CH619449A5 - - Google Patents
Download PDFInfo
- Publication number
- CH619449A5 CH619449A5 CH1661775A CH1661775A CH619449A5 CH 619449 A5 CH619449 A5 CH 619449A5 CH 1661775 A CH1661775 A CH 1661775A CH 1661775 A CH1661775 A CH 1661775A CH 619449 A5 CH619449 A5 CH 619449A5
- Authority
- CH
- Switzerland
- Prior art keywords
- shark
- compounds
- formula
- halogen
- mol
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 42
- -1 alkyl radical Chemical class 0.000 claims description 24
- 239000003795 chemical substances by application Substances 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 19
- 239000000460 chlorine Substances 0.000 claims description 17
- 230000002140 halogenating effect Effects 0.000 claims description 17
- 241000251730 Chondrichthyes Species 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 16
- 239000012433 hydrogen halide Substances 0.000 claims description 14
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 14
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical group 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 230000003641 microbiacidal effect Effects 0.000 claims description 9
- 239000004480 active ingredient Substances 0.000 claims description 8
- 230000000845 anti-microbial effect Effects 0.000 claims description 5
- 150000005840 aryl radicals Chemical class 0.000 claims description 5
- 239000002855 microbicide agent Substances 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 claims description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 3
- 239000004599 antimicrobial Substances 0.000 claims description 3
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 claims 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims 4
- 239000012770 industrial material Substances 0.000 claims 2
- 210000003608 fece Anatomy 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 17
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 16
- 239000007795 chemical reaction product Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- 239000000370 acceptor Substances 0.000 description 10
- 238000001953 recrystallisation Methods 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- 244000052616 bacterial pathogen Species 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 238000007792 addition Methods 0.000 description 6
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 6
- 235000015097 nutrients Nutrition 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 238000001816 cooling Methods 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 238000002955 isolation Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 230000000813 microbial effect Effects 0.000 description 4
- 150000003457 sulfones Chemical class 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- 229920001817 Agar Polymers 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 241000195493 Cryptophyta Species 0.000 description 3
- 241000588724 Escherichia coli Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 239000008272 agar Substances 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 210000003097 mucus Anatomy 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- 241000228212 Aspergillus Species 0.000 description 2
- 241000228245 Aspergillus niger Species 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000206761 Bacillariophyta Species 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 241000221955 Chaetomium Species 0.000 description 2
- 241001515917 Chaetomium globosum Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000195619 Euglena gracilis Species 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 241000761677 Jaaginema geminatum Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241000192608 Phormidium Species 0.000 description 2
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 241001504046 Stichococcus bacillaris Species 0.000 description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000005068 cooling lubricant Substances 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000003292 glue Substances 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004557 technical material Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- CRTSRAILSGDTQU-UHFFFAOYSA-N 2,2-dichloro-3-[2-[2-(2,2-dichloro-2-cyanoethyl)phenyl]sulfonylphenyl]propanenitrile Chemical compound N#CC(Cl)(Cl)CC1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1CC(Cl)(Cl)C#N CRTSRAILSGDTQU-UHFFFAOYSA-N 0.000 description 1
- KTYGIXMGVZEWRK-UHFFFAOYSA-N 3-(3-chlorophenyl)sulfonylprop-2-enenitrile Chemical compound ClC=1C=C(C=CC1)S(=O)(=O)C=CC#N KTYGIXMGVZEWRK-UHFFFAOYSA-N 0.000 description 1
- VYULCLGNLSTLFX-UHFFFAOYSA-N 3-(benzenesulfonyl)prop-2-enenitrile Chemical compound N#CC=CS(=O)(=O)C1=CC=CC=C1 VYULCLGNLSTLFX-UHFFFAOYSA-N 0.000 description 1
- CAOCNWKAZKGDQH-UHFFFAOYSA-N 3-sulfonylprop-2-enenitrile Chemical compound O=S(=O)=C=CC#N CAOCNWKAZKGDQH-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 244000249214 Chlorella pyrenoidosa Species 0.000 description 1
- 235000007091 Chlorella pyrenoidosa Nutrition 0.000 description 1
- 241000195628 Chlorophyta Species 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 241000192700 Cyanobacteria Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 241000588915 Klebsiella aerogenes Species 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000001888 Peptone Substances 0.000 description 1
- 108010080698 Peptones Proteins 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 241000235546 Rhizopus stolonifer Species 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 229940008309 acetone / ethanol Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002353 algacidal effect Effects 0.000 description 1
- 230000005791 algae growth Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000000498 cooling water Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 238000003618 dip coating Methods 0.000 description 1
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- VBQUDDWATQWCPP-UHFFFAOYSA-N ethylsulfonylbenzene Chemical compound CCS(=O)(=O)C1=CC=CC=C1 VBQUDDWATQWCPP-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000007380 fibre production Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 229940124561 microbicide Drugs 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 235000019319 peptone Nutrition 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2500265A DE2500265C2 (de) | 1975-01-04 | 1975-01-04 | Sulfone von Acrylsäurederivaten, Verfahren zu deren Herstellung und diese Verbindungen enthaltendes mikrobizides Mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH619449A5 true CH619449A5 (enExample) | 1980-09-30 |
Family
ID=5935987
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1661775A CH619449A5 (enExample) | 1975-01-04 | 1975-12-22 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4079148A (enExample) |
| JP (1) | JPS6011691B2 (enExample) |
| BE (1) | BE837284A (enExample) |
| CH (1) | CH619449A5 (enExample) |
| DE (1) | DE2500265C2 (enExample) |
| FR (1) | FR2296623A1 (enExample) |
| GB (1) | GB1519329A (enExample) |
| IT (1) | IT1052668B (enExample) |
| NL (1) | NL7600019A (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4238405A (en) * | 1977-09-19 | 1980-12-09 | Stauffer Chemical Company | Fungicidal 1,2-dichlorocyanovinyl compounds |
| US4217363A (en) * | 1978-08-17 | 1980-08-12 | Givaudan Corporation | Preservation of aqueous systems with α-chloro-β-aminocrotonamide |
| DE2926671A1 (de) | 1979-07-02 | 1981-01-15 | Bayer Ag | Verfahren zur herstellung von cyclopropan-carbonsaeure-derivaten sowie neue zwischenprodukte hierfuer und verfahren zu deren herstellung |
| DE2935682A1 (de) * | 1979-09-04 | 1981-03-12 | Bayer Ag, 5090 Leverkusen | Carbonsaeurederivate. |
| DE3041155A1 (de) * | 1980-10-31 | 1982-06-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 2,3-dichlor-sulfonyl-acrylnitrilen |
| DE3041154A1 (de) * | 1980-10-31 | 1982-06-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 2-halogen-3-sulfonylacrylnitrilen |
| US4388249A (en) * | 1980-12-29 | 1983-06-14 | Stauffer Chemical Company | 3-(Alkoxyphenylsulfonyl)acrylonitriles |
| US4331681A (en) * | 1980-12-29 | 1982-05-25 | Stauffer Chemical Company | Method for controlling algae |
| US4331480A (en) * | 1980-12-29 | 1982-05-25 | Stauffer Chemical Company | Biocides for protection of polymeric materials |
| DE3273119D1 (en) * | 1982-05-12 | 1986-10-16 | Stauffer Chemical Co | Method for controlling algae |
| EP0111413B1 (en) * | 1982-12-06 | 1986-08-06 | Stauffer Chemical Company | Novel sulfone, process for its preparation, composition containing it and use thereof |
| DE3346947A1 (de) * | 1983-12-24 | 1985-07-04 | Bayer Ag, 5090 Leverkusen | Halogenierte sulfide, verfahren zu ihrer herstellung und ihre verwendung in mikrobiziden mitteln |
| US4939132A (en) * | 1985-04-15 | 1990-07-03 | The Research Foundation Of State University Of New York | Novel 5-alkylsulfonylsalicylanilides and microbiocidal compositions for controlling the growth of microorganisms |
| DE3772966D1 (de) * | 1987-02-03 | 1991-10-17 | Grace W R & Co | Biozide. |
| GB2201595B (en) * | 1987-02-25 | 1990-11-07 | Grace W R & Co | Microbiological control agent |
| EP3450626B1 (en) | 2017-08-29 | 2020-05-06 | Kemira Oyj | Method for controlling growth of microorganisms and/or biofilms in an industrial process |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3140307A (en) * | 1957-05-01 | 1964-07-07 | Monsanto Co | Toxic arylsulfonyl haloalkanenitriles |
| US3078298A (en) * | 1958-12-15 | 1963-02-19 | Du Pont | 3-alkyl (sulfonyl and sulfoxyl) acrylic acid esters and nitriles |
| US3142616A (en) * | 1962-01-08 | 1964-07-28 | Stauffer Chemical Co | Controlling microorganisms employing sulfonylacetonitriles |
| US3437685A (en) * | 1964-07-14 | 1969-04-08 | Dow Chemical Co | Dihalosulfones |
| GB1170269A (en) * | 1965-12-27 | 1969-11-12 | Sanitized Inc | Method of Producing Unsaturated Sulfones. |
-
1975
- 1975-01-04 DE DE2500265A patent/DE2500265C2/de not_active Expired
- 1975-10-17 GB GB42635/75A patent/GB1519329A/en not_active Expired
- 1975-12-22 US US05/643,578 patent/US4079148A/en not_active Expired - Lifetime
- 1975-12-22 CH CH1661775A patent/CH619449A5/de not_active IP Right Cessation
- 1975-12-31 IT IT52925/75A patent/IT1052668B/it active
-
1976
- 1976-01-01 JP JP51000563A patent/JPS6011691B2/ja not_active Expired
- 1976-01-02 NL NL7600019A patent/NL7600019A/xx not_active Application Discontinuation
- 1976-01-02 FR FR7600031A patent/FR2296623A1/fr active Granted
- 1976-01-02 BE BE163288A patent/BE837284A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2500265C2 (de) | 1985-03-28 |
| DE2500265A1 (de) | 1976-07-08 |
| JPS5198218A (en) | 1976-08-30 |
| US4079148A (en) | 1978-03-14 |
| FR2296623B1 (enExample) | 1981-12-31 |
| NL7600019A (nl) | 1976-07-06 |
| IT1052668B (it) | 1981-07-20 |
| BE837284A (fr) | 1976-07-02 |
| JPS6011691B2 (ja) | 1985-03-27 |
| FR2296623A1 (fr) | 1976-07-30 |
| GB1519329A (en) | 1978-07-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH619449A5 (enExample) | ||
| EP0199047B1 (de) | Neue Iodpropargylether, ein Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE3545786A1 (de) | Pyrazolinderivate, ihre herstellung und ihre verwendung als mittel mit insektizider wirkung | |
| EP0165448A2 (de) | 1-Heteroaryl-4-aryl-pyrozolin-5-one | |
| DE3528583C2 (enExample) | ||
| EP0098953B1 (de) | Substituierte Maleinsäureimide, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| DE69612611T2 (de) | Triazin-derivate | |
| DE1809385A1 (de) | Oxim-O-kohlensaeure-phenylester sowie Verfahren zu ihrer Herstellung | |
| DE4104377A1 (de) | Halogencyclopropylalkylderivate, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel | |
| DE2426653B2 (de) | Derivate des 2-Amino-1,3-thiazins | |
| DE2419017A1 (de) | Isothiazolin-3-one | |
| DE3780574T2 (de) | 3-substituierte 4-fluorophenyl-1-(fluoroalkoxyphenyl-carbamoyl)-pyrazolin-insektizide. | |
| EP0007066B1 (de) | 4-Alkyl- und 4-Allyl-merkapto-, sulfinyl- und sulfonyl-methyl-2-amino-6-N,N'-dimethylcarbamoyloxy-pyrimidine, Verfahren zu ihrer Herstellung, Mittel welche diese Pyrimidine enthalten und deren Verwendung zur Bekämpfung von Insekten | |
| DE3236522A1 (de) | Halogenpropargylformamide | |
| EP0148442B1 (de) | Halogenierte Sulfide, Verfahren zu ihrer Herstellung und ihre Verwendung in mikrobiziden Mitteln | |
| EP0108352A2 (de) | 3-(3-Jodpropargyl)-benzo-1,2,3-triazin-4-one, Verfahren zu ihrer Herstellung und ihre Verwendung in mikrobiziden Mitteln | |
| DE2002800C3 (de) | Benzo [b] thiophen-l,l-dioxidverbindungen und Verfahren zu ihrer Herstellung | |
| EP0097854A1 (de) | Thiolphosphorsäureester, ihre Herstellung und Verwendung | |
| EP0142785B1 (de) | Trihaloallylthiocyanate, ein Verfahren zu ihrer Herstellung und ihre Verwendung in mikrobiziden Mitteln | |
| AT367967B (de) | Fungizides mittel | |
| DE2814453A1 (de) | Carbamoyloxyphenyl-verbindungen | |
| EP0161480B1 (de) | N-Jodpropargyl-chlormethansulfonamide | |
| DE2022494A1 (de) | Fungizide Mittel | |
| DE69619181T2 (de) | Verbindungen mit antimikrobieller Breitspektrum-Wirkung | |
| DE2536252A1 (de) | Mikrobizide arylketone |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |