CS209465B2 - Smaiíéřská frita k výrobě smaltů pro krycí vrstvy vnitřků pečicích trub - Google Patents
Smaiíéřská frita k výrobě smaltů pro krycí vrstvy vnitřků pečicích trub Download PDFInfo
- Publication number
- CS209465B2 CS209465B2 CS265471A CS265471A CS209465B2 CS 209465 B2 CS209465 B2 CS 209465B2 CS 265471 A CS265471 A CS 265471A CS 265471 A CS265471 A CS 265471A CS 209465 B2 CS209465 B2 CS 209465B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- frit
- enamel
- oxide
- enamels
- total weight
- Prior art date
Links
- 210000003298 dental enamel Anatomy 0.000 title claims description 62
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 33
- 230000003647 oxidation Effects 0.000 claims description 19
- 238000007254 oxidation reaction Methods 0.000 claims description 19
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 17
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 claims description 17
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 10
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 claims description 9
- CHWRSCGUEQEHOH-UHFFFAOYSA-N potassium oxide Chemical compound [O-2].[K+].[K+] CHWRSCGUEQEHOH-UHFFFAOYSA-N 0.000 claims description 8
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 claims description 7
- 239000000292 calcium oxide Substances 0.000 claims description 7
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 6
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 claims description 5
- 239000004408 titanium dioxide Substances 0.000 claims description 5
- 239000011787 zinc oxide Substances 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 239000000377 silicon dioxide Substances 0.000 claims description 4
- 239000005751 Copper oxide Substances 0.000 claims description 3
- 229910000431 copper oxide Inorganic materials 0.000 claims description 3
- FUJCRWPEOMXPAD-UHFFFAOYSA-N lithium oxide Chemical compound [Li+].[Li+].[O-2] FUJCRWPEOMXPAD-UHFFFAOYSA-N 0.000 claims description 3
- 235000015112 vegetable and seed oil Nutrition 0.000 claims description 3
- 239000008158 vegetable oil Substances 0.000 claims description 3
- 229910052810 boron oxide Inorganic materials 0.000 claims description 2
- 238000000576 coating method Methods 0.000 claims description 2
- 229910000428 cobalt oxide Inorganic materials 0.000 claims description 2
- IVMYJDGYRUAWML-UHFFFAOYSA-N cobalt(ii) oxide Chemical compound [Co]=O IVMYJDGYRUAWML-UHFFFAOYSA-N 0.000 claims description 2
- 229910001947 lithium oxide Inorganic materials 0.000 claims description 2
- 229910001950 potassium oxide Inorganic materials 0.000 claims description 2
- 229910001948 sodium oxide Inorganic materials 0.000 claims description 2
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 24
- 239000011521 glass Substances 0.000 description 14
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 10
- 239000004615 ingredient Substances 0.000 description 9
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 7
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- 239000000758 substrate Substances 0.000 description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 6
- 239000004327 boric acid Substances 0.000 description 6
- 230000001939 inductive effect Effects 0.000 description 6
- 235000012239 silicon dioxide Nutrition 0.000 description 6
- 229910021538 borax Inorganic materials 0.000 description 5
- 229910052681 coesite Inorganic materials 0.000 description 5
- 229910052906 cristobalite Inorganic materials 0.000 description 5
- 235000013305 food Nutrition 0.000 description 5
- 239000010453 quartz Substances 0.000 description 5
- 239000004317 sodium nitrate Substances 0.000 description 5
- 235000010344 sodium nitrate Nutrition 0.000 description 5
- 239000004328 sodium tetraborate Substances 0.000 description 5
- 235000010339 sodium tetraborate Nutrition 0.000 description 5
- 229910052682 stishovite Inorganic materials 0.000 description 5
- 229910052905 tridymite Inorganic materials 0.000 description 5
- 229920000388 Polyphosphate Polymers 0.000 description 4
- 238000004140 cleaning Methods 0.000 description 4
- 239000002320 enamel (paints) Substances 0.000 description 4
- 239000010794 food waste Substances 0.000 description 4
- 239000001205 polyphosphate Substances 0.000 description 4
- 235000011176 polyphosphates Nutrition 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical compound [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 4
- 238000005303 weighing Methods 0.000 description 4
- 241000416162 Astragalus gummifer Species 0.000 description 3
- 101100348017 Drosophila melanogaster Nazo gene Proteins 0.000 description 3
- 229910004298 SiO 2 Inorganic materials 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 229920001615 Tragacanth Polymers 0.000 description 3
- 239000000440 bentonite Substances 0.000 description 3
- 229910000278 bentonite Inorganic materials 0.000 description 3
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000010304 firing Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 3
- 229910052808 lithium carbonate Inorganic materials 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000002894 organic compounds Chemical class 0.000 description 3
- 239000011368 organic material Substances 0.000 description 3
- 230000001590 oxidative effect Effects 0.000 description 3
- 239000000196 tragacanth Substances 0.000 description 3
- 235000010487 tragacanth Nutrition 0.000 description 3
- 229940116362 tragacanth Drugs 0.000 description 3
- 229910018068 Li 2 O Inorganic materials 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000004880 explosion Methods 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 238000005201 scrubbing Methods 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 238000010186 staining Methods 0.000 description 2
- 239000000037 vitreous enamel Substances 0.000 description 2
- 229910010199 LiAl Inorganic materials 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000016257 Mentha pulegium Nutrition 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- 229910020489 SiO3 Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- 238000003915 air pollution Methods 0.000 description 1
- CNLWCVNCHLKFHK-UHFFFAOYSA-N aluminum;lithium;dioxido(oxo)silane Chemical compound [Li+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O CNLWCVNCHLKFHK-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- DZUDZSQDKOESQQ-UHFFFAOYSA-N cobalt hydrogen peroxide Chemical compound [Co].OO DZUDZSQDKOESQQ-UHFFFAOYSA-N 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- XUCJHNOBJLKZNU-UHFFFAOYSA-M dilithium;hydroxide Chemical compound [Li+].[Li+].[OH-] XUCJHNOBJLKZNU-UHFFFAOYSA-M 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000010433 feldspar Substances 0.000 description 1
- 238000007496 glass forming Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000007970 homogeneous dispersion Substances 0.000 description 1
- 235000001050 hortel pimenta Nutrition 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000007788 roughening Methods 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Landscapes
- Glass Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US4397170A | 1970-06-05 | 1970-06-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS209465B2 true CS209465B2 (cs) | 1981-12-31 |
Family
ID=21929864
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS265471A CS209465B2 (cs) | 1970-06-05 | 1971-04-14 | Smaiíéřská frita k výrobě smaltů pro krycí vrstvy vnitřků pečicích trub |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS5116451B1 (OSRAM) |
| BR (1) | BR7103440D0 (OSRAM) |
| CS (1) | CS209465B2 (OSRAM) |
| ES (1) | ES392060A1 (OSRAM) |
| FI (1) | FI52705C (OSRAM) |
| IL (1) | IL36483A (OSRAM) |
| NO (1) | NO130579C (OSRAM) |
| PL (1) | PL83151B1 (OSRAM) |
| RO (1) | RO61616A (OSRAM) |
| YU (1) | YU34384B (OSRAM) |
| ZA (1) | ZA712024B (OSRAM) |
-
1971
- 1971-03-23 IL IL36483A patent/IL36483A/xx unknown
- 1971-03-24 PL PL14711571A patent/PL83151B1/pl unknown
- 1971-03-25 NO NO113871A patent/NO130579C/no unknown
- 1971-03-29 YU YU76971A patent/YU34384B/xx unknown
- 1971-03-29 ZA ZA712024A patent/ZA712024B/xx unknown
- 1971-04-01 FI FI92571A patent/FI52705C/fi active
- 1971-04-14 CS CS265471A patent/CS209465B2/cs unknown
- 1971-05-27 ES ES392060A patent/ES392060A1/es not_active Expired
- 1971-06-02 JP JP46038547A patent/JPS5116451B1/ja active Pending
- 1971-06-03 BR BR344071A patent/BR7103440D0/pt unknown
- 1971-06-04 RO RO6718071A patent/RO61616A/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL36483A (en) | 1975-10-15 |
| FI52705C (fi) | 1977-11-10 |
| BR7103440D0 (pt) | 1973-03-13 |
| PL83151B1 (OSRAM) | 1975-12-31 |
| NO130579B (OSRAM) | 1974-09-30 |
| YU76971A (en) | 1978-12-31 |
| RO61616A (OSRAM) | 1976-12-15 |
| ES392060A1 (es) | 1974-08-01 |
| FI52705B (OSRAM) | 1977-08-01 |
| YU34384B (en) | 1979-07-10 |
| JPS5116451B1 (OSRAM) | 1976-05-24 |
| NO130579C (OSRAM) | 1975-01-08 |
| ZA712024B (en) | 1972-11-29 |
| IL36483A0 (en) | 1971-05-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR960015146B1 (ko) | 무연(lead-free) 유리 프릿 조성물 | |
| KR101476500B1 (ko) | 법랑 조성물, 그 제조방법 및 조리기기 | |
| KR101437219B1 (ko) | 법랑 조성물, 그 제조방법 및 조리기기 | |
| EP2662340B1 (en) | Enamel composition and cooking appliance including the same | |
| KR102118456B1 (ko) | 법랑 조성물, 그 제조방법 및 조리기기 | |
| KR101476501B1 (ko) | 법랑 조성물, 그 제조방법 및 조리기기 | |
| KR101411034B1 (ko) | 법랑용 조성물 및 그 법랑 조성물이 적용된 조리기기 | |
| EP0452065B1 (en) | Glaze compositions | |
| KR20180089988A (ko) | 유리 조성물, 이의 제조방법 및 조리기기 | |
| PL80012B1 (OSRAM) | ||
| EP0049041A1 (en) | Porcelain enamel frit | |
| KR20140115562A (ko) | 법랑 조성물, 그 제조방법 및 조리기기 | |
| EP1167310A1 (en) | Enamel composition | |
| JPS6351985B2 (OSRAM) | ||
| WO1999012857A1 (en) | Reflective porcelain enamel coating composition | |
| US3671278A (en) | Iron-containing titania-opacified porcelain enamels | |
| WO1999005070A1 (en) | Lead-free glaze for ceramic articles | |
| JPS61281042A (ja) | 鉛およびカドミウムを含有しない低温フリツト | |
| KR102292631B1 (ko) | 법랑 조성물, 그 제조방법 및 조리기기 | |
| KR102692264B1 (ko) | 열반사 기능을 갖는 코팅 조성물, 코팅 유리 및 그 제조방법, 이를 이용한 조리기기 | |
| US3216847A (en) | Frit compositions for vitreous enamels | |
| US2347187A (en) | Enameling | |
| JPH04325440A (ja) | 無毒性ガラスフリット、及びガラス、ガラスセラミック及びセラミックからなる製品の釉掛け及び装飾方法 | |
| JPH028976B2 (OSRAM) | ||
| US3598650A (en) | Method of removing organic soils in contact with a vitreous composition coated on a metallic substrate |