CS223803B2 - Building block - Google Patents
Building block Download PDFInfo
- Publication number
- CS223803B2 CS223803B2 CS774435A CS443577A CS223803B2 CS 223803 B2 CS223803 B2 CS 223803B2 CS 774435 A CS774435 A CS 774435A CS 443577 A CS443577 A CS 443577A CS 223803 B2 CS223803 B2 CS 223803B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- vertical
- building block
- blocks
- block
- central
- Prior art date
Links
- 238000010276 construction Methods 0.000 claims abstract description 8
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims 1
- 229910052749 magnesium Inorganic materials 0.000 claims 1
- 239000011777 magnesium Substances 0.000 claims 1
- 239000002689 soil Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 7
- 230000002093 peripheral effect Effects 0.000 description 5
- 230000003014 reinforcing effect Effects 0.000 description 4
- BQTXJHAJMDGOFI-NJLPOHDGSA-N Dexamethasone 21-(4-Pyridinecarboxylate) Chemical compound O=C([C@]1(O)[C@@]2(C)C[C@H](O)[C@]3(F)[C@@]4(C)C=CC(=O)C=C4CC[C@H]3[C@@H]2C[C@H]1C)COC(=O)C1=CC=NC=C1 BQTXJHAJMDGOFI-NJLPOHDGSA-N 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000004570 mortar (masonry) Substances 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000283923 Marmota monax Species 0.000 description 1
- 235000002492 Rungia klossii Nutrition 0.000 description 1
- 244000117054 Rungia klossii Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 210000003050 axon Anatomy 0.000 description 1
- 230000009514 concussion Effects 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04B—GENERAL BUILDING CONSTRUCTIONS; WALLS, e.g. PARTITIONS; ROOFS; FLOORS; CEILINGS; INSULATION OR OTHER PROTECTION OF BUILDINGS
- E04B2/00—Walls, e.g. partitions, for buildings; Wall construction with regard to insulation; Connections specially adapted to walls
- E04B2/02—Walls, e.g. partitions, for buildings; Wall construction with regard to insulation; Connections specially adapted to walls built-up from layers of building elements
- E04B2/14—Walls having cavities in, but not between, the elements, i.e. each cavity being enclosed by at least four sides forming part of one single element
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04B—GENERAL BUILDING CONSTRUCTIONS; WALLS, e.g. PARTITIONS; ROOFS; FLOORS; CEILINGS; INSULATION OR OTHER PROTECTION OF BUILDINGS
- E04B2/00—Walls, e.g. partitions, for buildings; Wall construction with regard to insulation; Connections specially adapted to walls
- E04B2/02—Walls, e.g. partitions, for buildings; Wall construction with regard to insulation; Connections specially adapted to walls built-up from layers of building elements
- E04B2/42—Walls having cavities between, as well as in, the elements; Walls of elements each consisting of two or more parts, kept in distance by means of spacers, at least one of the parts having cavities
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04B—GENERAL BUILDING CONSTRUCTIONS; WALLS, e.g. PARTITIONS; ROOFS; FLOORS; CEILINGS; INSULATION OR OTHER PROTECTION OF BUILDINGS
- E04B2/00—Walls, e.g. partitions, for buildings; Wall construction with regard to insulation; Connections specially adapted to walls
- E04B2/02—Walls, e.g. partitions, for buildings; Wall construction with regard to insulation; Connections specially adapted to walls built-up from layers of building elements
- E04B2002/0202—Details of connections
- E04B2002/0243—Separate connectors or inserts, e.g. pegs, pins or keys
- E04B2002/0245—Pegs or pins
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Civil Engineering (AREA)
- Structural Engineering (AREA)
- Retaining Walls (AREA)
- Revetment (AREA)
- Building Environments (AREA)
- Finishing Walls (AREA)
- Joining Of Building Structures In Genera (AREA)
- Fencing (AREA)
- Moulds, Cores, Or Mandrels (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH856576A CH606679A5 (en) | 1976-07-05 | 1976-07-05 | Building blocks with perimeter holes |
| CH229577A CH610976A5 (en) | 1977-02-24 | 1977-02-24 | Parallelepipedal construction block |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS223803B2 true CS223803B2 (en) | 1983-11-25 |
Family
ID=25690045
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS774435A CS223803B2 (en) | 1976-07-05 | 1977-07-04 | Building block |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4110949A (de) |
| JP (1) | JPS5334326A (de) |
| AR (1) | AR217436A1 (de) |
| AT (1) | AT354701B (de) |
| AU (1) | AU502912B2 (de) |
| BG (1) | BG29876A3 (de) |
| BR (1) | BR7704379A (de) |
| CA (1) | CA1070971A (de) |
| CS (1) | CS223803B2 (de) |
| DD (1) | DD131482A5 (de) |
| DE (1) | DE2729128A1 (de) |
| DK (1) | DK298677A (de) |
| ES (1) | ES460372A1 (de) |
| FR (1) | FR2357696A1 (de) |
| GB (1) | GB1559636A (de) |
| GR (1) | GR63565B (de) |
| IL (1) | IL52440A (de) |
| IT (1) | IT1083569B (de) |
| MX (1) | MX143686A (de) |
| NO (1) | NO772356L (de) |
| PL (1) | PL120233B1 (de) |
| PT (1) | PT66760B (de) |
| RO (1) | RO79611A (de) |
| SE (1) | SE414798B (de) |
| YU (1) | YU167977A (de) |
Families Citing this family (96)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1129828B (it) * | 1980-11-10 | 1986-06-11 | Keybrick System Srl | Sistema di costruzione edilizia |
| JPH032567Y2 (de) * | 1981-03-23 | 1991-01-24 | ||
| US4454699A (en) * | 1982-03-15 | 1984-06-19 | Fred Strobl | Brick fastening device |
| CH645152A5 (de) * | 1982-04-23 | 1984-09-14 | Aregger Bau Ag | Schalungselement fuer die mantelbetonbauweise. |
| DE3236187C2 (de) * | 1982-09-30 | 1986-05-28 | Didier-Werke Ag, 6200 Wiesbaden | Mörtelloser Isolationswandaufbau |
| US4523415A (en) * | 1984-01-25 | 1985-06-18 | Milton Rosen | One-piece building panel for walls and like structures |
| US4703600A (en) * | 1984-04-30 | 1987-11-03 | Suh Kun Hee | Vertically assembling box type blocks |
| DE3428148A1 (de) * | 1984-07-31 | 1986-02-13 | Metten Produktions- und Handels- GmbH, 5060 Bergisch Gladbach | Trockenmauer-system |
| US4655018A (en) * | 1985-01-31 | 1987-04-07 | National Concrete Masonry Association | Roof paver element and system |
| USD301064S (en) | 1986-05-14 | 1989-05-09 | Keystone Retaining Wall Systems, Inc. | Convex block |
| US4825619A (en) * | 1986-09-15 | 1989-05-02 | Keystone Retaining Wall Systems, Inc. | Block wall |
| US4802320A (en) * | 1986-09-15 | 1989-02-07 | Keystone Retaining Wall Systems, Inc. | Retaining wall block |
| USRE34314E (en) * | 1986-09-15 | 1993-07-20 | Keystone Retaining Wall Systems, Inc. | Block wall |
| US4914876A (en) * | 1986-09-15 | 1990-04-10 | Keystone Retaining Wall Systems, Inc. | Retaining wall with flexible mechanical soil stabilizing sheet |
| USD295788S (en) | 1987-02-11 | 1988-05-17 | Keystone Retaining Wall Systems, Inc. | Wall block |
| USD300254S (en) | 1988-06-06 | 1989-03-14 | Keystone Retaining Wall Systems, Inc. | Retaining wall block |
| USD300253S (en) | 1988-06-06 | 1989-03-14 | Keystone Retaining Wall Systems, Inc. | Retaining wall block |
| USD317048S (en) | 1988-11-21 | 1991-05-21 | Keystone Retaining Wall Systems, Inc. | Wall block |
| USD316904S (en) | 1988-11-21 | 1991-05-14 | Forsberg Paul J | Convex block |
| USD317209S (en) | 1988-12-05 | 1991-05-28 | Forsberg Paul J | Corner wall block |
| US5062610A (en) * | 1989-09-28 | 1991-11-05 | Block Systems Inc. | Composite masonry block mold for use in block molding machines |
| US5294216A (en) * | 1989-09-28 | 1994-03-15 | Anchor Wall Systems, Inc. | Composite masonry block |
| GB2241519B (en) * | 1990-03-03 | 1994-05-11 | Sidney Taylor | Improvements in and relating to building bricks and key members for use therewith |
| US5017049A (en) * | 1990-03-15 | 1991-05-21 | Block Systems Inc. | Composite masonry block |
| CA2045953C (en) * | 1991-06-28 | 1995-12-19 | Angelo Risi | Connector for use in combination with blocks for wall structures or the like |
| US5249950B1 (en) * | 1992-01-30 | 1997-05-13 | Anchor Wall Syst | Heated stripper shoe assembly |
| USD380560S (en) * | 1992-05-21 | 1997-07-01 | Keystone Retaining Wall Systems, Inc. | Three faceted broken front face of a retaining wall block |
| US5704183A (en) * | 1992-10-06 | 1998-01-06 | Anchor Wall Systems, Inc. | Composite masonry block |
| US5490363A (en) * | 1992-10-06 | 1996-02-13 | Anchor Wall Sytems, Inc. | Composite masonry block |
| SG46457A1 (en) * | 1992-10-06 | 1998-02-20 | Anchor Wall Syst | Composite masonry block |
| IT1257290B (it) * | 1992-11-18 | 1996-01-12 | Sirprogetti Srl | Blocco per costruzioni, procedimento per la sua fabbricazione e struttura muraria realizzata con l'impiego di tali blocchi. |
| US5507599A (en) * | 1993-03-31 | 1996-04-16 | Societe Civile Des Brevets Henri C. Vidal | Modular block retaining wall construction and components |
| US5624211A (en) * | 1993-03-31 | 1997-04-29 | Societe Civile Des Brevets Henri C. Vidal | Modular block retaining wall construction and components |
| US5474405A (en) * | 1993-03-31 | 1995-12-12 | Societe Civile Des Brevets Henri C. Vidal | Low elevation wall construction |
| GB9313095D0 (en) * | 1993-06-24 | 1993-08-11 | Vidal Henri Brevets | Earth structures |
| USD362511S (en) | 1993-08-16 | 1995-09-19 | Societ Civile des Brevets Henri C. Vidal | Cap block |
| CN100371544C (zh) * | 1993-12-20 | 2008-02-27 | Rar顾问有限公司 | 高层建筑物及形成一三度空间结构之多个建筑物镶板 |
| US5560171A (en) * | 1994-06-02 | 1996-10-01 | Mccoy; John R. | Stackable construction blocks |
| US5845444A (en) * | 1994-12-01 | 1998-12-08 | Besche; Charles F. | Masonry reinforcement |
| DE19502979A1 (de) * | 1995-01-31 | 1996-08-08 | Bodo Zschoppe | Bausatz für eine Wand |
| SE503919C2 (sv) * | 1995-01-31 | 1996-09-30 | Anders Hellsten | Blockformade byggelement för bildande av murverk |
| US5711130A (en) * | 1995-11-17 | 1998-01-27 | Shatley; Josh L. | Building block |
| USD458693S1 (en) | 1996-11-08 | 2002-06-11 | Anchor Wall Systems, Inc. | Retaining wall block |
| US6029943A (en) * | 1996-11-08 | 2000-02-29 | Anchor Wall Systems, Inc. | Splitting technique |
| US5879603A (en) * | 1996-11-08 | 1999-03-09 | Anchor Wall Systems, Inc. | Process for producing masonry block with roughened surface |
| US6082057A (en) | 1996-11-08 | 2000-07-04 | Anchor Wall Systems, Inc. | Splitting technique |
| USD445512S1 (en) | 1997-10-27 | 2001-07-24 | Anchor Wall Systems, Inc. | Retaining wall block |
| US6138426A (en) * | 1997-11-22 | 2000-10-31 | Mork; Robert James | Mortarless wall |
| AUPP647298A0 (en) * | 1998-10-13 | 1998-11-05 | Keystone Retaining Wall Systems, Inc. | Retaining wall block |
| USD435302S (en) | 1999-10-15 | 2000-12-19 | Kiltie Corp. | Front surface of a retaining wall module |
| US6488448B1 (en) * | 1999-10-15 | 2002-12-03 | Kiltie Corp. | Block module |
| DE19951937C1 (de) * | 1999-10-28 | 2001-10-18 | Schiedel Gmbh & Co | Verbindung für Mantelsteine |
| USD439678S1 (en) | 2000-02-04 | 2001-03-27 | Kiltie Corp. | Masonry block |
| WO2001077456A1 (en) * | 2000-04-07 | 2001-10-18 | Erasmus, Susarah, Aletta | A building system |
| US7591447B2 (en) * | 2001-10-18 | 2009-09-22 | Westblock Systems, Inc. | Wall block, system and mold for making the same |
| WO2003033833A1 (en) | 2001-10-18 | 2003-04-24 | Westblock Systems, Inc. | Wall block, system and method |
| US6796094B1 (en) * | 2002-10-30 | 2004-09-28 | Dionisie Kelemen | Mortarless concrete wall system |
| US6948282B2 (en) | 2003-01-09 | 2005-09-27 | Allan Block Corporation | Interlocking building block |
| US6889479B2 (en) * | 2003-04-28 | 2005-05-10 | Douglas G. Thorpe | Building block |
| US6996945B2 (en) * | 2003-05-16 | 2006-02-14 | Doty Steven E | Self interlocking block system |
| LU91032B1 (de) * | 2003-07-04 | 2005-01-05 | Hubert Van Den Berkmortel | Mauerstein. |
| US7168218B2 (en) * | 2004-06-11 | 2007-01-30 | David Stalder Spratlen | Mortarless fence block system |
| US20060005500A1 (en) * | 2004-07-07 | 2006-01-12 | Vahak Hovnanian | Mortar less brick wall construction |
| DE102004054368A1 (de) * | 2004-11-10 | 2006-05-11 | Kaindl Flooring Gmbh | Verkleidungspaneel |
| EP1910628A4 (de) * | 2005-02-28 | 2010-03-03 | Llc Zipblocks | Modulare blöcke und daraus hergestellte strukturen |
| NO20051817A (no) * | 2005-04-14 | 2006-07-17 | Svein Lund | Bygningsblokk for en bygningskonstruksjon |
| PA8631001A1 (es) * | 2005-04-21 | 2005-12-23 | Soloarmar Panama S A | Soloarmar |
| USD537533S1 (en) | 2005-09-28 | 2007-02-27 | Kiltie Corporation | Retaining wall block |
| US20070110524A1 (en) * | 2005-11-15 | 2007-05-17 | Macdonald Robert A | Pin having a tapered cap |
| US20070258776A1 (en) * | 2006-04-24 | 2007-11-08 | Strand Todd P | Retaining wall systems |
| CA2551252C (en) * | 2006-06-22 | 2012-10-23 | 9031-1671 Quebec Inc. | Hollow pipe connector |
| US20080110124A1 (en) * | 2006-11-13 | 2008-05-15 | Buse Jay | Apparatus and method for interlocking blocks |
| CA2577424C (en) * | 2007-02-02 | 2013-06-18 | Guy Lemieux | Block and connector system |
| US7584584B2 (en) * | 2007-04-09 | 2009-09-08 | Fennell Jr Harry C | Reusable modular block wall assembly system |
| GB2461879A (en) * | 2008-07-15 | 2010-01-20 | Borough Recycling Specialists | Building block and pin system |
| US8316610B2 (en) * | 2009-06-09 | 2012-11-27 | Adams Wendell B | Bulk liquid and material delivery device and construction block |
| US8256168B2 (en) * | 2009-10-08 | 2012-09-04 | Bigger George S | Structure comprising hexagonal tubes and rhomboid inserts |
| USD652154S1 (en) | 2011-03-11 | 2012-01-10 | Westblock Development, LLC | Wall block |
| USD652153S1 (en) | 2011-03-11 | 2012-01-10 | Westblock Development, LLC | Wall block |
| USD652155S1 (en) | 2011-06-21 | 2012-01-10 | Westblock Development, LLC | Wall block |
| USD652531S1 (en) | 2011-03-11 | 2012-01-17 | Westblock Development, LLC | Wall block |
| CA2771392C (en) | 2011-03-14 | 2018-06-12 | Westblock Development Llc | Wall block system |
| BE1020597A3 (nl) * | 2012-03-30 | 2014-01-07 | Vandenbempt Patent | Snelbouwsteen, evenals kunststof inzetstuk voor het vervaardigen van zulke snelbouwsteen. |
| US9145249B2 (en) | 2013-06-11 | 2015-09-29 | Wendell B. Adams | Bulk liquid/material construction block utility kit |
| US9086268B2 (en) * | 2013-10-02 | 2015-07-21 | Jonathan E Jones | Concrete block spacer system |
| US9382712B2 (en) | 2014-04-29 | 2016-07-05 | Mark R. Weber | Wall construction system and component thereof |
| US20160130809A1 (en) * | 2014-08-01 | 2016-05-12 | Just Biofiber Corp. | Load bearing interlocking structural blocks and methods of manufacture |
| WO2016054187A1 (en) | 2014-09-30 | 2016-04-07 | Miller Philip Glen | Self-bracing, two-way moment frame precast system for industrial support structure and method of utilizing same |
| US10415241B2 (en) | 2016-03-08 | 2019-09-17 | Excel Project Management Ltd. | Monolithic retaining wall |
| MX2018014349A (es) * | 2016-05-26 | 2019-02-14 | Sic Spa | Un dispositivo conector y separador de unidades de albañilería. |
| US10584502B2 (en) | 2016-09-09 | 2020-03-10 | Excel Project Management Ltd. | Arch-support system |
| FR3066207B1 (fr) * | 2017-05-11 | 2021-07-30 | Deam | Bloc de construction muni de son propre dispositif de liaison |
| DE102018102430A1 (de) * | 2017-09-19 | 2019-03-21 | DiHa Patentverwertungs GbR (vertretungsberechtigte Gesellschafter Konrad Wetzstein, 86502 Laugna und Anton Kempter, 89361 Landensberg) | Schalungselement |
| US20190127976A1 (en) * | 2017-10-26 | 2019-05-02 | William Donnelly | Interlocking Blocks |
| US12163329B2 (en) * | 2018-07-20 | 2024-12-10 | Dk Gevels B.V. | Wall assembly |
| USD990714S1 (en) * | 2019-04-24 | 2023-06-27 | Takching Chan | Brick |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH77810A (fr) * | 1917-06-23 | 1919-03-01 | De Brayer Alfred | Appareil de prise de vues cinématographiques |
| US1623094A (en) * | 1925-08-26 | 1927-04-05 | Floyd S Cooley | Block wall and method for constructing same |
| FR647249A (fr) * | 1927-06-10 | 1928-11-21 | Procédé de constructions cellulaires et matériaux pour la réalisation dudit procédé | |
| GB1045289A (en) * | 1963-08-28 | 1966-10-12 | Roland Evan Thomas | Bricks or building blocks |
| US3479782A (en) * | 1967-08-04 | 1969-11-25 | George B Muse | Construction block |
-
1977
- 1977-06-27 GB GB26807/77A patent/GB1559636A/en not_active Expired
- 1977-06-28 US US05/810,829 patent/US4110949A/en not_active Expired - Lifetime
- 1977-06-28 MX MX169654A patent/MX143686A/es unknown
- 1977-06-28 DE DE19772729128 patent/DE2729128A1/de not_active Withdrawn
- 1977-06-29 AT AT464277A patent/AT354701B/de not_active IP Right Cessation
- 1977-06-30 FR FR7720184A patent/FR2357696A1/fr active Granted
- 1977-07-01 AU AU26686/77A patent/AU502912B2/en not_active Expired
- 1977-07-03 IL IL52440A patent/IL52440A/xx unknown
- 1977-07-04 CA CA281,955A patent/CA1070971A/en not_active Expired
- 1977-07-04 NO NO772356A patent/NO772356L/no unknown
- 1977-07-04 GR GR53870A patent/GR63565B/el unknown
- 1977-07-04 PT PT66760A patent/PT66760B/pt unknown
- 1977-07-04 ES ES460372A patent/ES460372A1/es not_active Expired
- 1977-07-04 CS CS774435A patent/CS223803B2/cs unknown
- 1977-07-04 BR BR7704379A patent/BR7704379A/pt unknown
- 1977-07-04 AR AR268303A patent/AR217436A1/es active
- 1977-07-04 DK DK298677A patent/DK298677A/da not_active Application Discontinuation
- 1977-07-05 RO RO7790936A patent/RO79611A/ro unknown
- 1977-07-05 JP JP8034877A patent/JPS5334326A/ja active Pending
- 1977-07-05 IT IT68558/77A patent/IT1083569B/it active
- 1977-07-05 SE SE7707823A patent/SE414798B/xx unknown
- 1977-07-05 BG BG036808A patent/BG29876A3/xx unknown
- 1977-07-05 YU YU01679/77A patent/YU167977A/xx unknown
- 1977-07-05 DD DD7700199891A patent/DD131482A5/de unknown
- 1977-07-05 PL PL1977199390A patent/PL120233B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| YU167977A (en) | 1982-08-31 |
| PL120233B1 (en) | 1982-02-27 |
| RO79611A (ro) | 1982-08-17 |
| AT354701B (de) | 1979-01-25 |
| DK298677A (da) | 1978-01-06 |
| PT66760A (fr) | 1977-08-01 |
| BG29876A3 (en) | 1981-02-16 |
| AR217436A1 (es) | 1980-03-31 |
| CA1070971A (en) | 1980-02-05 |
| IT1083569B (it) | 1985-05-21 |
| DD131482A5 (de) | 1978-06-28 |
| PT66760B (fr) | 1978-12-14 |
| GB1559636A (en) | 1980-01-23 |
| IL52440A0 (en) | 1977-10-31 |
| BR7704379A (pt) | 1978-05-02 |
| JPS5334326A (en) | 1978-03-30 |
| SE7707823L (sv) | 1978-01-06 |
| GR63565B (en) | 1979-11-20 |
| SE414798B (sv) | 1980-08-18 |
| DE2729128A1 (de) | 1978-01-19 |
| MX143686A (es) | 1981-06-24 |
| FR2357696B3 (de) | 1980-05-09 |
| ES460372A1 (es) | 1978-10-01 |
| FR2357696A1 (fr) | 1978-02-03 |
| AU502912B2 (en) | 1979-08-09 |
| NO772356L (no) | 1978-01-06 |
| AU2668677A (en) | 1979-01-04 |
| IL52440A (en) | 1979-11-30 |
| PL199390A1 (pl) | 1978-03-13 |
| ATA464277A (de) | 1979-06-15 |
| US4110949A (en) | 1978-09-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS223803B2 (en) | Building block | |
| US6219984B1 (en) | Interconnectable formwork elements | |
| AU694724B2 (en) | A building block, a process for its manufacture and a building structure produced using these blocks | |
| EP0166249B1 (de) | Ineinandergreifende Baublöcke und Bausystem für diese Blöcke | |
| US5740648A (en) | Modular formwork for concrete | |
| US2881614A (en) | Building or construction blocks | |
| US5485703A (en) | Construction assembly including a rectangular block for dry walling or the permanent construction of a wall or partition | |
| US7818938B2 (en) | Block and connector system | |
| PL172426B1 (pl) | Zestaw pustaków murarskich PL | |
| US20100162650A1 (en) | Drywall construction method and apparatus | |
| US5072556A (en) | Wall assembly construction | |
| US716865A (en) | Interlocking bricks. | |
| US6722094B1 (en) | Insulating structural cores for block | |
| US1588332A (en) | Building wall | |
| WO2008052282A1 (en) | A building block | |
| KR102588711B1 (ko) | 공동주택의 벽체를 형성하기 위한 조적공사에 사용되는 조적구조체 | |
| SU670236A3 (ru) | Стеновой блок | |
| CN215055168U (zh) | 一种用于构造柱免支模施工的砌块及构造柱浇筑支护结构 | |
| US1534060A (en) | Wall construction and building block for the same | |
| RU2289660C2 (ru) | Блок, способ его производства и способ возведения стен из этих блоков | |
| US1197815A (en) | Hollow interlocking brick. | |
| CN109306760A (zh) | 装配式墙体及装配式建筑砌块 | |
| CN216586978U (zh) | 一种装配式混凝土框架结构 | |
| RU2800173C1 (ru) | Строительный пустотелый блок и способ его изготовления | |
| SU1733551A1 (ru) | Пустотелый бетонный массив |