CA970181A - Herbicidal compositions containing dinitroaniline derivatives - Google Patents
Herbicidal compositions containing dinitroaniline derivativesInfo
- Publication number
- CA970181A CA970181A CA118,250A CA118250A CA970181A CA 970181 A CA970181 A CA 970181A CA 118250 A CA118250 A CA 118250A CA 970181 A CA970181 A CA 970181A
- Authority
- CA
- Canada
- Prior art keywords
- compositions containing
- herbicidal compositions
- dinitroaniline derivatives
- containing dinitroaniline
- derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000002363 herbicidal effect Effects 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
- LZGUHMNOBNWABZ-UHFFFAOYSA-N n-nitro-n-phenylnitramide Chemical class [O-][N+](=O)N([N+]([O-])=O)C1=CC=CC=C1 LZGUHMNOBNWABZ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/06—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals
- C07D295/073—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals with the ring nitrogen atoms and the substituents separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/16—Esters of thiophosphoric acids or thiophosphorous acids
- C07F9/165—Esters of thiophosphoric acids
- C07F9/1651—Esters of thiophosphoric acids with hydroxyalkyl compounds with further substituents on alkyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702037265 DE2037265A1 (de) | 1970-07-28 | 1970-07-28 | Herbizid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA970181A true CA970181A (en) | 1975-07-01 |
Family
ID=5778058
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA118,250A Expired CA970181A (en) | 1970-07-28 | 1971-07-14 | Herbicidal compositions containing dinitroaniline derivatives |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3849107A (enFirst) |
| AT (4) | AT309886B (enFirst) |
| AU (1) | AU461725B2 (enFirst) |
| BE (1) | BE770395A (enFirst) |
| BR (1) | BR7104766D0 (enFirst) |
| CA (1) | CA970181A (enFirst) |
| CS (1) | CS171657B2 (enFirst) |
| DE (1) | DE2037265A1 (enFirst) |
| DK (1) | DK129074B (enFirst) |
| FR (1) | FR2099642B1 (enFirst) |
| GB (1) | GB1348428A (enFirst) |
| HU (1) | HU165877B (enFirst) |
| IL (1) | IL37313A (enFirst) |
| NL (1) | NL7110345A (enFirst) |
| PL (1) | PL77753B1 (enFirst) |
| SE (1) | SE381160B (enFirst) |
| SU (2) | SU511830A3 (enFirst) |
| ZA (1) | ZA714937B (enFirst) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4042628A (en) * | 1967-12-21 | 1977-08-16 | Badische Anilin- & Soda-Fabrik Aktiengesellschaft | 2,6-Dinitro-4-trifluoromethylanilines |
| US3989508A (en) * | 1970-01-28 | 1976-11-02 | Basf Aktiengesellschaft | Substituted nitroanilines and ureas as herbicidal mixtures |
| DE2334787A1 (de) * | 1973-07-09 | 1975-02-06 | Basf Ag | Herbizid |
| GB1473105A (enFirst) * | 1973-08-10 | 1977-05-11 | ||
| DE2352537A1 (de) * | 1973-10-19 | 1975-04-30 | Basf Ag | Herbizid |
| US3979453A (en) * | 1975-06-23 | 1976-09-07 | Eli Lilly And Company | 3-Cyanamino-2,6-dinitroanilines |
| DE2534042A1 (de) * | 1975-07-30 | 1977-02-17 | Shell Int Research | Herbicide mittel |
| US4124639A (en) * | 1975-12-22 | 1978-11-07 | America Cyanamid Company | N-alkoxyalkyl-2,6-dinitroaniline herbicides |
| DE2617736C2 (de) * | 1976-04-23 | 1982-12-09 | Hoechst Ag, 6000 Frankfurt | Schädlingsbekämpfungsmittel |
| DE2604224A1 (de) * | 1976-02-04 | 1977-08-11 | Hoechst Ag | Herbizide mittel |
| DE2706700A1 (de) * | 1977-02-17 | 1978-08-24 | Consortium Elektrochem Ind | Verfahren zur herstellung von pyridazin-3-on-verbindungen, neue pyridazin-3-one und deren verwendung |
| US4087460A (en) * | 1977-06-27 | 1978-05-02 | Eli Lilly And Company | Substituted N-alkoxy-N-substituted-2,6-dinitroanilines and intermediates for the preparation thereof |
| US4453965A (en) * | 1977-07-13 | 1984-06-12 | Patel Natu R | N-Isopropylcarbanilylmethyl dithiophosphates as pre-emergent herbicides |
| EP0006681A1 (en) * | 1978-06-17 | 1980-01-09 | FISONS plc | Herbicidal composition and method |
| DE2842142A1 (de) * | 1978-09-28 | 1980-04-10 | Hoechst Ag | Herbizide mittel |
| IT1131750B (it) * | 1980-06-06 | 1986-06-25 | Montedison Spa | Formulazioni stabili di n-(3,4-diclorofenil)-n'metossi-n'-metilurea (linorun) e 2,6-dinitor-n,n-dipropil-4-trifluoro metilanilina (trifluralin) in emulsione |
| DE3129374A1 (de) * | 1981-07-25 | 1983-02-10 | Norddeutsche Affinerie AG, 2000 Hamburg | Mittel zur selktiven unkrautbekaempfung und seine anwendung |
| DE3807896A1 (de) * | 1988-03-10 | 1989-09-21 | Basf Ag | 2-phenylpyridazin-3-on-verbindungen, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| CN100554249C (zh) * | 2003-08-29 | 2009-10-28 | 三井化学株式会社 | 农园艺用杀虫剂及其使用方法 |
| US7390395B2 (en) * | 2005-06-23 | 2008-06-24 | Saleh Elomari | Hydrocarbon conversion using molecular sieve SSZ-56 |
| WO2011097553A1 (en) * | 2010-02-08 | 2011-08-11 | Allergan, Inc. | Pyridazine derivatives useful as cannabinoid - 2 agonists |
| CN116635386A (zh) * | 2020-12-22 | 2023-08-22 | Fmc公司 | 取代的哒嗪酮除草剂 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3257190A (en) * | 1962-12-10 | 1966-06-21 | Lilly Co Eli | Method of eliminating weed grasses and broadleaf weeds |
| FR1486323A (fr) * | 1965-07-12 | 1967-06-23 | Daikin Ind Ltd | Compositions herbicides, procédés pour les obtenir et applications de ces compositions |
| US3442639A (en) * | 1965-12-22 | 1969-05-06 | Lilly Co Eli | Process of selectively eliminating weeds |
| US3449111A (en) * | 1966-12-08 | 1969-06-10 | Lilly Co Eli | Method of eliminating weeds |
| DE1670315B1 (de) * | 1968-02-10 | 1972-05-31 | Basf Ag | 1-(m-Trifluormethylphenyl)-4-methoxy-5-halogen-pyridazon-(6)-derivate |
-
1970
- 1970-07-28 DE DE19702037265 patent/DE2037265A1/de active Pending
-
1971
- 1971-07-13 US US00162317A patent/US3849107A/en not_active Expired - Lifetime
- 1971-07-14 CA CA118,250A patent/CA970181A/en not_active Expired
- 1971-07-14 IL IL37313A patent/IL37313A/xx unknown
- 1971-07-16 AU AU31319/71A patent/AU461725B2/en not_active Expired
- 1971-07-21 CS CS5381A patent/CS171657B2/cs unknown
- 1971-07-23 BE BE770395A patent/BE770395A/xx unknown
- 1971-07-23 ZA ZA714937A patent/ZA714937B/xx unknown
- 1971-07-26 SE SE7109578A patent/SE381160B/xx unknown
- 1971-07-26 SU SU1789831A patent/SU511830A3/ru active
- 1971-07-26 SU SU1790688A patent/SU460604A3/ru active
- 1971-07-27 PL PL1971149676A patent/PL77753B1/pl unknown
- 1971-07-27 AT AT462072A patent/AT309886B/de active
- 1971-07-27 NL NL7110345A patent/NL7110345A/xx unknown
- 1971-07-27 AT AT462272A patent/AT309887B/de not_active IP Right Cessation
- 1971-07-27 AT AT462372A patent/AT309888B/de not_active IP Right Cessation
- 1971-07-27 GB GB3518671A patent/GB1348428A/en not_active Expired
- 1971-07-27 AT AT653671A patent/AT308465B/de not_active IP Right Cessation
- 1971-07-27 DK DK367871AA patent/DK129074B/da unknown
- 1971-07-28 BR BR4766/71A patent/BR7104766D0/pt unknown
- 1971-07-28 HU HUBA2817A patent/HU165877B/hu unknown
- 1971-07-28 FR FR7127692A patent/FR2099642B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CS171657B2 (enFirst) | 1976-10-29 |
| SU460604A3 (ru) | 1975-02-15 |
| GB1348428A (en) | 1974-03-20 |
| IL37313A (en) | 1974-06-30 |
| IL37313A0 (en) | 1971-11-29 |
| AT308465B (de) | 1973-07-10 |
| SU404189A3 (enFirst) | 1973-10-26 |
| DK129074B (da) | 1974-08-19 |
| SE381160B (sv) | 1975-12-01 |
| FR2099642B1 (enFirst) | 1976-03-26 |
| FR2099642A1 (enFirst) | 1972-03-17 |
| DE2037265A1 (de) | 1972-02-03 |
| HU165877B (enFirst) | 1974-12-28 |
| AT309886B (de) | 1973-09-10 |
| ZA714937B (en) | 1972-05-31 |
| AU461725B2 (en) | 1975-06-05 |
| BR7104766D0 (pt) | 1973-04-17 |
| AT309888B (de) | 1973-09-10 |
| AU3131971A (en) | 1973-01-18 |
| PL77753B1 (enFirst) | 1975-04-30 |
| AT309887B (de) | 1973-09-10 |
| SU511830A3 (ru) | 1976-04-25 |
| US3849107A (en) | 1974-11-19 |
| NL7110345A (enFirst) | 1972-02-01 |
| BE770395A (fr) | 1972-01-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1033584A (en) | Herbicidal compositions | |
| CA970181A (en) | Herbicidal compositions containing dinitroaniline derivatives | |
| CA1005659A (en) | Herbicidal compositions | |
| CA1004494A (en) | Herbicidal compositions | |
| CA1025687A (en) | Herbicidal compositions | |
| AU456852B2 (en) | Herbicidal compositions | |
| CA1018789A (en) | Herbicidal compositions | |
| AU2881371A (en) | Herbicidal. composition | |
| CA965003A (en) | Compositions biocides | |
| CA1006708A (en) | Herbicidal compositions | |
| CA973091A (en) | Fungicidal composition | |
| AU457298B2 (en) | Stabilized herbicidal compositions | |
| CA963284A (en) | Herbicidal compositions containing atriazine derivative | |
| AU473346B2 (en) | Biocidal compositions | |
| AU458002B2 (en) | Herbicidal compositions | |
| CA851108A (en) | Herbicidal compositions | |
| CA837005A (en) | Herbicidal compositions | |
| AU459581B2 (en) | Herbicidal composition | |
| AU453237B2 (en) | Herbicidal composition | |
| AU3008871A (en) | Herbicidal compositions | |
| CA839684A (en) | Fungicidal compositions | |
| AU425048B2 (en) | Phenylazoalkenoate fungicidal compositions | |
| CA857849A (en) | Fungicidal compositions | |
| AU420423B2 (en) | Novel herbicidal compositions | |
| CA840953A (en) | Germicidal compositions |