DD201559A5 - Herbizide mittel - Google Patents
Herbizide mittel Download PDFInfo
- Publication number
- DD201559A5 DD201559A5 DD82237883A DD23788382A DD201559A5 DD 201559 A5 DD201559 A5 DD 201559A5 DD 82237883 A DD82237883 A DD 82237883A DD 23788382 A DD23788382 A DD 23788382A DD 201559 A5 DD201559 A5 DD 201559A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- methyl
- acid
- chloro
- phenyl
- group
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title abstract description 22
- 239000004009 herbicide Substances 0.000 title description 7
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 92
- 229910052739 hydrogen Inorganic materials 0.000 claims description 56
- -1 hydroxyimino Chemical group 0.000 claims description 47
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 230000000737 periodic effect Effects 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 2
- 125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 125000002560 nitrile group Chemical group 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 35
- 239000007787 solid Substances 0.000 abstract description 4
- 239000000203 mixture Substances 0.000 abstract description 2
- 239000007788 liquid Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 description 50
- 150000002148 esters Chemical class 0.000 description 31
- 150000001408 amides Chemical class 0.000 description 21
- 241000196324 Embryophyta Species 0.000 description 18
- 239000000460 chlorine Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 229910052801 chlorine Inorganic materials 0.000 description 15
- 239000004480 active ingredient Substances 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- SQQMOCHTAKMTGJ-UHFFFAOYSA-N 3,7-dichloro-8-(chloromethyl)quinoline Chemical compound ClC1=CN=C2C(CCl)=C(Cl)C=CC2=C1 SQQMOCHTAKMTGJ-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 240000002791 Brassica napus Species 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 240000007594 Oryza sativa Species 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 7
- 235000007164 Oryza sativa Nutrition 0.000 description 7
- 230000012010 growth Effects 0.000 description 7
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 7
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 7
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- 239000004202 carbamide Substances 0.000 description 6
- 238000005660 chlorination reaction Methods 0.000 description 6
- 235000009566 rice Nutrition 0.000 description 6
- 241000335053 Beta vulgaris Species 0.000 description 5
- 235000011293 Brassica napus Nutrition 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- ZKAIPXMHVYCWND-UHFFFAOYSA-N 3,7-dichloroquinoline-8-carbonitrile Chemical compound N#CC1=C(Cl)C=CC2=CC(Cl)=CN=C21 ZKAIPXMHVYCWND-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 244000105624 Arachis hypogaea Species 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 244000075850 Avena orientalis Species 0.000 description 4
- 235000007319 Avena orientalis Nutrition 0.000 description 4
- 235000021533 Beta vulgaris Nutrition 0.000 description 4
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 4
- 235000003255 Carthamus tinctorius Nutrition 0.000 description 4
- 244000020518 Carthamus tinctorius Species 0.000 description 4
- 235000003222 Helianthus annuus Nutrition 0.000 description 4
- 241000209219 Hordeum Species 0.000 description 4
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 4
- 240000004713 Pisum sativum Species 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 150000003248 quinolines Chemical class 0.000 description 4
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 3
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 244000291564 Allium cepa Species 0.000 description 3
- 244000099147 Ananas comosus Species 0.000 description 3
- 235000007119 Ananas comosus Nutrition 0.000 description 3
- 235000010777 Arachis hypogaea Nutrition 0.000 description 3
- 244000003416 Asparagus officinalis Species 0.000 description 3
- 235000005340 Asparagus officinalis Nutrition 0.000 description 3
- 235000021537 Beetroot Nutrition 0.000 description 3
- 235000006008 Brassica napus var napus Nutrition 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
- 244000068645 Carya illinoensis Species 0.000 description 3
- 235000009025 Carya illinoensis Nutrition 0.000 description 3
- 235000005918 Cirsium arvense Nutrition 0.000 description 3
- 240000001579 Cirsium arvense Species 0.000 description 3
- 235000005979 Citrus limon Nutrition 0.000 description 3
- 244000131522 Citrus pyriformis Species 0.000 description 3
- 240000007154 Coffea arabica Species 0.000 description 3
- 240000008067 Cucumis sativus Species 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 235000010469 Glycine max Nutrition 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 3
- 244000299507 Gossypium hirsutum Species 0.000 description 3
- 244000020551 Helianthus annuus Species 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- 244000025221 Humulus lupulus Species 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 244000017020 Ipomoea batatas Species 0.000 description 3
- 235000002678 Ipomoea batatas Nutrition 0.000 description 3
- 235000009496 Juglans regia Nutrition 0.000 description 3
- 240000007049 Juglans regia Species 0.000 description 3
- 235000003228 Lactuca sativa Nutrition 0.000 description 3
- 240000008415 Lactuca sativa Species 0.000 description 3
- 235000004431 Linum usitatissimum Nutrition 0.000 description 3
- 240000006240 Linum usitatissimum Species 0.000 description 3
- 240000004658 Medicago sativa Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 235000010617 Phaseolus lunatus Nutrition 0.000 description 3
- 235000010582 Pisum sativum Nutrition 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 3
- 244000269722 Thea sinensis Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 235000015724 Trifolium pratense Nutrition 0.000 description 3
- 235000021307 Triticum Nutrition 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 229940117389 dichlorobenzene Drugs 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 230000035784 germination Effects 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 235000013526 red clover Nutrition 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 2
- FUJSJWRORKKPAI-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)acetyl chloride Chemical compound ClC(=O)COC1=CC=C(Cl)C=C1Cl FUJSJWRORKKPAI-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- LWFCXBKKDAIZJE-UHFFFAOYSA-N 3,7-dichloro-8-(dichloromethyl)quinoline Chemical compound ClC1=CN=C2C(C(Cl)Cl)=C(Cl)C=CC2=C1 LWFCXBKKDAIZJE-UHFFFAOYSA-N 0.000 description 2
- NKWDCLXGUJHNHS-UHFFFAOYSA-N 7-chloro-8-methylquinoline Chemical compound C1=CN=C2C(C)=C(Cl)C=CC2=C1 NKWDCLXGUJHNHS-UHFFFAOYSA-N 0.000 description 2
- QNGUPQRODVPRDC-UHFFFAOYSA-N 7-chloroquinoline Chemical compound C1=CC=NC2=CC(Cl)=CC=C21 QNGUPQRODVPRDC-UHFFFAOYSA-N 0.000 description 2
- JRLTTZUODKEYDH-UHFFFAOYSA-N 8-methylquinoline Chemical class C1=CN=C2C(C)=CC=CC2=C1 JRLTTZUODKEYDH-UHFFFAOYSA-N 0.000 description 2
- 235000004507 Abies alba Nutrition 0.000 description 2
- 240000006995 Abutilon theophrasti Species 0.000 description 2
- 235000006667 Aleurites moluccana Nutrition 0.000 description 2
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 2
- 244000144725 Amygdalus communis Species 0.000 description 2
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 2
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 241001672694 Citrus reticulata Species 0.000 description 2
- 240000000560 Citrus x paradisi Species 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- 244000000626 Daucus carota Species 0.000 description 2
- 235000002767 Daucus carota Nutrition 0.000 description 2
- 240000003133 Elaeis guineensis Species 0.000 description 2
- 235000001950 Elaeis guineensis Nutrition 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 240000009088 Fragaria x ananassa Species 0.000 description 2
- 235000003230 Helianthus tuberosus Nutrition 0.000 description 2
- 240000008892 Helianthus tuberosus Species 0.000 description 2
- 244000043261 Hevea brasiliensis Species 0.000 description 2
- 240000004322 Lens culinaris Species 0.000 description 2
- 235000011430 Malus pumila Nutrition 0.000 description 2
- 235000015103 Malus silvestris Nutrition 0.000 description 2
- 240000003183 Manihot esculenta Species 0.000 description 2
- 235000010624 Medicago sativa Nutrition 0.000 description 2
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 2
- 244000061176 Nicotiana tabacum Species 0.000 description 2
- 240000007817 Olea europaea Species 0.000 description 2
- 244000115721 Pennisetum typhoides Species 0.000 description 2
- 235000007195 Pennisetum typhoides Nutrition 0.000 description 2
- 244000100170 Phaseolus lunatus Species 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- 241000218657 Picea Species 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 241001506137 Rapa Species 0.000 description 2
- 244000171263 Ribes grossularia Species 0.000 description 2
- 235000002357 Ribes grossularia Nutrition 0.000 description 2
- 244000281247 Ribes rubrum Species 0.000 description 2
- 240000000111 Saccharum officinarum Species 0.000 description 2
- 244000082988 Secale cereale Species 0.000 description 2
- 244000000231 Sesamum indicum Species 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- 244000138286 Sorghum saccharatum Species 0.000 description 2
- 244000062793 Sorghum vulgare Species 0.000 description 2
- 244000300264 Spinacia oleracea Species 0.000 description 2
- 235000021536 Sugar beet Nutrition 0.000 description 2
- 235000006468 Thea sinensis Nutrition 0.000 description 2
- 244000299461 Theobroma cacao Species 0.000 description 2
- 240000000851 Vaccinium corymbosum Species 0.000 description 2
- 240000006677 Vicia faba Species 0.000 description 2
- 244000042295 Vigna mungo Species 0.000 description 2
- 235000006085 Vigna mungo var mungo Nutrition 0.000 description 2
- 235000010721 Vigna radiata var radiata Nutrition 0.000 description 2
- 235000010726 Vigna sinensis Nutrition 0.000 description 2
- 240000006365 Vitis vinifera Species 0.000 description 2
- 229960001413 acetanilide Drugs 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000003931 anilides Chemical class 0.000 description 2
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 description 2
- 244000022203 blackseeded proso millet Species 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 229940125773 compound 10 Drugs 0.000 description 2
- 244000038559 crop plants Species 0.000 description 2
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000003864 humus Substances 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 235000020232 peanut Nutrition 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 230000008635 plant growth Effects 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 2
- SMYMJHWAQXWPDB-UHFFFAOYSA-N (2,4,5-trichlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC(Cl)=C(Cl)C=C1Cl SMYMJHWAQXWPDB-UHFFFAOYSA-N 0.000 description 1
- SODPIMGUZLOIPE-UHFFFAOYSA-N (4-chlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC=C(Cl)C=C1 SODPIMGUZLOIPE-UHFFFAOYSA-N 0.000 description 1
- LWULXYSYLOIDQY-UHFFFAOYSA-N (6-tert-butyl-3-methyl-2,4-dinitrophenyl) acetate Chemical compound CC(=O)OC1=C(C(C)(C)C)C=C([N+]([O-])=O)C(C)=C1[N+]([O-])=O LWULXYSYLOIDQY-UHFFFAOYSA-N 0.000 description 1
- SEPPVOUBHWNCAW-FNORWQNLSA-N (E)-4-oxonon-2-enal Chemical compound CCCCCC(=O)\C=C\C=O SEPPVOUBHWNCAW-FNORWQNLSA-N 0.000 description 1
- OXDSKEQSEGDAFN-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenylmethanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)NC1=CC=CC=C1 OXDSKEQSEGDAFN-UHFFFAOYSA-N 0.000 description 1
- BTINZZQVIGNWJQ-UHFFFAOYSA-M 1,1-dimethyl-2h-pyridin-1-ium;chloride Chemical compound [Cl-].C[N+]1(C)CC=CC=C1 BTINZZQVIGNWJQ-UHFFFAOYSA-M 0.000 description 1
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 1
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical class ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- WEJXOEVEPAGGLQ-UHFFFAOYSA-N 1-(methoxymethyl)-2,2-dioxo-3-propan-2-yl-2$l^{6},1,3-benzothiadiazin-4-one Chemical compound C1=CC=C2C(=O)N(C(C)C)S(=O)(=O)N(COC)C2=C1 WEJXOEVEPAGGLQ-UHFFFAOYSA-N 0.000 description 1
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical class C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 1
- OMEUWYYDEGOLEY-UHFFFAOYSA-N 1-butyl-3-(3,4-dichlorophenyl)-1-methylurea 1,1-dimethyl-3-(4-propylphenyl)urea 1,1-dimethyl-3-[3-(trifluoromethyl)phenyl]urea Chemical compound FC(C=1C=C(C=CC1)NC(=O)N(C)C)(F)F.C(CC)C1=CC=C(C=C1)NC(=O)N(C)C.ClC=1C=C(C=CC1Cl)NC(=O)N(CCCC)C OMEUWYYDEGOLEY-UHFFFAOYSA-N 0.000 description 1
- GUBICMUXUCEZRD-UHFFFAOYSA-N 1-methoxy-1-methyl-3-(4-phenylmethoxyphenyl)urea Chemical compound C1=CC(NC(=O)N(C)OC)=CC=C1OCC1=CC=CC=C1 GUBICMUXUCEZRD-UHFFFAOYSA-N 0.000 description 1
- NNEWRFHYQPTQKR-UHFFFAOYSA-N 1-methoxy-1-methyl-3-phenylurea Chemical compound CON(C)C(=O)NC1=CC=CC=C1 NNEWRFHYQPTQKR-UHFFFAOYSA-N 0.000 description 1
- XVIRIXVOLLJIPF-UHFFFAOYSA-N 1-nitro-2-(2-nitrophenoxy)benzene Chemical compound [O-][N+](=O)C1=CC=CC=C1OC1=CC=CC=C1[N+]([O-])=O XVIRIXVOLLJIPF-UHFFFAOYSA-N 0.000 description 1
- UHLGZMNPWHGIPM-UHFFFAOYSA-N 1H-pyrido[2,3-c][1,2,6]thiadiazine Chemical compound N1SN=CC2=C1N=CC=C2 UHLGZMNPWHGIPM-UHFFFAOYSA-N 0.000 description 1
- ATTVJWQVBUVDOP-UHFFFAOYSA-N 2,2,4-trimethylazetidine Chemical compound CC1CC(C)(C)N1 ATTVJWQVBUVDOP-UHFFFAOYSA-N 0.000 description 1
- ALLSOOQIDPLIER-UHFFFAOYSA-N 2,3,4-trichlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C(Cl)=C1Cl ALLSOOQIDPLIER-UHFFFAOYSA-N 0.000 description 1
- UYGUFXUBSNDUFA-UHFFFAOYSA-N 2,3,5,6-tetrachlorobenzoic acid Chemical compound OC(=O)C1=C(Cl)C(Cl)=CC(Cl)=C1Cl UYGUFXUBSNDUFA-UHFFFAOYSA-N 0.000 description 1
- XZIDTOHMJBOSOX-UHFFFAOYSA-N 2,3,6-TBA Chemical compound OC(=O)C1=C(Cl)C=CC(Cl)=C1Cl XZIDTOHMJBOSOX-UHFFFAOYSA-N 0.000 description 1
- KWVNKWCJDAWNAE-UHFFFAOYSA-N 2,3-dichloroquinoline Chemical class C1=CC=C2N=C(Cl)C(Cl)=CC2=C1 KWVNKWCJDAWNAE-UHFFFAOYSA-N 0.000 description 1
- 239000003559 2,4,5-trichlorophenoxyacetic acid Substances 0.000 description 1
- YIVXMZJTEQBPQO-UHFFFAOYSA-N 2,4-DB Chemical compound OC(=O)CCCOC1=CC=C(Cl)C=C1Cl YIVXMZJTEQBPQO-UHFFFAOYSA-N 0.000 description 1
- 239000002794 2,4-DB Substances 0.000 description 1
- KQCMTOWTPBNWDB-UHFFFAOYSA-N 2,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C=C1Cl KQCMTOWTPBNWDB-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- FCPJYWJEVFRRKH-UHFFFAOYSA-N 2,4-dinitro-6-pentylphenol Chemical compound CCCCCC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O FCPJYWJEVFRRKH-UHFFFAOYSA-N 0.000 description 1
- KGKGSIUWJCAFPX-UHFFFAOYSA-N 2,6-dichlorothiobenzamide Chemical compound NC(=S)C1=C(Cl)C=CC=C1Cl KGKGSIUWJCAFPX-UHFFFAOYSA-N 0.000 description 1
- VHXLSNVSLFTUKZ-UHFFFAOYSA-N 2-(1-chloro-6-methylcyclohexa-2,4-dien-1-yl)oxyacetic acid Chemical compound CC1C(OCC(=O)O)(C=CC=C1)Cl VHXLSNVSLFTUKZ-UHFFFAOYSA-N 0.000 description 1
- MZHCENGPTKEIGP-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1Cl MZHCENGPTKEIGP-UHFFFAOYSA-N 0.000 description 1
- OPQYFNRLWBWCST-UHFFFAOYSA-N 2-(2-chlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC=CC=C1Cl OPQYFNRLWBWCST-UHFFFAOYSA-N 0.000 description 1
- YIGXGYDKDDWZLS-UHFFFAOYSA-N 2-(2-methylphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=CC=C1C YIGXGYDKDDWZLS-UHFFFAOYSA-N 0.000 description 1
- ASRSBXRMOCLKQC-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)-n-methoxyacetamide Chemical compound CONC(=O)COC1=CC=C(Cl)C=C1C ASRSBXRMOCLKQC-UHFFFAOYSA-N 0.000 description 1
- WNTGYJSOUMFZEP-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-UHFFFAOYSA-N 0.000 description 1
- FICQFRCPSFCFBY-UHFFFAOYSA-N 2-[bis(methylsulfanyl)methylidene]propanedinitrile Chemical compound CSC(SC)=C(C#N)C#N FICQFRCPSFCFBY-UHFFFAOYSA-N 0.000 description 1
- FYEWDLAVQKIKQE-UHFFFAOYSA-N 2-methyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazinane-3,5-dione Chemical compound O=C1N(C)OCC(=O)N1C1=CC=CC(C(F)(F)F)=C1 FYEWDLAVQKIKQE-UHFFFAOYSA-N 0.000 description 1
- LLWADFLAOKUBDR-UHFFFAOYSA-N 2-methyl-4-chlorophenoxybutyric acid Chemical compound CC1=CC(Cl)=CC=C1OCCCC(O)=O LLWADFLAOKUBDR-UHFFFAOYSA-N 0.000 description 1
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 1
- OVBFMEVBMNZIBR-UHFFFAOYSA-N 2-methylvaleric acid Chemical compound CCCC(C)C(O)=O OVBFMEVBMNZIBR-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- REEXLQXWNOSJKO-UHFFFAOYSA-N 2h-1$l^{4},2,3-benzothiadiazine 1-oxide Chemical class C1=CC=C2S(=O)NN=CC2=C1 REEXLQXWNOSJKO-UHFFFAOYSA-N 0.000 description 1
- BFNNILAMSKQDRN-UHFFFAOYSA-N 2h-1,2,4-triazin-5-one Chemical compound O=C1C=NNC=N1 BFNNILAMSKQDRN-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- AFPTYLTZHXOXFR-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzonitrile;2,6-dichlorobenzonitrile Chemical compound ClC1=CC=CC(Cl)=C1C#N.OC1=C(Br)C=C(C#N)C=C1Br AFPTYLTZHXOXFR-UHFFFAOYSA-N 0.000 description 1
- ODKUDVZZOKMUSU-UHFFFAOYSA-N 3,5-dichloroquinoline-8-carbaldehyde Chemical compound O=CC1=CC=C(Cl)C2=CC(Cl)=CN=C21 ODKUDVZZOKMUSU-UHFFFAOYSA-N 0.000 description 1
- AADQYPDUXWUDIR-UHFFFAOYSA-N 3,6-dichloro-8-(trichloromethyl)quinoline Chemical compound ClC(Cl)(Cl)C1=CC(Cl)=CC2=CC(Cl)=CN=C21 AADQYPDUXWUDIR-UHFFFAOYSA-N 0.000 description 1
- CWFYNIAMLOPRFB-UHFFFAOYSA-N 3,6-dichloroquinoline-8-carbothioamide Chemical compound ClC1=CN=C2C(C(=S)N)=CC(Cl)=CC2=C1 CWFYNIAMLOPRFB-UHFFFAOYSA-N 0.000 description 1
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- ZRFUZDDJSQVQBY-UHFFFAOYSA-N 4-chloro-3-nitroquinoline Chemical compound C1=CC=CC2=C(Cl)C([N+](=O)[O-])=CN=C21 ZRFUZDDJSQVQBY-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- MVXMNHYVCLMLDD-UHFFFAOYSA-N 4-methoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(OC)=CC=C(C=O)C2=C1 MVXMNHYVCLMLDD-UHFFFAOYSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- LLBZPESJRQGYMB-UHFFFAOYSA-N 4-one Natural products O1C(C(=O)CC)CC(C)C11C2(C)CCC(C3(C)C(C(C)(CO)C(OC4C(C(O)C(O)C(COC5C(C(O)C(O)CO5)OC5C(C(OC6C(C(O)C(O)C(CO)O6)O)C(O)C(CO)O5)OC5C(C(O)C(O)C(C)O5)O)O4)O)CC3)CC3)=C3C2(C)CC1 LLBZPESJRQGYMB-UHFFFAOYSA-N 0.000 description 1
- XAZNOOMRYLFDQO-UHFFFAOYSA-N 4h-3,1-benzoxazine Chemical class C1=CC=C2COC=NC2=C1 XAZNOOMRYLFDQO-UHFFFAOYSA-N 0.000 description 1
- UWOPKGUIQOULAE-UHFFFAOYSA-N 5-chloro-6-methyl-3-(oxan-2-yl)-1h-pyrimidine-2,4-dione Chemical compound O=C1C(Cl)=C(C)NC(=O)N1C1OCCCC1 UWOPKGUIQOULAE-UHFFFAOYSA-N 0.000 description 1
- LJGZUMNXGLDTFF-UHFFFAOYSA-N 6-tert-butyl-3-methyl-2,4-dinitrophenol Chemical compound CC1=C([N+]([O-])=O)C=C(C(C)(C)C)C(O)=C1[N+]([O-])=O LJGZUMNXGLDTFF-UHFFFAOYSA-N 0.000 description 1
- UAWVRVFHMOSAPU-UHFFFAOYSA-N 7-chlorokynurenic acid Chemical compound C1=CC(Cl)=CC2=NC(C(=O)O)=CC(O)=C21 UAWVRVFHMOSAPU-UHFFFAOYSA-N 0.000 description 1
- GDQRNLYEBXTADO-UHFFFAOYSA-N 8-chloro-2,2,4-trioxo-3-propan-2-yl-2$l^{6},1,3-benzothiadiazine-1-carbonitrile Chemical compound C1=CC(Cl)=C2N(C#N)S(=O)(=O)N(C(C)C)C(=O)C2=C1 GDQRNLYEBXTADO-UHFFFAOYSA-N 0.000 description 1
- OAWGITMPUJYOIU-UHFFFAOYSA-N 8-methyl-3-propan-2-yl-4H-2,1,3-benzothiadiazine-1-carbonitrile Chemical compound CC(C)N1CC2=C(N(S1)C#N)C(C)=CC=C2 OAWGITMPUJYOIU-UHFFFAOYSA-N 0.000 description 1
- 241000191291 Abies alba Species 0.000 description 1
- 244000101408 Abies amabilis Species 0.000 description 1
- 235000014081 Abies amabilis Nutrition 0.000 description 1
- 235000017894 Abies grandis Nutrition 0.000 description 1
- MDBGGTQNNUOQRC-UHFFFAOYSA-N Allidochlor Chemical compound ClCC(=O)N(CC=C)CC=C MDBGGTQNNUOQRC-UHFFFAOYSA-N 0.000 description 1
- 235000005255 Allium cepa Nutrition 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 235000011437 Amygdalus communis Nutrition 0.000 description 1
- 244000144730 Amygdalus persica Species 0.000 description 1
- 235000011446 Amygdalus persica Nutrition 0.000 description 1
- 235000003276 Apios tuberosa Nutrition 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- 235000010744 Arachis villosulicarpa Nutrition 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- SLCGUGMPSUYJAY-UHFFFAOYSA-N Benzoylprop-ethyl Chemical compound C=1C=C(Cl)C(Cl)=CC=1N(C(C)C(=O)OCC)C(=O)C1=CC=CC=C1 SLCGUGMPSUYJAY-UHFFFAOYSA-N 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 235000014698 Brassica juncea var multisecta Nutrition 0.000 description 1
- 240000000385 Brassica napus var. napus Species 0.000 description 1
- 240000008100 Brassica rapa Species 0.000 description 1
- 235000011292 Brassica rapa Nutrition 0.000 description 1
- 235000006618 Brassica rapa subsp oleifera Nutrition 0.000 description 1
- IDGOGWZNWNZAIA-UHFFFAOYSA-N C1(=CC=CC2=CC=CC=C12)NC(C=1C(C(=O)O)=CC=CC1)=O.CC(C#C)(C)NC(C1=CC(=CC(=C1)Cl)Cl)=O Chemical compound C1(=CC=CC2=CC=CC=C12)NC(C=1C(C(=O)O)=CC=CC1)=O.CC(C#C)(C)NC(C1=CC(=CC(=C1)Cl)Cl)=O IDGOGWZNWNZAIA-UHFFFAOYSA-N 0.000 description 1
- GAUQTEWIAMSWGN-UHFFFAOYSA-N CS(=O)(=O)OC(CO)=O.C(CC)(=O)NC=1SC(=C(N1)C)Cl Chemical compound CS(=O)(=O)OC(CO)=O.C(CC)(=O)NC=1SC(=C(N1)C)Cl GAUQTEWIAMSWGN-UHFFFAOYSA-N 0.000 description 1
- 244000045232 Canavalia ensiformis Species 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 235000012766 Cannabis sativa ssp. sativa var. sativa Nutrition 0.000 description 1
- 235000012765 Cannabis sativa ssp. sativa var. spontanea Nutrition 0.000 description 1
- DXXVCXKMSWHGTF-UHFFFAOYSA-N Chlomethoxyfen Chemical compound C1=C([N+]([O-])=O)C(OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 DXXVCXKMSWHGTF-UHFFFAOYSA-N 0.000 description 1
- 235000001759 Citrus maxima Nutrition 0.000 description 1
- 244000276331 Citrus maxima Species 0.000 description 1
- 235000009088 Citrus pyriformis Nutrition 0.000 description 1
- 235000005976 Citrus sinensis Nutrition 0.000 description 1
- 240000002319 Citrus sinensis Species 0.000 description 1
- UHUZNUZNSKEWFY-UHFFFAOYSA-N ClC1=CC=C(C=C1)NC(=O)N(C)C.ClC1=CC=C(C=C1)N(C(=O)N(C)C)C(C1=CC=CC=C1)=O Chemical compound ClC1=CC=C(C=C1)NC(=O)N(C)C.ClC1=CC=C(C=C1)N(C(=O)N(C)C)C(C1=CC=CC=C1)=O UHUZNUZNSKEWFY-UHFFFAOYSA-N 0.000 description 1
- RGPXOVWHDOKODC-UHFFFAOYSA-N ClC=1C=C(C=CC1C)NC(=O)N(C)C.C(C)(C)(C)NC(=O)OC=1C=C(C=CC1)NC(=O)N(C)C Chemical compound ClC=1C=C(C=CC1C)NC(=O)N(C)C.C(C)(C)(C)NC(=O)OC=1C=C(C=CC1)NC(=O)N(C)C RGPXOVWHDOKODC-UHFFFAOYSA-N 0.000 description 1
- 235000007460 Coffea arabica Nutrition 0.000 description 1
- 241000228031 Coffea liberica Species 0.000 description 1
- 244000016593 Coffea robusta Species 0.000 description 1
- 235000002187 Coffea robusta Nutrition 0.000 description 1
- 241000219112 Cucumis Species 0.000 description 1
- 244000241257 Cucumis melo Species 0.000 description 1
- 235000009842 Cucumis melo Nutrition 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- 235000009849 Cucumis sativus Nutrition 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- DQZCVNGCTZLGAQ-UHFFFAOYSA-N Cycluron Chemical compound CN(C)C(=O)NC1CCCCCCC1 DQZCVNGCTZLGAQ-UHFFFAOYSA-N 0.000 description 1
- 244000052363 Cynodon dactylon Species 0.000 description 1
- NPOJQCVWMSKXDN-UHFFFAOYSA-N Dacthal Chemical compound COC(=O)C1=C(Cl)C(Cl)=C(C(=O)OC)C(Cl)=C1Cl NPOJQCVWMSKXDN-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- IIPZYDQGBIWLBU-UHFFFAOYSA-N Dinoterb Chemical compound CC(C)(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O IIPZYDQGBIWLBU-UHFFFAOYSA-N 0.000 description 1
- QAHFOPIILNICLA-UHFFFAOYSA-N Diphenamid Chemical compound C=1C=CC=CC=1C(C(=O)N(C)C)C1=CC=CC=C1 QAHFOPIILNICLA-UHFFFAOYSA-N 0.000 description 1
- 244000127993 Elaeis melanococca Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- ZLSWBLPERHFHIS-UHFFFAOYSA-N Fenoprop Chemical compound OC(=O)C(C)OC1=CC(Cl)=C(Cl)C=C1Cl ZLSWBLPERHFHIS-UHFFFAOYSA-N 0.000 description 1
- 244000286663 Ficus elastica Species 0.000 description 1
- 235000016623 Fragaria vesca Nutrition 0.000 description 1
- 235000011363 Fragaria x ananassa Nutrition 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 235000014820 Galium aparine Nutrition 0.000 description 1
- 240000005702 Galium aparine Species 0.000 description 1
- 235000014751 Gossypium arboreum Nutrition 0.000 description 1
- 240000001814 Gossypium arboreum Species 0.000 description 1
- 240000000047 Gossypium barbadense Species 0.000 description 1
- 235000009429 Gossypium barbadense Nutrition 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 1
- 241000208818 Helianthus Species 0.000 description 1
- CAWXEEYDBZRFPE-UHFFFAOYSA-N Hexazinone Chemical compound O=C1N(C)C(N(C)C)=NC(=O)N1C1CCCCC1 CAWXEEYDBZRFPE-UHFFFAOYSA-N 0.000 description 1
- 235000008694 Humulus lupulus Nutrition 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 1
- HGSJULUZSLHBOQ-UHFFFAOYSA-N IC1=C(C(=O)O)C=C(C=C1I)I.C(C1=CC=CC=C1)(=O)NOCC(=O)O Chemical compound IC1=C(C(=O)O)C=C(C=C1I)I.C(C1=CC=CC=C1)(=O)NOCC(=O)O HGSJULUZSLHBOQ-UHFFFAOYSA-N 0.000 description 1
- PSYBGEADHLUXCS-UHFFFAOYSA-N Isocil Chemical compound CC(C)N1C(=O)NC(C)=C(Br)C1=O PSYBGEADHLUXCS-UHFFFAOYSA-N 0.000 description 1
- 241000219739 Lens Species 0.000 description 1
- 235000014647 Lens culinaris subsp culinaris Nutrition 0.000 description 1
- 235000010666 Lens esculenta Nutrition 0.000 description 1
- 235000003403 Limnocharis flava Nutrition 0.000 description 1
- 241000227653 Lycopersicon Species 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 241001300479 Macroptilium Species 0.000 description 1
- 208000002720 Malnutrition Diseases 0.000 description 1
- 241000220225 Malus Species 0.000 description 1
- 244000081841 Malus domestica Species 0.000 description 1
- 244000070406 Malus silvestris Species 0.000 description 1
- 235000004456 Manihot esculenta Nutrition 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- 241001479543 Mentha x piperita Species 0.000 description 1
- LRUUNMYPIBZBQH-UHFFFAOYSA-N Methazole Chemical compound O=C1N(C)C(=O)ON1C1=CC=C(Cl)C(Cl)=C1 LRUUNMYPIBZBQH-UHFFFAOYSA-N 0.000 description 1
- 241000234295 Musa Species 0.000 description 1
- 240000005561 Musa balbisiana Species 0.000 description 1
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 1
- FOUFHKAEBIPQKV-UHFFFAOYSA-N N-(3,7-dichloro-7H-quinolin-8-ylidene)hydroxylamine Chemical compound ClC=1C=NC=2C(C(C=CC2C1)Cl)=NO FOUFHKAEBIPQKV-UHFFFAOYSA-N 0.000 description 1
- 241000208134 Nicotiana rustica Species 0.000 description 1
- 235000017590 Nymphoides indica Nutrition 0.000 description 1
- 240000000905 Nymphoides indica Species 0.000 description 1
- SOIGSLZEOIRHID-UHFFFAOYSA-N O=C(C(=O)O)N1CSC2=C1C=CC=C2 Chemical compound O=C(C(=O)O)N1CSC2=C1C=CC=C2 SOIGSLZEOIRHID-UHFFFAOYSA-N 0.000 description 1
- 235000002725 Olea europaea Nutrition 0.000 description 1
- QEYLARISPDMNQL-UHFFFAOYSA-N P(=O)(O)(O)N(CC(=O)O)C.C[As](O)(O)=O Chemical compound P(=O)(O)(O)N(CC(=O)O)C.C[As](O)(O)=O QEYLARISPDMNQL-UHFFFAOYSA-N 0.000 description 1
- 235000007199 Panicum miliaceum Nutrition 0.000 description 1
- 240000009164 Petroselinum crispum Species 0.000 description 1
- 235000002770 Petroselinum crispum Nutrition 0.000 description 1
- 240000004133 Petroselinum crispum Radicosum Group Species 0.000 description 1
- 244000062780 Petroselinum sativum Species 0.000 description 1
- 235000008124 Picea excelsa Nutrition 0.000 description 1
- 235000005205 Pinus Nutrition 0.000 description 1
- 241000218602 Pinus <genus> Species 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- 235000016816 Pisum sativum subsp sativum Nutrition 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 244000007021 Prunus avium Species 0.000 description 1
- 235000010401 Prunus avium Nutrition 0.000 description 1
- 241001290151 Prunus avium subsp. avium Species 0.000 description 1
- 244000141353 Prunus domestica Species 0.000 description 1
- 235000011435 Prunus domestica Nutrition 0.000 description 1
- 240000005809 Prunus persica Species 0.000 description 1
- 241000220324 Pyrus Species 0.000 description 1
- 240000001987 Pyrus communis Species 0.000 description 1
- 241000208422 Rhododendron Species 0.000 description 1
- 244000083724 Rhododendron simsii Species 0.000 description 1
- 235000016911 Ribes sativum Nutrition 0.000 description 1
- 235000003846 Ricinus Nutrition 0.000 description 1
- 241000322381 Ricinus <louse> Species 0.000 description 1
- 240000000528 Ricinus communis Species 0.000 description 1
- 235000004443 Ricinus communis Nutrition 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 235000007238 Secale cereale Nutrition 0.000 description 1
- 235000003434 Sesamum indicum Nutrition 0.000 description 1
- 235000008515 Setaria glauca Nutrition 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 235000007230 Sorghum bicolor Nutrition 0.000 description 1
- 235000009337 Spinacia oleracea Nutrition 0.000 description 1
- NBQCNZYJJMBDKY-UHFFFAOYSA-N Terbacil Chemical compound CC=1NC(=O)N(C(C)(C)C)C(=O)C=1Cl NBQCNZYJJMBDKY-UHFFFAOYSA-N 0.000 description 1
- PNRAZZZISDRWMV-UHFFFAOYSA-N Terbucarb Chemical compound CNC(=O)OC1=C(C(C)(C)C)C=C(C)C=C1C(C)(C)C PNRAZZZISDRWMV-UHFFFAOYSA-N 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- 206010044278 Trace element deficiency Diseases 0.000 description 1
- 240000002913 Trifolium pratense Species 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 235000003095 Vaccinium corymbosum Nutrition 0.000 description 1
- 240000001717 Vaccinium macrocarpon Species 0.000 description 1
- 235000012545 Vaccinium macrocarpon Nutrition 0.000 description 1
- 235000002118 Vaccinium oxycoccus Nutrition 0.000 description 1
- 235000017606 Vaccinium vitis idaea Nutrition 0.000 description 1
- 244000077923 Vaccinium vitis idaea Species 0.000 description 1
- 241000990144 Veronica persica Species 0.000 description 1
- 235000010749 Vicia faba Nutrition 0.000 description 1
- 235000010753 Vicia faba var minor Nutrition 0.000 description 1
- 235000002096 Vicia faba var. equina Nutrition 0.000 description 1
- 244000105016 Vicia faba var. minor Species 0.000 description 1
- 241000219977 Vigna Species 0.000 description 1
- 240000004922 Vigna radiata Species 0.000 description 1
- 235000011469 Vigna radiata var sublobata Nutrition 0.000 description 1
- 244000042327 Vigna sinensis Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- RWBBYNFKWBDAJO-UHFFFAOYSA-L [Na+].[Na+].[Na+].C[As]([O-])([O-])=O Chemical compound [Na+].[Na+].[Na+].C[As]([O-])([O-])=O RWBBYNFKWBDAJO-UHFFFAOYSA-L 0.000 description 1
- GAHUQIUQVMKJII-UHFFFAOYSA-N [Na]c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl Chemical class [Na]c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl GAHUQIUQVMKJII-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 229940111121 antirheumatic drug quinolines Drugs 0.000 description 1
- PXWUKZGIHQRDHL-UHFFFAOYSA-N atraton Chemical compound CCNC1=NC(NC(C)C)=NC(OC)=N1 PXWUKZGIHQRDHL-UHFFFAOYSA-N 0.000 description 1
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 1
- OTSAMNSACVKIOJ-UHFFFAOYSA-N azane;carbamoyl(ethoxy)phosphinic acid Chemical compound [NH4+].CCOP([O-])(=O)C(N)=O OTSAMNSACVKIOJ-UHFFFAOYSA-N 0.000 description 1
- ZOMSMJKLGFBRBS-UHFFFAOYSA-N bentazone Chemical compound C1=CC=C2NS(=O)(=O)N(C(C)C)C(=O)C2=C1 ZOMSMJKLGFBRBS-UHFFFAOYSA-N 0.000 description 1
- HTTLBYITFHMYFK-UHFFFAOYSA-N bentranil Chemical compound N=1C2=CC=CC=C2C(=O)OC=1C1=CC=CC=C1 HTTLBYITFHMYFK-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZPFKRQXYKULZKP-UHFFFAOYSA-N butylidene Chemical group [CH2+]CC[CH-] ZPFKRQXYKULZKP-UHFFFAOYSA-N 0.000 description 1
- 235000009120 camo Nutrition 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 235000013709 carrot oil Nutrition 0.000 description 1
- 235000005607 chanvre indien Nutrition 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- XQNAUQUKWRBODG-UHFFFAOYSA-N chlornitrofen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=C(Cl)C=C(Cl)C=C1Cl XQNAUQUKWRBODG-UHFFFAOYSA-N 0.000 description 1
- CWJSHJJYOPWUGX-UHFFFAOYSA-N chlorpropham Chemical compound CC(C)OC(=O)NC1=CC=CC(Cl)=C1 CWJSHJJYOPWUGX-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 235000004634 cranberry Nutrition 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 150000004891 diazines Chemical class 0.000 description 1
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 150000004816 dichlorobenzenes Chemical class 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- MZGNSEAPZQGJRB-UHFFFAOYSA-N dimethyldithiocarbamic acid Chemical compound CN(C)C(S)=S MZGNSEAPZQGJRB-UHFFFAOYSA-N 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- KYQGXCCNOVZBLK-UHFFFAOYSA-L disodium 2,2,2-trichloroacetate Chemical compound ClC(C(=O)[O-])(Cl)Cl.[Na+].[Na+].ClC(C(=O)[O-])(Cl)Cl KYQGXCCNOVZBLK-UHFFFAOYSA-L 0.000 description 1
- XRHVZWWRFMCBAZ-PXYBLNDHSA-L disodium;(1s,2r,3s,4r)-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate Chemical compound [Na+].[Na+].C1C[C@@H]2[C@@H](C([O-])=O)[C@@H](C(=O)[O-])[C@H]1O2 XRHVZWWRFMCBAZ-PXYBLNDHSA-L 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 244000013123 dwarf bean Species 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 235000004426 flaxseed Nutrition 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- OXHDYFKENBXUEM-UHFFFAOYSA-N glyphosine Chemical compound OC(=O)CN(CP(O)(O)=O)CP(O)(O)=O OXHDYFKENBXUEM-UHFFFAOYSA-N 0.000 description 1
- 235000002532 grape seed extract Nutrition 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 150000003977 halocarboxylic acids Chemical class 0.000 description 1
- 239000011487 hemp Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- NXPHCVPFHOVZBC-UHFFFAOYSA-N hydroxylamine;sulfuric acid Chemical compound ON.OS(O)(=O)=O NXPHCVPFHOVZBC-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- NRXQIUSYPAHGNM-UHFFFAOYSA-N ioxynil Chemical compound OC1=C(I)C=C(C#N)C=C1I NRXQIUSYPAHGNM-UHFFFAOYSA-N 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000001771 mentha piperita Substances 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- RBNIGDFIUWJJEV-UHFFFAOYSA-N methyl 2-(n-benzoyl-3-chloro-4-fluoroanilino)propanoate Chemical compound C=1C=C(F)C(Cl)=CC=1N(C(C)C(=O)OC)C(=O)C1=CC=CC=C1 RBNIGDFIUWJJEV-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- FOXFZRUHNHCZPX-UHFFFAOYSA-N metribuzin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1N FOXFZRUHNHCZPX-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- XKUWFOYPQIVFMM-UHFFFAOYSA-N n,n-bis(2-chloroethyl)-4-methyl-2,6-dinitroaniline Chemical compound CC1=CC([N+]([O-])=O)=C(N(CCCl)CCCl)C([N+]([O-])=O)=C1 XKUWFOYPQIVFMM-UHFFFAOYSA-N 0.000 description 1
- PVSQYROAMUCMNU-UHFFFAOYSA-N n-[(3,7-dichloroquinolin-8-yl)methyl]-n-ethylethanamine Chemical compound ClC1=CN=C2C(CN(CC)CC)=C(Cl)C=CC2=C1 PVSQYROAMUCMNU-UHFFFAOYSA-N 0.000 description 1
- MXBFSAYTTZBUBY-UHFFFAOYSA-N n-chlorohydroxylamine Chemical compound ONCl MXBFSAYTTZBUBY-UHFFFAOYSA-N 0.000 description 1
- UZTNLZSZNKYAIO-UHFFFAOYSA-N n-ethyl-2,6-dinitro-n-propan-2-yl-4-(trifluoromethyl)aniline Chemical compound CCN(C(C)C)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O UZTNLZSZNKYAIO-UHFFFAOYSA-N 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- XCHKGEWYMWKALV-UHFFFAOYSA-N o-ethyl 2-(4-chloro-2-methylphenoxy)ethanethioate Chemical compound CCOC(=S)COC1=CC=C(Cl)C=C1C XCHKGEWYMWKALV-UHFFFAOYSA-N 0.000 description 1
- KZWGIBANVZHFTJ-UHFFFAOYSA-N o-ethyl n,n-di(butan-2-yl)carbamothioate Chemical compound CCOC(=S)N(C(C)CC)C(C)CC KZWGIBANVZHFTJ-UHFFFAOYSA-N 0.000 description 1
- HEAHCDNRFZZQOC-UHFFFAOYSA-N o-ethyl n-cyclohexyl-n-ethylcarbamothioate Chemical compound CCOC(=S)N(CC)C1CCCCC1 HEAHCDNRFZZQOC-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 101150101567 pat-2 gene Proteins 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 235000011197 perejil Nutrition 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical class OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 230000003032 phytopathogenic effect Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- ISEUFVQQFVOBCY-UHFFFAOYSA-N prometon Chemical compound COC1=NC(NC(C)C)=NC(NC(C)C)=N1 ISEUFVQQFVOBCY-UHFFFAOYSA-N 0.000 description 1
- VXPLXMJHHKHSOA-UHFFFAOYSA-N propham Chemical compound CC(C)OC(=O)NC1=CC=CC=C1 VXPLXMJHHKHSOA-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- HKAMKLBXTLTVCN-UHFFFAOYSA-N simeton Chemical compound CCNC1=NC(NCC)=NC(OC)=N1 HKAMKLBXTLTVCN-UHFFFAOYSA-N 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- CFPLEOLETMZLIB-UHFFFAOYSA-M sodium;4-chlorophenolate Chemical compound [Na+].[O-]C1=CC=C(Cl)C=C1 CFPLEOLETMZLIB-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 235000021012 strawberries Nutrition 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- RJKCKKDSSSRYCB-UHFFFAOYSA-N tebutam Chemical compound CC(C)(C)C(=O)N(C(C)C)CC1=CC=CC=C1 RJKCKKDSSSRYCB-UHFFFAOYSA-N 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- REEQLXCGVXDJSQ-UHFFFAOYSA-N trichlopyr Chemical compound OC(=O)COC1=NC(Cl)=C(Cl)C=C1Cl REEQLXCGVXDJSQ-UHFFFAOYSA-N 0.000 description 1
- 125000004953 trihalomethyl group Chemical group 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
- A01N43/42—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings condensed with carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813108873 DE3108873A1 (de) | 1981-03-09 | 1981-03-09 | Dichlorchinolinderivate, ihre herstellung, ihre verwendung als herbizide und mittel dafuer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD201559A5 true DD201559A5 (de) | 1983-07-27 |
Family
ID=6126713
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD82237883A DD201559A5 (de) | 1981-03-09 | 1982-03-04 | Herbizide mittel |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4632696A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0060429B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JPS57165368A (cg-RX-API-DMAC10.html) |
| AR (1) | AR230267A1 (cg-RX-API-DMAC10.html) |
| AT (1) | ATE5964T1 (cg-RX-API-DMAC10.html) |
| AU (1) | AU544877B2 (cg-RX-API-DMAC10.html) |
| BR (1) | BR8201241A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1202026A (cg-RX-API-DMAC10.html) |
| CS (1) | CS227042B2 (cg-RX-API-DMAC10.html) |
| DD (1) | DD201559A5 (cg-RX-API-DMAC10.html) |
| DE (2) | DE3108873A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK159879C (cg-RX-API-DMAC10.html) |
| GR (1) | GR76049B (cg-RX-API-DMAC10.html) |
| HU (1) | HU188783B (cg-RX-API-DMAC10.html) |
| IE (1) | IE52607B1 (cg-RX-API-DMAC10.html) |
| IL (1) | IL65052A (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA821503B (cg-RX-API-DMAC10.html) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3210979A1 (de) * | 1982-03-25 | 1983-09-29 | Basf Ag, 6700 Ludwigshafen | 3-chlor-8-cyano-chinoline, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
| DE3223884A1 (de) * | 1982-06-26 | 1983-12-29 | Basf Ag, 6700 Ludwigshafen | 3,7-dichlor-chinolinderivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
| DE3229175A1 (de) * | 1982-08-05 | 1984-02-09 | Basf Ag, 6700 Ludwigshafen | 3,7-dichlor-8-chinolinderivate |
| DE3233089A1 (de) * | 1982-09-07 | 1984-03-08 | Basf Ag, 6700 Ludwigshafen | Chinolinderivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
| DE3346696A1 (de) * | 1983-12-23 | 1985-07-04 | Basf Ag, 6700 Ludwigshafen | Herbizide mittel auf basis von dichlorchinolinderivaten |
| DE3422215A1 (de) * | 1984-06-15 | 1985-12-19 | Basf Ag, 6700 Ludwigshafen | Herbizide mittel auf der basis von dichlorchinolinderivaten |
| US4845100A (en) * | 1985-04-12 | 1989-07-04 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives and salts thereof, processes for preparing the same and cardiotonic composition containing the same |
| DE3524918A1 (de) * | 1985-07-12 | 1987-01-15 | Basf Ag | Chinolin-8-carbonsaeureazolide, ein verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| EP0224823A3 (de) * | 1985-11-26 | 1988-02-10 | BASF Aktiengesellschaft | Chinolinderivate und ihre Verwendung zur Bekämpfung von unerwümschtem Pflanzenwachstum |
| DE3545904A1 (de) * | 1985-12-23 | 1987-06-25 | Basf Ag | Oximester von substituierten chinolin-8-carbonsaeuren und deren verwendung als herbizide |
| DE3628356A1 (de) * | 1986-08-21 | 1988-02-25 | Basf Ag | Chinolin-8-carbonsaeurederivate |
| CH668530A5 (de) * | 1986-10-22 | 1989-01-13 | Ciba Geigy Ag | Synergistisches mittel und verfahren zur selektiven unkrautbekaempfung in reis. |
| DE3639837A1 (de) * | 1986-11-21 | 1988-06-01 | Basf Ag | Verfahren zur beeinflussung der entwicklung von kulturpflanzen |
| DE3703113A1 (de) * | 1987-02-03 | 1988-08-11 | Basf Ag | Verfahren zur herstellung von substituierten 3-alkyl-chinolin-8-carbonsaeuren |
| EP0282778B1 (de) * | 1987-03-03 | 1992-05-13 | BASF Aktiengesellschaft | Verfahren zur Herstellung von 7-Chlor-chinolin-8-carbonsäuren |
| DE3706792A1 (de) * | 1987-03-03 | 1988-09-15 | Basf Ag | Verfahren zur herstellung von 7-chlor-chinolin-8-carbonsaeure |
| CA2015267A1 (en) * | 1989-05-26 | 1990-11-26 | Rainer Seele | 8-azolylmethylquinolines |
| DE3933543A1 (de) * | 1989-10-07 | 1991-04-11 | Hoechst Ag | Synergistische herbizide mittel |
| KR927002913A (ko) * | 1989-10-18 | 1992-12-17 | 짜우너, 라피체 | 제초 활성 물질 혼합물 |
| DE4003174A1 (de) * | 1990-02-03 | 1991-08-08 | Basf Ag | Verfahren zur reinigung von 7-chlor-chinolin-8-carbonsaeuren |
| DE4444708A1 (de) * | 1994-12-15 | 1996-06-20 | Basf Ag | Verwendung von Herbiziden vom Auxin-Typ zur Behandlung von transgenen Kulturpflanzen |
| DE69633196D1 (de) * | 1995-10-16 | 2004-09-23 | Fujisawa Pharmaceutical Co | Heterocyclische verbindungen als h+-atpasen |
| US9210930B2 (en) * | 2005-12-23 | 2015-12-15 | Basf Se | Control of submerged aquatic vegetation |
| AU2006327061A1 (en) * | 2005-12-23 | 2007-06-28 | Basf Se | A method for controlling aquatic weeds |
| CN101346066B (zh) * | 2005-12-23 | 2012-05-23 | 巴斯夫欧洲公司 | 防治水草黑藻的方法 |
| EP2052613A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037625A1 (de) * | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| WO2010046422A2 (en) | 2008-10-22 | 2010-04-29 | Basf Se | Use of auxin type herbicides on cultivated plants |
| CN102265857B (zh) * | 2010-06-03 | 2013-09-18 | 南京华洲药业有限公司 | 一种含灭草松、氰氟草酯和二氯喹啉酸的混合除草剂及其应用 |
| CN101851197B (zh) * | 2010-06-07 | 2011-03-23 | 江苏绿利来股份有限公司 | 二氯喹啉酸的合成和精制方法 |
| AU2010363056B2 (en) * | 2010-10-27 | 2015-03-05 | Corteva Agriscience Llc | Synergistic herbicidal composition containing fluroxypyr and quinclorac |
| CA2868134C (en) * | 2012-04-05 | 2020-12-08 | Basf Se | Herbicidal active mixtures comprising a quinclorac ammonium salt and a glutamine synthetase inhibitor such as bialaphos, glufosinate and glufosinate p. |
| CN102754663A (zh) * | 2012-08-14 | 2012-10-31 | 佛山市盈辉作物科学有限公司 | 一种含莎稗磷和二氯喹啉酸或其盐类的除草组合物及其制剂 |
| CN112174887B (zh) * | 2020-11-02 | 2022-08-23 | 江苏快达农化股份有限公司 | 一种制备8-喹啉羧酸及其衍生物的方法 |
| US20250295113A1 (en) | 2022-05-10 | 2025-09-25 | Syngenta Crop Protection Ag | Composition and method for controlling weeds |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE673999A (cg-RX-API-DMAC10.html) * | 1964-12-16 | |||
| IT998326B (it) * | 1973-08-06 | 1976-01-20 | Montedison Spa | Derivati degli acidi chinolin 8 carbossilici ad attivita antiparas sitaria |
| DE2517229A1 (de) * | 1975-04-18 | 1976-10-28 | Boehringer Mannheim Gmbh | Phenylalkylcarbonsaeure-derivate und verfahren zu ihrer herstellung |
| US4497651A (en) * | 1982-02-17 | 1985-02-05 | Basf Aktiengesellschaft | Dichloroquinoline derivatives for use as herbicides |
| DE3210979A1 (de) * | 1982-03-25 | 1983-09-29 | Basf Ag, 6700 Ludwigshafen | 3-chlor-8-cyano-chinoline, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
| DE3223884A1 (de) * | 1982-06-26 | 1983-12-29 | Basf Ag, 6700 Ludwigshafen | 3,7-dichlor-chinolinderivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
-
1981
- 1981-03-09 DE DE19813108873 patent/DE3108873A1/de not_active Withdrawn
-
1982
- 1982-02-02 GR GR67182A patent/GR76049B/el unknown
- 1982-02-18 IL IL65052A patent/IL65052A/xx unknown
- 1982-02-18 CA CA000396575A patent/CA1202026A/en not_active Expired
- 1982-02-27 AT AT82101534T patent/ATE5964T1/de not_active IP Right Cessation
- 1982-02-27 EP EP82101534A patent/EP0060429B1/de not_active Expired
- 1982-02-27 DE DE8282101534T patent/DE3260034D1/de not_active Expired
- 1982-03-04 DD DD82237883A patent/DD201559A5/de not_active IP Right Cessation
- 1982-03-05 JP JP57034124A patent/JPS57165368A/ja active Granted
- 1982-03-08 CS CS821572A patent/CS227042B2/cs unknown
- 1982-03-08 HU HU82710A patent/HU188783B/hu unknown
- 1982-03-08 ZA ZA821503A patent/ZA821503B/xx unknown
- 1982-03-08 AR AR288663A patent/AR230267A1/es active
- 1982-03-08 IE IE520/82A patent/IE52607B1/en unknown
- 1982-03-08 BR BR8201241A patent/BR8201241A/pt not_active IP Right Cessation
- 1982-03-08 DK DK099382A patent/DK159879C/da not_active IP Right Cessation
- 1982-03-09 AU AU81214/82A patent/AU544877B2/en not_active Expired
-
1984
- 1984-12-27 US US06/686,747 patent/US4632696A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DK159879B (da) | 1990-12-24 |
| GR76049B (cg-RX-API-DMAC10.html) | 1984-08-03 |
| IE820520L (en) | 1982-09-09 |
| EP0060429B1 (de) | 1984-01-25 |
| US4632696A (en) | 1986-12-30 |
| ZA821503B (en) | 1983-02-23 |
| CS227042B2 (en) | 1984-04-16 |
| IL65052A (en) | 1985-08-30 |
| CA1202026A (en) | 1986-03-18 |
| BR8201241A (pt) | 1983-01-18 |
| DK99382A (da) | 1982-09-10 |
| DK159879C (da) | 1991-05-13 |
| IL65052A0 (en) | 1982-04-30 |
| IE52607B1 (en) | 1987-12-23 |
| HU188783B (en) | 1986-05-28 |
| AU8121482A (en) | 1982-09-16 |
| ATE5964T1 (de) | 1984-02-15 |
| EP0060429A1 (de) | 1982-09-22 |
| AU544877B2 (en) | 1985-06-20 |
| JPH0216298B2 (cg-RX-API-DMAC10.html) | 1990-04-16 |
| DE3108873A1 (de) | 1982-09-16 |
| AR230267A1 (es) | 1984-03-01 |
| JPS57165368A (en) | 1982-10-12 |
| DE3260034D1 (en) | 1984-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD201559A5 (de) | Herbizide mittel | |
| US4497651A (en) | Dichloroquinoline derivatives for use as herbicides | |
| DE2934543A1 (de) | Substituierte n-benzoylanthranilsaeurederivate und deren anydroverbindungen, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE3233089A1 (de) | Chinolinderivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses | |
| DD153566A5 (de) | Herbizide mittel | |
| DE3100387A1 (de) | Substituierte diphenylether, diese enthaltende herbizide und ihre anwendung als herbizide | |
| DE3129429A1 (de) | 5-amino-1-phenyl-pyrazol-4-carbonsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses | |
| DE3000309A1 (de) | 4h-3,1-benzoxazinderivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses | |
| DD157752A5 (de) | Herbizide mittel | |
| DD201750A5 (de) | Herbizide mittel | |
| DE3037970A1 (de) | 4h-3,1-benzoxazinderivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses | |
| DE3343415A1 (de) | Mittel zur beeinflussung des pflanzenwachstums | |
| DE3032973A1 (de) | Cyclohexan-1,3-dion-derivate | |
| DE3331692A1 (de) | 3-phenyl-4-methoxycarbonylpyrazole, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses | |
| DD158734A5 (de) | Herbizide mittel | |
| DE3045805A1 (de) | Diphenylether, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE3134145A1 (de) | 2h-1,2,4,6-thiatriazin-1,1-dioxide, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses | |
| DE3008985A1 (de) | N-aryl(thiol)carbamate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses | |
| DE2920933A1 (de) | 3-aryl-5-methyl-pyrazol-4-carbonsaeureester enthaltende herbizide | |
| DE3123731A1 (de) | Chloressigsaeurecyclohexylamide, ihre herstellung, ihre verwendung zur herbizidbekaempfung und mittel dafuer | |
| DE2921130A1 (de) | N-arylthiolcarbamate | |
| DE2933889A1 (de) | 5.6-dihydro-1.2.4.6-thiatriazin (5)on-1.1-dioxide, verfahren zu ihrer herstellung und diese enthaltende herbizide. | |
| DE3134143A1 (de) | 2h-1,2,4,6-thiatriazin-1,1-dioxide, ein verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses | |
| DE3020784A1 (de) | Aralkylanilinderivate und herbizide, die diese verbindungen enthalten | |
| DE2926049A1 (de) | M-anilidurethane und diese enthaltende herbizide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ENJ | Ceased due to non-payment of renewal fee |