CH459174A - Verfahren zur Herstellung neuer Carbanilid-Verbindungen - Google Patents
Verfahren zur Herstellung neuer Carbanilid-VerbindungenInfo
- Publication number
- CH459174A CH459174A CH935164A CH935164A CH459174A CH 459174 A CH459174 A CH 459174A CH 935164 A CH935164 A CH 935164A CH 935164 A CH935164 A CH 935164A CH 459174 A CH459174 A CH 459174A
- Authority
- CH
- Switzerland
- Prior art keywords
- preparation
- new
- carbanilide compounds
- carbanilide
- compounds
- Prior art date
Links
- GWEHVDNNLFDJLR-UHFFFAOYSA-N 1,3-diphenylurea Chemical class C=1C=CC=CC=1NC(=O)NC1=CC=CC=C1 GWEHVDNNLFDJLR-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1809—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas with formation of the N-C(O)-N moiety
- C07C273/1818—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas with formation of the N-C(O)-N moiety from -N=C=O and XNR'R"
- C07C273/1827—X being H
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US295819A US3284433A (en) | 1963-07-17 | 1963-07-17 | 4-phenoxy-carbanilides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH459174A true CH459174A (de) | 1968-07-15 |
Family
ID=23139356
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH935164A CH459174A (de) | 1963-07-17 | 1964-07-16 | Verfahren zur Herstellung neuer Carbanilid-Verbindungen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3284433A (de) |
| BR (1) | BR6460879D0 (de) |
| CH (1) | CH459174A (de) |
| DE (1) | DE1468337A1 (de) |
| GB (1) | GB1068887A (de) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2504983C2 (de) * | 1975-02-06 | 1982-10-21 | Bayer Ag, 5090 Leverkusen | Benzoylureido-nitro-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2531202C2 (de) * | 1975-07-12 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | 2',4-Dichlor-4'-benzoylureido- diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| US4468380A (en) * | 1979-12-26 | 1984-08-28 | Eli Lilly And Company | Anticoccidial combinations comprising polyether antibiotics and carbanilides |
| US4526997A (en) * | 1981-05-06 | 1985-07-02 | Doherty George O P O | Anticoccidial combinations comprising polyether antibiotics and carbanilides |
| SK282727B6 (sk) * | 1997-12-19 | 2002-11-06 | Slovakofarma, A. S. | 1,3-Disubstituované močoviny - inhibítory ACAT a spôsob ich prípravy |
| TR200100874T2 (tr) * | 1997-12-22 | 2001-06-21 | Bayer Corporation | Simetrik ve simetrik olmayan sübstitüe edilmiş difenil üreler kullanılarak raf kinazın inhibe edilmesi |
| US7517880B2 (en) | 1997-12-22 | 2009-04-14 | Bayer Pharmaceuticals Corporation | Inhibition of p38 kinase using symmetrical and unsymmetrical diphenyl ureas |
| EP2298311B1 (de) | 1999-01-13 | 2012-05-09 | Bayer HealthCare LLC | Omega-carboxyarylsubstituierte-Diphenyl-Harnstoffe als p38-Kinasehemmer |
| EP1140840B1 (de) | 1999-01-13 | 2006-03-22 | Bayer Pharmaceuticals Corp. | -g(v)-carboxyaryl substituierte diphenyl harnstoffe als raf kinase inhibitoren |
| RU2319693C9 (ru) | 1999-01-13 | 2008-08-20 | Байер Копэрейшн | Производные мочевины (варианты), фармацевтическая композиция (варианты) и способ лечения заболевания, связанного с ростом раковых клеток (варианты) |
| US8124630B2 (en) | 1999-01-13 | 2012-02-28 | Bayer Healthcare Llc | ω-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| SE9903894D0 (sv) | 1999-10-28 | 1999-10-28 | New Pharma Research Ab | Novel compounds |
| ES2391382T3 (es) * | 2001-12-03 | 2012-11-23 | Bayer Healthcare Llc | Compuestos de aril-urea en combinación con otros agentes citostáticos o citotóxicos para tratamiento de cánceres humanos |
| US20030207872A1 (en) * | 2002-01-11 | 2003-11-06 | Bayer Corporation | Omega-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| US7838541B2 (en) | 2002-02-11 | 2010-11-23 | Bayer Healthcare, Llc | Aryl ureas with angiogenesis inhibiting activity |
| UY28213A1 (es) | 2003-02-28 | 2004-09-30 | Bayer Pharmaceuticals Corp | Nuevos derivados de cianopiridina útiles en el tratamiento de cáncer y otros trastornos. |
| CA2526617C (en) * | 2003-05-20 | 2015-04-28 | Bayer Pharmaceuticals Corporation | Diaryl ureas with kinase inhibiting activity |
| ME00294B (me) | 2003-07-23 | 2011-05-10 | Bayer Pharmaceuticals Corp | Fluoro supstituisana omega-karaboksiaril difenil urea za liječenje i prevenciju bolesti i stanja bolesti |
| ATE517885T1 (de) * | 2004-04-30 | 2011-08-15 | Bayer Healthcare Llc | Substituierte pyrazolyl-harnstoff-derivate zur behandlung von krebs |
| CN110523091A (zh) * | 2019-08-22 | 2019-12-03 | 临沂市博士爱文具有限公司 | 一种具有抗菌功能的儿童安全水晶泥制备工艺 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2731382A (en) * | 1954-12-29 | 1956-01-17 | Merck & Co Inc | Pyrimidine substituted urea complexes and processes for preparing the same |
| US2731383A (en) * | 1955-02-11 | 1956-01-17 | Merck & Co Inc | Substituted urea-amide complex |
| US2951010A (en) * | 1955-09-26 | 1960-08-30 | Merck & Co Inc | Substituted carbanilide compositions for treating coccidiosis |
| US2879201A (en) * | 1955-10-12 | 1959-03-24 | Salsbury S Lab Dr | Coccidiostatic remedies |
| US2876260A (en) * | 1956-08-27 | 1959-03-03 | Dow Chemical Co | Preparation of symmetrical disubstituted ureas |
| US2857430A (en) * | 1956-12-31 | 1958-10-21 | Monsanto Chemicals | Preparation of ureas |
-
1963
- 1963-07-17 US US295819A patent/US3284433A/en not_active Expired - Lifetime
-
1964
- 1964-07-01 GB GB27184/64A patent/GB1068887A/en not_active Expired
- 1964-07-15 BR BR160879/64A patent/BR6460879D0/pt unknown
- 1964-07-16 CH CH935164A patent/CH459174A/de unknown
- 1964-07-16 DE DE19641468337 patent/DE1468337A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US3284433A (en) | 1966-11-08 |
| GB1068887A (en) | 1967-05-17 |
| DE1468337A1 (de) | 1968-11-28 |
| BR6460879D0 (pt) | 1973-08-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT260948B (de) | Verfahren zur Herstellung neuer, substituierter Hydroxyhydrocarbyloxyalkylsiloxane | |
| CH459174A (de) | Verfahren zur Herstellung neuer Carbanilid-Verbindungen | |
| CH476724A (de) | Verfahren zur Herstellung neuer Indolverbindungen | |
| AT258875B (de) | Verfahren zur Herstellung neuer β-Aminopropionsäureamidderivate | |
| CH454856A (de) | Verfahren zur Herstellung substituierter Isoindolenine | |
| CH467751A (de) | Verfahren zur Herstellung neuer disubstituierter Aminoäthoxyphenylderivate | |
| CH441332A (de) | Verfahren zur Herstellung neuer Benzolsulfonylsemicarbazide | |
| AT247323B (de) | Verfahren zur Herstellung neuer Piperidinverbindungen | |
| CH451169A (de) | Verfahren zur Herstellung neuer substituierter Phenylamino-1,3-diazacyclopentene-(2) | |
| CH443310A (de) | Verfahren zur Herstellung neuer 2-Methyl-3-phenyl-3H-4-chinazolone | |
| AT249047B (de) | Verfahren zur Herstellung neuer Benzamidobenzanilid-Derivate | |
| CH485746A (de) | Verfahren zur Herstellung neuer Benzo-azacycloalkene | |
| AT260202B (de) | Verfahren zur Herstellung neuer Dibenzocycloheptaenverbindungen | |
| CH471136A (de) | Verfahren zur Herstellung neuer 1,3-Dihydro-5-aryl-2H-1,4-benzodiazepin-2-on-4-oxyde | |
| CH421107A (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen | |
| CH448049A (de) | Verfahren zur Herstellung neuer Benzolsulfonylsemicarbazide | |
| AT247364B (de) | Verfahren zur Herstellung neuer Organophosphorverbindungen | |
| CH476672A (de) | Verfahren zur Herstellung neuer 1-(N-Alkinylamino)-Acenaphthene | |
| AT244510B (de) | Verfahren zur Herstellung neuer Colchicinderivate | |
| CH457450A (de) | Verfahren zur Herstellung neuer 2-Methyl-3-phenyl-3H-4-chinazolone | |
| CH467257A (de) | Verfahren zur Herstellung neuer Isatin-B-Thiosemicarbazone | |
| AT244953B (de) | Verfahren zur Herstellung neuer 5-Nitro-2-furamidine | |
| CH448337A (de) | Verfahren zur Herstellung neuer 1-Amino-2-benzoyl-4-hydroxyanthrachinone | |
| CH439307A (de) | Verfahren zur Herstellung neuer Phthalazinium-Verbindungen | |
| CH459193A (de) | Verfahren zur Herstellung neuer 1-Methyl- 1-5a-androsten-17B-ol-3-on-17-ester |