CS181244B2 - Method of producing salts of acid cephalosporine with basic aminoacids,selected from group contaning arginine and lysine - Google Patents
Method of producing salts of acid cephalosporine with basic aminoacids,selected from group contaning arginine and lysineInfo
- Publication number
- CS181244B2 CS181244B2 CS7300004631A CS463173A CS181244B2 CS 181244 B2 CS181244 B2 CS 181244B2 CS 7300004631 A CS7300004631 A CS 7300004631A CS 463173 A CS463173 A CS 463173A CS 181244 B2 CS181244 B2 CS 181244B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- cephalosporine
- arginine
- lysine
- acid
- basic aminoacids
- Prior art date
Links
- HOKIDJSKDBPKTQ-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(NC(=O)CCCC(N)C(O)=O)C12 HOKIDJSKDBPKTQ-UHFFFAOYSA-N 0.000 title 1
- 239000004475 Arginine Substances 0.000 title 1
- 239000004472 Lysine Substances 0.000 title 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 235000001014 amino acid Nutrition 0.000 title 1
- 150000001413 amino acids Chemical class 0.000 title 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP47066076A JPS4925118A (cg-RX-API-DMAC7.html) | 1972-06-30 | 1972-06-30 | |
| JP1263173A JPS557434B2 (cg-RX-API-DMAC7.html) | 1973-01-30 | 1973-01-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS181244B2 true CS181244B2 (en) | 1978-03-31 |
Family
ID=26348263
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS7300004631A CS181244B2 (en) | 1972-06-30 | 1973-06-27 | Method of producing salts of acid cephalosporine with basic aminoacids,selected from group contaning arginine and lysine |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3984403A (cg-RX-API-DMAC7.html) |
| AT (1) | AT325205B (cg-RX-API-DMAC7.html) |
| AU (1) | AU472943B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1021321A (cg-RX-API-DMAC7.html) |
| CH (1) | CH592676A5 (cg-RX-API-DMAC7.html) |
| CS (1) | CS181244B2 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2332878C2 (cg-RX-API-DMAC7.html) |
| FI (1) | FI57109C (cg-RX-API-DMAC7.html) |
| FR (1) | FR2190422B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1418149A (cg-RX-API-DMAC7.html) |
| HU (1) | HU166161B (cg-RX-API-DMAC7.html) |
| NL (1) | NL7309126A (cg-RX-API-DMAC7.html) |
| PL (1) | PL91583B1 (cg-RX-API-DMAC7.html) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES412429A1 (es) * | 1973-03-08 | 1976-01-01 | Gallardo Antonio Sa | Un procedimiento para la obtencion de sales de antibioticoscon aminoacidos de naturaleza basica. |
| FR2308368A1 (fr) * | 1975-04-21 | 1976-11-19 | Gallardo Antonio Sa | Sel soluble de la cephalexine comme antibiotique injectable |
| CA1093997A (en) * | 1975-12-25 | 1981-01-20 | Shunichi Watanabe | Process of producing 7-methoxy cephalosporins |
| GB1575905A (en) * | 1976-04-28 | 1980-10-01 | Glaxo Lab Ltd | Salt of cefuroxime |
| US4165429A (en) * | 1976-06-28 | 1979-08-21 | Yamanouchi Pharmaceutical Co., Ltd. | 7α-METHOXY-CEPHALOSPORANIC ACID DERIVATIVES |
| FR2371923A1 (fr) * | 1976-11-30 | 1978-06-23 | Viridis Ets | Sels de lysine et d'arginine de l'acide 7-((cyanomethylthio)-acetamido)-3-(2-(5-methyl-1, 3, 4-thiadiazolyl)-thiomethyl)-d3-cepheme-4-carboxylique et procede pour leur preparation |
| GB1579533A (en) * | 1977-03-26 | 1980-11-19 | Farmaceutici Italia | Cephalosporins and their preparation |
| US4235900A (en) * | 1978-11-15 | 1980-11-25 | E. R. Squibb & Sons, Inc. | Cephradine compositions |
| SE458505B (sv) * | 1979-07-10 | 1989-04-10 | Lepetit Spa | Anvaendningen av rifamycin sv och salter daerav foer framstaellning av en beredning foer behandling av reumatoid artrit samt vissa av salterna och deras framstaellning |
| ES8101078A1 (es) * | 1980-02-05 | 1980-12-16 | Liofilizaciones Esterilizacion | Procedimiento para la obtencion de una sal soluble en agua de cefadroxilo |
| US4354023A (en) * | 1980-04-01 | 1982-10-12 | Dobfar S.P.A. | Cefadroxil acetylcysteinate salt |
| US4448958A (en) * | 1982-10-20 | 1984-05-15 | Bristol-Myers Company | Purification of ceforanide |
| US5244891A (en) * | 1985-08-05 | 1993-09-14 | Bristol-Myers Squibb Company | Injectable compositions of cefepime dihydrochloride hydrate |
| US4994451A (en) * | 1988-01-19 | 1991-02-19 | Bristol-Myers Company | Cephalosporin salts and injectable compositions |
| JPH0840907A (ja) | 1994-08-03 | 1996-02-13 | Meiji Seika Kaisha Ltd | セファロスポリン注射剤 |
| US7247642B2 (en) | 1999-05-07 | 2007-07-24 | Wockhardt Limited | Antibacterial optically pure benzoquinolizine carboxylic acids, processes, compositions and methods of treatment |
| US6514986B2 (en) | 2000-11-22 | 2003-02-04 | Wockhardt Limited | Chiral fluoroquinolone arginine salt forms |
| US6608078B2 (en) | 2000-05-08 | 2003-08-19 | Wockhardt Limited | Antibacterial chiral 8-(substituted piperidino)-benzo [i,j] quinolizines, processes, compositions and methods of treatment |
| US7098219B2 (en) | 2000-08-01 | 2006-08-29 | Wockhart Limited | Inhibitors of cellular efflux pumps of microbes |
| US7138419B2 (en) † | 2000-12-27 | 2006-11-21 | Corus Pharma, Inc. | Process for manufacturing bulk solutions and a lyophilized pure α-aztreonam lysinate |
| US6878713B2 (en) | 2001-04-25 | 2005-04-12 | Wockhardt Limited | Generation triple-targeting, chiral, broad-spectrum antimicrobial 7-substituted piperidino-quinolone carboxylic acid derivatives, their preparation, compositions and use as medicaments |
| US6964966B2 (en) | 2001-04-25 | 2005-11-15 | Wockhardt Limited | Generation triple-targeting, chiral, broad-spectrum antimicrobial 7-substituted piperidino-quinolone carboxylic acid derivatives, their preparation, compositions and use as medicaments |
| US20030171424A1 (en) * | 2002-03-07 | 2003-09-11 | Lin Ai J. | Intravenous formulation of artelinic acid for treatment of severe and complicated malaria |
| US6664267B1 (en) * | 2002-05-28 | 2003-12-16 | Wockhardt Limited | Crystalline fluoroquinolone arginine salt form |
| PL214849B1 (pl) | 2003-09-04 | 2013-09-30 | Wockhardt Ltd | Tetrahydrat soli kwasu benzochinolizyno-2-karboksylowego z arginina, sposób jego wytwarzania, kompozycja zawierajaca przedmiotowy tetrahydrat soli oraz jego zastosowanie |
| WO2005094800A2 (en) * | 2004-03-31 | 2005-10-13 | Lupin Ltd. | A co-precipitated cefepime composition and process for preparation thereof |
| CN101830914B (zh) * | 2010-06-04 | 2012-03-21 | 深圳九福药业科技有限公司 | 头孢呋辛赖氨酸结晶化合物及其制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1052068A (cg-RX-API-DMAC7.html) * | 1963-11-04 | |||
| US3488730A (en) * | 1966-09-08 | 1970-01-06 | Lilly Co Eli | Salts of cephalosporin antibiotics |
| CH469021A (fr) * | 1967-05-05 | 1969-02-28 | Alpharm S A | Procédé de préparation de sels organiques de pénicillines sémisynthétiques |
| CA939265A (en) * | 1967-11-18 | 1974-01-01 | Yoshitaka Ikezuki | Injectable compositions for alleviating the pain incurred from administrations of injections |
| GB1316964A (en) * | 1969-07-24 | 1973-05-16 | Glaxo Lab Ltd | Antibiotics |
| US3676434A (en) * | 1970-07-29 | 1972-07-11 | Lilly Co Eli | Cephalosporin salts |
-
1973
- 1973-06-19 US US05/371,531 patent/US3984403A/en not_active Expired - Lifetime
- 1973-06-27 CS CS7300004631A patent/CS181244B2/cs unknown
- 1973-06-28 FR FR7323738A patent/FR2190422B1/fr not_active Expired
- 1973-06-28 DE DE2332878A patent/DE2332878C2/de not_active Expired
- 1973-06-28 CA CA175,139A patent/CA1021321A/en not_active Expired
- 1973-06-28 HU HUTA1262A patent/HU166161B/hu unknown
- 1973-06-29 NL NL7309126A patent/NL7309126A/xx not_active Application Discontinuation
- 1973-06-29 CH CH955773A patent/CH592676A5/xx not_active IP Right Cessation
- 1973-06-29 GB GB3096973A patent/GB1418149A/en not_active Expired
- 1973-06-29 FI FI2096/73A patent/FI57109C/fi active
- 1973-06-29 AT AT576373A patent/AT325205B/de not_active IP Right Cessation
- 1973-06-30 PL PL1973163733A patent/PL91583B1/pl unknown
- 1973-07-02 AU AU57599/73A patent/AU472943B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| HU166161B (cg-RX-API-DMAC7.html) | 1975-01-28 |
| FI57109B (fi) | 1980-02-29 |
| PL91583B1 (en) | 1977-03-31 |
| FI57109C (fi) | 1981-06-22 |
| CH592676A5 (cg-RX-API-DMAC7.html) | 1977-10-31 |
| AT325205B (de) | 1975-10-10 |
| AU5759973A (en) | 1975-01-09 |
| CA1021321A (en) | 1977-11-22 |
| DE2332878A1 (de) | 1974-01-17 |
| US3984403A (en) | 1976-10-05 |
| FR2190422A1 (cg-RX-API-DMAC7.html) | 1974-02-01 |
| DE2332878C2 (de) | 1983-07-28 |
| FR2190422B1 (cg-RX-API-DMAC7.html) | 1977-02-25 |
| NL7309126A (cg-RX-API-DMAC7.html) | 1974-01-02 |
| AU472943B2 (en) | 1976-06-10 |
| GB1418149A (en) | 1975-12-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS181244B2 (en) | Method of producing salts of acid cephalosporine with basic aminoacids,selected from group contaning arginine and lysine | |
| CS194234B2 (en) | Method of production of the bis-/dihydrixypropylamides/ of the acid 5-hydroxypropionylamino-2,4,6-troiodisophtale | |
| IL40521A (en) | 1-heterocyclyl-3-indolealkanoic acid derivatives | |
| ZM12074A1 (en) | Prostanoic acid derivatives | |
| CS189671B2 (en) | Method of producin 3-phenyl-1,2-benzisoxazolylcarboxylic acid | |
| IL42223A0 (en) | Prostanoic acid derivatives | |
| IL39376A0 (en) | Prostanoic acid derivatives | |
| ZA737357B (en) | Prostanoic acid derivatives | |
| GB1406621A (en) | Derivatives of prostanoic acid | |
| AU4847172A (en) | Cycloalkylaminoarylcarboxylic acid derivatives | |
| AU7658674A (en) | New prostanoic acid derivatives and process for their manufacture | |
| JPS53111073A (en) | Method of producing pyridinecarboxylyc acid | |
| ZA742734B (en) | Derivatives of 1,3-benzodioxole-2-carboxylic acid | |
| IE37237L (en) | Pyrroleacetic acid derivatives | |
| PH9332A (en) | 2-chloroethanephosphonic acid derivatives | |
| PH11766A (en) | Preparation of 3,6-dichloropucolinic acid | |
| AU6566674A (en) | Beta-pyridyl-carbonamido-alkane-sulfonic acid salts | |
| IL44622A0 (en) | Crystallization of monosodium citrate | |
| GB1405794A (en) | Alpha-thioacetic acid derivatives | |
| CS184765B2 (en) | Method of producing itaconic acid | |
| CS193013B2 (en) | Method of producing 6-beta-amino-2,2-dimethylpenam-3-alpha-carboxylic acid | |
| CS180022B2 (en) | Method of preparing naphtalene-1,4,5,8-tetracarboxylic acid | |
| CS187364B2 (en) | Method of preparing derivatives of 3-carbamoyloxymethyl-7-/2-thienylacetamido/-7-methoxy-3-cephem-4-carboxylic acid | |
| YU35105B (en) | Process for preparing acetylamine derivatives of 2,4,6-triiodo-benzoic acid | |
| GB1406993A (en) | Amino acid derivatives |