CS226424B2 - Method of preparing 1-hydrazonoisoindoline - Google Patents
Method of preparing 1-hydrazonoisoindoline Download PDFInfo
- Publication number
- CS226424B2 CS226424B2 CS811784A CS178481A CS226424B2 CS 226424 B2 CS226424 B2 CS 226424B2 CS 811784 A CS811784 A CS 811784A CS 178481 A CS178481 A CS 178481A CS 226424 B2 CS226424 B2 CS 226424B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- group
- formula
- reaction
- mol
- atoms
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 10
- AALCCGUYTBKSCV-UHFFFAOYSA-N 3h-isoindol-1-ylhydrazine Chemical compound C1=CC=C2C(=NN)NCC2=C1 AALCCGUYTBKSCV-UHFFFAOYSA-N 0.000 title description 4
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 239000000460 chlorine Substances 0.000 claims description 12
- -1 benzylcarbamoyl group Chemical group 0.000 claims description 11
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- MTKKGHVQPVOXIL-UHFFFAOYSA-N 3h-isoindol-1-amine Chemical compound C1=CC=C2C(N)=NCC2=C1 MTKKGHVQPVOXIL-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 239000002798 polar solvent Substances 0.000 claims description 5
- 125000004434 sulfur atom Chemical group 0.000 claims description 5
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 40
- 239000000203 mixture Substances 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 23
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 16
- 229910052799 carbon Inorganic materials 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 13
- 229910052739 hydrogen Inorganic materials 0.000 description 13
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 150000004696 coordination complex Chemical class 0.000 description 10
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 10
- 229910052759 nickel Inorganic materials 0.000 description 9
- 239000000049 pigment Substances 0.000 description 9
- 239000000543 intermediate Substances 0.000 description 8
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- RZVCEPSDYHAHLX-UHFFFAOYSA-N 3-iminoisoindol-1-amine Chemical compound C1=CC=C2C(N)=NC(=N)C2=C1 RZVCEPSDYHAHLX-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 4
- 239000004922 lacquer Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- BDKUZCAWVKAITR-UHFFFAOYSA-N 2-(3-aminoisoindol-1-ylidene)-n-(4-chlorophenyl)-2-cyanoacetamide Chemical compound C12=CC=CC=C2C(N)=NC1=C(C#N)C(=O)NC1=CC=C(Cl)C=C1 BDKUZCAWVKAITR-UHFFFAOYSA-N 0.000 description 3
- MQRWBMAEBQOWAF-UHFFFAOYSA-N acetic acid;nickel Chemical compound [Ni].CC(O)=O.CC(O)=O MQRWBMAEBQOWAF-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229940078494 nickel acetate Drugs 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920000915 polyvinyl chloride Polymers 0.000 description 3
- 239000004800 polyvinyl chloride Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- RQKFYFNZSHWXAW-UHFFFAOYSA-N 3-chloro-p-toluidine Chemical compound CC1=CC=C(N)C=C1Cl RQKFYFNZSHWXAW-UHFFFAOYSA-N 0.000 description 2
- XMXLBDNVSIHRRA-UHFFFAOYSA-N 4,5-dimethyl-1,3-thiazol-2-amine Chemical compound CC=1N=C(N)SC=1C XMXLBDNVSIHRRA-UHFFFAOYSA-N 0.000 description 2
- HDHQZCHIXUUSMK-UHFFFAOYSA-N 4-hydroxy-2-quinolone Chemical compound C1=CC=C2C(O)=CC(=O)NC2=C1 HDHQZCHIXUUSMK-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 150000007857 hydrazones Chemical class 0.000 description 2
- 238000004452 microanalysis Methods 0.000 description 2
- FVRPUCCFKLDISH-UHFFFAOYSA-N n-(4-chlorophenyl)-2-cyano-2-(3-hydrazinyl-2,3-dihydroisoindol-1-ylidene)acetamide Chemical compound C12=CC=CC=C2C(NN)NC1=C(C#N)C(=O)NC1=CC=C(Cl)C=C1 FVRPUCCFKLDISH-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 2
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 description 1
- 125000006569 (C5-C6) heterocyclic group Chemical group 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- DEVUYWTZRXOMSI-UHFFFAOYSA-N (sulfamoylamino)benzene Chemical compound NS(=O)(=O)NC1=CC=CC=C1 DEVUYWTZRXOMSI-UHFFFAOYSA-N 0.000 description 1
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 1
- DLLFADYPMCACGI-UHFFFAOYSA-N 2,3-dihydro-1h-isoindol-1-ylhydrazine Chemical class C1=CC=C2C(NN)NCC2=C1 DLLFADYPMCACGI-UHFFFAOYSA-N 0.000 description 1
- GEQNZVKIDIPGCO-UHFFFAOYSA-N 2,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C(OC)=C1 GEQNZVKIDIPGCO-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- OGAMRAQUAIMWKV-UHFFFAOYSA-N 2-(3-aminoisoindol-1-ylidene)-2-cyano-n-phenylacetamide Chemical compound C12=CC=CC=C2C(=N)NC1=C(C#N)C(=O)NC1=CC=CC=C1 OGAMRAQUAIMWKV-UHFFFAOYSA-N 0.000 description 1
- LWGUCIXHBVVATR-UHFFFAOYSA-N 2-amino-1h-quinolin-4-one Chemical compound C1=CC=C2NC(N)=CC(=O)C2=C1 LWGUCIXHBVVATR-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- XNOKRCUPTFRUTN-UHFFFAOYSA-N 2-chloro-5-(difluoromethyl)aniline Chemical compound NC1=CC(C(F)F)=CC=C1Cl XNOKRCUPTFRUTN-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- SDYWXFYBZPNOFX-UHFFFAOYSA-N 3,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1 SDYWXFYBZPNOFX-UHFFFAOYSA-N 0.000 description 1
- MKARNSWMMBGSHX-UHFFFAOYSA-N 3,5-dimethylaniline Chemical compound CC1=CC(C)=CC(N)=C1 MKARNSWMMBGSHX-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- JSUIZGUMJYDHAP-UHFFFAOYSA-N 4-(anilinomethylidene)-2-(4-chlorophenyl)-5-methylpyrazol-3-one Chemical compound CC1=NN(C=2C=CC(Cl)=CC=2)C(=O)C1=CNC1=CC=CC=C1 JSUIZGUMJYDHAP-UHFFFAOYSA-N 0.000 description 1
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- WOYZXEVUWXQVNV-UHFFFAOYSA-N 4-phenoxyaniline Chemical compound C1=CC(N)=CC=C1OC1=CC=CC=C1 WOYZXEVUWXQVNV-UHFFFAOYSA-N 0.000 description 1
- QPQKUYVSJWQSDY-UHFFFAOYSA-N 4-phenyldiazenylaniline Chemical compound C1=CC(N)=CC=C1N=NC1=CC=CC=C1 QPQKUYVSJWQSDY-UHFFFAOYSA-N 0.000 description 1
- MAXBVGJEFDMHNV-UHFFFAOYSA-N 5-chloropyridin-2-amine Chemical compound NC1=CC=C(Cl)C=N1 MAXBVGJEFDMHNV-UHFFFAOYSA-N 0.000 description 1
- XISYUJXZBWBYPS-UHFFFAOYSA-N 7-chloro-3-iminoisoindol-1-amine Chemical compound ClC1=CC=CC2=C1C(=N)NC2=N XISYUJXZBWBYPS-UHFFFAOYSA-N 0.000 description 1
- ILDAMKBJLLALQZ-UHFFFAOYSA-N 9,10-diazatricyclo[6.1.1.02,7]deca-2,4,6-triene Chemical compound C12=CC=CC=C2C2NC1N2 ILDAMKBJLLALQZ-UHFFFAOYSA-N 0.000 description 1
- 101100387923 Caenorhabditis elegans dos-1 gene Proteins 0.000 description 1
- 229910021543 Nickel dioxide Inorganic materials 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 150000001555 benzenes Chemical group 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- NWYSGVZOXZTSDQ-UHFFFAOYSA-N cyanomethyl 2-(3-aminoisoindol-1-ylidene)acetate Chemical compound C1=CC=C2C(=N)NC(=CC(=O)OCC#N)C2=C1 NWYSGVZOXZTSDQ-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 150000002466 imines Chemical group 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- JQDUOCCITWQNES-UHFFFAOYSA-N n'-(4-chlorophenyl)benzohydrazide Chemical compound C1=CC(Cl)=CC=C1NNC(=O)C1=CC=CC=C1 JQDUOCCITWQNES-UHFFFAOYSA-N 0.000 description 1
- CHMBIJAOCISYEW-UHFFFAOYSA-N n-(4-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=C1 CHMBIJAOCISYEW-UHFFFAOYSA-N 0.000 description 1
- GTTFJYUWPUKXJH-UHFFFAOYSA-N n-(4-aminophenyl)benzamide Chemical compound C1=CC(N)=CC=C1NC(=O)C1=CC=CC=C1 GTTFJYUWPUKXJH-UHFFFAOYSA-N 0.000 description 1
- 238000010915 one-step procedure Methods 0.000 description 1
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- RCTGMCJBQGBLKT-PAMTUDGESA-N scarlet red Chemical compound CC1=CC=CC=C1\N=N\C(C=C1C)=CC=C1\N=N\C1=C(O)C=CC2=CC=CC=C12 RCTGMCJBQGBLKT-PAMTUDGESA-N 0.000 description 1
- 229960005369 scarlet red Drugs 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B57/00—Other synthetic dyes of known constitution
- C09B57/04—Isoindoline dyes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH197480 | 1980-03-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS226424B2 true CS226424B2 (en) | 1984-03-19 |
Family
ID=4222967
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS811784A CS226424B2 (en) | 1980-03-13 | 1981-03-11 | Method of preparing 1-hydrazonoisoindoline |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4414395A (enExample) |
| EP (1) | EP0036387B1 (enExample) |
| JP (1) | JPS56142263A (enExample) |
| CA (1) | CA1143379A (enExample) |
| CS (1) | CS226424B2 (enExample) |
| DE (1) | DE3173547D1 (enExample) |
| PL (1) | PL230111A1 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3229733A1 (de) * | 1982-08-10 | 1984-02-16 | Bayer Ag, 5090 Leverkusen | Isoindolazine, verfahren zu ihrer herstellung sowie ihre verwendung |
| CH668978A5 (de) * | 1985-06-26 | 1989-02-15 | Basf Ag | Isoindolinfarbstoffe. |
| JPH0482338U (enExample) * | 1990-11-28 | 1992-07-17 | ||
| IL102790A (en) * | 1991-09-17 | 1996-01-31 | Roussel Uclaf | 3-Cycloalkyl-prop-2- enamide derivatives |
| GB9119874D0 (en) * | 1991-09-17 | 1991-10-30 | Roussel Lab Ltd | 3-cylopropyl-prop-2-enamide derivatives |
| DE4341769A1 (de) * | 1993-12-08 | 1995-06-14 | Basf Ag | Verfahren zur Herstellung von unsymmetrischen Bisisoindolinpigmenten |
| DE502005001191D1 (de) * | 2004-04-02 | 2007-09-20 | Dystar Textilfarben Gmbh & Co | Hochlichtechte tinten für den digitalen textildruck |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE952810C (de) * | 1953-08-25 | 1956-11-22 | Cassella Farbwerke Mainkur Ag | Verfahren zur Herstellung von Dihydrazinodiazinderivaten |
| NL218863A (enExample) * | 1956-07-13 | |||
| US3095448A (en) * | 1958-07-30 | 1963-06-25 | Lakeside Lab Inc | Cycloalkyl-alkyl hydrazines |
| DE1670748A1 (de) * | 1966-09-09 | 1973-05-30 | Bayer Ag | Verfahren zur herstellung neuer isoindolinderivate |
| CH510088A (de) * | 1968-03-21 | 1971-07-15 | Ciba Geigy Ag | Verfahren zur Herstellung transparenter Pigmente der Isoindolinreihe |
| CH597324A5 (enExample) * | 1974-02-06 | 1978-03-31 | Ciba Geigy Ag | |
| US4111947A (en) * | 1974-02-06 | 1978-09-05 | Ciba-Geigy Corporation | Novel metal complexes of azomethines and process for their manufacture |
| US4139563A (en) * | 1977-07-01 | 1979-02-13 | Merrell Toraude Et Compagnie | α-ACETYLENIC DERIVATIVES OF AMINES |
-
1981
- 1981-03-06 US US06/241,142 patent/US4414395A/en not_active Expired - Lifetime
- 1981-03-09 DE DE8181810080T patent/DE3173547D1/de not_active Expired
- 1981-03-09 EP EP81810080A patent/EP0036387B1/de not_active Expired
- 1981-03-11 CA CA000372762A patent/CA1143379A/en not_active Expired
- 1981-03-11 CS CS811784A patent/CS226424B2/cs unknown
- 1981-03-12 PL PL23011181A patent/PL230111A1/xx unknown
- 1981-03-13 JP JP3643281A patent/JPS56142263A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0036387A2 (de) | 1981-09-23 |
| CA1143379A (en) | 1983-03-22 |
| EP0036387A3 (en) | 1981-11-25 |
| JPH0254340B2 (enExample) | 1990-11-21 |
| US4414395A (en) | 1983-11-08 |
| JPS56142263A (en) | 1981-11-06 |
| EP0036387B1 (de) | 1986-01-22 |
| PL230111A1 (enExample) | 1981-11-13 |
| DE3173547D1 (en) | 1986-03-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3646033A (en) | Derivatives of isoindoline | |
| US2754293A (en) | Azo dyes from 6-aminocarbostyrils | |
| CS226424B2 (en) | Method of preparing 1-hydrazonoisoindoline | |
| US4385174A (en) | Isoindoline compounds and the manufacture and use thereof | |
| US4083842A (en) | Diazo compounds containing two optionally substituted-5-arylazo-6-hydroxypyridone-2 radicals linked through their nitrogen atoms | |
| CA1277979C (en) | Amine salts of azo compounds | |
| US4349671A (en) | Process for the production of metal complexes of isoindoline azines | |
| DE2513949A1 (de) | Azofarbstoffe | |
| JP2538997B2 (ja) | ジアゾおよびアゾ化合物の製造方法 | |
| US4564680A (en) | Isoindolazines | |
| US4474952A (en) | Process for the preparation of metal complexes of isoindolinazines | |
| US4366312A (en) | Metal complexes of isoindolinazines, process for their preparation and use | |
| US4113759A (en) | Metal-containing disazomethine compounds, process for preparing them and their use as colorants | |
| US4042611A (en) | Water-in-soluble disazo methine compounds | |
| CA1142931A (en) | Metal complexes of isoindolinazines, process for their preparation and use | |
| US4002630A (en) | Novel aromatic o-hydroxyaldehydes, a process for their preparation and their utilization | |
| CA1089869A (en) | Metal-containing disazomethine compounds, process for preparing them and their use as colorants | |
| US5134237A (en) | Pyridonyl substituted isoindolehydrazone metal complex compounds | |
| US3715360A (en) | Dyes of the 2,4-dihydroxyquinoline series | |
| DE1901422A1 (de) | Trisazofarbstoffe,ihre Herstellung und Verwendung | |
| JPS58164648A (ja) | イソインドリン染料及びその使用 | |
| JPH07258565A (ja) | イソインドリンアゾ顔料 | |
| CA1155122A (en) | 1:1 nickel complexes of isoindolinazines, process for their preparation and use | |
| JPS5838467B2 (ja) | シンキビスアゾメチンガンリヨウノ セイホウ | |
| US3510488A (en) | Pyridazone-hydrazones |