CH557347A - Verfahren zur herstellung von xanthonderivaten. - Google Patents
Verfahren zur herstellung von xanthonderivaten.Info
- Publication number
- CH557347A CH557347A CH1760070A CH1760070A CH557347A CH 557347 A CH557347 A CH 557347A CH 1760070 A CH1760070 A CH 1760070A CH 1760070 A CH1760070 A CH 1760070A CH 557347 A CH557347 A CH 557347A
- Authority
- CH
- Switzerland
- Prior art keywords
- producing
- xanthone derivatives
- xanthone
- derivatives
- producing xanthone
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- JNELGWHKGNBSMD-UHFFFAOYSA-N xanthone Chemical class C1=CC=C2C(=O)C3=CC=CC=C3OC2=C1 JNELGWHKGNBSMD-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D311/86—Oxygen atoms, e.g. xanthones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5812169 | 1969-11-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH557347A true CH557347A (de) | 1974-12-31 |
Family
ID=10480814
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1760070A CH557347A (de) | 1969-11-27 | 1970-11-27 | Verfahren zur herstellung von xanthonderivaten. |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US3706768A (member.php) |
| AT (1) | AT304547B (member.php) |
| BE (1) | BE759292A (member.php) |
| CA (1) | CA930743A (member.php) |
| CH (1) | CH557347A (member.php) |
| CS (1) | CS172918B4 (member.php) |
| DE (1) | DE2058295C3 (member.php) |
| DK (1) | DK130740B (member.php) |
| ES (1) | ES385927A1 (member.php) |
| FI (1) | FI56005C (member.php) |
| FR (1) | FR2073425B1 (member.php) |
| GB (1) | GB1312620A (member.php) |
| HU (1) | HU162579B (member.php) |
| IE (1) | IE34720B1 (member.php) |
| IL (1) | IL35668A (member.php) |
| NL (1) | NL7017336A (member.php) |
| NO (1) | NO133367C (member.php) |
| PH (1) | PH11097A (member.php) |
| PL (1) | PL81223B1 (member.php) |
| SE (1) | SE382459B (member.php) |
| ZA (1) | ZA707727B (member.php) |
Families Citing this family (67)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1362782A (en) * | 1970-08-26 | 1974-08-07 | Fisons Ltd | Tetrazole derivatives |
| US4064256A (en) * | 1970-08-26 | 1977-12-20 | Fisons Limited | Benzopyranyltetrazoles as antiasthma agents |
| US3873714A (en) * | 1971-07-14 | 1975-03-25 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| US3818042A (en) * | 1972-01-12 | 1974-06-18 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| GB1389827A (en) * | 1971-07-23 | 1975-04-09 | Fisons Ltd | Tetrazolyl benzopyrans |
| CA988525A (en) * | 1971-07-23 | 1976-05-04 | Fisons Limited | 4 oxo-2(tetrazol-5-yl)4h-1-benzopyrans for treating allergic asthma |
| US3867407A (en) * | 1971-08-23 | 1975-02-18 | Jurg R Pfister | Substituted xanthone carboxylic acid compounds |
| US3859442A (en) * | 1971-08-23 | 1975-01-07 | Syntex Inc | A method of inhibiting symptoms of asthma |
| BE787843A (fr) * | 1971-08-23 | 1973-02-22 | Syntex Corp | Nouveaux composes d'acides xanthone-carboxyliques substitues |
| US3885038A (en) * | 1971-08-23 | 1975-05-20 | Syntex Inc | Method of using substituted xanthone carboxylic acid |
| US3950342A (en) * | 1971-09-08 | 1976-04-13 | Burroughs Wellcome Co. | Acridone-dicarboxylic acids |
| US4061768A (en) * | 1971-09-08 | 1977-12-06 | Burroughs Wellcome Co. | Certain cyclic carbonyl compounds used in the prophylaxis of allergic conditions |
| US3959482A (en) * | 1971-09-08 | 1976-05-25 | Burroughs Wellcome Co. | Fluorenone carboxylic acids for the prevention of the symptoms of asthma and allergin rhinitis |
| BE789822A (fr) * | 1971-10-08 | 1973-04-06 | Allen & Hanburys Ltd | Nouveaux composes heterocycliques |
| US3886181A (en) * | 1972-01-12 | 1975-05-27 | Syntex Inc | Disubstituted xanthone carboxylic acid compounds |
| BE793751A (fr) * | 1972-01-12 | 1973-07-09 | Syntex Corp | Nouveaux composes d'acides xanthone-carboxyliques disubstitues |
| BE793749A (fr) * | 1972-01-12 | 1973-07-09 | Syntex Corp | Nouveaux composes d'acides xanthone-carboxyliques disubstitues |
| US3894049A (en) * | 1972-06-05 | 1975-07-08 | Syntex Inc | Disubstituted xanthone carboxylic acid compounds |
| NL7209622A (member.php) * | 1972-01-12 | 1973-07-16 | ||
| US4250182A (en) * | 1972-02-24 | 1981-02-10 | Burroughs Wellcome Co. | Pharmaceutical composition containing acridone compounds and method of using same |
| US3928379A (en) * | 1972-03-03 | 1975-12-23 | Mead Johnson & Co | N-phenyl amidines |
| US3949084A (en) * | 1972-03-03 | 1976-04-06 | Syntex (U.S.A.) Inc. | Novel substituted xanthone carboxylic acid compounds |
| US3835157A (en) * | 1972-05-17 | 1974-09-10 | Syntex Inc | Heterocyclic substituted xanthone carboxylic acid compounds |
| US3835158A (en) * | 1972-05-17 | 1974-09-10 | Syntex Inc | Heterocyclic substituted xanthone carboxylic acid compounds |
| US4012499A (en) * | 1972-05-19 | 1977-03-15 | Burroughs Wellcome Co. | Cyclic sulphur compounds |
| GB1447031A (en) * | 1972-05-19 | 1976-08-25 | Wellcome Found | Tricyclic sulphones and pharmaceutical compositions containing them |
| US3910957A (en) * | 1972-06-05 | 1975-10-07 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| US3835139A (en) * | 1972-07-19 | 1974-09-10 | Syntex Inc | N-substituted acridone carboxylic acids and derivatives |
| BE793954A (fr) * | 1972-07-19 | 1973-07-12 | Syntex Corp | Acides thioxanthone-carboxyliques et leurs derives |
| US4025635A (en) * | 1972-09-06 | 1977-05-24 | Burroughs Wellcome Co. | Cyclic sulphur compounds |
| US4094968A (en) * | 1972-09-06 | 1978-06-13 | Burroughs Wellcome Co. | Treatment for allergy and method of composition thereof |
| US4039556A (en) * | 1972-09-06 | 1977-08-02 | Burroughs Wellcome Co. | Substituted carbonyl compounds |
| GB1452891A (en) * | 1972-09-06 | 1976-10-20 | Wellcome Found | Tricyclic tetrazole derivatives their synthesis and compositions containing them |
| US4127573A (en) * | 1972-09-06 | 1978-11-28 | Burroughs Wellcome Co. | Ditetrazole substituted acridone compounds |
| US3939276A (en) * | 1972-09-07 | 1976-02-17 | Burroughs Wellcome Co. | Cyclic carbonyl compounds |
| BE793865A (fr) * | 1972-09-25 | 1973-07-10 | Syntex Corp | Composes d'acides xanthone-carboxyliques substitues par des groupes alcenyles et alcynyles |
| BE793864A (fr) * | 1972-09-25 | 1973-07-10 | Syntex Corp | Derives d'acide xanthone-carboxylique substitues par un groupement ether non sature |
| US3919211A (en) * | 1973-02-12 | 1975-11-11 | American Home Prod | 9-Oxoxanthene-N,N{40 -bis(substituted)-2,7-disulfonamides |
| NL7403583A (member.php) * | 1973-03-19 | 1974-09-23 | ||
| US3963752A (en) * | 1974-01-08 | 1976-06-15 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3963753A (en) * | 1974-01-08 | 1976-06-15 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3965115A (en) * | 1974-01-08 | 1976-06-22 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US4107172A (en) * | 1974-03-01 | 1978-08-15 | Abbott Laboratories | Uricosuric diuretic composition |
| US3951618A (en) * | 1974-03-12 | 1976-04-20 | Syntex (U.S.A.) Inc. | Method of use of, and compositions containing, disubstituted xanthone carboxylic acid compounds |
| JPS5516432B2 (member.php) * | 1974-05-28 | 1980-05-01 | ||
| US3920826A (en) * | 1974-07-01 | 1975-11-18 | American Home Prod | Method of treating antiarrhythmic activity with bis(2-(dialkylamino)ethoxy)xanthen-9-one antiarrhythmic agents |
| US3979414A (en) * | 1975-03-13 | 1976-09-07 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3988352A (en) * | 1975-03-13 | 1976-10-26 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3989720A (en) * | 1975-03-13 | 1976-11-02 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3989721A (en) * | 1975-03-13 | 1976-11-02 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US4035368A (en) * | 1975-04-02 | 1977-07-12 | Riker Laboratories, Inc. | Substituted 3-(1H-tetrazol-5-yl)-quinoline compounds |
| US4103015A (en) * | 1975-06-12 | 1978-07-25 | Burroughs Wellcome Co. | Antiallergic cyclic sulphur compounds |
| US4007205A (en) * | 1976-03-16 | 1977-02-08 | Warner-Lambert Company | 7-Substituted-9-oxoxanthene-2-carboxaldehydes |
| US4221800A (en) * | 1977-12-23 | 1980-09-09 | Miles Laboratories, Inc. | Cycloalkenochromone |
| US4232040A (en) * | 1978-03-08 | 1980-11-04 | Syntex (U.S.A.) Inc. | Compositions for and a method of preventing diabetic complications |
| US4217361A (en) * | 1978-05-22 | 1980-08-12 | Syntex (U.S.A.) Inc. | Disubstituted xanthone-2-carboxylic acid antiallergy agents |
| US4282365A (en) * | 1978-11-24 | 1981-08-04 | Merck & Co., Inc. | Dibenz[b,e]oxepin compounds |
| JPS5576873A (en) * | 1978-11-30 | 1980-06-10 | Kaken Pharmaceut Co Ltd | Coumarin derivative, its preparation, and antiallergic drugs containing it as active constituent |
| IL59104A (en) * | 1979-02-09 | 1984-02-29 | Roussel Uclaf | Heterotricyclic derivatives,process for their preparation and pharmaceutical compositions incorporating them |
| FR2492372A1 (fr) * | 1980-10-21 | 1982-04-23 | Cird | Dihydroxy-1,8 anthrones-9 substituees en position 10 et leur utilisation en medecine humaine ou veterinaire et en cosmetique |
| IL68498A (en) * | 1982-04-27 | 1986-09-30 | Wellcome Found | Xanthene-and xanthone-3-carboxylic acids and(5-tetrazolyl)derivatives thereof,their preparation and pharmaceutical compositions containing them |
| US4544557A (en) * | 1982-07-29 | 1985-10-01 | Merck & Co., Inc. | 6-(1-Hydroxyethyl)-2-(2-aminoethylthio)-3-tetrazoly-1-carbadethiapen-2-em |
| GB8328495D0 (en) * | 1983-10-25 | 1983-11-23 | Wellcome Found | Pharmacologically active ketones |
| EP0430881A3 (en) * | 1989-11-29 | 1991-10-23 | Ciba-Geigy Ag | Photochromic compounds, process for their preparation and their use |
| CN102180858A (zh) * | 2011-04-08 | 2011-09-14 | 华东师范大学 | 一取代或二取代呫吨酮化合物及合成方法 |
| AU2017355603A1 (en) | 2016-11-04 | 2019-06-20 | Auckland Uniservices Limited | Tricyclic heterocyclic derivatives and uses thereof |
| US11970505B1 (en) | 2023-11-07 | 2024-04-30 | King Faisal University | Pyridino-2,16-dioxapentacyclo[7.7.5.01,21.03,8.010,15]henicosa3(8),10,12,14-tetraene-7,20-dione as an antimicrobial compound |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB708917A (en) * | 1951-01-29 | 1954-05-12 | Ward Blenkinsop & Co Ltd | Xanthones and process for the production thereof |
| FR1417961A (fr) * | 1961-01-19 | 1965-11-19 | Cassella Farbwerke Mainkur Ag | Procédé de préparation de dérivés d'hydroxy-xanthones |
-
0
- BE BE759292D patent/BE759292A/xx unknown
-
1969
- 1969-11-27 GB GB5812169A patent/GB1312620A/en not_active Expired
-
1970
- 1970-11-12 IE IE1448/70A patent/IE34720B1/xx unknown
- 1970-11-16 AT AT1028170A patent/AT304547B/de not_active IP Right Cessation
- 1970-11-16 ZA ZA707727A patent/ZA707727B/xx unknown
- 1970-11-16 IL IL35668A patent/IL35668A/xx unknown
- 1970-11-17 US US90444A patent/US3706768A/en not_active Expired - Lifetime
- 1970-11-18 FI FI3099/70A patent/FI56005C/fi active
- 1970-11-19 CA CA098544A patent/CA930743A/en not_active Expired
- 1970-11-23 PL PL1970144588A patent/PL81223B1/pl unknown
- 1970-11-25 CS CS7950A patent/CS172918B4/cs unknown
- 1970-11-26 NL NL7017336A patent/NL7017336A/xx not_active Application Discontinuation
- 1970-11-26 SE SE7016049A patent/SE382459B/xx unknown
- 1970-11-26 PH PH11987A patent/PH11097A/en unknown
- 1970-11-26 NO NO4538/70A patent/NO133367C/no unknown
- 1970-11-26 ES ES385927A patent/ES385927A1/es not_active Expired
- 1970-11-26 DE DE2058295A patent/DE2058295C3/de not_active Expired
- 1970-11-27 DK DK607370AA patent/DK130740B/da unknown
- 1970-11-27 HU HUHA902A patent/HU162579B/hu unknown
- 1970-11-27 CH CH1760070A patent/CH557347A/xx not_active IP Right Cessation
- 1970-11-27 FR FR707042706A patent/FR2073425B1/fr not_active Expired
-
1972
- 1972-03-08 US US00232954A patent/US3755319A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2073425A1 (member.php) | 1971-10-01 |
| NL7017336A (member.php) | 1971-06-01 |
| IL35668A0 (en) | 1971-01-28 |
| AT304547B (de) | 1973-01-10 |
| HU162579B (member.php) | 1973-03-28 |
| FI56005C (fi) | 1979-11-12 |
| GB1312620A (en) | 1973-04-04 |
| FI56005B (fi) | 1979-07-31 |
| IL35668A (en) | 1973-08-29 |
| DE2058295C3 (de) | 1980-06-19 |
| PL81223B1 (member.php) | 1975-08-30 |
| CA930743A (en) | 1973-07-24 |
| DK130740B (da) | 1975-04-07 |
| US3755319A (en) | 1973-08-28 |
| NO133367C (member.php) | 1976-04-21 |
| ES385927A1 (es) | 1973-12-01 |
| CS172918B4 (member.php) | 1977-01-28 |
| NO133367B (member.php) | 1976-01-12 |
| DE2058295B2 (de) | 1979-10-04 |
| ZA707727B (en) | 1971-08-25 |
| IE34720L (en) | 1971-05-27 |
| IE34720B1 (en) | 1975-07-23 |
| DK130740C (member.php) | 1975-09-08 |
| DE2058295A1 (de) | 1971-06-03 |
| BE759292A (fr) | 1971-05-24 |
| PH11097A (en) | 1977-10-25 |
| US3706768A (en) | 1972-12-19 |
| FR2073425B1 (member.php) | 1974-06-21 |
| SE382459B (sv) | 1976-02-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH557347A (de) | Verfahren zur herstellung von xanthonderivaten. | |
| CH552607A (de) | Verfahren zur herstellung von azaspiroalkandion-derivaten. | |
| CH557322A (de) | Verfahren zur herstellung von methylenmalonester. | |
| CH554877A (de) | Verfahren zur herstellung von neuen chinazolinon- bzw. chinazolinthionderivaten. | |
| CH553833A (de) | Verfahren zur herstellung von hochmolekularen polyamidimiden. | |
| CH549569A (de) | Verfahren zur herstellung von aminopyridonen und aminothiopyridonen. | |
| CH554830A (de) | Verfahren zur herstellung von styrylaralkylaminen. | |
| CH547290A (de) | Verfahren zur herstellung von nitro-imidazolderivaten. | |
| CH558349A (de) | Verfahren zur herstellung von furan-3-carboxamiden. | |
| CH549599A (de) | Verfahren zur herstellung von neuen 5-nitrofuranderivaten. | |
| CH547819A (de) | Verfahren zur herstellung von isothiazolderiavaten. | |
| CH546746A (de) | Verfahren zur herstellung von halogenierten sulfonamiden. | |
| CH553797A (de) | Verfahren zur herstellung von heterocyclischen verbindungen. | |
| CH550166A (de) | Verfahren zur herstellung von indolderivaten. | |
| CH555801A (de) | Verfahren zur herstellung von phenylaethanolamin-derivaten. | |
| CH551991A (de) | Verfahren zur herstellung von azacarbazolen. | |
| AT323713B (de) | Verfahren zur herstellung von cycloalkanonoximen | |
| CH555826A (de) | Verfahren zur herstellung von indolderivaten. | |
| CH548979A (de) | Verfahren zur herstellung von chalconderivaten. | |
| CH555366A (de) | Verfahren zur herstellung von 3-aza-a-homo-steroide. | |
| CH550164A (de) | Verfahren zur herstellung von erythromycyl-b-amin. | |
| CH550812A (de) | Verfahren zur herstellung von heterocyclischen verbindungen. | |
| CH557362A (de) | Verfahren zur herstellung von l-pyroglutamyl-l-histidyl -l-prolinamid. | |
| CH550128A (de) | Verfahren zur herstellung von pent-4-en-1-alen. | |
| AT306013B (de) | Verfahren zur herstellung von 3-methyl-7-methoxy-8-dimethylaminomethyl-flavon |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |