CH570398A5 - 1-alkyl 1,4-dihydro 4-oxo 3-quinoline carboxylic acids - and esters - antibacterials - Google Patents
1-alkyl 1,4-dihydro 4-oxo 3-quinoline carboxylic acids - and esters - antibacterialsInfo
- Publication number
- CH570398A5 CH570398A5 CH284074A CH284074A CH570398A5 CH 570398 A5 CH570398 A5 CH 570398A5 CH 284074 A CH284074 A CH 284074A CH 284074 A CH284074 A CH 284074A CH 570398 A5 CH570398 A5 CH 570398A5
- Authority
- CH
- Switzerland
- Prior art keywords
- diethyl
- pyridyl
- mixture
- nitrophenyl
- dihydro
- Prior art date
Links
- 150000002148 esters Chemical class 0.000 title claims 2
- 230000000844 anti-bacterial effect Effects 0.000 title description 4
- 229940088710 antibiotic agent Drugs 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 20
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 6
- 125000004076 pyridyl group Chemical group 0.000 claims abstract description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 3
- -1 cyano, carbamyl Chemical group 0.000 claims description 89
- 238000002360 preparation method Methods 0.000 claims description 33
- 238000000034 method Methods 0.000 claims description 21
- 239000001257 hydrogen Substances 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 3
- RPBWZBPLNQWXMX-UHFFFAOYSA-N [C].N1=CC=CC2=CC=CC=C21 Chemical group [C].N1=CC=CC2=CC=CC=C21 RPBWZBPLNQWXMX-UHFFFAOYSA-N 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 230000007062 hydrolysis Effects 0.000 claims 1
- 238000006460 hydrolysis reaction Methods 0.000 claims 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims 1
- XXJGBENTLXFVFI-UHFFFAOYSA-N 1-amino-methylene Chemical compound N[CH2] XXJGBENTLXFVFI-UHFFFAOYSA-N 0.000 abstract 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 abstract 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 1
- 230000003197 catalytic effect Effects 0.000 abstract 1
- 230000032050 esterification Effects 0.000 abstract 1
- 238000005886 esterification reaction Methods 0.000 abstract 1
- YAGKRVSRTSUGEY-UHFFFAOYSA-N ferricyanide Chemical compound [Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] YAGKRVSRTSUGEY-UHFFFAOYSA-N 0.000 abstract 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 abstract 1
- 125000005936 piperidyl group Chemical group 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 80
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 60
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 54
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 52
- 239000007787 solid Substances 0.000 description 47
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 46
- 239000000243 solution Substances 0.000 description 42
- 239000011541 reaction mixture Substances 0.000 description 39
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 38
- 238000003756 stirring Methods 0.000 description 35
- 239000000047 product Substances 0.000 description 32
- 239000000706 filtrate Substances 0.000 description 31
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 25
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- 150000001875 compounds Chemical class 0.000 description 23
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical compound C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 21
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 21
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 18
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 17
- 230000008018 melting Effects 0.000 description 17
- 238000002844 melting Methods 0.000 description 17
- 239000002253 acid Substances 0.000 description 16
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 16
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000003921 oil Substances 0.000 description 15
- 239000003610 charcoal Substances 0.000 description 14
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 13
- 239000002244 precipitate Substances 0.000 description 13
- 239000000908 ammonium hydroxide Substances 0.000 description 12
- 238000010438 heat treatment Methods 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 238000000354 decomposition reaction Methods 0.000 description 8
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 6
- 229910017604 nitric acid Inorganic materials 0.000 description 6
- 229920000137 polyphosphoric acid Polymers 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 5
- BDSBSHZVSVKIHM-UHFFFAOYSA-N 3-pyridin-4-ylaniline Chemical compound NC1=CC=CC(C=2C=CN=CC=2)=C1 BDSBSHZVSVKIHM-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 238000005984 hydrogenation reaction Methods 0.000 description 5
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 5
- AYVXNUDELHJNHS-UHFFFAOYSA-N 6-chloro-2,3-dimethyl-4-(3-nitrophenyl)pyridine Chemical compound CC1=NC(Cl)=CC(C=2C=C(C=CC=2)[N+]([O-])=O)=C1C AYVXNUDELHJNHS-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 239000004305 biphenyl Substances 0.000 description 4
- 235000010290 biphenyl Nutrition 0.000 description 4
- 125000006267 biphenyl group Chemical group 0.000 description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 4
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 4
- 229940011051 isopropyl acetate Drugs 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- NPISDZNRUXWAKM-UHFFFAOYSA-N 2,6-diethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid Chemical compound CCC1=NC(CC)=C(C(O)=O)C(C=2C=C(C=CC=2)[N+]([O-])=O)=C1C(O)=O NPISDZNRUXWAKM-UHFFFAOYSA-N 0.000 description 3
- OHEKHNZMCAMZNU-UHFFFAOYSA-N 2-(3-nitrophenyl)pyridine Chemical compound [O-][N+](=O)C1=CC=CC(C=2N=CC=CC=2)=C1 OHEKHNZMCAMZNU-UHFFFAOYSA-N 0.000 description 3
- UYTKXCBJCQOVHG-UHFFFAOYSA-N 2-methyl-3-(3-nitrophenyl)-3-oxopropanenitrile Chemical compound N#CC(C)C(=O)C1=CC=CC([N+]([O-])=O)=C1 UYTKXCBJCQOVHG-UHFFFAOYSA-N 0.000 description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- OXFYXBFIGCNQNE-UHFFFAOYSA-N 3-(6-methylpyridin-3-yl)aniline Chemical compound C1=NC(C)=CC=C1C1=CC=CC(N)=C1 OXFYXBFIGCNQNE-UHFFFAOYSA-N 0.000 description 3
- QLOXDLSINWSONF-UHFFFAOYSA-N 3-methyl-5-pyridin-4-ylaniline Chemical compound NC=1C=C(C=C(C1)C)C1=CC=NC=C1 QLOXDLSINWSONF-UHFFFAOYSA-N 0.000 description 3
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- IBDMRHDXAQZJAP-UHFFFAOYSA-N dichlorophosphorylbenzene Chemical compound ClP(Cl)(=O)C1=CC=CC=C1 IBDMRHDXAQZJAP-UHFFFAOYSA-N 0.000 description 3
- 239000000374 eutectic mixture Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 150000002431 hydrogen Chemical group 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 3
- 229910003446 platinum oxide Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- AIFRBWMPIZCGCS-UHFFFAOYSA-N 2,6-bis(furan-2-yl)-3-methyl-4-(3-nitrophenyl)pyridine Chemical compound CC1=C(C=2OC=CC=2)N=C(C=2OC=CC=2)C=C1C1=CC=CC([N+]([O-])=O)=C1 AIFRBWMPIZCGCS-UHFFFAOYSA-N 0.000 description 2
- FWXAMLYPFIGGKG-UHFFFAOYSA-N 2,6-diethyl-4-(3-nitrophenyl)pyridine Chemical compound CCC1=NC(CC)=CC(C=2C=C(C=CC=2)[N+]([O-])=O)=C1 FWXAMLYPFIGGKG-UHFFFAOYSA-N 0.000 description 2
- HBHSQJCOOYIXQA-UHFFFAOYSA-N 2,6-dimethyl-4-(3-nitrophenyl)-1-oxidopyridin-1-ium Chemical compound CC1=[N+]([O-])C(C)=CC(C=2C=C(C=CC=2)[N+]([O-])=O)=C1 HBHSQJCOOYIXQA-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- CUYRZRDHYCUQFE-UHFFFAOYSA-N 2-chloro-3,6-dimethyl-4-(3-nitrophenyl)pyridine Chemical compound ClC1=NC(C)=CC(C=2C=C(C=CC=2)[N+]([O-])=O)=C1C CUYRZRDHYCUQFE-UHFFFAOYSA-N 0.000 description 2
- DWWATEVVFBMVDA-UHFFFAOYSA-N 2-methyl-4-(3-nitrophenyl)pyridine Chemical compound C1=NC(C)=CC(C=2C=C(C=CC=2)[N+]([O-])=O)=C1 DWWATEVVFBMVDA-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- XMBNNXYNQZQPPH-UHFFFAOYSA-N 3,5,6-trimethyl-4-(3-nitrophenyl)-1h-pyridin-2-one Chemical compound CC1=C(C)NC(=O)C(C)=C1C1=CC=CC([N+]([O-])=O)=C1 XMBNNXYNQZQPPH-UHFFFAOYSA-N 0.000 description 2
- SFSIJTWCDWEFFV-UHFFFAOYSA-N 3-(2,3,5-trimethylpyridin-4-yl)aniline Chemical compound CC1=CN=C(C)C(C)=C1C1=CC=CC(N)=C1 SFSIJTWCDWEFFV-UHFFFAOYSA-N 0.000 description 2
- DHBUBMKZHXHCPG-UHFFFAOYSA-N 3-(2,3-dimethylpyridin-4-yl)aniline Chemical compound CC1=NC=CC(C=2C=C(N)C=CC=2)=C1C DHBUBMKZHXHCPG-UHFFFAOYSA-N 0.000 description 2
- XDGVYNJOBCLHQU-UHFFFAOYSA-N 3-(2,5-dimethylpyridin-4-yl)aniline Chemical compound C1=NC(C)=CC(C=2C=C(N)C=CC=2)=C1C XDGVYNJOBCLHQU-UHFFFAOYSA-N 0.000 description 2
- OUHPMRGTIAPXAA-UHFFFAOYSA-N 3-(2,6-diethylpyridin-4-yl)aniline Chemical compound CCC1=NC(CC)=CC(C=2C=C(N)C=CC=2)=C1 OUHPMRGTIAPXAA-UHFFFAOYSA-N 0.000 description 2
- ADHASKYQWAONSZ-UHFFFAOYSA-N 3-(2,6-dimethylpyridin-4-yl)aniline Chemical compound CC1=NC(C)=CC(C=2C=C(N)C=CC=2)=C1 ADHASKYQWAONSZ-UHFFFAOYSA-N 0.000 description 2
- RBQLZXGSNYUPSO-UHFFFAOYSA-N 3-(3-methylpyridin-4-yl)aniline Chemical compound CC1=CN=CC=C1C1=CC=CC(N)=C1 RBQLZXGSNYUPSO-UHFFFAOYSA-N 0.000 description 2
- OTZUXMACTFIJAZ-UHFFFAOYSA-N 3-(3-nitrophenyl)-3-oxopropanenitrile Chemical compound [O-][N+](=O)C1=CC=CC(C(=O)CC#N)=C1 OTZUXMACTFIJAZ-UHFFFAOYSA-N 0.000 description 2
- DUIAZBOASZOCMZ-UHFFFAOYSA-N 3-methyl-4-(3-nitrophenyl)pyridine Chemical compound CC1=CN=CC=C1C1=CC=CC([N+]([O-])=O)=C1 DUIAZBOASZOCMZ-UHFFFAOYSA-N 0.000 description 2
- ITQTTZVARXURQS-UHFFFAOYSA-N 3-methylpyridine Chemical compound CC1=CC=CN=C1 ITQTTZVARXURQS-UHFFFAOYSA-N 0.000 description 2
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 2
- BTFYNBRRPAJPFQ-UHFFFAOYSA-N 4-(2-methoxy-5-nitrophenyl)-2,6-dimethylpyridine Chemical compound COC1=CC=C([N+]([O-])=O)C=C1C1=CC(C)=NC(C)=C1 BTFYNBRRPAJPFQ-UHFFFAOYSA-N 0.000 description 2
- QORUYQWFGMIEHN-UHFFFAOYSA-N 4-(3-aminophenyl)-6-methyl-1h-pyridin-2-one Chemical compound OC1=NC(C)=CC(C=2C=C(N)C=CC=2)=C1 QORUYQWFGMIEHN-UHFFFAOYSA-N 0.000 description 2
- OJDBZCHUPHMGEV-UHFFFAOYSA-N 5,6-dimethyl-4-(3-nitrophenyl)-1h-pyridin-2-one Chemical compound CC1=C(C)NC(=O)C=C1C1=CC=CC([N+]([O-])=O)=C1 OJDBZCHUPHMGEV-UHFFFAOYSA-N 0.000 description 2
- BRLOCWPGLWPKTD-UHFFFAOYSA-N 6-methyl-4-(3-nitrophenyl)pyridine-2-carbaldehyde Chemical compound O=CC1=NC(C)=CC(C=2C=C(C=CC=2)[N+]([O-])=O)=C1 BRLOCWPGLWPKTD-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 241000588747 Klebsiella pneumoniae Species 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 229940111121 antirheumatic drug quinolines Drugs 0.000 description 2
- UNTBPXHCXVWYOI-UHFFFAOYSA-O azanium;oxido(dioxo)vanadium Chemical compound [NH4+].[O-][V](=O)=O UNTBPXHCXVWYOI-UHFFFAOYSA-O 0.000 description 2
- 230000000721 bacterilogical effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000003226 decolorizating effect Effects 0.000 description 2
- LFVDUUBRDWRHRA-UHFFFAOYSA-N diethyl 2,6-diethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(CC)NC(CC)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 LFVDUUBRDWRHRA-UHFFFAOYSA-N 0.000 description 2
- YLGIBCYHQZTFQL-UHFFFAOYSA-N dimethyl pyridine-2,3-dicarboxylate Chemical compound COC(=O)C1=CC=CN=C1C(=O)OC YLGIBCYHQZTFQL-UHFFFAOYSA-N 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- XMEGHWFPOVOSJH-UHFFFAOYSA-N ethyl 7-(2,6-diethylpyridin-4-yl)-4-oxo-1h-quinoline-3-carboxylate Chemical compound C=1C=C2C(=O)C(C(=O)OCC)=CNC2=CC=1C1=CC(CC)=NC(CC)=C1 XMEGHWFPOVOSJH-UHFFFAOYSA-N 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- HCPORNAVHSWTOJ-UHFFFAOYSA-N 1-(2-Furanyl)-1-propanone Chemical compound CCC(=O)C1=CC=CO1 HCPORNAVHSWTOJ-UHFFFAOYSA-N 0.000 description 1
- QRDBDLAERAOLRU-UHFFFAOYSA-N 1-(3-nitrophenyl)pyridin-2-one Chemical compound [N+](=O)([O-])C=1C=C(C=CC=1)N1C(C=CC=C1)=O QRDBDLAERAOLRU-UHFFFAOYSA-N 0.000 description 1
- NSUYUXFCVIEMIN-UHFFFAOYSA-N 1-(furan-2-yl)-3-(3-nitrophenyl)prop-2-en-1-one Chemical compound [O-][N+](=O)C1=CC=CC(C=CC(=O)C=2OC=CC=2)=C1 NSUYUXFCVIEMIN-UHFFFAOYSA-N 0.000 description 1
- XYPISWUKQGWYGX-UHFFFAOYSA-N 2,2,2-trifluoroethaneperoxoic acid Chemical compound OOC(=O)C(F)(F)F XYPISWUKQGWYGX-UHFFFAOYSA-N 0.000 description 1
- FTWIJYIVFAWSLZ-UHFFFAOYSA-N 2,6-dimethyl-4-(3-nitrophenyl)pyridine Chemical compound CC1=NC(C)=CC(C=2C=C(C=CC=2)[N+]([O-])=O)=C1 FTWIJYIVFAWSLZ-UHFFFAOYSA-N 0.000 description 1
- AAXXNHTVLPPAAZ-UHFFFAOYSA-N 2-[(4-fluoroanilino)methylidene]propanedioic acid Chemical compound FC1=CC=C(NC=C(C(=O)O)C(=O)O)C=C1 AAXXNHTVLPPAAZ-UHFFFAOYSA-N 0.000 description 1
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- FVSRLYYLERDAGV-UHFFFAOYSA-N 2-chloro-3,5,6-trimethyl-4-(3-nitrophenyl)pyridine Chemical compound CC1=NC(Cl)=C(C)C(C=2C=C(C=CC=2)[N+]([O-])=O)=C1C FVSRLYYLERDAGV-UHFFFAOYSA-N 0.000 description 1
- DERAACKMMNJAFU-UHFFFAOYSA-N 2-ethoxy-1,3-dioxane-4,6-dione Chemical compound CCOC1OC(=O)CC(=O)O1 DERAACKMMNJAFU-UHFFFAOYSA-N 0.000 description 1
- VVXFDFQEIRGULC-UHFFFAOYSA-N 2-fluoro-5-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(F)C(C=O)=C1 VVXFDFQEIRGULC-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- YWVSKFXYEWMHEO-UHFFFAOYSA-N 2-methoxy-5-nitrobenzaldehyde Chemical compound COC1=CC=C([N+]([O-])=O)C=C1C=O YWVSKFXYEWMHEO-UHFFFAOYSA-N 0.000 description 1
- INWMXIQMYAEUTE-UHFFFAOYSA-N 3,6-dimethyl-4-(3-nitrophenyl)-1h-pyridin-2-one Chemical compound O=C1NC(C)=CC(C=2C=C(C=CC=2)[N+]([O-])=O)=C1C INWMXIQMYAEUTE-UHFFFAOYSA-N 0.000 description 1
- YJCSRNJKGSWYTC-UHFFFAOYSA-N 3-(2-methylpyridin-3-yl)aniline Chemical compound CC1=NC=CC=C1C1=CC=CC(N)=C1 YJCSRNJKGSWYTC-UHFFFAOYSA-N 0.000 description 1
- JJMANWUWPISFCM-UHFFFAOYSA-N 3-(2-methylpyridin-4-yl)aniline Chemical compound C1=NC(C)=CC(C=2C=C(N)C=CC=2)=C1 JJMANWUWPISFCM-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- SOOAEDQFMAKACY-UHFFFAOYSA-N 3-ethoxy-2-methoxycarbonylprop-2-enoic acid Chemical compound CCOC=C(C(O)=O)C(=O)OC SOOAEDQFMAKACY-UHFFFAOYSA-N 0.000 description 1
- CRJIJFXPTNAYIC-UHFFFAOYSA-N 3-methyl-4-(3-nitrophenyl)pyridine-2,6-dicarboxylic acid Chemical compound CC1=C(C(O)=O)N=C(C(O)=O)C=C1C1=CC=CC([N+]([O-])=O)=C1 CRJIJFXPTNAYIC-UHFFFAOYSA-N 0.000 description 1
- FWUWFWQPNCAYFW-UHFFFAOYSA-M 3-nitrobenzenediazonium;chloride Chemical compound [Cl-].[O-][N+](=O)C1=CC=CC([N+]#N)=C1 FWUWFWQPNCAYFW-UHFFFAOYSA-M 0.000 description 1
- PRRBQHNMYJRHFW-UHFFFAOYSA-M 3-oxoheptanoate Chemical compound CCCCC(=O)CC([O-])=O PRRBQHNMYJRHFW-UHFFFAOYSA-M 0.000 description 1
- BDCLDNALSPBWPQ-UHFFFAOYSA-M 3-oxohexanoate Chemical compound CCCC(=O)CC([O-])=O BDCLDNALSPBWPQ-UHFFFAOYSA-M 0.000 description 1
- YTJQJGKMRLQBJP-UHFFFAOYSA-N 3-pyridin-3-ylaniline Chemical compound NC1=CC=CC(C=2C=NC=CC=2)=C1 YTJQJGKMRLQBJP-UHFFFAOYSA-N 0.000 description 1
- AFVBDOPDKXFXTN-UHFFFAOYSA-N 4-(3-nitrophenyl)pyridine Chemical compound [O-][N+](=O)C1=CC=CC(C=2C=CN=CC=2)=C1 AFVBDOPDKXFXTN-UHFFFAOYSA-N 0.000 description 1
- ILNJBIQQAIIMEY-UHFFFAOYSA-N 4-oxo-1h-quinoline-3-carboxylic acid Chemical compound C1=CC=CC2=C(O)C(C(=O)O)=CN=C21 ILNJBIQQAIIMEY-UHFFFAOYSA-N 0.000 description 1
- VQTRHJYDHOIEQB-UHFFFAOYSA-N 4-oxo-7-pyridin-2-yl-1h-quinoline-3-carboxylic acid Chemical compound C=1C=C2C(=O)C(C(=O)O)=CNC2=CC=1C1=CC=CC=N1 VQTRHJYDHOIEQB-UHFFFAOYSA-N 0.000 description 1
- LMUHEUHLMYYYTL-UHFFFAOYSA-N 4-oxo-7-pyridin-4-yl-1h-quinoline-3-carboxylic acid Chemical compound C=1C=C2C(=O)C(C(=O)O)=CNC2=CC=1C1=CC=NC=C1 LMUHEUHLMYYYTL-UHFFFAOYSA-N 0.000 description 1
- FXVZULJWGOHDGF-UHFFFAOYSA-N 6-methyl-4-(3-nitrophenyl)-1h-pyridin-2-one Chemical compound O=C1NC(C)=CC(C=2C=C(C=CC=2)[N+]([O-])=O)=C1 FXVZULJWGOHDGF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- UAWTVZXNSKMKQU-UHFFFAOYSA-N CC1=CN=C(C)C(C2=CC(N)=CC=C2)=C1 Chemical compound CC1=CN=C(C)C(C2=CC(N)=CC=C2)=C1 UAWTVZXNSKMKQU-UHFFFAOYSA-N 0.000 description 1
- HUXYMSFDVAMEAX-UHFFFAOYSA-N CC=1C=C(C=C(C1)C1=CC=NC=C1)[N+](=O)[O-] Chemical compound CC=1C=C(C=C(C1)C1=CC=NC=C1)[N+](=O)[O-] HUXYMSFDVAMEAX-UHFFFAOYSA-N 0.000 description 1
- VSPXDKJAZQAQNX-UHFFFAOYSA-N CCOC(=O)C1=CN=C2C=C(C=CC2=C1)C3=CC=NC=C3 Chemical compound CCOC(=O)C1=CN=C2C=C(C=CC2=C1)C3=CC=NC=C3 VSPXDKJAZQAQNX-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- MHRVKWPNSMSNCI-UHFFFAOYSA-N Cl.NC=1C=CC(=C(C1)C1=CC(=NC(=C1)C)C)OC Chemical compound Cl.NC=1C=CC(=C(C1)C1=CC(=NC(=C1)C)C)OC MHRVKWPNSMSNCI-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 241000588767 Proteus vulgaris Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- PPWYXUHZXMYSFA-UHFFFAOYSA-N [6-methyl-4-(3-nitrophenyl)pyridin-2-yl]methanol Chemical compound OCC1=NC(C)=CC(C=2C=C(C=CC=2)[N+]([O-])=O)=C1 PPWYXUHZXMYSFA-UHFFFAOYSA-N 0.000 description 1
- LRKNVVJDVHRCIC-UHFFFAOYSA-N [6-methyl-4-(3-nitrophenyl)pyridin-2-yl]methyl acetate Chemical compound CC1=NC(COC(=O)C)=CC(C=2C=C(C=CC=2)[N+]([O-])=O)=C1 LRKNVVJDVHRCIC-UHFFFAOYSA-N 0.000 description 1
- OSFXWFXAUNBZCH-UHFFFAOYSA-M [Cl-].[N+](=O)([O-])C=1C=C(C=C(C1)C)[N+]#N Chemical compound [Cl-].[N+](=O)([O-])C=1C=C(C=C(C1)C)[N+]#N OSFXWFXAUNBZCH-UHFFFAOYSA-M 0.000 description 1
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- CFBDQQYTVXYZLD-UHFFFAOYSA-N diethyl 4-(3-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)N=C(C)C(C(=O)OCC)=C1C1=CC=CC(N)=C1 CFBDQQYTVXYZLD-UHFFFAOYSA-N 0.000 description 1
- BBFKMXWYVQEFJU-UHFFFAOYSA-N dimethyl 2,6-diethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(CC)NC(CC)=C(C(=O)OC)C1C1=CC=CC([N+]([O-])=O)=C1 BBFKMXWYVQEFJU-UHFFFAOYSA-N 0.000 description 1
- FHHCBLOOSPNHDY-UHFFFAOYSA-N dimethyl 4-(5-amino-2-fluorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C)N=C(C)C(C(=O)OC)=C1C1=CC(N)=CC=C1F FHHCBLOOSPNHDY-UHFFFAOYSA-N 0.000 description 1
- HDTNLHHNQYBOHJ-UHFFFAOYSA-N dimethyl pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=CN=CC(C(=O)OC)=C1 HDTNLHHNQYBOHJ-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 1
- DBGDJYKAPSDOCO-UHFFFAOYSA-N ethyl 4-oxo-7-pyridin-2-yl-1h-quinoline-3-carboxylate Chemical compound C=1C=C2C(=O)C(C(=O)OCC)=CNC2=CC=1C1=CC=CC=N1 DBGDJYKAPSDOCO-UHFFFAOYSA-N 0.000 description 1
- MZESMDMSRBNRBO-UHFFFAOYSA-N ethyl 4-oxo-7-pyridin-4-yl-1h-quinoline-3-carboxylate Chemical compound C=1C=C2C(=O)C(C(=O)OCC)=CNC2=CC=1C1=CC=NC=C1 MZESMDMSRBNRBO-UHFFFAOYSA-N 0.000 description 1
- YZZRTZDYWJVJCL-UHFFFAOYSA-N ethyl 7-(2,6-dimethylpyridin-4-yl)-4-oxo-1h-quinoline-3-carboxylate Chemical compound C=1C=C2C(=O)C(C(=O)OCC)=CNC2=CC=1C1=CC(C)=NC(C)=C1 YZZRTZDYWJVJCL-UHFFFAOYSA-N 0.000 description 1
- PWOYTBYNBYNZCO-UHFFFAOYSA-N ethyl quinoline-2-carboxylate Chemical compound C1=CC=CC2=NC(C(=O)OCC)=CC=C21 PWOYTBYNBYNZCO-UHFFFAOYSA-N 0.000 description 1
- 230000005496 eutectics Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229940073640 magnesium sulfate anhydrous Drugs 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000001298 n-hexoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 229940007042 proteus vulgaris Drugs 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- SHNUBALDGXWUJI-UHFFFAOYSA-N pyridin-2-ylmethanol Chemical compound OCC1=CC=CC=N1 SHNUBALDGXWUJI-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/02—Preparation by ring-closure or hydrogenation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D211/78—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/26—Radicals substituted by halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/48—Aldehydo radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/89—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US14430771A | 1971-05-17 | 1971-05-17 | |
| CH726172A CH565789A5 (cs) | 1971-05-17 | 1972-05-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH570398A5 true CH570398A5 (en) | 1975-12-15 |
Family
ID=25701042
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH284074A CH570398A5 (en) | 1971-05-17 | 1972-05-16 | 1-alkyl 1,4-dihydro 4-oxo 3-quinoline carboxylic acids - and esters - antibacterials |
| CH583274A CH570995A5 (cs) | 1971-05-17 | 1972-05-16 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH583274A CH570995A5 (cs) | 1971-05-17 | 1972-05-16 |
Country Status (1)
| Country | Link |
|---|---|
| CH (2) | CH570398A5 (cs) |
-
1972
- 1972-05-16 CH CH284074A patent/CH570398A5/fr not_active IP Right Cessation
- 1972-05-16 CH CH583274A patent/CH570995A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH570995A5 (cs) | 1975-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3753993A (en) | 1,4-dihydro-4-oxo-7-pyridyl-3-quinoline-carboxylic acid derivatives | |
| US3907808A (en) | 1,4-Dihydro-4-oxo-7-pyridyl-3-quinolinecarboxylic acid derivatives | |
| DE2611824C2 (cs) | ||
| CA1305147C (en) | Benzo¬5,6|cycloheptapyridines, compositions and methods of use | |
| DE69303191T2 (de) | Naphthalinderivate, ihre Herstellungsverfahren und synthetische Zwischenprodukte dafür | |
| KR100266305B1 (ko) | 아릴기-또는방향족헤테로시클릭기-치환된아미노퀴놀론유도체및항-hiv제 | |
| US4432979A (en) | Pyridone compounds | |
| JPS597703B2 (ja) | ピリジン誘導体の製造方法 | |
| FR2614620A1 (fr) | Derives de la 1,4-dihydro-4-oxonaphtyridine et leurs sels, procede pour leur production et agents anti-bacteriens les contenant | |
| JPH01216974A (ja) | 置換ピリジン類 | |
| FR2553767A1 (fr) | 1-pyridinyl-2-(dialkyl-amino) ethenyl alkyl cetones et leur procede de preparation | |
| DE69713255T2 (de) | Pharmazeutische Pyridin-Derivate, ihre Herstellungsverfahren und Zwischenprodukte dafür | |
| US4771054A (en) | Antibacterial agents | |
| DE3023626A1 (de) | 1,9-dihydroxyoctahydrobenzo eckige klammer auf c eckige klammer zu chinoline und 1-hydroxyhexahydrobenzo eckige klammer auf c eckige klammer zu chinolin-9 (8h)- one als antiemetika | |
| JPS6372674A (ja) | ジヒドロピリジン化合物 | |
| JPS61205258A (ja) | キノロンカルボン酸誘導体及びその製造方法 | |
| DE2333603A1 (de) | Neue derivate von dipyrazolopyridinen und ihre salze | |
| JPH0544942B2 (cs) | ||
| US4659718A (en) | Antihypertensive 3-tetrazoyl-4-quinolones | |
| US4994599A (en) | Intermediates for producing quinolone-3-carboxylic acids | |
| US4129738A (en) | 5-Phenylpyrazolo[1,5-a]pyrimidin-7(1H)-ones | |
| CH570398A5 (en) | 1-alkyl 1,4-dihydro 4-oxo 3-quinoline carboxylic acids - and esters - antibacterials | |
| AU601946B2 (en) | 1,4-dihydropyridine derivatives useful for the treatment of cardiovascular disorders | |
| JPH03209367A (ja) | フッ素置換メトキシキノロンカルボン酸誘導体 | |
| AU2038683A (en) | Bicyclic heteroaryl substituted pyridone compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |