CH644363A5 - N-alchil-piperidin derivati dell'acido idrossi-benzil malonico e loro impiego come stabilizzanti per polimeri. - Google Patents
N-alchil-piperidin derivati dell'acido idrossi-benzil malonico e loro impiego come stabilizzanti per polimeri. Download PDFInfo
- Publication number
- CH644363A5 CH644363A5 CH76580A CH76580A CH644363A5 CH 644363 A5 CH644363 A5 CH 644363A5 CH 76580 A CH76580 A CH 76580A CH 76580 A CH76580 A CH 76580A CH 644363 A5 CH644363 A5 CH 644363A5
- Authority
- CH
- Switzerland
- Prior art keywords
- alkyl
- carbon atoms
- hydroxy
- benzyl
- use according
- Prior art date
Links
- 239000003381 stabilizer Substances 0.000 title claims description 19
- 229920000642 polymer Polymers 0.000 title claims description 15
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 title claims 2
- -1 polypropylene Polymers 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 25
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 11
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 11
- 229920001059 synthetic polymer Polymers 0.000 claims description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- 229920001169 thermoplastic Polymers 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 239000004416 thermosoftening plastic Substances 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 239000000654 additive Substances 0.000 claims description 7
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 7
- 229920000098 polyolefin Polymers 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 239000004743 Polypropylene Substances 0.000 claims description 4
- 238000007254 oxidation reaction Methods 0.000 claims description 4
- 229920001155 polypropylene Polymers 0.000 claims description 4
- 239000004952 Polyamide Substances 0.000 claims description 3
- 229920001328 Polyvinylidene chloride Polymers 0.000 claims description 3
- 239000003963 antioxidant agent Substances 0.000 claims description 3
- 125000006289 hydroxybenzyl group Chemical group 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- JRKDSFVGOHIRPM-UHFFFAOYSA-N phenol propanedioic acid Chemical compound OC(=O)CC(O)=O.OC1=CC=CC=C1 JRKDSFVGOHIRPM-UHFFFAOYSA-N 0.000 claims description 3
- 229920002647 polyamide Polymers 0.000 claims description 3
- 229920002635 polyurethane Polymers 0.000 claims description 3
- 239000004814 polyurethane Substances 0.000 claims description 3
- 239000004800 polyvinyl chloride Substances 0.000 claims description 3
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 3
- 239000005033 polyvinylidene chloride Substances 0.000 claims description 3
- 239000002250 absorbent Substances 0.000 claims description 2
- 230000002745 absorbent Effects 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 230000000593 degrading effect Effects 0.000 claims description 2
- 239000000945 filler Substances 0.000 claims description 2
- 229920002521 macromolecule Polymers 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 239000000049 pigment Substances 0.000 claims description 2
- GHQOUFDDPQNBDR-UHFFFAOYSA-N 2-benzyl-2-hydroxypropanedioic acid Chemical compound OC(=O)C(O)(C(O)=O)CC1=CC=CC=C1 GHQOUFDDPQNBDR-UHFFFAOYSA-N 0.000 claims 1
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 claims 1
- 239000000047 product Substances 0.000 description 10
- 229920001577 copolymer Polymers 0.000 description 7
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 238000010521 absorption reaction Methods 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 4
- 230000006698 induction Effects 0.000 description 4
- 230000006641 stabilisation Effects 0.000 description 4
- 238000011105 stabilization Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000032683 aging Effects 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000000087 stabilizing effect Effects 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- YAXWOADCWUUUNX-UHFFFAOYSA-N 1,2,2,3-tetramethylpiperidine Chemical compound CC1CCCN(C)C1(C)C YAXWOADCWUUUNX-UHFFFAOYSA-N 0.000 description 2
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-Tetramethylpiperidine Substances CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 241000786363 Rhampholeon spectrum Species 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 230000006866 deterioration Effects 0.000 description 2
- UKFXDFUAPNAMPJ-UHFFFAOYSA-N ethylmalonic acid Chemical compound CCC(C(O)=O)C(O)=O UKFXDFUAPNAMPJ-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 229920006324 polyoxymethylene Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- MCRZWYDXIGCFKO-UHFFFAOYSA-N 2-butylpropanedioic acid Chemical compound CCCCC(C(O)=O)C(O)=O MCRZWYDXIGCFKO-UHFFFAOYSA-N 0.000 description 1
- CAQWNKXTMBFBGI-UHFFFAOYSA-N C.[Na] Chemical compound C.[Na] CAQWNKXTMBFBGI-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical class OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Natural products C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 239000011656 manganese carbonate Substances 0.000 description 1
- 229940093474 manganese carbonate Drugs 0.000 description 1
- 235000006748 manganese carbonate Nutrition 0.000 description 1
- 229910000016 manganese(II) carbonate Inorganic materials 0.000 description 1
- XMWCXZJXESXBBY-UHFFFAOYSA-L manganese(ii) carbonate Chemical compound [Mn+2].[O-]C([O-])=O XMWCXZJXESXBBY-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- KIQBVKPQYARZTK-UHFFFAOYSA-N n-(2-hydroxyphenyl)prop-2-enamide Chemical class OC1=CC=CC=C1NC(=O)C=C KIQBVKPQYARZTK-UHFFFAOYSA-N 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000002530 phenolic antioxidant Substances 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 238000007539 photo-oxidation reaction Methods 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- OVSQVDMCBVZWGM-QSOFNFLRSA-N quercetin 3-O-beta-D-glucopyranoside Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=C(C=2C=C(O)C(O)=CC=2)OC2=CC(O)=CC(O)=C2C1=O OVSQVDMCBVZWGM-QSOFNFLRSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000013112 stability test Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000012721 stereospecific polymerization Methods 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- 238000007056 transamidation reaction Methods 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 230000001131 transforming effect Effects 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- KAKZBPTYRLMSJV-UHFFFAOYSA-N vinyl-ethylene Natural products C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3432—Six-membered rings
- C08K5/3435—Piperidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Hydrogenated Pyridines (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT19761/79A IT1110826B (it) | 1979-02-01 | 1979-02-01 | N-alchil-piperidin derivati dell'acido idrossi-benzil malonico e loro impiego come stabilizzanti per polimeri |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH644363A5 true CH644363A5 (it) | 1984-07-31 |
Family
ID=11161005
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH76580A CH644363A5 (it) | 1979-02-01 | 1980-01-31 | N-alchil-piperidin derivati dell'acido idrossi-benzil malonico e loro impiego come stabilizzanti per polimeri. |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US4317767A (enExample) |
| BE (1) | BE881429A (enExample) |
| CH (1) | CH644363A5 (enExample) |
| DE (1) | DE3003517A1 (enExample) |
| FR (1) | FR2447912A1 (enExample) |
| GB (1) | GB2043058B (enExample) |
| IT (1) | IT1110826B (enExample) |
| NL (1) | NL186317C (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1110826B (it) * | 1979-02-01 | 1986-01-06 | Montedison Spa | N-alchil-piperidin derivati dell'acido idrossi-benzil malonico e loro impiego come stabilizzanti per polimeri |
| US4444928A (en) * | 1981-08-14 | 1984-04-24 | Ciba-Geigy Corporation | Polymeric malonic acid derivatives |
| DE4444135B4 (de) * | 1994-12-11 | 2005-06-02 | Gerold Tebbe | Sauerstoff-Behandlungseinrichtung |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH483461A (de) * | 1967-10-06 | 1969-12-31 | Ciba Geigy | Verwendung von Oxalsäurediamiden als Stabilisierungsmittel für Polyalkylene |
| US3640928A (en) * | 1968-06-12 | 1972-02-08 | Sankyo Co | Stabilization of synthetic polymers |
| JPS554133B2 (enExample) * | 1972-07-27 | 1980-01-29 | ||
| US3975357A (en) * | 1973-04-19 | 1976-08-17 | Sankyo Company Limited | Stabilized synthetic polymer compositions |
| CH589056A5 (enExample) * | 1973-12-10 | 1977-06-30 | Ciba Geigy Ag | |
| DE2647452A1 (de) * | 1975-11-07 | 1977-05-18 | Ciba Geigy Ag | Neue hydroxybenzylmalonsaeure-derivate |
| DE2656769A1 (de) * | 1975-12-29 | 1977-07-14 | Ciba Geigy Ag | Neue phenol-stabilisatoren |
| US4197236A (en) * | 1976-04-28 | 1980-04-08 | Ciba-Geigy Corporation | Piperidine stabilizers |
| DE2718458A1 (de) * | 1976-05-04 | 1977-11-24 | Ciba Geigy Ag | Neue stabilisatoren |
| EP0002260B1 (de) * | 1977-12-02 | 1982-07-14 | Ciba-Geigy Ag | Malonsäurederivate von sterisch gehinderten Piperidinen, Verfahren zu ihrer Herstellung und mit ihnen stabilisiertes organisches Material |
| IT1110826B (it) * | 1979-02-01 | 1986-01-06 | Montedison Spa | N-alchil-piperidin derivati dell'acido idrossi-benzil malonico e loro impiego come stabilizzanti per polimeri |
-
1979
- 1979-02-01 IT IT19761/79A patent/IT1110826B/it active
-
1980
- 1980-01-28 NL NLAANVRAGE8000525,A patent/NL186317C/xx not_active IP Right Cessation
- 1980-01-30 US US06/116,850 patent/US4317767A/en not_active Expired - Lifetime
- 1980-01-30 BE BE0/199168A patent/BE881429A/fr not_active IP Right Cessation
- 1980-01-31 FR FR8002174A patent/FR2447912A1/fr active Granted
- 1980-01-31 GB GB8003385A patent/GB2043058B/en not_active Expired
- 1980-01-31 CH CH76580A patent/CH644363A5/it not_active IP Right Cessation
- 1980-01-31 DE DE19803003517 patent/DE3003517A1/de not_active Withdrawn
-
1981
- 1981-06-03 US US06/269,847 patent/US4371695A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US4317767A (en) | 1982-03-02 |
| DE3003517A1 (de) | 1980-08-07 |
| NL8000525A (nl) | 1980-08-05 |
| IT7919761A0 (it) | 1979-02-01 |
| NL186317B (nl) | 1990-06-01 |
| GB2043058B (en) | 1983-05-25 |
| FR2447912B1 (enExample) | 1984-02-17 |
| NL186317C (nl) | 1990-11-01 |
| GB2043058A (en) | 1980-10-01 |
| US4371695A (en) | 1983-02-01 |
| IT1110826B (it) | 1986-01-06 |
| FR2447912A1 (fr) | 1980-08-29 |
| BE881429A (fr) | 1980-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4221701A (en) | Stabilized synthetic polymers | |
| DE2661090C2 (enExample) | ||
| US4210576A (en) | Stabilizers for polymers and polymers stabilized thereby | |
| US3542729A (en) | Stabilization of synthetic polymers | |
| US4279804A (en) | Piperidine compounds and their use as stabilizers for synthetic polymers | |
| EP0022501B1 (en) | Polycondensates of substituted piperidines and use thereof as stabilizers for polymers | |
| GB1582051A (en) | Alkylphenol stabilisers | |
| EP0047605A1 (en) | Polyalkylated 4-aminopiperidine derivatives and synthetic polymers containing the same | |
| EP0034829A1 (en) | Tetra-alkyl-4-amino-piperidine containing acids and corresponding salts and use thereof as stabilizers for polymers | |
| CH644363A5 (it) | N-alchil-piperidin derivati dell'acido idrossi-benzil malonico e loro impiego come stabilizzanti per polimeri. | |
| US4293466A (en) | Piperidine phosphite stabilizers for polymers and polymers stabilized thereby | |
| GB1580914A (en) | Hindered phosphite esters | |
| US3970636A (en) | Tetramethylpiperidinylphosphine oxides as light stabilizers for polymers | |
| EP0172138B1 (de) | N-Piperidyl-tetrahydro-1,4-oxazin-2-one als Lichtschutzmittel | |
| US4373042A (en) | N,N-Di-(hydroxy-phenyl) derivatives of piperazine and use thereof as stabilizers for polymers | |
| EP0114658B1 (en) | Alkyl-substituted 4-methyl-piperidine derivatives and use thereof as stabilizers | |
| US4191682A (en) | Hindered piperidine carboxylic acids, metal salts thereof and stabilized compositions | |
| CA1051903A (en) | Piperidine carboxylic acids and their metal salts | |
| US4116933A (en) | Hindered piperidine carboxylic acids, metal salts thereof and stabilized compositions | |
| EP0062322A1 (en) | Improved process for synthesis of hindered amine stabilizers for polymeric materials | |
| US4361695A (en) | Polyesters of N,N-di-alkanol-amines with di-(hydroxy-alkyl-benzyl) malonic acids and use thereof as stabilizers for polymers | |
| JPH01193362A (ja) | 安定化された合成樹脂組成物 | |
| EP0219332B1 (en) | Tartrate compounds useful as light stabilizers for plastics | |
| JPS6412276B2 (enExample) | ||
| FR2620715A1 (fr) | Compositions de resines synthetiques ayant un comportement au feu ameliore renfermant une polyolefine, un additif ignifugeant phosphore associe a des composes bromes et oxyde d'antimoine ou bien associe ou combine avec un compose azote et eventuellement d'autres additifs et/ou charges et objets conformes produits a partir de ces compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |