CS209881B2 - Herbicide means - Google Patents
Herbicide means Download PDFInfo
- Publication number
- CS209881B2 CS209881B2 CS772050A CS205077A CS209881B2 CS 209881 B2 CS209881 B2 CS 209881B2 CS 772050 A CS772050 A CS 772050A CS 205077 A CS205077 A CS 205077A CS 209881 B2 CS209881 B2 CS 209881B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- compound
- formula
- active ingredient
- herbicidal composition
- снз
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims abstract description 48
- 239000004009 herbicide Substances 0.000 title abstract description 11
- 150000001875 compounds Chemical class 0.000 claims abstract description 62
- 239000000203 mixture Substances 0.000 claims description 40
- 239000004480 active ingredient Substances 0.000 claims description 30
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- -1 cyclopnopylmethyl Chemical group 0.000 claims description 9
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 7
- 125000002947 alkylene group Chemical group 0.000 claims description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 4
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- RFONJRMUUALMBA-UHFFFAOYSA-N 2-methanidylpropane Chemical group CC(C)[CH2-] RFONJRMUUALMBA-UHFFFAOYSA-N 0.000 claims 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 2
- 125000005156 substituted alkylene group Chemical group 0.000 claims 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 abstract description 8
- 230000008635 plant growth Effects 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 241000196324 Embryophyta Species 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 230000006378 damage Effects 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000010410 layer Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 239000004793 Polystyrene Substances 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- 229920001213 Polysorbate 20 Polymers 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000004495 emulsifiable concentrate Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 3
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 150000003462 sulfoxides Chemical class 0.000 description 3
- 244000075850 Avena orientalis Species 0.000 description 2
- 235000007319 Avena orientalis Nutrition 0.000 description 2
- 244000178993 Brassica juncea Species 0.000 description 2
- 235000011332 Brassica juncea Nutrition 0.000 description 2
- 235000014700 Brassica juncea var napiformis Nutrition 0.000 description 2
- LIHJUCXMPWDAIS-UHFFFAOYSA-N CCCCN(CC1CC1)C([O-])=[S+]CC1CC1 Chemical compound CCCCN(CC1CC1)C([O-])=[S+]CC1CC1 LIHJUCXMPWDAIS-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 2
- 244000152970 Digitaria sanguinalis Species 0.000 description 2
- VDVSWUIKUXSNKX-UHFFFAOYSA-N O-(cyclopropylmethyl) chloromethanethioate Chemical compound ClC(=S)OCC1CC1 VDVSWUIKUXSNKX-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- 235000021501 Rumex crispus Nutrition 0.000 description 2
- 244000207667 Rumex vesicarius Species 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 125000006727 (C1-C6) alkenyl group Chemical group 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- BEYQLBRVBNRBCE-UHFFFAOYSA-N CCCN(CCC)C(=O)SCC1CCC1 Chemical compound CCCN(CCC)C(=O)SCC1CCC1 BEYQLBRVBNRBCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- ZIZPZBCAULXKJN-UHFFFAOYSA-N O-(2,2-dimethylpropyl) chloromethanethioate Chemical compound C(C(C)(C)C)OC(=S)Cl ZIZPZBCAULXKJN-UHFFFAOYSA-N 0.000 description 1
- 244000088461 Panicum crus-galli Species 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 244000115721 Pennisetum typhoides Species 0.000 description 1
- 235000007195 Pennisetum typhoides Nutrition 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- BZMJOGKMGYUQGC-UHFFFAOYSA-N S-(2,2-dimethylpropyl) azepane-2-carbothioate Chemical compound N1C(CCCCC1)C(SCC(C)(C)C)=O BZMJOGKMGYUQGC-UHFFFAOYSA-N 0.000 description 1
- 235000008515 Setaria glauca Nutrition 0.000 description 1
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- DCPZJACXSHVQOD-UHFFFAOYSA-N carbamoylsulfinylformamide Chemical class NC(=O)S(=O)C(N)=O DCPZJACXSHVQOD-UHFFFAOYSA-N 0.000 description 1
- KTRFZWJCHOQHMN-UHFFFAOYSA-N chloromethanethioic s-acid Chemical compound SC(Cl)=O KTRFZWJCHOQHMN-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002646 long chain fatty acid esters Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- FWTWRVPKRBPMGT-UHFFFAOYSA-N n-butylcyclopropanamine;hydrochloride Chemical compound Cl.CCCCNC1CC1 FWTWRVPKRBPMGT-UHFFFAOYSA-N 0.000 description 1
- QHCCDDQKNUYGNC-UHFFFAOYSA-N n-ethylbutan-1-amine Chemical compound CCCCNCC QHCCDDQKNUYGNC-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003090 pesticide formulation Substances 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920006327 polystyrene foam Polymers 0.000 description 1
- WTNABIPUOMXOPQ-UHFFFAOYSA-N s-(cyclobutylmethyl) chloromethanethioate Chemical compound ClC(=O)SCC1CCC1 WTNABIPUOMXOPQ-UHFFFAOYSA-N 0.000 description 1
- KEHIXOYPHUZNSX-UHFFFAOYSA-N s-(cyclopentylmethyl) chloromethanethioate Chemical compound ClC(=O)SCC1CCCC1 KEHIXOYPHUZNSX-UHFFFAOYSA-N 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/21—Radicals derived from sulfur analogues of carbonic acid
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US67121976A | 1976-03-29 | 1976-03-29 | |
| US67122676A | 1976-03-29 | 1976-03-29 | |
| US68110576A | 1976-04-28 | 1976-04-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS209881B2 true CS209881B2 (en) | 1981-12-31 |
Family
ID=27418223
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS772050A CS209881B2 (en) | 1976-03-29 | 1977-03-28 | Herbicide means |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS52118425A (de) |
| AR (1) | AR219067A1 (de) |
| AU (1) | AU502225B2 (de) |
| BR (1) | BR7701644A (de) |
| CA (1) | CA1082721A (de) |
| CH (1) | CH629652A5 (de) |
| CS (1) | CS209881B2 (de) |
| DD (1) | DD129610A5 (de) |
| DE (1) | DE2712760A1 (de) |
| DK (1) | DK137777A (de) |
| EG (1) | EG12513A (de) |
| ES (1) | ES457286A1 (de) |
| FR (1) | FR2346328A1 (de) |
| GB (1) | GB1537991A (de) |
| IL (1) | IL51750A (de) |
| NL (1) | NL7703325A (de) |
| NZ (1) | NZ183691A (de) |
| PH (1) | PH14094A (de) |
| PL (1) | PL104608B1 (de) |
| RO (1) | RO73259A (de) |
| SU (1) | SU638235A3 (de) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8007849B2 (en) | 2005-12-14 | 2011-08-30 | International Flavors & Fragrances Inc. | Unsaturated cyclic and acyclic carbamates exhibiting taste and flavor enhancement effect in flavor compositions |
| KR20230175175A (ko) * | 2020-11-30 | 2023-12-29 | 소프로시네 파마슈티칼스 리미티드 | 알코올 사용 장애(Alcohol Use Disorder)를 치료하기 위한 화합물 및 방법 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3804873A (en) * | 1971-03-18 | 1974-04-16 | Gulf Research Development Co | Process for manufacturing a liquid thiocarbamate |
| IT972188B (it) * | 1972-10-09 | 1974-05-20 | Montedison Spa | Composti carbamoil solfossidi |
| DE2341119A1 (de) * | 1972-08-14 | 1974-02-28 | Stauffer Chemical Co | Sulfoxid- und sulfonderivate von thiocarbamaten, verfahren zu ihrer herstellung und herbizide mittel, die diese verbindungen enthalten |
| PH10781A (en) * | 1973-03-29 | 1977-09-06 | Stauffer Chemical Co | Process of manufacturing sulphoxides |
-
1977
- 1977-02-28 AR AR266722A patent/AR219067A1/es active
- 1977-03-02 AU AU22856/77A patent/AU502225B2/en not_active Expired
- 1977-03-03 CA CA273,155A patent/CA1082721A/en not_active Expired
- 1977-03-07 GB GB9420/77A patent/GB1537991A/en not_active Expired
- 1977-03-17 RO RO7789688A patent/RO73259A/ro unknown
- 1977-03-17 BR BR7701644A patent/BR7701644A/pt unknown
- 1977-03-23 JP JP3121777A patent/JPS52118425A/ja active Pending
- 1977-03-23 DE DE19772712760 patent/DE2712760A1/de not_active Withdrawn
- 1977-03-24 NZ NZ183691A patent/NZ183691A/xx unknown
- 1977-03-24 CH CH378577A patent/CH629652A5/de not_active IP Right Cessation
- 1977-03-25 FR FR7708955A patent/FR2346328A1/fr not_active Withdrawn
- 1977-03-28 NL NL7703325A patent/NL7703325A/xx not_active Application Discontinuation
- 1977-03-28 IL IL51750A patent/IL51750A/xx unknown
- 1977-03-28 PH PH19595A patent/PH14094A/en unknown
- 1977-03-28 CS CS772050A patent/CS209881B2/cs unknown
- 1977-03-28 DD DD7700198100A patent/DD129610A5/de unknown
- 1977-03-29 PL PL1977197001A patent/PL104608B1/pl not_active IP Right Cessation
- 1977-03-29 SU SU772466802A patent/SU638235A3/ru active
- 1977-03-29 EG EG176/77A patent/EG12513A/xx active
- 1977-03-29 ES ES457286A patent/ES457286A1/es not_active Expired
- 1977-03-29 DK DK137777A patent/DK137777A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DK137777A (da) | 1977-09-30 |
| BR7701644A (pt) | 1978-01-03 |
| IL51750A0 (en) | 1977-05-31 |
| PL197001A1 (pl) | 1978-01-02 |
| IL51750A (en) | 1982-01-31 |
| GB1537991A (en) | 1979-01-10 |
| SU638235A3 (ru) | 1978-12-15 |
| DE2712760A1 (de) | 1977-10-20 |
| RO73259A (ro) | 1981-06-26 |
| NL7703325A (nl) | 1977-10-03 |
| DD129610A5 (de) | 1978-02-01 |
| CH629652A5 (en) | 1982-05-14 |
| AR219067A1 (es) | 1980-07-31 |
| JPS52118425A (en) | 1977-10-04 |
| CA1082721A (en) | 1980-07-29 |
| EG12513A (en) | 1979-06-30 |
| NZ183691A (en) | 1979-03-16 |
| PH14094A (en) | 1981-02-10 |
| ES457286A1 (es) | 1978-06-16 |
| PL104608B1 (pl) | 1979-08-31 |
| AU2285677A (en) | 1978-09-07 |
| FR2346328A1 (fr) | 1977-10-28 |
| AU502225B2 (en) | 1979-07-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4927824A (en) | Fungicidal trisubstituted 1,3,5-triazine-2,4,6-triones | |
| PL110213B1 (en) | Pesticide | |
| JPS6049638B2 (ja) | カ−バメイト系殺虫剤 | |
| CS233739B2 (en) | Fungicide agent and processing of effective component | |
| US3644422A (en) | 2-(substituted phenoxymethyl) dioxolanes | |
| CS212230B2 (en) | Fungicide means and method of making the active agent | |
| SK136493A3 (en) | Herbicides | |
| EP0011473B1 (de) | 2-Imino-substituierte-1,3-dithia und 1,3-oxathia heterocyclische Verbindungen als herbizide Schutzmittel | |
| US4317310A (en) | Substituted 2-imino-1,3-dithio and 1,3-oxathio heterocyclic compounds as herbicidal antidotes | |
| EP0990649A1 (de) | Benzoylpyrazolderivate mit bestimmten substituenten und herbizide | |
| EP0031686B1 (de) | Antidote, ihre Herstellung und ihre Verwendung zusammen mit Herbiziden | |
| US4605764A (en) | Substituted acetamide derivatives with an antidote action, antidote compositions containing such compounds, selective herbicide compositions containing these antidotes and a process for the preparation of substituted acetamide derivatives | |
| US3532488A (en) | N-cyclo-hexyldithiocarbamates as selective herbicides in rice | |
| US4443628A (en) | Antidotal compounds for use with herbicides | |
| US4112116A (en) | Certain cyclopropane thiolcarboxylates and use thereof as miticides | |
| EP0025345B1 (de) | N-Cyanalkyl-haloacetamide, deren Herstellung, deren Verwendung als Antidote für Herbizide und sie enthaltende Zusammensetzungen | |
| US4403444A (en) | Substituted 2-imino-1,3-dithio and 1,3-oxathio heterocyclic compounds as herbicidal antidotes | |
| GB2041353A (en) | Process for preparing triazolidine derivatives | |
| US3119735A (en) | Method for combatting plant-parasitic nematodes | |
| US4737522A (en) | N-sulphenylated benzenesulphonic acid amide fungicides | |
| US3206491A (en) | Compounds for combatting plantparasitic nematodes | |
| CA1082721A (en) | Herbicidally active thiocarbamates and sulfoxides | |
| JPH0150701B2 (de) | ||
| US4159902A (en) | 1,3,3-Trimethyl-6-azabicyclo-(3.2.1)-octane-6-carboxylic acid ester, herbicides, process for making same and composition containing same | |
| US4470843A (en) | Dihalopropyl ester herbicide antidotes |