1959-01-14 | 1961-08-22 | Shockley William | Semiconductive device and method of operating same |
| NL248703A (esLanguage) * | 1959-02-24 | |||
| DE1104071B (de) * | 1959-04-04 | 1961-04-06 | Siemens Ag | Vierschichten-Halbleiteranordnung mit einkristallinem Halbleiterkoerper und drei hintereinandergeschalteten pn-UEbergaengen mit abwechselnd entgegengesetzter Sperrichtung und Verfahren zu ihrer Herstellung |
| US3089998A (en) * | 1959-04-15 | 1963-05-14 | Westinghouse Electric Corp | Regulator system |
| DE1121693B (de) * | 1959-05-28 | 1962-01-11 | Licentai Patent Verwaltungs G | Anordnung zum Steuern eines elektrisch steuerbaren Schalters |
| BE590420A (esLanguage) * | 1959-06-04 | |||
| DE1164575B (de) | 1959-06-17 | 1964-03-05 | Western Electric Co | Schaltendes Halbleiterbauelement mit mindestens vier Zonen abwechselnden Leitfaehigkeitstyps |
| NL251532A (esLanguage) * | 1959-06-17 | |||
| US3093813A (en) * | 1959-08-26 | 1963-06-11 | Ferumeldewerk Arnstadt Veb | Electronic switch |
| US3040270A (en) * | 1959-09-01 | 1962-06-19 | Gen Electric | Silicon controlled rectifier circuit including a variable frequency oscillator |
| GB910459A (en) * | 1959-10-02 | 1962-11-14 | Standard Telephones Cables Ltd | Improvements in or relating to automatic telecommunication exchanges |
| US3160828A (en) * | 1960-01-25 | 1964-12-08 | Westinghouse Electric Corp | Radiation sensitive semiconductor oscillating device |
| BE624028A (esLanguage) * | 1960-03-23 | 1900-01-01 | ||
| NL265766A (esLanguage) * | 1960-06-10 | |||
| US3173091A (en) * | 1960-08-30 | 1965-03-09 | Westinghouse Electric Corp | Microwave detector apparatus |
| NL268951A (esLanguage) * | 1960-09-07 | |||
| US3254267A (en) * | 1960-10-25 | 1966-05-31 | Westinghouse Electric Corp | Semiconductor-controlled, direct current responsive electroluminescent phosphors |
| GB945374A (en) | 1960-11-04 | 1963-12-23 | Ass Elect Ind | Improvements relating to switching systems employing co-ordinate switching arrangements of the cross-point type |
| DE1159096B (de) * | 1960-12-05 | 1963-12-12 | Fairchild Camera Instr Co | Vierzonen-Halbleiterbauelement, insbesondere Transistor, zum Schalten mit einem pnpn-Halbleiterkoerper |
| NL272752A (esLanguage) * | 1960-12-20 | |||
| US3171040A (en) * | 1961-01-16 | 1965-02-23 | Gen Dynamics Corp | Fast charging circuit for pulse networks |
| US3193700A (en) * | 1961-02-23 | 1965-07-06 | Fairbanks Morse Inc | Ramp generator circuit employing two capacitors, one including means for rapid discharging thereof |
| US3177375A (en) * | 1961-03-27 | 1965-04-06 | Electro Mechanical Res Inc | Time-of-occurrence markers |
| US3135875A (en) * | 1961-05-04 | 1964-06-02 | Ibm | Ring counter employing four-layer diodes and scaling resistors to effect counting |
| US3109109A (en) * | 1961-08-29 | 1963-10-29 | Bell Telephone Labor Inc | Circuit employing negative resistance asymmetrically conducting devices connected inseries randomly or sequentially switched |
| US3248616A (en) * | 1962-03-08 | 1966-04-26 | Westinghouse Electric Corp | Monolithic bistable flip-flop |
| US3221106A (en) * | 1962-03-22 | 1965-11-30 | Itt | Speech path controller |
| US3193739A (en) * | 1962-05-15 | 1965-07-06 | Siemens Ag | Semiconductor device having four-layer components for obtaining negative current-voltage characteristics |
| US3223978A (en) * | 1962-06-08 | 1965-12-14 | Radiation Inc | End marking switch matrix utilizing negative impedance crosspoints |
| US3278687A (en) * | 1963-07-19 | 1966-10-11 | Stromberg Carlson Corp | Four-layer diode network for identifying parties on a telephone line |
| DE1231296C2 (de) * | 1964-03-19 | 1974-03-28 | Elektronische schaltanordnung mit mindestens zwei zweipoligen halbleiterschaltelementen | |
| DK114912B (da) * | 1964-07-15 | 1969-08-18 | R Relsted | Vælgerkobling med lysimpulsstyring til anvendelse i automatiske koblingsanlæg samt vælger og koblingsanlæg opbygget med den nævnte vælgerkobling. |
| US3410966A (en) * | 1965-05-27 | 1968-11-12 | Bell Telephone Labor Inc | System for remote testing of telephone subscribers' lines |
| US3454434A (en) * | 1966-05-09 | 1969-07-08 | Motorola Inc | Multilayer semiconductor device |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2588254A (en) * | 1950-05-09 | 1952-03-04 | Purdue Research Foundation | Photoelectric and thermoelectric device utilizing semiconducting material |
| DE1048359B (esLanguage) * | 1952-07-22 |
-
0
- NL NL99632D patent/NL99632C/xx active
- BE BE551952D patent/BE551952A/xx unknown
-
1955
- 1955-11-22 US US548330A patent/US2855524A/en not_active Expired - Lifetime
-
1956
- 1956-09-03 FR FR1157540D patent/FR1157540A/fr not_active Expired
- 1956-10-16 DE DE1956W0019922 patent/DE1021891C2/de not_active Expired
- 1956-11-09 CH CH349299D patent/CH349299A/de unknown
- 1956-11-21 GB GB35590/56A patent/GB813862A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB813862A (en) | 1959-05-27 |
| NL99632C (esLanguage) | |
| CH349299A (de) | 1960-10-15 |
| US2855524A (en) | 1958-10-07 |
| DE1021891B (de) | 1958-01-02 |
| BE551952A (esLanguage) | |
| FR1157540A (fr) | 1958-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1021891C2 (de) | Halbleiterdiode fuer Schaltstromkreise | |
| DE961913C (de) | Verfahren zur Herstellung von elektrisch unsymmetrisch leitenden Systemen mit p-n-UEbergaengen | |
| DE1152763C2 (de) | Halbleiterbauelement mit mindestens einem PN-UEbergang | |
| DE1292256B (de) | Drift-Transistor und Diffusionsverfahren zu seiner Herstellung | |
| DE2851643A1 (de) | Lichtaktivierte lichtemittierende vorrichtung | |
| DE1838035U (de) | Halbleitervorrichtung. | |
| DE1090331B (de) | Strombegrenzende Halbleiteranordnung, insbesondere Diode, mit einem Halbleiterkoerper mit einer Folge von wenigstens vier Zonen abwechselnd entgegengesetzten Leitfaehigkeitstyps | |
| DE1811492A1 (de) | Feldeffekttransistor | |
| DE1214790C2 (de) | Leistungsgleichrichter mit einkristallinem Halbleiterkoerper und vier Schichten abwechselnden Leitfaehigkeitstyps | |
| DE2626730A1 (de) | Ueber mehrere anschluesse verfuegende und gesteuerte halbleiter-geraete mit inversionsschicht | |
| DE1163459B (de) | Doppel-Halbleiterdiode mit teilweise negativer Stromspannungskennlinie und Verfahren zum Herstellen | |
| DE1266891B (de) | Strahlungsempfindliches P+NN+_Halbleiterbauelement | |
| DE2030367A1 (de) | Verfahren zur Herstellung \on Halb leiterelementen mit p n Verbindungen | |
| DE1564170C3 (de) | Halbleiterbauelement hoher Schaltgeschwindigkeit und Verfahren zu seiner Herstellung | |
| DE2310453C3 (de) | Verfahren zum Herstellen eines gegen Überspannungen geschützten Halbleiterbauelementes | |
| DE2430687C3 (de) | Kaltemissionshalbleitervorrichtung | |
| DE2639364C3 (de) | Thyristor | |
| DE1006531B (de) | Asymmetrisch leitende Halbleiteranordnung | |
| DE1137078B (de) | Halbleitervorrichtung mit mehreren stabilen Halbleiterelementen | |
| DE2551035C3 (de) | Logische Schaltung in Festkörpertechnik | |
| DE1911335A1 (de) | Verfahren zum Herstellen von Halbleiterbauelementen | |
| DE1439674B2 (de) | Steuerbares und schaltbares pn-Halbleiterbauelement für große elektrische Leistungen | |
| DE1464979C3 (de) | Halbleiterschaltelement | |
| DE1168567B (de) | Verfahren zum Herstellen eines Transistors, insbesondere fuer Schaltzwecke | |
| DE1965051C2 (de) | Halbleiterbauelement |