CH450417A - Procédé pour préparer des esters de l'acide cyclopropanecarboxylique - Google Patents
Procédé pour préparer des esters de l'acide cyclopropanecarboxyliqueInfo
- Publication number
- CH450417A CH450417A CH471264A CH471264A CH450417A CH 450417 A CH450417 A CH 450417A CH 471264 A CH471264 A CH 471264A CH 471264 A CH471264 A CH 471264A CH 450417 A CH450417 A CH 450417A
- Authority
- CH
- Switzerland
- Prior art keywords
- cyclohexene
- acid
- dicarboximide
- preparation
- methyl
- Prior art date
Links
- 150000002148 esters Chemical class 0.000 title claims description 25
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 239000000203 mixture Substances 0.000 claims description 29
- 238000000034 method Methods 0.000 claims description 21
- 238000002360 preparation method Methods 0.000 claims description 21
- 241000257226 Muscidae Species 0.000 claims description 19
- 230000000749 insecticidal effect Effects 0.000 claims description 14
- ZCVAOQKBXKSDMS-AQYZNVCMSA-N (+)-trans-allethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(CC=C)C(=O)C1 ZCVAOQKBXKSDMS-AQYZNVCMSA-N 0.000 claims description 11
- FMTFEIJHMMQUJI-NJAFHUGGSA-N 102130-98-3 Natural products CC=CCC1=C(C)[C@H](CC1=O)OC(=O)[C@@H]1[C@@H](C=C(C)C)C1(C)C FMTFEIJHMMQUJI-NJAFHUGGSA-N 0.000 claims description 11
- 229940024113 allethrin Drugs 0.000 claims description 11
- -1 atom halogen Chemical class 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 239000004495 emulsifiable concentrate Substances 0.000 claims description 5
- 239000000843 powder Substances 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 150000003863 ammonium salts Chemical class 0.000 claims description 3
- 239000000159 acid neutralizing agent Substances 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims description 2
- 239000000443 aerosol Substances 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 239000000243 solution Substances 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 229910052739 hydrogen Inorganic materials 0.000 description 18
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 235000020075 ouzo Nutrition 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- VNTCVNLNEOVBEE-UHFFFAOYSA-N 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride Chemical compound CC(C)=CC1C(C(Cl)=O)C1(C)C VNTCVNLNEOVBEE-UHFFFAOYSA-N 0.000 description 9
- 241000255925 Diptera Species 0.000 description 7
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 7
- 239000003350 kerosene Substances 0.000 description 7
- 239000008096 xylene Substances 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- XLOPRKKSAJMMEW-UHFFFAOYSA-N chrysanthemic acid Chemical compound CC(C)=CC1C(C(O)=O)C1(C)C XLOPRKKSAJMMEW-UHFFFAOYSA-N 0.000 description 6
- 125000005843 halogen group Chemical group 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- XLOPRKKSAJMMEW-SFYZADRCSA-N Chrysanthemic acid Natural products CC(C)=C[C@@H]1[C@@H](C(O)=O)C1(C)C XLOPRKKSAJMMEW-SFYZADRCSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000012263 liquid product Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- QQHOVRKETYPQHY-UHFFFAOYSA-N 2-(hydroxymethyl)-4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound O=C1N(CO)C(=O)C2=C1CCCC2 QQHOVRKETYPQHY-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 230000034994 death Effects 0.000 description 4
- 231100000517 death Toxicity 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- UIWNHGWOYRFCSF-KTERXBQFSA-N (1r,3r)-3-[(e)-3-methoxy-2-methyl-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound COC(=O)C(\C)=C\[C@@H]1[C@@H](C(O)=O)C1(C)C UIWNHGWOYRFCSF-KTERXBQFSA-N 0.000 description 3
- UZPWKTCMUADILM-UHFFFAOYSA-N 3-methylcyclohexene Chemical compound CC1CCCC=C1 UZPWKTCMUADILM-UHFFFAOYSA-N 0.000 description 3
- FSWCCQWDVGZMRD-UHFFFAOYSA-N 4-methylcyclohexene Chemical compound CC1CCC=CC1 FSWCCQWDVGZMRD-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- UIWNHGWOYRFCSF-UHFFFAOYSA-N Pyrethric acid Natural products COC(=O)C(C)=CC1C(C(O)=O)C1(C)C UIWNHGWOYRFCSF-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- 125000005907 alkyl ester group Chemical group 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- WZRUHNUBXOTVHG-PKNBQFBNSA-N (2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl) 3-[(e)-3-methoxy-2-methyl-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)C(/C=C(\C)C(=O)OC)C1C(=O)OC1C(C)=C(CC=C)C(=O)C1 WZRUHNUBXOTVHG-PKNBQFBNSA-N 0.000 description 2
- UXTFKIJKRJJXNV-UHFFFAOYSA-N 1-$l^{1}-oxidanylethanone Chemical compound CC([O])=O UXTFKIJKRJJXNV-UHFFFAOYSA-N 0.000 description 2
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- GOLYTYCPRGMBRU-UHFFFAOYSA-N 2-(hydroxymethyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione Chemical class C1CC=CC2C(=O)N(CO)C(=O)C21 GOLYTYCPRGMBRU-UHFFFAOYSA-N 0.000 description 2
- OJDVOZSAUINMCR-UHFFFAOYSA-N 2-(hydroxymethyl)-4-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound OCN1C(=O)C2C(C(C=CC2)C)C1=O OJDVOZSAUINMCR-UHFFFAOYSA-N 0.000 description 2
- ADPYSZNUBWNLDH-UHFFFAOYSA-N 3,6-dimethylcyclohexene Chemical compound CC1CCC(C)C=C1 ADPYSZNUBWNLDH-UHFFFAOYSA-N 0.000 description 2
- CIFFBTOJCKSRJY-UHFFFAOYSA-N 3α,4,7,7α-tetrahydro-1h-isoindole-1,3(2h)-dione Chemical compound C1C=CCC2C(=O)NC(=O)C21 CIFFBTOJCKSRJY-UHFFFAOYSA-N 0.000 description 2
- 241000723353 Chrysanthemum Species 0.000 description 2
- 235000007516 Chrysanthemum Nutrition 0.000 description 2
- 241000256059 Culex pipiens Species 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 241000257159 Musca domestica Species 0.000 description 2
- LDUMGZICOGBZGN-UHFFFAOYSA-N OCN1C(=O)C2C(C(C=CC2)OC(C)=O)C1=O Chemical compound OCN1C(=O)C2C(C(C=CC2)OC(C)=O)C1=O LDUMGZICOGBZGN-UHFFFAOYSA-N 0.000 description 2
- VQXSOUPNOZTNAI-UHFFFAOYSA-N Pyrethrin I Natural products CC(=CC1CC1C(=O)OC2CC(=O)C(=C2C)CC=C/C=C)C VQXSOUPNOZTNAI-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 240000004460 Tanacetum coccineum Species 0.000 description 2
- ROVGZAWFACYCSP-MQBLHHJJSA-N [2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(C\C=C/C=C)C(=O)C1 ROVGZAWFACYCSP-MQBLHHJJSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000003595 mist Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- HYJYGLGUBUDSLJ-UHFFFAOYSA-N pyrethrin Natural products CCC(=O)OC1CC(=C)C2CC3OC3(C)C2C2OC(=O)C(=C)C12 HYJYGLGUBUDSLJ-UHFFFAOYSA-N 0.000 description 2
- VJFUPGQZSXIULQ-XIGJTORUSA-N pyrethrin II Chemical compound CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VJFUPGQZSXIULQ-XIGJTORUSA-N 0.000 description 2
- 239000002728 pyrethroid Substances 0.000 description 2
- 229940015367 pyrethrum Drugs 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- CXBMCYHAMVGWJQ-UHFFFAOYSA-N tetramethrin Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OCN1C(=O)C(CCCC2)=C2C1=O CXBMCYHAMVGWJQ-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- GZZBBYJSUJRPMA-UHFFFAOYSA-N 1,2,3,6-tetramethylcyclohexene Chemical compound CC1CCC(C)C(C)=C1C GZZBBYJSUJRPMA-UHFFFAOYSA-N 0.000 description 1
- CTMHWPIWNRWQEG-UHFFFAOYSA-N 1-methylcyclohexene Chemical compound CC1=CCCCC1 CTMHWPIWNRWQEG-UHFFFAOYSA-N 0.000 description 1
- HSHRRGMIKGDTLF-UHFFFAOYSA-N 2-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CCC2C(=O)N(CO)C(=O)C21 HSHRRGMIKGDTLF-UHFFFAOYSA-N 0.000 description 1
- CUNHUWXYOZIPME-UHFFFAOYSA-N 2-(hydroxymethyl)-4,7-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound OCN1C(=O)C2C(C(C=CC2C)C)C1=O CUNHUWXYOZIPME-UHFFFAOYSA-N 0.000 description 1
- AYLMYXGASQGQTG-UHFFFAOYSA-N 2-(hydroxymethyl)-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound OCN1C(=O)C2C(CC(=CC2)C)C1=O AYLMYXGASQGQTG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- KNAGFNYSMXRYMW-UHFFFAOYSA-N 3,6-dichlorocyclohexene Chemical compound ClC1CCC(Cl)C=C1 KNAGFNYSMXRYMW-UHFFFAOYSA-N 0.000 description 1
- XXTFGUFRXPWYDA-SNAWJCMRSA-N 3-[(e)-2-carboxyprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound OC(=O)C(/C)=C/C1C(C(O)=O)C1(C)C XXTFGUFRXPWYDA-SNAWJCMRSA-N 0.000 description 1
- AJKDUJRRWLQXHM-UHFFFAOYSA-N 3-bromocyclohexene Chemical compound BrC1CCCC=C1 AJKDUJRRWLQXHM-UHFFFAOYSA-N 0.000 description 1
- LNGQLHZIYFQUIR-UHFFFAOYSA-N 3-chlorocyclohexene Chemical compound ClC1CCCC=C1 LNGQLHZIYFQUIR-UHFFFAOYSA-N 0.000 description 1
- SPAMRUYRVYMHPV-UHFFFAOYSA-N 3a,4,5,7a-tetrahydroisoindole-1,3-dione Chemical class C1=CCCC2C(=O)NC(=O)C21 SPAMRUYRVYMHPV-UHFFFAOYSA-N 0.000 description 1
- AFJWMGOTLUUGHF-UHFFFAOYSA-N 4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound C1CCCC2=C1C(=O)NC2=O AFJWMGOTLUUGHF-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 241001674044 Blattodea Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XXTFGUFRXPWYDA-UHFFFAOYSA-N Chrysanthemumdicarboxylic acid Natural products OC(=O)C(C)=CC1C(C(O)=O)C1(C)C XXTFGUFRXPWYDA-UHFFFAOYSA-N 0.000 description 1
- FMTFEIJHMMQUJI-UHFFFAOYSA-N Cinerin I Natural products C1C(=O)C(CC=CC)=C(C)C1OC(=O)C1C(C)(C)C1C=C(C)C FMTFEIJHMMQUJI-UHFFFAOYSA-N 0.000 description 1
- 239000005947 Dimethoate Substances 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 239000005949 Malathion Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- OCBOMFWBKYNJOT-UHFFFAOYSA-N OCN1C(=O)C2(C(CC=CC2)C1=O)C Chemical compound OCN1C(=O)C2(C(CC=CC2)C1=O)C OCBOMFWBKYNJOT-UHFFFAOYSA-N 0.000 description 1
- MEFXDQXGPFFJSZ-UHFFFAOYSA-N OCN1C(=O)C2=C(C(CCC2)C)C1=O Chemical compound OCN1C(=O)C2=C(C(CCC2)C)C1=O MEFXDQXGPFFJSZ-UHFFFAOYSA-N 0.000 description 1
- JPXVGPKTQFZNFJ-UHFFFAOYSA-N OCN1C(=O)C2=C(C(CCC2C)C)C1=O Chemical compound OCN1C(=O)C2=C(C(CCC2C)C)C1=O JPXVGPKTQFZNFJ-UHFFFAOYSA-N 0.000 description 1
- 206010058667 Oral toxicity Diseases 0.000 description 1
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- ZCVAOQKBXKSDMS-UHFFFAOYSA-N allethrin Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OC1C(C)=C(CC=C)C(=O)C1 ZCVAOQKBXKSDMS-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229930193529 cinerin Natural products 0.000 description 1
- FMTFEIJHMMQUJI-DFKXKMKHSA-N cinerin I Chemical compound C1C(=O)C(C\C=C/C)=C(C)[C@H]1OC(=O)[C@H]1C(C)(C)[C@@H]1C=C(C)C FMTFEIJHMMQUJI-DFKXKMKHSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- MQNAWGURFBPDMW-UHFFFAOYSA-N cyclohex-2-en-1-yl acetate Chemical compound CC(=O)OC1CCCC=C1 MQNAWGURFBPDMW-UHFFFAOYSA-N 0.000 description 1
- IFDVQVHZEKPUSC-UHFFFAOYSA-N cyclohex-3-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCC=CC1C(O)=O IFDVQVHZEKPUSC-UHFFFAOYSA-N 0.000 description 1
- LZEPOJMTQYNFTR-UHFFFAOYSA-N cyclopropanecarbonyl cyclopropanecarboxylate Chemical compound C1CC1C(=O)OC(=O)C1CC1 LZEPOJMTQYNFTR-UHFFFAOYSA-N 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- ZJUGAXARPHQZMX-UHFFFAOYSA-N dihydroxy-(3-methyl-4-nitrophenoxy)-sulfanylidene-$l^{5}-phosphane Chemical compound CC1=CC(OP(O)(O)=S)=CC=C1[N+]([O-])=O ZJUGAXARPHQZMX-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000004119 disulfanediyl group Chemical group *SS* 0.000 description 1
- VIMXTGUGWLAOFZ-UHFFFAOYSA-N ethyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CCOC(=O)C1C(C=C(C)C)C1(C)C VIMXTGUGWLAOFZ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229960000453 malathion Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 231100000418 oral toxicity Toxicity 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229940048383 pyrethrum extract Drugs 0.000 description 1
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- SAGLFPFPXBBVPP-UHFFFAOYSA-M sodium 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound [Na+].CC(C)=CC1C(C([O-])=O)C1(C)C SAGLFPFPXBBVPP-UHFFFAOYSA-M 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000012747 synergistic agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- UFDHBDMSHIXOKF-UHFFFAOYSA-N tetrahydrophthalic acid Natural products OC(=O)C1=C(C(O)=O)CCCC1 UFDHBDMSHIXOKF-UHFFFAOYSA-N 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/448—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide
- C07D207/452—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide with hydrocarbon radicals, substituted by hetero atoms, directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/46—Iso-indoles; Hydrogenated iso-indoles with an oxygen atom in position 1
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
- C07D209/49—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide and having in the molecule an acyl radical containing a saturated three-membered ring, e.g. chrysanthemumic acid esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/58—[b]- or [c]-condensed
- C07D209/62—Naphtho [c] pyrroles; Hydrogenated naphtho [c] pyrroles
- C07D209/66—Naphtho [c] pyrroles; Hydrogenated naphtho [c] pyrroles with oxygen atoms in positions 1 and 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1915563 | 1963-04-11 | ||
| JP1915663 | 1963-04-11 | ||
| JP4280863 | 1963-08-13 | ||
| JP4322763 | 1963-08-15 | ||
| JP4605063 | 1963-08-29 | ||
| JP4616863 | 1963-08-30 | ||
| JP6518063 | 1963-12-03 | ||
| JP6518163 | 1963-12-03 | ||
| JP6546763 | 1963-12-04 | ||
| JP6562263 | 1963-12-05 | ||
| JP6562163 | 1963-12-05 | ||
| JP6680463 | 1963-12-10 | ||
| JP6680363 | 1963-12-10 | ||
| JP6821563 | 1963-12-17 | ||
| JP6867363 | 1963-12-19 | ||
| JP1494664 | 1964-03-18 | ||
| JP2091264 | 1964-04-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH450417A true CH450417A (fr) | 1968-01-31 |
Family
ID=27585911
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH471264A CH450417A (fr) | 1963-04-11 | 1964-04-13 | Procédé pour préparer des esters de l'acide cyclopropanecarboxylique |
| CH1037964A CH453362A (fr) | 1963-04-11 | 1964-08-07 | Procédé pour la préparation d'esters d'acides cyclopropane-carboxyliques |
| CH1554264A CH451940A (fr) | 1963-04-11 | 1964-12-02 | Procédé pour préparer des esters d'acides cyclopropanecarboxyliques |
| CH1554364A CH449619A (fr) | 1963-04-11 | 1964-12-02 | Procédé pour préparer des esters d'acides chrysanthème-carboxyliques |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1037964A CH453362A (fr) | 1963-04-11 | 1964-08-07 | Procédé pour la préparation d'esters d'acides cyclopropane-carboxyliques |
| CH1554264A CH451940A (fr) | 1963-04-11 | 1964-12-02 | Procédé pour préparer des esters d'acides cyclopropanecarboxyliques |
| CH1554364A CH449619A (fr) | 1963-04-11 | 1964-12-02 | Procédé pour préparer des esters d'acides chrysanthème-carboxyliques |
Country Status (16)
| Country | Link |
|---|---|
| US (5) | US3268398A (enFirst) |
| BE (4) | BE646399A (enFirst) |
| BR (3) | BR6458350D0 (enFirst) |
| CH (4) | CH450417A (enFirst) |
| CS (1) | CS158551B2 (enFirst) |
| CY (1) | CY392A (enFirst) |
| DE (2) | DE1283843B (enFirst) |
| DK (1) | DK115697B (enFirst) |
| FI (2) | FI44398B (enFirst) |
| GB (4) | GB1052119A (enFirst) |
| IL (2) | IL22541A (enFirst) |
| LU (2) | LU46765A1 (enFirst) |
| MY (1) | MY6700092A (enFirst) |
| NL (7) | NL6403882A (enFirst) |
| OA (1) | OA00035A (enFirst) |
| SE (3) | SE325438B (enFirst) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1052137A (enFirst) * | 1963-04-11 | |||
| NL125654C (enFirst) * | 1963-12-17 | 1900-01-01 | ||
| GB1087016A (en) * | 1964-07-08 | 1967-10-11 | Sumitomo Chemical Co | Crysanthemic acid esters, methods of making them, and insecticidal compositions including them |
| GB1102838A (en) * | 1965-02-19 | 1968-02-14 | Sumitomo Chemical Co | Cyclopropanecarboxylic acid esters, methods of making them and insecticidal compositions including them |
| US4000266A (en) * | 1968-02-29 | 1976-12-28 | Fmc Corporation | Synergistic combination of insecticides |
| US4622337A (en) * | 1972-05-25 | 1986-11-11 | National Research Development Corporation | 2,2-dimethyl-3-(2-halovinyl)cyclopropane carboxlic acid ester pesticides |
| JPS537499B2 (enFirst) * | 1974-12-05 | 1978-03-18 | ||
| US4174326A (en) * | 1975-06-18 | 1979-11-13 | Ciba-Geigy Corporation | Imidyl compounds |
| US4172836A (en) * | 1975-06-18 | 1979-10-30 | Ciba-Geigy Corporation | Imidyl compounds |
| US4107174A (en) * | 1975-06-18 | 1978-08-15 | Ciba-Geigy Corporation | Imidyl compounds |
| US4193927A (en) * | 1975-06-18 | 1980-03-18 | Ciba-Geigy Corporation | Imidyl compounds |
| US4182771A (en) * | 1976-12-01 | 1980-01-08 | Bayer Aktiengesellschaft | Synergistic arthropodicidal compositions containing α-substituted-3,4-methylenedioxyph-enylacetonitriles |
| EP0003757B1 (de) * | 1978-02-08 | 1981-10-14 | Ciba-Geigy Ag | Tricyclische Imidylderivate und Verfahren zu ihrer Herstellung |
| FR2426673A1 (fr) * | 1978-05-25 | 1979-12-21 | Nat Res Dev | Pesticides du type pyrethrine |
| US4235777A (en) * | 1979-11-19 | 1980-11-25 | Zoecon Corporation | Benzylpyrrolylmethyl esters of 3-(1,2-dibromo-2,2-dichloroethyl)-2,2-dimethylcyclopropanecarboxylic acid |
| US4327094A (en) * | 1980-01-29 | 1982-04-27 | Sumitomo Chemical Company, Limited | Insecticidal and acaricidal 3,5-dioxo-2,3,4,5-triazine compounds |
| FR2678611B1 (fr) * | 1991-07-04 | 1995-01-20 | Roussel Uclaf | Nouveaux esters pyrethrinouides de l'alcool 1,3,4,5,6,7-hexahydro 1,3-dioxo-2h-isoindol-2-yl-methylique, leur procede de preparation et leur application comme pesticides. |
| FR2708930B1 (fr) * | 1993-08-10 | 1995-09-08 | Roussel Uclaf | Nouveaux esters dérivés de l'acide 2,2-diméthyl 3-(3,3,3-trifluoro-1-propényl) cyclopropane carboxylique, leur procédé de préparation et leur application comme pesticides. |
| JP3694915B2 (ja) * | 1994-06-17 | 2005-09-14 | 住友化学株式会社 | エステル化合物およびそれを有効成分とする有害生物防除剤 |
| AU764352B2 (en) * | 1999-04-22 | 2003-08-14 | Sumitomo Chemical Company, Limited | Cockroach controlling compositions |
| ES2387927T3 (es) | 2004-12-17 | 2012-10-04 | Devgen Nv | Composiciones nematicidas |
| WO2018050213A1 (en) | 2016-09-14 | 2018-03-22 | Endura S.P.A. | Improved process for the preparation of pyrethroids |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2075359A (en) * | 1930-10-16 | 1937-03-30 | Du Pont | Insecticide |
| US1915334A (en) * | 1930-10-16 | 1933-06-27 | Du Pont | Fluosilicate of organic heterocyclic bases and process of making it |
| US2487106A (en) * | 1947-07-17 | 1949-11-08 | American Viscose Corp | Composition capable of being molded and being cast into films |
| US2872450A (en) * | 1955-12-06 | 1959-02-03 | Bayer Ag | Thio- and dithio-carboxylic acid esters and a process for their manufacture |
| DE1064064B (de) * | 1956-06-15 | 1959-08-27 | Bayer Ag | Verfahren zur Herstellung von Thionophosphorsaeureestern von N-Methylolverbindungen |
| US2943976A (en) * | 1957-10-08 | 1960-07-05 | Phillips Petroleum Co | Method of killing insects comprising applying nitropyridine and nitropyridine-1-oxide |
| US2958624A (en) * | 1958-04-30 | 1960-11-01 | Diamond Alkali Co | Method of controlling insect and fungi comprising contacting with a 1, 4-diformyl-2, 5-dimethyl piperazine |
| US3127413A (en) * | 1960-11-22 | 1964-03-31 | Neisler Lab Inc | Octahydroisoindoles |
| US3071592A (en) * | 1961-07-07 | 1963-01-01 | Us Rubber Co | N, n'-thiodimaleimide and n, n'-dithiodimaleimide |
| US3127414A (en) * | 1962-01-12 | 1964-03-31 | Du Pont | Preparation of m-phenylenedimaleimide |
| US3152138A (en) * | 1962-05-29 | 1964-10-06 | Chemagro Corp | Certain nu-(halovinylthio)imides |
| BE635902A (enFirst) * | 1962-08-06 | |||
| GB1052137A (enFirst) * | 1963-04-11 |
-
0
- GB GB1052137D patent/GB1052137A/en active Active
- NL NL127787D patent/NL127787C/xx active
- NL NL125058D patent/NL125058C/xx active
- NL NL128183D patent/NL128183C/xx active
-
1964
- 1964-04-02 GB GB1373064A patent/GB1052119A/en not_active Expired - Lifetime
- 1964-04-06 US US357756A patent/US3268398A/en not_active Expired - Lifetime
- 1964-04-08 DE DES90430A patent/DE1283843B/de active Pending
- 1964-04-09 OA OA50061A patent/OA00035A/xx unknown
- 1964-04-10 NL NL6403882A patent/NL6403882A/xx unknown
- 1964-04-10 BR BR158350/64A patent/BR6458350D0/pt unknown
- 1964-04-10 FI FI0752/64A patent/FI44398B/fi active
- 1964-04-10 BE BE646399D patent/BE646399A/xx unknown
- 1964-04-10 CS CS209064A patent/CS158551B2/cs unknown
- 1964-04-13 CH CH471264A patent/CH450417A/fr unknown
- 1964-07-10 US US381907A patent/US3268400A/en not_active Expired - Lifetime
- 1964-08-01 DE DES92432A patent/DE1280871B/de active Pending
- 1964-08-04 GB GB30683/64A patent/GB1058309A/en not_active Expired
- 1964-08-07 CH CH1037964A patent/CH453362A/fr unknown
- 1964-08-12 NL NL6409281A patent/NL6409281A/xx unknown
- 1964-08-12 BE BE651737D patent/BE651737A/xx unknown
- 1964-08-13 BR BR161736/64A patent/BR6461736D0/pt unknown
- 1964-08-14 LU LU46765D patent/LU46765A1/xx unknown
- 1964-08-14 DK DK403864AA patent/DK115697B/da unknown
- 1964-12-01 BR BR164958/64A patent/BR6464958D0/pt unknown
- 1964-12-01 IL IL22541A patent/IL22541A/xx unknown
- 1964-12-01 US US415209A patent/US3318766A/en not_active Expired - Lifetime
- 1964-12-01 US US415175A patent/US3316275A/en not_active Expired - Lifetime
- 1964-12-01 IL IL22540A patent/IL22540A/xx unknown
- 1964-12-02 GB GB49058/64A patent/GB1076579A/en not_active Expired
- 1964-12-02 FI FI642540A patent/FI45042C/fi active
- 1964-12-02 CH CH1554264A patent/CH451940A/fr unknown
- 1964-12-02 BE BE656566D patent/BE656566A/xx unknown
- 1964-12-02 BE BE656565D patent/BE656565A/xx unknown
- 1964-12-02 CH CH1554364A patent/CH449619A/fr unknown
- 1964-12-03 NL NL6414038A patent/NL6414038A/xx unknown
- 1964-12-03 LU LU47512A patent/LU47512A1/xx unknown
- 1964-12-03 NL NL6414037A patent/NL6414037A/xx unknown
-
1965
- 1965-08-04 SE SE10233/65A patent/SE325438B/xx unknown
- 1965-08-10 SE SE10462/65A patent/SE326066B/xx unknown
- 1965-12-02 SE SE10463/65A patent/SE326067B/xx unknown
-
1966
- 1966-02-11 US US538885A patent/US3428651A/en not_active Expired - Lifetime
-
1967
- 1967-05-13 CY CY39267A patent/CY392A/xx unknown
- 1967-12-31 MY MY196792A patent/MY6700092A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH450417A (fr) | Procédé pour préparer des esters de l'acide cyclopropanecarboxylique | |
| FI56475C (fi) | D-cis transkrysantemat innehaollande insekticidkomposition | |
| IL45358A (en) | 2-dichlorovinyl-3,3-dimethyl cyclopropane carbocylic acid phenylbutenyl esters processes for producing the same pesticidal compositions containing the same and method of controlling pests by use thereof | |
| US3647857A (en) | Novel esters of chrysanthemic acid and alcohols related to 2-indanol | |
| US4148918A (en) | Substituted 2-higher alkyl-3-hydroxy-1,4-naphthoquinone carboxylic acid esters and their use as miticides | |
| US4070481A (en) | Substituted 2-higher alkyl-3-hydroxy-1,4-naphthoquinone carboxylic acid esters and their use as miticides | |
| US2471790A (en) | Insect-affecting compositions | |
| US3636059A (en) | Cyclopentenolone esters | |
| US3266984A (en) | Chrysanthemic acid esters | |
| US3839561A (en) | Insecticidal compositions stabilized by certain diisophorone derivatives | |
| US3268396A (en) | Insecticidal compositions containing cyclopropane carboxylic acid esters | |
| US3414607A (en) | Novel cyclopropanecarboxylic acid esters | |
| FR2772759A1 (fr) | Nouveaux derives de l'acide 2,2-dimethyl 3-(2-fluorovinyl) cyclopropane carboxylique, leur procede de preparation et leur application comme pesticides | |
| BE897675A (fr) | Nouveaux derives du thiophene, leur preparation et leur utilisation en tant que fongicides | |
| US2891889A (en) | Insecticidal compositions containing cyclethrin | |
| US2891888A (en) | 3(2-cyclopentenyl)-2-methyl-4-oxo-2-cyclopentenyl chrysanthemumate insecticide and process of making it | |
| US2350324A (en) | Parasiticidal composition | |
| US3758504A (en) | Vinylcyclopropanecarboxylates | |
| US3377356A (en) | Cyclopropanecarboxylic acid esters | |
| US3742052A (en) | Diisophorone derivatives and compositions containing same | |
| US3440245A (en) | Glutarimidomethyl and beta-methylglutarimidomethyl esters of chrysanthemum carboxylic acids | |
| CH660188A5 (fr) | Esters de n-methyl hydantoines d'acides cyclopropane carboxyliques, leur preparation et les compositions les renfermant. | |
| BE883271R (fr) | Nouveaux pyrethroides | |
| US2938057A (en) | Cyclic ketones | |
| DE1470301C (de) | Cyclopropancarbonsaureester und Ver fahren zu ihrer Herstellung |