CA927838A - Bis-thioureido-benzenes and preparation thereof - Google Patents
Bis-thioureido-benzenes and preparation thereofInfo
- Publication number
- CA927838A CA927838A CA033834A CA33834A CA927838A CA 927838 A CA927838 A CA 927838A CA 033834 A CA033834 A CA 033834A CA 33834 A CA33834 A CA 33834A CA 927838 A CA927838 A CA 927838A
- Authority
- CA
- Canada
- Prior art keywords
- thioureido
- benzenes
- bis
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- RVJHDCPHSAUCEV-UHFFFAOYSA-N [2-(carbamothioylamino)phenyl]thiourea Chemical class NC(=S)NC1=CC=CC=C1NC(N)=S RVJHDCPHSAUCEV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/24—Derivatives of thiourea containing any of the groups, X being a hetero atom, Y being any atom
- C07C335/28—Y being a hetero atom, e.g. thiobiuret
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6935867 | 1967-10-30 | ||
| JP8329567 | 1967-12-27 | ||
| JP2452868 | 1968-04-13 | ||
| JP2582968 | 1968-04-19 | ||
| JP4158768 | 1968-06-18 | ||
| JP4158968 | 1968-06-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA927838A true CA927838A (en) | 1973-06-05 |
Family
ID=27549188
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA033834A Expired CA927838A (en) | 1967-10-30 | 1968-10-29 | Bis-thioureido-benzenes and preparation thereof |
Country Status (13)
| Country | Link |
|---|---|
| AT (1) | AT296685B (show.php) |
| BE (1) | BE722080A (show.php) |
| CA (1) | CA927838A (show.php) |
| CH (2) | CH541580A (show.php) |
| DE (2) | DE1817879C3 (show.php) |
| DK (1) | DK123473B (show.php) |
| FR (1) | FR1590329A (show.php) |
| GB (1) | GB1191406A (show.php) |
| IL (1) | IL30778A (show.php) |
| IT (1) | IT951520B (show.php) |
| NL (1) | NL6815482A (show.php) |
| SE (2) | SE340617B (show.php) |
| YU (1) | YU34400B (show.php) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA893141A (en) * | 1968-06-18 | 1972-02-15 | Nippon Soda Co., Ltd. | Preparation and uses thereof thioureidobenzenes |
| US3856847A (en) * | 1968-10-28 | 1974-12-24 | Nippon Soda Co | Metal salts of bis-thioureido benzenes |
| FR2087366A5 (show.php) * | 1970-05-15 | 1971-12-31 | Rhone Poulenc Sa | |
| GB1307250A (en) * | 1970-06-16 | 1973-02-14 | May & Baker Ltd | Benzene derivatives |
| US4048326A (en) * | 1970-06-16 | 1977-09-13 | May & Baker Limited | Treatment of helminth infections with substituted 1,2-bis(thioureido)benzene |
| JPS5610282B1 (show.php) * | 1971-04-05 | 1981-03-06 | ||
| US3925380A (en) * | 1973-08-13 | 1975-12-09 | Du Pont | Quinoxalinylthioallophanate fungicides |
| OA05041A (fr) | 1974-07-15 | 1980-12-31 | Rhone Poulenc Ind | Nouvelles compositions fongicides. |
| DK140520B (da) * | 1977-03-08 | 1979-09-24 | Sadolin & Holmblad As | Fremgangsmåde til behandling af nyfældet eller nysavet træ samt middel til brug ved fremgangsmåden. |
| RO66706A2 (ro) * | 1977-10-01 | 1982-03-24 | Centrala Industriala De Produse Anorganice,Ro | Compozitie fungicida cu volum ultraredus |
| JPS5681506A (en) | 1979-12-07 | 1981-07-03 | Nippon Soda Co Ltd | Fungicidal composition for agricultural and horticultural use |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102004049761A1 (de) | 2004-10-12 | 2006-04-13 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| MX2007015376A (es) | 2005-06-09 | 2008-02-14 | Bayer Cropscience Ag | Combinaciones de productos activos. |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| EP2453750A2 (de) | 2009-07-16 | 2012-05-23 | Bayer CropScience AG | Synergistische wirkstoffkombinationen mit phenyltriazolen |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
| CN111631223A (zh) * | 2019-03-02 | 2020-09-08 | 刘力 | 广谱杀菌低毒促生长甲基硫菌灵金属复合物及其组合物 |
-
1968
- 1968-09-27 IL IL30778A patent/IL30778A/xx unknown
- 1968-10-04 CH CH1922470A patent/CH541580A/de not_active IP Right Cessation
- 1968-10-04 CH CH1484168A patent/CH504421A/de not_active IP Right Cessation
- 1968-10-10 BE BE722080D patent/BE722080A/xx not_active IP Right Cessation
- 1968-10-11 GB GB48215/68A patent/GB1191406A/en not_active Expired
- 1968-10-23 AT AT08080/69A patent/AT296685B/de not_active IP Right Cessation
- 1968-10-25 YU YU2486/68A patent/YU34400B/xx unknown
- 1968-10-28 SE SE14542/68A patent/SE340617B/xx unknown
- 1968-10-28 SE SE7111320A patent/SE373143B/xx unknown
- 1968-10-29 IT IT40806/68A patent/IT951520B/it active
- 1968-10-29 CA CA033834A patent/CA927838A/en not_active Expired
- 1968-10-29 DK DK522868AA patent/DK123473B/da not_active IP Right Cessation
- 1968-10-30 NL NL6815482A patent/NL6815482A/xx unknown
- 1968-10-30 DE DE1817879A patent/DE1817879C3/de not_active Expired
- 1968-10-30 DE DE1806123A patent/DE1806123C3/de not_active Expired
- 1968-10-30 FR FR1590329D patent/FR1590329A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT951520B (it) | 1973-07-10 |
| DE1806123C3 (de) | 1973-11-15 |
| IL30778A (en) | 1972-10-29 |
| YU248668A (en) | 1978-12-31 |
| SE373143B (show.php) | 1975-01-27 |
| DE1817879A1 (de) | 1973-04-19 |
| FR1590329A (show.php) | 1970-04-13 |
| AT296685B (de) | 1972-01-15 |
| CH504421A (de) | 1971-03-15 |
| DE1817879B2 (de) | 1973-12-13 |
| DE1817879C3 (de) | 1974-07-11 |
| DK123473B (da) | 1972-06-26 |
| CH541580A (de) | 1973-10-31 |
| GB1191406A (en) | 1970-05-13 |
| DE1806123B2 (de) | 1973-04-05 |
| SE340617B (show.php) | 1971-11-29 |
| YU34400B (en) | 1979-07-10 |
| NL6815482A (show.php) | 1969-05-02 |
| IL30778A0 (en) | 1968-11-27 |
| BE722080A (show.php) | 1969-03-14 |
| DE1806123A1 (de) | 1969-06-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA927838A (en) | Bis-thioureido-benzenes and preparation thereof | |
| CA918652A (en) | 2-acyl-7-deoxy-7-halo lincomycins and their preparation | |
| CA752424A (en) | Hexamethyldiphenyl-dioxadisila-hexanediol and preparation | |
| CA753657A (en) | Tetrahydrocarbylcyclotetrasiloxanetetrols and preparation | |
| CA759464A (en) | N-trihydrocarbylsilylamides and preparation | |
| AU424068B2 (en) | 16-methyl-4-pregnen-3b-ol-20-ones and their preparation | |
| CA751496A (en) | Nitrosulfones and their preparation | |
| CA765434A (en) | Acryloylphenols and their preparation | |
| AU437982B2 (en) | NOVEL ARYLSULPHONYLUREAS AND ARYLSULPHONYLTHIOUREAS and THEIR PREPARATION | |
| CA771195A (en) | Methyl decatrien-dioate and preparation thereof | |
| AU2552367A (en) | 16-methyl-4-pregnen-3b-ol-20-ones and their preparation | |
| CA754194A (en) | 3-sulfamidocyclobutanone and 3-sulfamidocyclobutanol compounds and their preparation | |
| CA755125A (en) | Camphocean derivatives and preparation thereof | |
| CA750912A (en) | Diazabicyclo-heptanes and diazabicyclo-octanes | |
| CA758629A (en) | Omega-hydroxyalkylcyclohexanols and omega-hydroxyalkylcyclohexenes | |
| CA765829A (en) | Epoxyhexahydrophthalates and endoalkyleneepoxyhexahydrophthalates | |
| CA760452A (en) | Acetoacetate-aluminum diacetylsalicylate derivative and preparation | |
| AU2985967A (en) | NOVEL ARYLSULPHONYLUREAS AND ARYLSULPHONYLTHIOUREAS and THEIR PREPARATION | |
| AU403265B2 (en) | 20-halomethyl021-halo-pregnane derivatives and their preparation | |
| CA757603A (en) | Antioxidant and preparation thereof | |
| CA937142A (en) | Reagin-immunoglobulins (reagin-ig) and their use | |
| AU416792B2 (en) | Vaccine and its preparation | |
| CA772189A (en) | Carboxy-di-p-xylylene and derivatives thereof | |
| CA755112A (en) | 3-(hydroxylated-phenyl)-2-lower alkylserines and their preparation | |
| CA766267A (en) | 3-acetamido-adamantane-1-carboxylic acid and its preparation |