CS247160B2 - Copper (ii) hydroxide production method - Google Patents
Copper (ii) hydroxide production method Download PDFInfo
- Publication number
- CS247160B2 CS247160B2 CS828287A CS828782A CS247160B2 CS 247160 B2 CS247160 B2 CS 247160B2 CS 828287 A CS828287 A CS 828287A CS 828782 A CS828782 A CS 828782A CS 247160 B2 CS247160 B2 CS 247160B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- copper
- hydroxide
- oxychloride
- suspension
- cupric
- Prior art date
Links
- JJLJMEJHUUYSSY-UHFFFAOYSA-L copper(II) hydroxide Inorganic materials [OH-].[OH-].[Cu+2] JJLJMEJHUUYSSY-UHFFFAOYSA-L 0.000 title claims abstract description 39
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- AEJIMXVJZFYIHN-UHFFFAOYSA-N copper;dihydrate Chemical compound O.O.[Cu] AEJIMXVJZFYIHN-UHFFFAOYSA-N 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 28
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims abstract description 21
- 239000000725 suspension Substances 0.000 claims abstract description 17
- 239000005752 Copper oxychloride Substances 0.000 claims abstract description 8
- HKMOPYJWSFRURD-UHFFFAOYSA-N chloro hypochlorite;copper Chemical compound [Cu].ClOCl HKMOPYJWSFRURD-UHFFFAOYSA-N 0.000 claims abstract description 8
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims abstract description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims abstract description 3
- 239000008346 aqueous phase Substances 0.000 claims abstract description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical group [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 8
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 claims description 6
- VWMZFZQGKIPFFE-UHFFFAOYSA-N [Cu+].ClOCl Chemical compound [Cu+].ClOCl VWMZFZQGKIPFFE-UHFFFAOYSA-N 0.000 claims description 5
- 239000002002 slurry Substances 0.000 claims description 5
- 229940085991 phosphate ion Drugs 0.000 claims description 4
- 239000002244 precipitate Substances 0.000 claims description 4
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- -1 hydroxide copper (I) oxychloride phosphoric acid Chemical compound 0.000 claims description 3
- 239000007900 aqueous suspension Substances 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 2
- SKQUUKNCBWILCD-UHFFFAOYSA-J dicopper;chloride;trihydroxide Chemical compound [OH-].[OH-].[OH-].[Cl-].[Cu+2].[Cu+2] SKQUUKNCBWILCD-UHFFFAOYSA-J 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 229910019142 PO4 Inorganic materials 0.000 abstract description 3
- 239000010452 phosphate Substances 0.000 abstract description 3
- 238000003860 storage Methods 0.000 abstract description 2
- 239000002253 acid Substances 0.000 abstract 1
- 150000004679 hydroxides Chemical class 0.000 abstract 1
- 239000005750 Copper hydroxide Substances 0.000 description 6
- 229910001956 copper hydroxide Inorganic materials 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- ODINCKMPIJJUCX-UHFFFAOYSA-N Calcium oxide Chemical compound [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 2
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 150000001879 copper Chemical class 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 229910000162 sodium phosphate Inorganic materials 0.000 description 2
- 235000011008 sodium phosphates Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- YCVPPWRWDHXWIV-UHFFFAOYSA-K [Cu+2].[Cu+2].P(=O)([O-])([O-])[O-] Chemical compound [Cu+2].[Cu+2].P(=O)([O-])([O-])[O-] YCVPPWRWDHXWIV-UHFFFAOYSA-K 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- 235000012255 calcium oxide Nutrition 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(I) oxide Inorganic materials [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 1
- 229910000153 copper(II) phosphate Inorganic materials 0.000 description 1
- GQDHEYWVLBJKBA-UHFFFAOYSA-H copper(ii) phosphate Chemical compound [Cu+2].[Cu+2].[Cu+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O GQDHEYWVLBJKBA-UHFFFAOYSA-H 0.000 description 1
- MNPICTSLNPAQOZ-UHFFFAOYSA-K copper;sodium;phosphate Chemical compound [Na+].[Cu+2].[O-]P([O-])([O-])=O MNPICTSLNPAQOZ-UHFFFAOYSA-K 0.000 description 1
- KRFJLUBVMFXRPN-UHFFFAOYSA-N cuprous oxide Chemical compound [O-2].[Cu+].[Cu+] KRFJLUBVMFXRPN-UHFFFAOYSA-N 0.000 description 1
- 229940112669 cuprous oxide Drugs 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 239000008151 electrolyte solution Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- IGUXCTSQIGAGSV-UHFFFAOYSA-K indium(iii) hydroxide Chemical compound [OH-].[OH-].[OH-].[In+3] IGUXCTSQIGAGSV-UHFFFAOYSA-K 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01G—COMPOUNDS CONTAINING METALS NOT COVERED BY SUBCLASSES C01D OR C01F
- C01G3/00—Compounds of copper
- C01G3/02—Oxides; Hydroxides
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01P—INDEXING SCHEME RELATING TO STRUCTURAL AND PHYSICAL ASPECTS OF SOLID INORGANIC COMPOUNDS
- C01P2004/00—Particle morphology
- C01P2004/60—Particles characterised by their size
- C01P2004/61—Micrometer sized, i.e. from 1-100 micrometer
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01P—INDEXING SCHEME RELATING TO STRUCTURAL AND PHYSICAL ASPECTS OF SOLID INORGANIC COMPOUNDS
- C01P2004/00—Particle morphology
- C01P2004/60—Particles characterised by their size
- C01P2004/62—Submicrometer sized, i.e. from 0.1-1 micrometer
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Removal Of Specific Substances (AREA)
- Paper (AREA)
- Chemically Coating (AREA)
- Manufacture And Refinement Of Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813145995 DE3145995A1 (de) | 1981-11-20 | 1981-11-20 | Verfahren zur herstellung von kupfer-ii-hydroxid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS247160B2 true CS247160B2 (en) | 1986-12-18 |
Family
ID=6146800
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS828287A CS247160B2 (en) | 1981-11-20 | 1982-11-19 | Copper (ii) hydroxide production method |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4404169A (ro) |
| EP (1) | EP0080227B1 (ro) |
| AT (1) | ATE17562T1 (ro) |
| BG (1) | BG51247A3 (ro) |
| BR (1) | BR8204939A (ro) |
| CS (1) | CS247160B2 (ro) |
| DD (1) | DD207370A1 (ro) |
| DE (2) | DE3145995A1 (ro) |
| HU (1) | HU188227B (ro) |
| IL (1) | IL67058A (ro) |
| PL (1) | PL134956B1 (ro) |
| RO (1) | RO88959A (ro) |
| YU (1) | YU249182A (ro) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3419089A1 (de) * | 1984-05-23 | 1985-11-28 | Norddeutsche Affinerie AG, 2000 Hamburg | Verfahren zur herstellung von kupfer-ii-hydroxid |
| US6518860B2 (en) | 2001-01-05 | 2003-02-11 | Nokia Mobile Phones Ltd | BAW filters having different center frequencies on a single substrate and a method for providing same |
| US6596246B2 (en) * | 2001-03-20 | 2003-07-22 | Dermet Sa De Cv | Process for producing stable cupric hydroxide and basic cupric salts |
| ITMI20010607A1 (it) | 2001-03-22 | 2002-09-22 | Caffaro Spa Ind Chim | Procedimento per la preparazione di idrossiso di rame e dispositivo utilizzato nel procedimento |
| US8637089B2 (en) | 2003-04-09 | 2014-01-28 | Osmose, Inc. | Micronized wood preservative formulations |
| US8747908B2 (en) * | 2003-04-09 | 2014-06-10 | Osmose, Inc. | Micronized wood preservative formulations |
| EP2345329B1 (en) | 2003-04-09 | 2019-09-18 | Koppers Performance Chemicals Inc. | Micronized wood preservative formulations |
| CA2530044C (en) | 2003-06-17 | 2012-09-25 | Phibro-Tech, Inc. | Particulate wood preservative and method for producing same |
| US20060062926A1 (en) * | 2004-05-17 | 2006-03-23 | Richardson H W | Use of sub-micron copper salt particles in wood preservation |
| US20050252408A1 (en) | 2004-05-17 | 2005-11-17 | Richardson H W | Particulate wood preservative and method for producing same |
| KR101176681B1 (ko) * | 2004-09-02 | 2012-08-23 | 이 아이 듀폰 디 네모아 앤드 캄파니 | 수산화 구리의 안정화 방법 |
| AU2005296077B2 (en) * | 2004-10-14 | 2010-12-23 | Koppers Performance Chemicals Inc. | Micronized wood preservative formulations in organic carriers |
| US20070259016A1 (en) * | 2006-05-05 | 2007-11-08 | Hodge Robert L | Method of treating crops with submicron chlorothalonil |
| US9271502B2 (en) | 2014-05-23 | 2016-03-01 | Robert Sabin | Potentiation of fixed coppers and other pesticides containing copper and supplementing plant nutrition |
| CN110545669A (zh) | 2016-12-16 | 2019-12-06 | 科佩斯性能化学股份有限公司 | 木材防腐剂及其生产方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE24324E (en) | 1951-05-05 | 1957-05-28 | Method of making stable cupric | |
| US2924505A (en) * | 1956-01-03 | 1960-02-09 | Henry Bower Chemical Mfg Compa | Copper hydrate-phosphorus complex and process for making same |
| US3428731A (en) * | 1965-10-19 | 1969-02-18 | Mary A Furness | Stable dispersions of finely divided phosphate-process cupric hydroxide |
| DE1592256A1 (de) * | 1966-01-15 | 1970-12-03 | Uisburger Kupferhuette | Verfahren zum gleichzeitigen Entwaessern und Entchloren von NE-Metalloxychloriden |
| US3628920A (en) * | 1969-02-25 | 1971-12-21 | Cities Service Co | Preparation of a cupric hydroxide-phosphorous complex |
| US3635668A (en) * | 1969-03-21 | 1972-01-18 | Cities Service Co | Copper hydrate production |
| US4097281A (en) * | 1977-10-17 | 1978-06-27 | Eastman Kodak Company | Heat developable photographic material and process comprising transition metal carbonyl compounds |
| US4292281A (en) * | 1980-07-15 | 1981-09-29 | The Hanna Mining Company | Selective leaching of chloride from copper oxide minerals |
-
1981
- 1981-11-20 DE DE19813145995 patent/DE3145995A1/de not_active Withdrawn
-
1982
- 1982-08-24 BR BR8204939A patent/BR8204939A/pt not_active IP Right Cessation
- 1982-10-25 IL IL67058A patent/IL67058A/xx not_active IP Right Cessation
- 1982-11-08 YU YU02491/82A patent/YU249182A/xx unknown
- 1982-11-12 DE DE8282201433T patent/DE3268713D1/de not_active Expired
- 1982-11-12 EP EP82201433A patent/EP0080227B1/de not_active Expired
- 1982-11-12 AT AT82201433T patent/ATE17562T1/de not_active IP Right Cessation
- 1982-11-17 RO RO82109062A patent/RO88959A/ro unknown
- 1982-11-18 US US06/442,749 patent/US4404169A/en not_active Expired - Lifetime
- 1982-11-19 BG BG058654A patent/BG51247A3/xx unknown
- 1982-11-19 CS CS828287A patent/CS247160B2/cs unknown
- 1982-11-19 PL PL1982239124A patent/PL134956B1/xx unknown
- 1982-11-19 HU HU823748A patent/HU188227B/hu not_active IP Right Cessation
- 1982-11-22 DD DD82245132A patent/DD207370A1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PL239124A2 (en) | 1983-07-18 |
| DE3268713D1 (en) | 1986-03-06 |
| DD207370A1 (de) | 1984-02-29 |
| IL67058A0 (en) | 1983-02-23 |
| PL134956B1 (en) | 1985-09-30 |
| IL67058A (en) | 1986-01-31 |
| DE3145995A1 (de) | 1983-06-01 |
| YU249182A (en) | 1985-03-20 |
| BR8204939A (pt) | 1983-08-02 |
| BG51247A3 (en) | 1993-03-15 |
| US4404169A (en) | 1983-09-13 |
| HU188227B (en) | 1986-03-28 |
| ATE17562T1 (de) | 1986-02-15 |
| RO88959A (ro) | 1986-03-31 |
| EP0080227B1 (de) | 1986-01-22 |
| EP0080227A1 (de) | 1983-06-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS247160B2 (en) | Copper (ii) hydroxide production method | |
| US4490337A (en) | Preparation of cupric hydroxide | |
| US4418056A (en) | Process for making cupric hydroxide | |
| EP0247987B1 (en) | A basic metal hydroxysulphate complex in solid form and a method for its manufacture | |
| US2924505A (en) | Copper hydrate-phosphorus complex and process for making same | |
| NO159383B (no) | Fremgangsmaate for fremstilling av nye lignosulfonsyrederivater og anvendelse av dem som additiver. | |
| US4209497A (en) | Preparation of detergent grade sodium tripolyphosphate from wet process phosphoric acid and soda ash | |
| US3195978A (en) | Method of recovering potassium values from brines | |
| FI71292B (fi) | Foerfarande foer framstaellning av basiskt aluminiumsulfat | |
| JP2675465B2 (ja) | 含水炭酸カルシウムおよびその製造方法 | |
| US4212708A (en) | Gold-plating electrolyte | |
| US3628920A (en) | Preparation of a cupric hydroxide-phosphorous complex | |
| US4483837A (en) | Process for making calciummonohydrogen phosphate dihydrate | |
| US3966880A (en) | Method for producing alkali metal gold sulfite | |
| JPS5950603B2 (ja) | 亜酸化銅の製造方法 | |
| US3393233A (en) | Method for recovering ethylene diamine tetraacetic acid | |
| PL177619B1 (pl) | Sposób wytwarzania soli cezu z ałunu cezowo-glinowego | |
| KR0142918B1 (ko) | 산화제일구리의 제조방법 | |
| JPS6111890B2 (ro) | ||
| JP3211216B2 (ja) | 銀含有結晶質リン酸ジルコニウムの製造方法 | |
| US3981782A (en) | Electroplating of gold and gold compounds therefor | |
| RU2051104C1 (ru) | Способ получения хлорокиси меди | |
| KR100390588B1 (ko) | 산화제1동의 제조방법 | |
| US3418238A (en) | Process for preparing additive-modified silica gels | |
| JPH0258209B2 (ro) |