CH651314A5 - Composition detergente pour lave-vaisselle. - Google Patents
Composition detergente pour lave-vaisselle. Download PDFInfo
- Publication number
- CH651314A5 CH651314A5 CH8234/81A CH823481A CH651314A5 CH 651314 A5 CH651314 A5 CH 651314A5 CH 8234/81 A CH8234/81 A CH 8234/81A CH 823481 A CH823481 A CH 823481A CH 651314 A5 CH651314 A5 CH 651314A5
- Authority
- CH
- Switzerland
- Prior art keywords
- composition
- composition according
- detergent
- enzymes
- good
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 50
- 239000003599 detergent Substances 0.000 title claims description 33
- 102000004190 Enzymes Human genes 0.000 claims description 28
- 108090000790 Enzymes Proteins 0.000 claims description 28
- 229940088598 enzyme Drugs 0.000 claims description 28
- 230000003625 amylolytic effect Effects 0.000 claims description 16
- 230000000694 effects Effects 0.000 claims description 14
- 229920000388 Polyphosphate Polymers 0.000 claims description 11
- 239000001205 polyphosphate Substances 0.000 claims description 11
- 235000011176 polyphosphates Nutrition 0.000 claims description 11
- 108091005804 Peptidases Proteins 0.000 claims description 8
- 239000002736 nonionic surfactant Substances 0.000 claims description 7
- 239000007800 oxidant agent Substances 0.000 claims description 6
- 230000001590 oxidative effect Effects 0.000 claims description 6
- 150000004760 silicates Chemical class 0.000 claims description 6
- 102000035195 Peptidases Human genes 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 5
- 229910052910 alkali metal silicate Inorganic materials 0.000 claims description 5
- 239000004365 Protease Substances 0.000 claims description 4
- 239000002671 adjuvant Substances 0.000 claims description 4
- 108090000637 alpha-Amylases Proteins 0.000 claims description 4
- 102000004139 alpha-Amylases Human genes 0.000 claims description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 4
- 239000011707 mineral Substances 0.000 claims description 4
- 150000002978 peroxides Chemical class 0.000 claims description 4
- 229960001922 sodium perborate Drugs 0.000 claims description 4
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical group [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 claims description 4
- 239000004382 Amylase Substances 0.000 claims description 3
- 108010065511 Amylases Proteins 0.000 claims description 3
- 102000013142 Amylases Human genes 0.000 claims description 3
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 claims description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 3
- 235000019418 amylase Nutrition 0.000 claims description 3
- 150000001451 organic peroxides Chemical class 0.000 claims description 3
- 229910052681 coesite Inorganic materials 0.000 claims description 2
- 229910052906 cristobalite Inorganic materials 0.000 claims description 2
- 229910052682 stishovite Inorganic materials 0.000 claims description 2
- 229910052905 tridymite Inorganic materials 0.000 claims description 2
- 239000000377 silicon dioxide Substances 0.000 claims 1
- 235000012239 silicon dioxide Nutrition 0.000 claims 1
- 238000005406 washing Methods 0.000 description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 9
- 239000000460 chlorine Substances 0.000 description 9
- 229910052801 chlorine Inorganic materials 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- 239000000843 powder Substances 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 7
- 239000011521 glass Substances 0.000 description 7
- 239000004094 surface-active agent Substances 0.000 description 7
- 239000004615 ingredient Substances 0.000 description 6
- 235000018102 proteins Nutrition 0.000 description 6
- 102000004169 proteins and genes Human genes 0.000 description 6
- 108090000623 proteins and genes Proteins 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 108010075550 termamyl Proteins 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- -1 Peroxide compounds Chemical class 0.000 description 4
- 229920002472 Starch Polymers 0.000 description 4
- 244000269722 Thea sinensis Species 0.000 description 4
- 238000004140 cleaning Methods 0.000 description 4
- 238000004090 dissolution Methods 0.000 description 4
- 235000013305 food Nutrition 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000008107 starch Substances 0.000 description 4
- 235000019698 starch Nutrition 0.000 description 4
- 102000011632 Caseins Human genes 0.000 description 3
- 108010076119 Caseins Proteins 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 229940024171 alpha-amylase Drugs 0.000 description 3
- 229940025131 amylases Drugs 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 238000004851 dishwashing Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 239000010794 food waste Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000002304 perfume Substances 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 3
- 235000019832 sodium triphosphate Nutrition 0.000 description 3
- 239000001648 tannin Substances 0.000 description 3
- 229920001864 tannin Polymers 0.000 description 3
- 235000018553 tannin Nutrition 0.000 description 3
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000005018 casein Substances 0.000 description 2
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 2
- 235000021240 caseins Nutrition 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 108010003855 mesentericopeptidase Proteins 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 235000013336 milk Nutrition 0.000 description 2
- 239000008267 milk Substances 0.000 description 2
- 210000004080 milk Anatomy 0.000 description 2
- 239000003352 sequestering agent Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000005494 tarnishing Methods 0.000 description 2
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 108010082495 Dietary Plant Proteins Proteins 0.000 description 1
- 102000002322 Egg Proteins Human genes 0.000 description 1
- 108010000912 Egg Proteins Proteins 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 101000620359 Homo sapiens Melanocyte protein PMEL Proteins 0.000 description 1
- 102100022430 Melanocyte protein PMEL Human genes 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 229920002257 Plurafac® Polymers 0.000 description 1
- 229920002266 Pluriol® Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 244000300264 Spinacia oleracea Species 0.000 description 1
- 235000009337 Spinacia oleracea Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000003254 anti-foaming effect Effects 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 235000013351 cheese Nutrition 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000012790 confirmation Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 235000021185 dessert Nutrition 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 235000013345 egg yolk Nutrition 0.000 description 1
- 210000002969 egg yolk Anatomy 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical class II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000000691 measurement method Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000002366 mineral element Substances 0.000 description 1
- 150000004712 monophosphates Chemical class 0.000 description 1
- 210000003739 neck Anatomy 0.000 description 1
- 229910052605 nesosilicate Inorganic materials 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 150000002482 oligosaccharides Polymers 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000004762 orthosilicates Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000006174 pH buffer Substances 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical group [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 229920000867 polyelectrolyte Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229940080237 sodium caseinate Drugs 0.000 description 1
- 235000019795 sodium metasilicate Nutrition 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 235000014347 soups Nutrition 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38609—Protease or amylase in solid compositions only
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Priority Applications (20)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH8234/81A CH651314A5 (fr) | 1981-12-23 | 1981-12-23 | Composition detergente pour lave-vaisselle. |
| DE19823246389 DE3246389A1 (de) | 1981-12-23 | 1982-12-15 | Geschirr-reinigungsmittel |
| MX195717A MX158780A (es) | 1981-12-23 | 1982-12-17 | Mejoras a composicion detergente para lavar trastos |
| GR70110A GR78432B (enExample) | 1981-12-23 | 1982-12-20 | |
| FR8221338A FR2518567B1 (fr) | 1981-12-23 | 1982-12-20 | Composition detergente pour le lavage de la vaisselle |
| ZA829341A ZA829341B (en) | 1981-12-23 | 1982-12-20 | Detergent dish-washing composition |
| US06/451,527 US4501681A (en) | 1981-12-23 | 1982-12-20 | Detergent dish-washing composition |
| AT0462082A AT388927B (de) | 1981-12-23 | 1982-12-21 | Geschirr-reinigungsmittel |
| SE8207286A SE500347C2 (sv) | 1981-12-23 | 1982-12-21 | Maskindiskmedelkomposition innehållande ett amylolytiskt enzym |
| IE3060/82A IE53681B1 (en) | 1981-12-23 | 1982-12-22 | Detergent dish-washing composition |
| NO824329A NO155295C (no) | 1981-12-23 | 1982-12-22 | Oppvaskmiddel. |
| NZ202897A NZ202897A (en) | 1981-12-23 | 1982-12-22 | Detergent dishwashing composition |
| CA000418313A CA1192512A (en) | 1981-12-23 | 1982-12-22 | Detergent dish-washing composition |
| AU91766/82A AU554642B2 (en) | 1981-12-23 | 1982-12-22 | Dishwashing composition comprising an amylolytic enzyme and a peroxide |
| PT76025A PT76025B (en) | 1981-12-23 | 1982-12-22 | Process for preparing a detergent dish-washing composition con taining polyphosphates and alcalin silicates |
| GB08236470A GB2116198B (en) | 1981-12-23 | 1982-12-22 | Detergent dish-washing composition |
| DK572882A DK159067C (da) | 1981-12-23 | 1982-12-23 | Opvaskemiddel |
| JP57235020A JPS58141299A (ja) | 1981-12-23 | 1982-12-23 | 皿洗い用洗剤組成物 |
| BE0/209795A BE895459A (fr) | 1981-12-23 | 1982-12-23 | Composition detergente pour le lavage de la vaisselle |
| NL8204971A NL8204971A (nl) | 1981-12-23 | 1982-12-23 | Reinigend afwasmengsel. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH8234/81A CH651314A5 (fr) | 1981-12-23 | 1981-12-23 | Composition detergente pour lave-vaisselle. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH651314A5 true CH651314A5 (fr) | 1985-09-13 |
Family
ID=4337208
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH8234/81A CH651314A5 (fr) | 1981-12-23 | 1981-12-23 | Composition detergente pour lave-vaisselle. |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4501681A (enExample) |
| JP (1) | JPS58141299A (enExample) |
| AT (1) | AT388927B (enExample) |
| AU (1) | AU554642B2 (enExample) |
| BE (1) | BE895459A (enExample) |
| CA (1) | CA1192512A (enExample) |
| CH (1) | CH651314A5 (enExample) |
| DE (1) | DE3246389A1 (enExample) |
| DK (1) | DK159067C (enExample) |
| FR (1) | FR2518567B1 (enExample) |
| GB (1) | GB2116198B (enExample) |
| GR (1) | GR78432B (enExample) |
| IE (1) | IE53681B1 (enExample) |
| MX (1) | MX158780A (enExample) |
| NL (1) | NL8204971A (enExample) |
| NO (1) | NO155295C (enExample) |
| NZ (1) | NZ202897A (enExample) |
| PT (1) | PT76025B (enExample) |
| SE (1) | SE500347C2 (enExample) |
| ZA (1) | ZA829341B (enExample) |
Families Citing this family (64)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8321924D0 (en) * | 1983-08-15 | 1983-09-14 | Unilever Plc | Enzymatic machine-dishwashing compositions |
| GB8321923D0 (en) * | 1983-08-15 | 1983-09-14 | Unilever Plc | Machine-dishwashing compositions |
| GB8328075D0 (en) * | 1983-10-20 | 1983-11-23 | Unilever Plc | Dishwashing compositions |
| DE3428848A1 (de) * | 1984-08-04 | 1986-02-13 | Henkel KGaA, 4000 Düsseldorf | Geschirreinigungsmittel |
| DE3428834A1 (de) * | 1984-08-04 | 1986-02-13 | Henkel KGaA, 4000 Düsseldorf | Geschirreinigungsmittel |
| DE3428833A1 (de) * | 1984-08-04 | 1986-02-13 | Henkel KGaA, 4000 Düsseldorf | Geschirreinigungsmittel |
| IN165978B (enExample) * | 1985-08-20 | 1990-02-17 | Colgate Palmolive Co | |
| US5093021A (en) * | 1985-08-21 | 1992-03-03 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| US5167854A (en) * | 1985-08-21 | 1992-12-01 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| US5254287A (en) * | 1985-08-21 | 1993-10-19 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| DE3683882D1 (de) * | 1985-08-21 | 1992-03-26 | Clorox Co | Stabiles persaeurebleichmittel. |
| US4863626A (en) * | 1985-08-21 | 1989-09-05 | The Clorox Company | Encapsulated enzyme in dry bleach composition |
| US5211874A (en) * | 1985-08-21 | 1993-05-18 | The Clorox Company | Stable peracid and enzyme bleaching composition |
| CA1334389C (en) * | 1986-03-26 | 1995-02-14 | Ernest H. Brumbaugh | Machine dishwasher water spot control composition |
| GB8813688D0 (en) * | 1988-06-09 | 1988-07-13 | Unilever Plc | Enzymatic dishwashing composition |
| DE4110764A1 (de) * | 1991-04-03 | 1992-10-08 | Weigert Chem Fab | Verfahren zum entfernen von staerkehaltigen verunreinigungen von geschirr und hierfuer geeignete tensidkonzentrate |
| US5318715A (en) * | 1991-05-31 | 1994-06-07 | Colgate-Palmolive Company | Liquid automatic dishwashing composition containing two enzymes |
| US5173207A (en) * | 1991-05-31 | 1992-12-22 | Colgate-Palmolive Company | Powered automatic dishwashing composition containing enzymes |
| US5169553A (en) * | 1991-05-31 | 1992-12-08 | Colgate Palmolive Company | Nonaqueous liquid, phosphate-free, improved automatic dishwashing composition containing enzymes |
| US5240633A (en) * | 1991-05-31 | 1993-08-31 | Colgate-Palmolive Company | Liquid automatic dishwashing composition containing enzymes |
| US5423997A (en) * | 1991-05-31 | 1995-06-13 | Colgate Palmolive Co. | Spray dried powdered automatic dishwashing composition containing enzymes |
| US5200189A (en) * | 1991-07-23 | 1993-04-06 | Ecolab Inc. | Peroxyacid antimicrobial composition |
| US5437868A (en) * | 1991-07-23 | 1995-08-01 | Ecolab Inc. | Peroxyacid antimicrobial composition |
| US5378242A (en) * | 1992-12-22 | 1995-01-03 | Apollo Chemical Company | Liquid alkali for soaping off reactive dyes |
| TW255887B (en) * | 1994-05-25 | 1995-09-01 | Lilly Co Eli | Synthesis of benzoquinolinones |
| US5968881A (en) * | 1995-02-02 | 1999-10-19 | The Procter & Gamble Company | Phosphate built automatic dishwashing compositions comprising catalysts |
| US6034048A (en) * | 1995-03-01 | 2000-03-07 | Charvid Limited Liability Co. | Non-caustic cleaning composition using an alkali salt |
| US5703034A (en) * | 1995-10-30 | 1997-12-30 | The Procter & Gamble Company | Bleach catalyst particles |
| US5929008A (en) * | 1997-09-29 | 1999-07-27 | The Procter & Gamble Company | Liquid automatic dishwashing compositions providing high pH wash solutions |
| US6010729A (en) | 1998-08-20 | 2000-01-04 | Ecolab Inc. | Treatment of animal carcasses |
| JP3564067B2 (ja) * | 1998-08-21 | 2004-09-08 | 千寿製薬株式会社 | コンタクトレンズ用剤 |
| US6326032B1 (en) | 1998-11-18 | 2001-12-04 | Ecolab Inc. | Beverage manufacture and cold aseptic bottling using peroxyacid antimicrobial composition |
| US6484734B1 (en) | 1999-07-14 | 2002-11-26 | Ecolab Inc. | Multi-step post detergent treatment method |
| GB0001021D0 (en) * | 2000-01-14 | 2000-03-08 | Dow Corning Sa | Foam control agents |
| ATE306812T1 (de) * | 2000-04-28 | 2005-11-15 | Ecolab Inc | Antimikrobielle zusammensetzung |
| US7150884B1 (en) | 2000-07-12 | 2006-12-19 | Ecolab Inc. | Composition for inhibition of microbial growth |
| DE50107849D1 (de) * | 2000-07-28 | 2005-12-01 | Henkel Kgaa | Neues amylolytisches enzym aus bacillus sp. a 7-7 (dsm 12368) sowie wasch- und reinigungsmittel mit diesem neuen amylolytischen enzym |
| US6479454B1 (en) | 2000-10-05 | 2002-11-12 | Ecolab Inc. | Antimicrobial compositions and methods containing hydrogen peroxide and octyl amine oxide |
| US7316824B2 (en) * | 2000-12-15 | 2008-01-08 | Ecolab Inc. | Method and composition for washing poultry during processing |
| US6514556B2 (en) * | 2000-12-15 | 2003-02-04 | Ecolab Inc. | Method and composition for washing poultry during processing |
| US6964787B2 (en) * | 2001-02-01 | 2005-11-15 | Ecolab Inc. | Method and system for reducing microbial burden on a food product |
| WO2002077170A2 (en) * | 2001-03-22 | 2002-10-03 | Pioneer Hi-Bred International, Inc. | Expansin protein and polynucleotides and methods of use |
| US6635286B2 (en) * | 2001-06-29 | 2003-10-21 | Ecolab Inc. | Peroxy acid treatment to control pathogenic organisms on growing plants |
| US6627593B2 (en) | 2001-07-13 | 2003-09-30 | Ecolab Inc. | High concentration monoester peroxy dicarboxylic acid compositions, use solutions, and methods employing them |
| US7060301B2 (en) | 2001-07-13 | 2006-06-13 | Ecolab Inc. | In situ mono-or diester dicarboxylate compositions |
| US8092613B2 (en) * | 2002-05-31 | 2012-01-10 | Ecolab Usa Inc. | Methods and compositions for the removal of starch |
| US7622606B2 (en) * | 2003-01-17 | 2009-11-24 | Ecolab Inc. | Peroxycarboxylic acid compositions with reduced odor |
| US7135448B2 (en) * | 2003-07-02 | 2006-11-14 | Ecolab Inc. | Warewashing composition for use in automatic dishwashing machines, comprising a mixture of aluminum and zinc ions |
| US7196044B2 (en) | 2003-07-02 | 2007-03-27 | Ecolab, Inc. | Warewashing composition for use in automatic dishwashing machines, comprising a zinc ion and aluminum ion corrosion inhibitor |
| US7887641B2 (en) * | 2004-01-09 | 2011-02-15 | Ecolab Usa Inc. | Neutral or alkaline medium chain peroxycarboxylic acid compositions and methods employing them |
| US7507429B2 (en) * | 2004-01-09 | 2009-03-24 | Ecolab Inc. | Methods for washing carcasses, meat, or meat products with medium chain peroxycarboxylic acid compositions |
| US8999175B2 (en) * | 2004-01-09 | 2015-04-07 | Ecolab Usa Inc. | Methods for washing and processing fruits, vegetables, and other produce with medium chain peroxycarboxylic acid compositions |
| US7504123B2 (en) | 2004-01-09 | 2009-03-17 | Ecolab Inc. | Methods for washing poultry during processing with medium chain peroxycarboxylic acid compositions |
| EP1703791B1 (en) * | 2004-01-09 | 2014-07-23 | Ecolab Inc. | Medium chain peroxycarboxylic acid compositions |
| US20050161636A1 (en) * | 2004-01-09 | 2005-07-28 | Ecolab Inc. | Methods for washing and processing fruits, vegetables, and other produce with medium chain peroxycarboxylic acid compositions |
| US7771737B2 (en) * | 2004-01-09 | 2010-08-10 | Ecolab Inc. | Medium chain peroxycarboxylic acid compositions |
| US7754670B2 (en) * | 2005-07-06 | 2010-07-13 | Ecolab Inc. | Surfactant peroxycarboxylic acid compositions |
| US7759299B2 (en) * | 2006-07-24 | 2010-07-20 | Ecolab Inc. | Warewashing composition for use in automatic dishwashing machines |
| US7547421B2 (en) | 2006-10-18 | 2009-06-16 | Ecolab Inc. | Apparatus and method for making a peroxycarboxylic acid |
| US8075857B2 (en) | 2006-10-18 | 2011-12-13 | Ecolab Usa Inc. | Apparatus and method for making a peroxycarboxylic acid |
| US9752105B2 (en) | 2012-09-13 | 2017-09-05 | Ecolab Usa Inc. | Two step method of cleaning, sanitizing, and rinsing a surface |
| US20140308162A1 (en) | 2013-04-15 | 2014-10-16 | Ecolab Usa Inc. | Peroxycarboxylic acid based sanitizing rinse additives for use in ware washing |
| US10865367B2 (en) | 2017-06-26 | 2020-12-15 | Ecolab Usa Inc. | Method of dishwashing comprising detergent compositions substantially free of polycarboxylic acid polymers |
| WO2019160948A1 (en) | 2018-02-14 | 2019-08-22 | Ecolab Usa Inc. | Compositions and methods for the reduction of biofilm and spores from membranes |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1617189A1 (de) * | 1966-04-25 | 1970-06-25 | Procter & Gamble | Enzyme enthaltende Waschmittel |
| DK130418A (enExample) * | 1967-07-19 | |||
| GB1275301A (en) * | 1969-02-19 | 1972-05-24 | Procter And Gamble Ltd | DETERGENT COMPOSITIONS CONTAINING STABILISED alpha-AMYLASE |
| DE2038103A1 (de) * | 1970-07-31 | 1972-02-10 | Henkel & Cie Gmbh | Waessrige Reinigungsmittelkonzentrate mit einem Gehalt an stabilisierten Enzymen |
| US3773674A (en) * | 1971-02-25 | 1973-11-20 | Procter & Gamble | Detergent composition containing enzymes |
| US3701735A (en) * | 1971-04-12 | 1972-10-31 | Colgate Palmolive Co | Automatic dishwashing compositions |
| US3789001A (en) * | 1972-03-09 | 1974-01-29 | Colgate Palmolive Co | Detergent containing enzyme and coarse perborate particles |
| US3799879A (en) * | 1972-04-27 | 1974-03-26 | Lever Brothers Ltd | Method for cleaning dishes and the like |
| JPS548533Y2 (enExample) * | 1972-06-12 | 1979-04-19 | ||
| DE2727463A1 (de) * | 1976-06-24 | 1978-01-05 | Procter & Gamble | Reinigungsmittel, das insbesondere zur verwendung in geschirrspuelmaschinen geeignet ist |
| JPS5950280B2 (ja) * | 1980-10-24 | 1984-12-07 | 花王株式会社 | 酵素入り漂白剤組成物 |
-
1981
- 1981-12-23 CH CH8234/81A patent/CH651314A5/fr not_active IP Right Cessation
-
1982
- 1982-12-15 DE DE19823246389 patent/DE3246389A1/de not_active Withdrawn
- 1982-12-17 MX MX195717A patent/MX158780A/es unknown
- 1982-12-20 GR GR70110A patent/GR78432B/el unknown
- 1982-12-20 US US06/451,527 patent/US4501681A/en not_active Expired - Fee Related
- 1982-12-20 ZA ZA829341A patent/ZA829341B/xx unknown
- 1982-12-20 FR FR8221338A patent/FR2518567B1/fr not_active Expired
- 1982-12-21 AT AT0462082A patent/AT388927B/de not_active IP Right Cessation
- 1982-12-21 SE SE8207286A patent/SE500347C2/sv unknown
- 1982-12-22 PT PT76025A patent/PT76025B/pt unknown
- 1982-12-22 NO NO824329A patent/NO155295C/no unknown
- 1982-12-22 IE IE3060/82A patent/IE53681B1/en unknown
- 1982-12-22 GB GB08236470A patent/GB2116198B/en not_active Expired
- 1982-12-22 CA CA000418313A patent/CA1192512A/en not_active Expired
- 1982-12-22 AU AU91766/82A patent/AU554642B2/en not_active Ceased
- 1982-12-22 NZ NZ202897A patent/NZ202897A/en unknown
- 1982-12-23 JP JP57235020A patent/JPS58141299A/ja active Granted
- 1982-12-23 DK DK572882A patent/DK159067C/da not_active IP Right Cessation
- 1982-12-23 BE BE0/209795A patent/BE895459A/fr not_active IP Right Cessation
- 1982-12-23 NL NL8204971A patent/NL8204971A/nl not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| SE8207286L (sv) | 1983-06-24 |
| AU554642B2 (en) | 1986-08-28 |
| SE500347C2 (sv) | 1994-06-06 |
| DK572882A (da) | 1983-06-24 |
| IE53681B1 (en) | 1989-01-04 |
| FR2518567A1 (fr) | 1983-06-24 |
| NO155295B (no) | 1986-12-01 |
| PT76025B (en) | 1985-12-20 |
| BE895459A (fr) | 1983-06-23 |
| ZA829341B (en) | 1984-08-29 |
| NO824329L (no) | 1983-06-24 |
| GR78432B (enExample) | 1984-09-27 |
| FR2518567B1 (fr) | 1986-04-04 |
| DK159067B (da) | 1990-08-27 |
| GB2116198B (en) | 1985-10-30 |
| AU9176682A (en) | 1983-06-30 |
| DE3246389A1 (de) | 1983-09-08 |
| NL8204971A (nl) | 1983-07-18 |
| JPS58141299A (ja) | 1983-08-22 |
| US4501681A (en) | 1985-02-26 |
| CA1192512A (en) | 1985-08-27 |
| ATA462082A (de) | 1989-02-15 |
| NO155295C (no) | 1987-03-11 |
| JPH0354720B2 (enExample) | 1991-08-21 |
| GB2116198A (en) | 1983-09-21 |
| NZ202897A (en) | 1986-04-11 |
| IE823060L (en) | 1983-06-23 |
| DK159067C (da) | 1991-01-28 |
| SE8207286D0 (sv) | 1982-12-21 |
| PT76025A (en) | 1983-01-01 |
| MX158780A (es) | 1989-03-13 |
| AT388927B (de) | 1989-09-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH651314A5 (fr) | Composition detergente pour lave-vaisselle. | |
| JP5551622B2 (ja) | 自動食器洗浄洗剤組成物 | |
| US5030377A (en) | Detergent compositions containing starch debranching enzymes | |
| EP2247705B1 (en) | Automatic phospate-free dishwashing detergent providing improved spotting and filming performance | |
| EP2844729B1 (en) | Detergent formulation for dishwashing machine | |
| JP3984287B2 (ja) | 食器洗浄のための洗剤組成物および方法 | |
| US8454757B2 (en) | Phosphate and phosphonate-free automatic gel dishwashing detergent providing improved spotting and filming performance | |
| JP2013503932A5 (ja) | 洗剤組成物 | |
| CA1334389C (en) | Machine dishwasher water spot control composition | |
| CN103620013A (zh) | 用于除去茶叶和咖啡污渍的非漂白程序 | |
| JP2004511277A (ja) | 洗剤組成物および器物洗浄方法 | |
| FR2711995A1 (fr) | Compositions en poudre pour le lavage de la vaisselle. | |
| FR2689901A1 (fr) | Composition en poudre pour le lavage de la vaisselle. | |
| WO2022250123A1 (ja) | 酵素反応促進方法 | |
| JP2009052006A (ja) | 酵素含有洗浄剤組成物 | |
| KR970002056B1 (ko) | 자동 식기 세척기용 분말 세제 조성물 | |
| US20150107629A1 (en) | Enzyme-containing automatic dishwashing booster/rinse aid composition, kit containing the same and method of using the same | |
| IT8347617A1 (it) | Composizione per il lavaggio di stoviglie. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |