CA3036428A1 - Antiviral compounds - Google Patents
Antiviral compounds Download PDFInfo
- Publication number
- CA3036428A1 CA3036428A1 CA3036428A CA3036428A CA3036428A1 CA 3036428 A1 CA3036428 A1 CA 3036428A1 CA 3036428 A CA3036428 A CA 3036428A CA 3036428 A CA3036428 A CA 3036428A CA 3036428 A1 CA3036428 A1 CA 3036428A1
- Authority
- CA
- Canada
- Prior art keywords
- nmr
- purity
- nrere
- mhz
- synthesized
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 318
- 230000000840 anti-viral effect Effects 0.000 title description 4
- -1 diastereomers Chemical class 0.000 claims description 128
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 66
- 125000001072 heteroaryl group Chemical group 0.000 claims description 48
- 239000000203 mixture Substances 0.000 claims description 46
- 150000003839 salts Chemical class 0.000 claims description 41
- 229910052739 hydrogen Inorganic materials 0.000 claims description 29
- 239000001257 hydrogen Substances 0.000 claims description 29
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 26
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 25
- 125000001424 substituent group Chemical group 0.000 claims description 23
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 21
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 21
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 20
- 125000005885 heterocycloalkylalkyl group Chemical group 0.000 claims description 20
- 150000004677 hydrates Chemical class 0.000 claims description 18
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 12
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 10
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 claims description 8
- 125000000623 heterocyclic group Chemical group 0.000 claims description 8
- 125000004043 oxo group Chemical group O=* 0.000 claims description 8
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 5
- 239000003814 drug Substances 0.000 claims description 5
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 4
- 239000013543 active substance Substances 0.000 claims description 4
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- 206010028980 Neoplasm Diseases 0.000 claims description 3
- 208000008589 Obesity Diseases 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 235000020824 obesity Nutrition 0.000 claims description 3
- 230000002265 prevention Effects 0.000 claims description 3
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims description 2
- 208000035473 Communicable disease Diseases 0.000 claims description 2
- 201000011510 cancer Diseases 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims 2
- 208000005155 Picornaviridae Infections Diseases 0.000 claims 1
- 101000595800 Homo sapiens Phospholipase A and acyltransferase 3 Proteins 0.000 abstract description 7
- 208000036142 Viral infection Diseases 0.000 abstract description 7
- 230000009385 viral infection Effects 0.000 abstract description 7
- 102100036066 Phospholipase A and acyltransferase 3 Human genes 0.000 abstract description 6
- 201000010099 disease Diseases 0.000 abstract description 5
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 5
- 238000004519 manufacturing process Methods 0.000 abstract description 2
- 238000000034 method Methods 0.000 description 460
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 332
- 238000005160 1H NMR spectroscopy Methods 0.000 description 308
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 223
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 222
- 238000000746 purification Methods 0.000 description 219
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 190
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 142
- 239000003921 oil Substances 0.000 description 118
- 235000019198 oils Nutrition 0.000 description 118
- 239000012071 phase Substances 0.000 description 114
- 238000003818 flash chromatography Methods 0.000 description 113
- 239000000377 silicon dioxide Substances 0.000 description 111
- 239000007787 solid Substances 0.000 description 100
- XZOWIJDBQIHMFC-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O.CCCC(N)=O XZOWIJDBQIHMFC-UHFFFAOYSA-N 0.000 description 71
- 239000003643 water by type Substances 0.000 description 64
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 51
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 51
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 46
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 44
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 40
- 239000000243 solution Substances 0.000 description 32
- 238000001953 recrystallisation Methods 0.000 description 30
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 29
- 238000010828 elution Methods 0.000 description 29
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 29
- 238000001665 trituration Methods 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 24
- 238000002347 injection Methods 0.000 description 23
- 239000007924 injection Substances 0.000 description 23
- 238000002211 ultraviolet spectrum Methods 0.000 description 22
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 21
- 230000002378 acidificating effect Effects 0.000 description 21
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 20
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 20
- 235000019253 formic acid Nutrition 0.000 description 20
- 239000000843 powder Substances 0.000 description 20
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 18
- 229910052938 sodium sulfate Inorganic materials 0.000 description 18
- 235000011152 sodium sulphate Nutrition 0.000 description 18
- 125000000217 alkyl group Chemical group 0.000 description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 17
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 15
- 125000004432 carbon atom Chemical class C* 0.000 description 13
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- 239000012044 organic layer Substances 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 229920006395 saturated elastomer Polymers 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N dichloromethane Natural products ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 11
- 238000001819 mass spectrum Methods 0.000 description 11
- 238000005070 sampling Methods 0.000 description 11
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 11
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- 239000003480 eluent Substances 0.000 description 10
- 238000000589 high-performance liquid chromatography-mass spectrometry Methods 0.000 description 10
- HLEKYJVHEBHTMR-UHFFFAOYSA-N pentanamide Chemical compound CCCCC(N)=O.CCCCC(N)=O HLEKYJVHEBHTMR-UHFFFAOYSA-N 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 230000002441 reversible effect Effects 0.000 description 10
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- BEPOKULTVBNNKT-UHFFFAOYSA-N N-(cyclohexylmethyl)-3-methyloxirane-2-carboxamide Chemical compound C1(CCCCC1)CNC(=O)C1OC1C BEPOKULTVBNNKT-UHFFFAOYSA-N 0.000 description 9
- 241000700605 Viruses Species 0.000 description 9
- 125000004429 atom Chemical group 0.000 description 9
- 125000000753 cycloalkyl group Chemical group 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- FMAZQSYXRGRESX-UHFFFAOYSA-N Glycidamide Chemical compound NC(=O)C1CO1 FMAZQSYXRGRESX-UHFFFAOYSA-N 0.000 description 8
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 235000011114 ammonium hydroxide Nutrition 0.000 description 8
- 125000003118 aryl group Chemical group 0.000 description 8
- 125000002619 bicyclic group Chemical group 0.000 description 8
- NYTAJBJUEATPED-UHFFFAOYSA-N C(C)(C)NC(=O)C1OC1C Chemical compound C(C)(C)NC(=O)C1OC1C NYTAJBJUEATPED-UHFFFAOYSA-N 0.000 description 7
- BAECEWNJOANEAK-UHFFFAOYSA-N N-(cyclopropylmethyl)-3-(2-methylpropyl)oxirane-2-carboxamide Chemical compound C1(CC1)CNC(=O)C1OC1CC(C)C BAECEWNJOANEAK-UHFFFAOYSA-N 0.000 description 7
- 239000000908 ammonium hydroxide Substances 0.000 description 7
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 7
- 229910052799 carbon Inorganic materials 0.000 description 7
- 239000013058 crude material Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 150000002430 hydrocarbons Chemical group 0.000 description 7
- 238000004808 supercritical fluid chromatography Methods 0.000 description 7
- NQQRXZOPZBKCNF-NSCUHMNNSA-N (e)-but-2-enamide Chemical compound C\C=C\C(N)=O NQQRXZOPZBKCNF-NSCUHMNNSA-N 0.000 description 6
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 6
- 241000709661 Enterovirus Species 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- PCBIWZJNPLHYGL-UHFFFAOYSA-N N-(cyclopropylmethyl)-3-propyloxirane-2-carboxamide Chemical compound C1(CC1)CNC(=O)C1OC1CCC PCBIWZJNPLHYGL-UHFFFAOYSA-N 0.000 description 6
- 241000709664 Picornaviridae Species 0.000 description 6
- 238000010640 amide synthesis reaction Methods 0.000 description 6
- 150000002118 epoxides Chemical class 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 238000005342 ion exchange Methods 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Inorganic materials [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium;hydroxide;hydrate Chemical compound [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 6
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 5
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 5
- 239000007821 HATU Substances 0.000 description 5
- UTGXVVDJGWARQB-UHFFFAOYSA-N N-(cyclohexylmethyl)-3-ethyloxirane-2-carboxamide Chemical compound C1(CCCCC1)CNC(=O)C1OC1CC UTGXVVDJGWARQB-UHFFFAOYSA-N 0.000 description 5
- HEJBYYPXMRTPGR-UHFFFAOYSA-N N-(cyclopropylmethyl)-3-methyloxirane-2-carboxamide Chemical compound C1(CC1)CNC(=O)C1OC1C HEJBYYPXMRTPGR-UHFFFAOYSA-N 0.000 description 5
- 125000003342 alkenyl group Chemical group 0.000 description 5
- 125000000304 alkynyl group Chemical group 0.000 description 5
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 5
- 239000001099 ammonium carbonate Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 5
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 125000002950 monocyclic group Chemical group 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 4
- PAQZWJGSJMLPMG-UHFFFAOYSA-N 2,4,6-tripropyl-1,3,5,2$l^{5},4$l^{5},6$l^{5}-trioxatriphosphinane 2,4,6-trioxide Chemical compound CCCP1(=O)OP(=O)(CCC)OP(=O)(CCC)O1 PAQZWJGSJMLPMG-UHFFFAOYSA-N 0.000 description 4
- HRJTXSXEZVGCGU-UHFFFAOYSA-N 3-cyclopropyl-N-(cyclopropylmethyl)oxirane-2-carboxamide Chemical compound C1(CC1)C1C(O1)C(=O)NCC1CC1 HRJTXSXEZVGCGU-UHFFFAOYSA-N 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 241000991587 Enterovirus C Species 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 238000004296 chiral HPLC Methods 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- IGSKHXTUVXSOMB-UHFFFAOYSA-N cyclopropylmethanamine Chemical compound NCC1CC1 IGSKHXTUVXSOMB-UHFFFAOYSA-N 0.000 description 4
- 125000005842 heteroatom Chemical group 0.000 description 4
- ALBYIUDWACNRRB-UHFFFAOYSA-N hexanamide Chemical compound CCCCCC(N)=O ALBYIUDWACNRRB-UHFFFAOYSA-N 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 239000002480 mineral oil Substances 0.000 description 4
- 235000010446 mineral oil Nutrition 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Substances [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 4
- PLWMGMCBGZYSHL-AATRIKPKSA-N (E)-3-cyclopropyl-N-(cyclopropylmethyl)prop-2-enamide Chemical compound C1(CC1)/C=C/C(=O)NCC1CC1 PLWMGMCBGZYSHL-AATRIKPKSA-N 0.000 description 3
- DBGZGINMCMTNRO-QHHAFSJGSA-N (E)-N-(cyclohexylmethyl)but-2-enamide Chemical compound C1(CCCCC1)CNC(\C=C\C)=O DBGZGINMCMTNRO-QHHAFSJGSA-N 0.000 description 3
- YNVIDWBXYIJJOS-YCRREMRBSA-N (E)-N-(cyclohexylmethyl)pent-2-enamide Chemical compound C1(CCCCC1)CNC(\C=C\CC)=O YNVIDWBXYIJJOS-YCRREMRBSA-N 0.000 description 3
- DHMNPKGDYKWZEA-ONEGZZNKSA-N (E)-N-(cyclopropylmethyl)-3-(oxan-4-yl)prop-2-enamide Chemical compound C1(CC1)CNC(\C=C\C1CCOCC1)=O DHMNPKGDYKWZEA-ONEGZZNKSA-N 0.000 description 3
- SBHZTEYHXIPFEB-DUXPYHPUSA-N (E)-N-(cyclopropylmethyl)-5-methoxypent-2-enamide Chemical compound C1(CC1)CNC(\C=C\CCOC)=O SBHZTEYHXIPFEB-DUXPYHPUSA-N 0.000 description 3
- JKNLIHRSRMGWQX-WEVVVXLNSA-N (E)-N-(cyclopropylmethyl)-5-phenylpent-2-enamide Chemical compound C1(CC1)CNC(\C=C\CCC1=CC=CC=C1)=O JKNLIHRSRMGWQX-WEVVVXLNSA-N 0.000 description 3
- ONVORYYNCOYBEH-SNAWJCMRSA-N (E)-N-(cyclopropylmethyl)hex-2-enamide Chemical compound C1(CC1)CNC(\C=C\CCC)=O ONVORYYNCOYBEH-SNAWJCMRSA-N 0.000 description 3
- WRFLTLVXCKWWBI-SNAWJCMRSA-N (e)-n-(2-methylpropyl)but-2-enamide Chemical compound C\C=C\C(=O)NCC(C)C WRFLTLVXCKWWBI-SNAWJCMRSA-N 0.000 description 3
- PMYOYDPRILKMKB-SNAWJCMRSA-N (e)-n-propan-2-ylbut-2-enamide Chemical compound C\C=C\C(=O)NC(C)C PMYOYDPRILKMKB-SNAWJCMRSA-N 0.000 description 3
- LHSNWZRMVCJRKH-UHFFFAOYSA-N 2-hydroxy-3-(2-methoxyanilino)butanamide Chemical compound OC(C(=O)N)C(C)NC1=C(C=CC=C1)OC LHSNWZRMVCJRKH-UHFFFAOYSA-N 0.000 description 3
- FCDWUGOEWNFAOK-UHFFFAOYSA-N 3-(2,2-dimethylpropylamino)-2-hydroxy-N-(2-methylpropyl)butanamide Chemical compound CC(CNC(C(C(=O)NCC(C)C)O)C)(C)C FCDWUGOEWNFAOK-UHFFFAOYSA-N 0.000 description 3
- AEGVLQYCTASNHG-UHFFFAOYSA-N 3-(2,2-dimethylpropylamino)-2-hydroxy-N-propan-2-ylbutanamide Chemical compound CC(CNC(C(C(=O)NC(C)C)O)C)(C)C AEGVLQYCTASNHG-UHFFFAOYSA-N 0.000 description 3
- BDRMIESVQVGXJP-UHFFFAOYSA-N 3-(benzylamino)-N-(cyclopropylmethyl)-2-hydroxy-5-methoxypentanamide Chemical compound C(C1=CC=CC=C1)NC(C(C(=O)NCC1CC1)O)CCOC BDRMIESVQVGXJP-UHFFFAOYSA-N 0.000 description 3
- JXUBGHBMYSYIRJ-UHFFFAOYSA-N 3-(cyclohexylamino)-N-(cyclohexylmethyl)-2-hydroxypentanamide Chemical compound C1(CCCCC1)NC(C(C(=O)NCC1CCCCC1)O)CC JXUBGHBMYSYIRJ-UHFFFAOYSA-N 0.000 description 3
- LKSXPYPFMQVOPK-UHFFFAOYSA-N 3-[cyclohexyl(formyl)amino]-2-hydroxy-N-(2-methylpropyl)butanamide Chemical compound C1(CCCCC1)N(C=O)C(C(C(=O)NCC(C)C)O)C LKSXPYPFMQVOPK-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241000711549 Hepacivirus C Species 0.000 description 3
- 241000282412 Homo Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- GDGRZJHQBDJPTQ-UHFFFAOYSA-N N-(cyclopropylmethyl)-3-(2,2-dimethylpropylamino)-2-hydroxy-4-methylpentanamide Chemical compound C1(CC1)CNC(C(C(C(C)C)NCC(C)(C)C)O)=O GDGRZJHQBDJPTQ-UHFFFAOYSA-N 0.000 description 3
- ZYEUOMIYIZGQED-UHFFFAOYSA-N N-(cyclopropylmethyl)-3-(2,2-dimethylpropylamino)-2-hydroxybutanamide Chemical compound C1(CC1)CNC(C(C(C)NCC(C)(C)C)O)=O ZYEUOMIYIZGQED-UHFFFAOYSA-N 0.000 description 3
- NYBMSAYHUGDQFQ-UHFFFAOYSA-N N-(cyclopropylmethyl)-4-methylpent-2-enamide Chemical compound C1(CC1)CNC(C=CC(C)C)=O NYBMSAYHUGDQFQ-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003443 antiviral agent Substances 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- HXBCPBSHJYHXQV-AATRIKPKSA-N ethyl (e)-3-cyclopropylprop-2-enoate Chemical compound CCOC(=O)\C=C\C1CC1 HXBCPBSHJYHXQV-AATRIKPKSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- ONPJDXCABIUPLK-BJILWQEISA-M lithium (E)-3-cyclopropylprop-2-enoate Chemical compound [Li+].C1(CC1)/C=C/C(=O)[O-] ONPJDXCABIUPLK-BJILWQEISA-M 0.000 description 3
- HVBBTFMWWXQQOQ-UHFFFAOYSA-N n-[(3-chlorophenyl)methyl]prop-2-enamide Chemical compound ClC1=CC=CC(CNC(=O)C=C)=C1 HVBBTFMWWXQQOQ-UHFFFAOYSA-N 0.000 description 3
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- QKQAINPCEFDPMG-HWKANZROSA-N (E)-N-(cyclopropylmethyl)-5-methylhex-2-enamide Chemical compound C1(CC1)CNC(\C=C\CC(C)C)=O QKQAINPCEFDPMG-HWKANZROSA-N 0.000 description 2
- ZFVQJLSLMKCWNP-ONEGZZNKSA-N (E)-N-(cyclopropylmethyl)pent-2-enamide Chemical compound C1(CC1)CNC(\C=C\CC)=O ZFVQJLSLMKCWNP-ONEGZZNKSA-N 0.000 description 2
- BCMJLBHYOGUFFR-DUXPYHPUSA-N (E)-N-[(3-chlorophenyl)methyl]but-2-enamide Chemical compound ClC=1C=C(C=CC=1)CNC(\C=C\C)=O BCMJLBHYOGUFFR-DUXPYHPUSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 2
- HJLAVGWSOQPGKC-UHFFFAOYSA-N 2-hydroxy-3-(2-methoxyanilino)-N-propan-2-ylbutanamide Chemical compound OC(C(=O)NC(C)C)C(C)NC1=C(C=CC=C1)OC HJLAVGWSOQPGKC-UHFFFAOYSA-N 0.000 description 2
- OTDHTMXOXCNMPZ-UHFFFAOYSA-N 3-(N-formyl-2-methoxyanilino)-2-hydroxy-N-propan-2-ylbutanamide Chemical compound OC(C(=O)NC(C)C)C(C)N(C=O)C1=C(C=CC=C1)OC OTDHTMXOXCNMPZ-UHFFFAOYSA-N 0.000 description 2
- KEWLQHDTYBWOEX-UHFFFAOYSA-N 3-(benzylamino)-N-(cyclopropylmethyl)-2-hydroxy-3-(oxan-4-yl)propanamide Chemical compound C(C1=CC=CC=C1)NC(C(C(=O)NCC1CC1)O)C1CCOCC1 KEWLQHDTYBWOEX-UHFFFAOYSA-N 0.000 description 2
- VFZLBLAFYCYRRN-UHFFFAOYSA-N 3-(cyclohexylamino)-2-hydroxy-N-propan-2-ylbutanamide Chemical compound C1(CCCCC1)NC(C(C(=O)NC(C)C)O)C VFZLBLAFYCYRRN-UHFFFAOYSA-N 0.000 description 2
- GCBRJYRFDAAORD-UHFFFAOYSA-N 3-(cyclohexylmethylamino)-N-(cyclopropylmethyl)-2-hydroxybutanamide Chemical compound C1(CCCCC1)CNC(C(C(=O)NCC1CC1)O)C GCBRJYRFDAAORD-UHFFFAOYSA-N 0.000 description 2
- XFNFLRINJYIXHI-UHFFFAOYSA-N 3-[benzyl(formyl)amino]-2-hydroxy-N-propan-2-ylbutanamide Chemical compound C(C1=CC=CC=C1)N(C=O)C(C(C(=O)NC(C)C)O)C XFNFLRINJYIXHI-UHFFFAOYSA-N 0.000 description 2
- LODVEVJCVLSBCW-UHFFFAOYSA-N 3-[benzyl(formyl)amino]-3-cyclopropyl-N-(cyclopropylmethyl)-2-hydroxypropanamide Chemical compound C(C1=CC=CC=C1)N(C=O)C(C(C(=O)NCC1CC1)O)C1CC1 LODVEVJCVLSBCW-UHFFFAOYSA-N 0.000 description 2
- IEXFWTGIHLWSDA-UHFFFAOYSA-N 3-[benzyl(formyl)amino]-N-(cyclopropylmethyl)-2-hydroxy-3-(oxan-4-yl)propanamide Chemical compound C(C1=CC=CC=C1)N(C=O)C(C(C(=O)NCC1CC1)O)C1CCOCC1 IEXFWTGIHLWSDA-UHFFFAOYSA-N 0.000 description 2
- VDBLPHKJNFOVNX-UHFFFAOYSA-N 3-[benzyl(formyl)amino]-N-(cyclopropylmethyl)-2-hydroxy-5-methoxypentanamide Chemical compound C(C1=CC=CC=C1)N(C=O)C(C(C(=O)NCC1CC1)O)CCOC VDBLPHKJNFOVNX-UHFFFAOYSA-N 0.000 description 2
- DGOSXACGQVBKTC-UHFFFAOYSA-N 3-[benzyl(formyl)amino]-N-(cyclopropylmethyl)-2-hydroxybutanamide Chemical compound C(C1=CC=CC=C1)N(C=O)C(C(C(=O)NCC1CC1)O)C DGOSXACGQVBKTC-UHFFFAOYSA-N 0.000 description 2
- ZOXCGNMSRSDVJU-UHFFFAOYSA-N 3-[cyclohexyl(formyl)amino]-2-hydroxy-N-propan-2-ylbutanamide Chemical compound C1(CCCCC1)N(C=O)C(C(C(=O)NC(C)C)O)C ZOXCGNMSRSDVJU-UHFFFAOYSA-N 0.000 description 2
- RSYOQUJQGUVLTB-UHFFFAOYSA-N 3-[cyclohexyl(formyl)amino]-N-(cyclopropylmethyl)-2-hydroxybutanamide Chemical compound C1(CCCCC1)N(C=O)C(C(C(=O)NCC1CC1)O)C RSYOQUJQGUVLTB-UHFFFAOYSA-N 0.000 description 2
- WDBRFJLBBYKCHE-UHFFFAOYSA-N 3-[cyclohexylmethyl(formyl)amino]-N-(cyclopropylmethyl)-2-hydroxybutanamide Chemical compound C1(CCCCC1)CN(C=O)C(C(C(=O)NCC1CC1)O)C WDBRFJLBBYKCHE-UHFFFAOYSA-N 0.000 description 2
- SCRDUUGQIHXOTF-UHFFFAOYSA-N 3-[cyclopropylmethyl(formyl)amino]-2-hydroxy-N-(2-methylpropyl)butanamide Chemical compound C1(CC1)CN(C=O)C(C(C(=O)NCC(C)C)O)C SCRDUUGQIHXOTF-UHFFFAOYSA-N 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000710829 Dengue virus group Species 0.000 description 2
- 241000988559 Enterovirus A Species 0.000 description 2
- 241000988556 Enterovirus B Species 0.000 description 2
- 241000991586 Enterovirus D Species 0.000 description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N Heavy water Chemical compound [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 241000710842 Japanese encephalitis virus Species 0.000 description 2
- QVAHUAJGEYPERW-UHFFFAOYSA-N N-(cyclohexylmethyl)-2-hydroxy-3-(2,2,2-trifluoroethylamino)butanamide Chemical compound C1(CCCCC1)CNC(C(C(C)NCC(F)(F)F)O)=O QVAHUAJGEYPERW-UHFFFAOYSA-N 0.000 description 2
- MQYGIPWZPHFPAL-UHFFFAOYSA-N N-(cyclohexylmethyl)-2-hydroxy-3-(2-methoxyanilino)butanamide Chemical compound C1(CCCCC1)CNC(C(C(C)NC1=C(C=CC=C1)OC)O)=O MQYGIPWZPHFPAL-UHFFFAOYSA-N 0.000 description 2
- KXUKPICCDPVZFZ-UHFFFAOYSA-N N-(cyclohexylmethyl)-3-(cyclopropylmethylamino)-2-hydroxybutanamide Chemical compound C1(CCCCC1)CNC(C(C(C)NCC1CC1)O)=O KXUKPICCDPVZFZ-UHFFFAOYSA-N 0.000 description 2
- KYJVZTUZSGBXEZ-UHFFFAOYSA-N N-(cyclopropylmethyl)-2-hydroxy-3-(3-methoxypropylamino)-5-methylhexanamide Chemical compound C1(CC1)CNC(C(C(CC(C)C)NCCCOC)O)=O KYJVZTUZSGBXEZ-UHFFFAOYSA-N 0.000 description 2
- CRZATYFYCOFJIO-UHFFFAOYSA-N N-(cyclopropylmethyl)-2-hydroxy-3-(oxan-4-ylmethylamino)-5-phenylpentanamide Chemical compound C1(CC1)CNC(C(C(CCC1=CC=CC=C1)NCC1CCOCC1)O)=O CRZATYFYCOFJIO-UHFFFAOYSA-N 0.000 description 2
- SFRFNTZXORHTCO-UHFFFAOYSA-N N-(cyclopropylmethyl)-2-hydroxy-4-methyl-3-(2-methylpropylamino)pentanamide Chemical compound C1(CC1)CNC(C(C(C(C)C)NCC(C)C)O)=O SFRFNTZXORHTCO-UHFFFAOYSA-N 0.000 description 2
- ROENRRJPFQIVHQ-UHFFFAOYSA-N N-(cyclopropylmethyl)-2-hydroxy-5-methyl-3-(oxolan-3-ylmethylamino)hexanamide Chemical compound C1(CC1)CNC(C(C(CC(C)C)NCC1COCC1)O)=O ROENRRJPFQIVHQ-UHFFFAOYSA-N 0.000 description 2
- IJYMWWNNRRQMAT-UHFFFAOYSA-N N-(cyclopropylmethyl)-3-(2-methoxyethyl)oxirane-2-carboxamide Chemical compound C1(CC1)CNC(=O)C1OC1CCOC IJYMWWNNRRQMAT-UHFFFAOYSA-N 0.000 description 2
- RNUIBFRCJCPMDA-UHFFFAOYSA-N N-(cyclopropylmethyl)-3-(2-phenylethyl)oxirane-2-carboxamide Chemical compound C1(CC1)CNC(=O)C1OC1CCC1=CC=CC=C1 RNUIBFRCJCPMDA-UHFFFAOYSA-N 0.000 description 2
- DUQWGLKKIOGLAS-UHFFFAOYSA-N N-(cyclopropylmethyl)-3-ethyloxirane-2-carboxamide Chemical compound C1(CC1)CNC(=O)C1OC1CC DUQWGLKKIOGLAS-UHFFFAOYSA-N 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 241001325464 Rhinovirus A Species 0.000 description 2
- 241001325459 Rhinovirus B Species 0.000 description 2
- 241001139982 Rhinovirus C Species 0.000 description 2
- 241000710886 West Nile virus Species 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 230000009435 amidation Effects 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 125000002100 cyclohexa-1,3-dienyl group Chemical group [H]C1([*])C([H])=C([H])C([H])=C([H])C1([H])[H] 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- NKLCNNUWBJBICK-UHFFFAOYSA-N dess–martin periodinane Chemical compound C1=CC=C2I(OC(=O)C)(OC(C)=O)(OC(C)=O)OC(=O)C2=C1 NKLCNNUWBJBICK-UHFFFAOYSA-N 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 2
- 125000005054 dihydropyrrolyl group Chemical group [H]C1=C([H])C([H])([H])C([H])([H])N1* 0.000 description 2
- 206010014599 encephalitis Diseases 0.000 description 2
- 238000006735 epoxidation reaction Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- CSIWANXLBDEVNY-WGCWOXMQSA-M lithium (E)-5-methylhex-2-enoate Chemical compound [Li+].CC(C/C=C/C(=O)[O-])C CSIWANXLBDEVNY-WGCWOXMQSA-M 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- WWKISERFVXSUAD-UHFFFAOYSA-N methyl 2-[[3-[benzyl(formyl)amino]-2-hydroxybutanoyl]amino]acetate Chemical compound C(C1=CC=CC=C1)N(C=O)C(C(C(=O)NCC(=O)OC)O)C WWKISERFVXSUAD-UHFFFAOYSA-N 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- 201000009240 nasopharyngitis Diseases 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 244000309711 non-enveloped viruses Species 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- VXVHHXPTNQANQX-UHFFFAOYSA-N pent-2-enamide Chemical compound [CH2]CC=CC(N)=O VXVHHXPTNQANQX-UHFFFAOYSA-N 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 238000000527 sonication Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- GISABGIWJQJFHL-UHFFFAOYSA-N tert-butyl 3-[[[1-(cyclohexylmethylamino)-2-hydroxy-1-oxopentan-3-yl]-formylamino]methyl]azetidine-1-carboxylate Chemical compound C1(CCCCC1)CNC(=O)C(C(CC)N(C=O)CC1CN(C1)C(=O)OC(C)(C)C)O GISABGIWJQJFHL-UHFFFAOYSA-N 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 230000003612 virological effect Effects 0.000 description 2
- BJFPYGGTDAYECS-UHFFFAOYSA-N (3-chlorophenyl)methanamine Chemical compound NCC1=CC=CC(Cl)=C1 BJFPYGGTDAYECS-UHFFFAOYSA-N 0.000 description 1
- STZHSUSOTWSRRM-NSCUHMNNSA-N (E)-1-(7-chloro-3,4-dihydro-1H-isoquinolin-2-yl)but-2-en-1-one Chemical compound ClC1=CC=C2CCN(CC2=C1)C(\C=C\C)=O STZHSUSOTWSRRM-NSCUHMNNSA-N 0.000 description 1
- RJUIDDKTATZJFE-NSCUHMNNSA-N (e)-but-2-enoyl chloride Chemical compound C\C=C\C(Cl)=O RJUIDDKTATZJFE-NSCUHMNNSA-N 0.000 description 1
- RPOJIZYYJQJMJR-NSCUHMNNSA-N (e)-n-(cyclopropylmethyl)but-2-enamide Chemical compound C\C=C\C(=O)NCC1CC1 RPOJIZYYJQJMJR-NSCUHMNNSA-N 0.000 description 1
- MNRDPIJFSOZQED-NSCUHMNNSA-N (e)-n-cyclopropylbut-2-enamide Chemical compound C\C=C\C(=O)NC1CC1 MNRDPIJFSOZQED-NSCUHMNNSA-N 0.000 description 1
- MKNFUPBPNVFSGF-AATRIKPKSA-N (e)-n-tert-butylbut-2-enamide Chemical compound C\C=C\C(=O)NC(C)(C)C MKNFUPBPNVFSGF-AATRIKPKSA-N 0.000 description 1
- FKZYYYDRLJCHGL-UHFFFAOYSA-N 1,1,3-trimethoxypropane Chemical compound COCCC(OC)OC FKZYYYDRLJCHGL-UHFFFAOYSA-N 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000004529 1,2,3-triazinyl group Chemical group N1=NN=C(C=C1)* 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004530 1,2,4-triazinyl group Chemical group N1=NC(=NC=C1)* 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- 125000005962 1,4-oxazepanyl group Chemical group 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- PTLWKRLAWHBMLM-UHFFFAOYSA-N 2,3-dihydroazete Chemical compound C1CN=C1 PTLWKRLAWHBMLM-UHFFFAOYSA-N 0.000 description 1
- ZIIUUSVHCHPIQD-UHFFFAOYSA-N 2,4,6-trimethyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide Chemical compound CC1=CC(C)=CC(C)=C1S(=O)(=O)NC1=CC=CC(C(F)(F)F)=C1 ZIIUUSVHCHPIQD-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- UMRORUJDIIWTRA-UHFFFAOYSA-N 3-(benzylamino)-2-hydroxy-N-(2-methylpropyl)butanamide Chemical compound C(C1=CC=CC=C1)NC(C(C(=O)NCC(C)C)O)C UMRORUJDIIWTRA-UHFFFAOYSA-N 0.000 description 1
- OYFOEHWKMDLNJB-UHFFFAOYSA-N 3-(benzylamino)-2-hydroxy-N-propan-2-ylbutanamide Chemical compound C(C1=CC=CC=C1)NC(C(C(=O)NC(C)C)O)C OYFOEHWKMDLNJB-UHFFFAOYSA-N 0.000 description 1
- WVKQSUFTRITTNR-UHFFFAOYSA-N 3-(benzylamino)-3-cyclopropyl-N-(cyclopropylmethyl)-2-hydroxypropanamide Chemical compound C(C1=CC=CC=C1)NC(C(C(=O)NCC1CC1)O)C1CC1 WVKQSUFTRITTNR-UHFFFAOYSA-N 0.000 description 1
- XWCOYUWNHPTVKZ-UHFFFAOYSA-N 3-(benzylamino)-N-(cyclopropylmethyl)-2-hydroxybutanamide Chemical compound C(C1=CC=CC=C1)NC(C(C(=O)NCC1CC1)O)C XWCOYUWNHPTVKZ-UHFFFAOYSA-N 0.000 description 1
- RFABODRQSKKLPR-UHFFFAOYSA-N 3-(cyclohexylamino)-N-(cyclohexylmethyl)-2-hydroxybutanamide Chemical compound C1(CCCCC1)NC(C(C(=O)NCC1CCCCC1)O)C RFABODRQSKKLPR-UHFFFAOYSA-N 0.000 description 1
- OSWIEKINDQESQS-UHFFFAOYSA-N 3-(cyclohexylamino)-N-(cyclopropylmethyl)-2-hydroxybutanamide Chemical compound C1(CCCCC1)NC(C(C(=O)NCC1CC1)O)C OSWIEKINDQESQS-UHFFFAOYSA-N 0.000 description 1
- SDAOQYRMYNXGQD-UHFFFAOYSA-N 3-(cyclopropylmethylamino)-2-hydroxy-N-(2-methylpropyl)butanamide Chemical compound C1(CC1)CNC(C(C(=O)NCC(C)C)O)C SDAOQYRMYNXGQD-UHFFFAOYSA-N 0.000 description 1
- DPNLDJXIHWUUCF-UHFFFAOYSA-N 3-[2,2-dimethylpropyl(formyl)amino]-2-hydroxy-N-propan-2-ylbutanamide Chemical compound CC(CN(C=O)C(C(C(=O)NC(C)C)O)C)(C)C DPNLDJXIHWUUCF-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- OXGJKCALURPRCN-UHFFFAOYSA-N 3-methoxypropanal Chemical compound COCCC=O OXGJKCALURPRCN-UHFFFAOYSA-N 0.000 description 1
- NRNIEDYEYVBIMW-UHFFFAOYSA-N 3-methyloxirane-2-carboxamide Chemical compound CC1OC1C(N)=O NRNIEDYEYVBIMW-UHFFFAOYSA-N 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- 125000001826 4H-pyranyl group Chemical group O1C(=CCC=C1)* 0.000 description 1
- VYZUBHRSGQAROM-UHFFFAOYSA-N 5-fluoro-2-methoxyaniline Chemical compound COC1=CC=C(F)C=C1N VYZUBHRSGQAROM-UHFFFAOYSA-N 0.000 description 1
- 125000006163 5-membered heteroaryl group Chemical group 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000701242 Adenoviridae Species 0.000 description 1
- 208000037874 Asthma exacerbation Diseases 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 206010006448 Bronchiolitis Diseases 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000714198 Caliciviridae Species 0.000 description 1
- 241000710190 Cardiovirus Species 0.000 description 1
- 102000004171 Cathepsin K Human genes 0.000 description 1
- 108090000625 Cathepsin K Proteins 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 1
- 102000012422 Collagen Type I Human genes 0.000 description 1
- 108010022452 Collagen Type I Proteins 0.000 description 1
- 241000711573 Coronaviridae Species 0.000 description 1
- 241000709687 Coxsackievirus Species 0.000 description 1
- 238000006646 Dess-Martin oxidation reaction Methods 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- 241001466953 Echovirus Species 0.000 description 1
- 241000709691 Enterovirus E Species 0.000 description 1
- 241001523584 Enterovirus G Species 0.000 description 1
- 241001219115 Enterovirus H Species 0.000 description 1
- 241000710831 Flavivirus Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 208000007212 Foot-and-Mouth Disease Diseases 0.000 description 1
- 241000710198 Foot-and-mouth disease virus Species 0.000 description 1
- 102000020897 Formins Human genes 0.000 description 1
- 108091022623 Formins Proteins 0.000 description 1
- 208000005577 Gastroenteritis Diseases 0.000 description 1
- 208000020061 Hand, Foot and Mouth Disease Diseases 0.000 description 1
- 208000025713 Hand-foot-and-mouth disease Diseases 0.000 description 1
- 206010019663 Hepatic failure Diseases 0.000 description 1
- 241000700721 Hepatitis B virus Species 0.000 description 1
- 241000709715 Hepatovirus Species 0.000 description 1
- 241000709721 Hepatovirus A Species 0.000 description 1
- 201000006219 Herpangina Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 201000009906 Meningitis Diseases 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 208000009525 Myocarditis Diseases 0.000 description 1
- WVTSDHPQQKQJNH-UHFFFAOYSA-N N-(cyclopropylmethyl)-3-(oxan-4-yl)oxirane-2-carboxamide Chemical compound C1(CC1)CNC(=O)C1OC1C1CCOCC1 WVTSDHPQQKQJNH-UHFFFAOYSA-N 0.000 description 1
- CKZHIUVBONSTOH-UHFFFAOYSA-N N-[(3-chlorophenyl)methyl]-2-hydroxy-3-(methylamino)butanamide Chemical compound ClC=1C=C(C=CC=1)CNC(C(C(C)NC)O)=O CKZHIUVBONSTOH-UHFFFAOYSA-N 0.000 description 1
- CVGKJDUAPWQFOQ-UHFFFAOYSA-N N-[(3-chlorophenyl)methyl]oxirane-2-carboxamide Chemical compound ClC=1C=C(C=CC=1)CNC(=O)C1OC1 CVGKJDUAPWQFOQ-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 241001263478 Norovirus Species 0.000 description 1
- 206010033645 Pancreatitis Diseases 0.000 description 1
- 241001631646 Papillomaviridae Species 0.000 description 1
- 241000701945 Parvoviridae Species 0.000 description 1
- 208000037581 Persistent Infection Diseases 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 1
- 108010064785 Phospholipases Proteins 0.000 description 1
- 102000015439 Phospholipases Human genes 0.000 description 1
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- 208000000474 Poliomyelitis Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000702247 Reoviridae Species 0.000 description 1
- 241000725643 Respiratory syncytial virus Species 0.000 description 1
- 241000702670 Rotavirus Species 0.000 description 1
- 241000315672 SARS coronavirus Species 0.000 description 1
- 241000580858 Simian-Human immunodeficiency virus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- SJZAPSHKTOTRBQ-UHFFFAOYSA-N [dimethylamino(triazolo[4,5-b]pyridin-1-yl)methylidene]-dimethylazanium Chemical compound C1=CC=C2[N+](=C(N(C)C)N(C)C)N=NC2=N1 SJZAPSHKTOTRBQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- YBCVMFKXIKNREZ-UHFFFAOYSA-N acoh acetic acid Chemical compound CC(O)=O.CC(O)=O YBCVMFKXIKNREZ-UHFFFAOYSA-N 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 108700010877 adenoviridae proteins Proteins 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000000123 anti-resoprtive effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000003725 azepanyl group Chemical group 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000003310 benzodiazepinyl group Chemical group N1N=C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- PCDHSSHKDZYLLI-UHFFFAOYSA-N butan-1-one Chemical compound CCC[C]=O PCDHSSHKDZYLLI-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Chemical group 0.000 description 1
- 229910052801 chlorine Chemical group 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 208000019425 cirrhosis of liver Diseases 0.000 description 1
- 206010009887 colitis Diseases 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000011258 core-shell material Substances 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002150 cyclohexa-1,4-dienyl group Chemical group [H]C1=C([H])C([H])(*)C([H])=C([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- JMYVMOUINOAAPA-UHFFFAOYSA-N cyclopropanecarbaldehyde Chemical compound O=CC1CC1 JMYVMOUINOAAPA-UHFFFAOYSA-N 0.000 description 1
- YOXHCYXIAVIFCZ-UHFFFAOYSA-N cyclopropanol Chemical class OC1CC1 YOXHCYXIAVIFCZ-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 238000009795 derivation Methods 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 239000012973 diazabicyclooctane Substances 0.000 description 1
- 125000005959 diazepanyl group Chemical group 0.000 description 1
- 125000002576 diazepinyl group Chemical group N1N=C(C=CC=C1)* 0.000 description 1
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 1
- 125000005051 dihydropyrazinyl group Chemical group N1(CC=NC=C1)* 0.000 description 1
- 125000005052 dihydropyrazolyl group Chemical group N1(NCC=C1)* 0.000 description 1
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 125000005053 dihydropyrimidinyl group Chemical group N1(CN=CC=C1)* 0.000 description 1
- 125000005057 dihydrothienyl group Chemical group S1C(CC=C1)* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 231100000676 disease causative agent Toxicity 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 201000002491 encephalomyelitis Diseases 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 208000010227 enterocolitis Diseases 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Chemical group 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 230000005802 health problem Effects 0.000 description 1
- 208000006454 hepatitis Diseases 0.000 description 1
- 231100000283 hepatitis Toxicity 0.000 description 1
- 231100000844 hepatocellular carcinoma Toxicity 0.000 description 1
- 206010073071 hepatocellular carcinoma Diseases 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004366 heterocycloalkenyl group Chemical group 0.000 description 1
- 244000052637 human pathogen Species 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical group [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000012678 infectious agent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- SYJRVVFAAIUVDH-UHFFFAOYSA-N ipa isopropanol Chemical compound CC(C)O.CC(C)O SYJRVVFAAIUVDH-UHFFFAOYSA-N 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 231100000835 liver failure Toxicity 0.000 description 1
- 208000007903 liver failure Diseases 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- BCVXHSPFUWZLGQ-UHFFFAOYSA-N mecn acetonitrile Chemical compound CC#N.CC#N BCVXHSPFUWZLGQ-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 201000011475 meningoencephalitis Diseases 0.000 description 1
- 229910052751 metal Chemical class 0.000 description 1
- 239000002184 metal Chemical class 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- KNSMNULJDOTFMN-GQCTYLIASA-N methyl (e)-5-methylhex-2-enoate Chemical compound COC(=O)\C=C\CC(C)C KNSMNULJDOTFMN-GQCTYLIASA-N 0.000 description 1
- OMXMUPFBFXABMB-ONEGZZNKSA-N methyl 2-[[(e)-but-2-enoyl]amino]acetate Chemical compound COC(=O)CNC(=O)\C=C\C OMXMUPFBFXABMB-ONEGZZNKSA-N 0.000 description 1
- MXCSKPDBUQAROB-UHFFFAOYSA-N methyl 2-[[3-(benzylamino)-2-hydroxybutanoyl]amino]acetate Chemical compound C(C1=CC=CC=C1)NC(C(C(=O)NCC(=O)OC)O)C MXCSKPDBUQAROB-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000010172 mouse model Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000003518 norbornenyl group Chemical group C12(C=CC(CC1)C2)* 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- FIYYMXYOBLWYQO-UHFFFAOYSA-N ortho-iodylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1I(=O)=O FIYYMXYOBLWYQO-UHFFFAOYSA-N 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- CXLGNJCMPWUZKM-UHFFFAOYSA-N oxane-4-carbaldehyde Chemical compound O=CC1CCOCC1 CXLGNJCMPWUZKM-UHFFFAOYSA-N 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- 125000005476 oxopyrrolidinyl group Chemical group 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- QJWFJOSRSZOLKK-UHFFFAOYSA-N prop-2-enamide Chemical compound NC(=O)C=C.NC(=O)C=C QJWFJOSRSZOLKK-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000005180 public health Effects 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- HNJBEVLQSNELDL-YZRHJBSPSA-N pyrrolidin-2-one Chemical group O=C1CC[14CH2]N1 HNJBEVLQSNELDL-YZRHJBSPSA-N 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 150000003870 salicylic acids Chemical class 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000012163 sequencing technique Methods 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- WGRULTCAYDOGQK-UHFFFAOYSA-M sodium;sodium;hydroxide Chemical compound [OH-].[Na].[Na+] WGRULTCAYDOGQK-UHFFFAOYSA-M 0.000 description 1
- LZCVVMQABORALM-UHFFFAOYSA-N spiro[2.5]octyl Chemical group [CH]1CC11CCCCC1 LZCVVMQABORALM-UHFFFAOYSA-N 0.000 description 1
- LMUMMJCCZMWLEN-UHFFFAOYSA-N spiro[3.3]heptyl Chemical group [CH]1CCC11CCC1 LMUMMJCCZMWLEN-UHFFFAOYSA-N 0.000 description 1
- CCOIJUDZGUXWEH-UHFFFAOYSA-N spiro[4.5]dec-2-ene Chemical compound C1C=CCC11CCCCC1 CCOIJUDZGUXWEH-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- 125000003507 tetrahydrothiofenyl group Chemical group 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- PHCBRBWANGJMHS-UHFFFAOYSA-J tetrasodium;disulfate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O PHCBRBWANGJMHS-UHFFFAOYSA-J 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- YIYBQIKDCADOSF-ONEGZZNKSA-N trans-pent-2-enoic acid Chemical compound CC\C=C\C(O)=O YIYBQIKDCADOSF-ONEGZZNKSA-N 0.000 description 1
- 150000003628 tricarboxylic acids Chemical class 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- 238000004704 ultra performance liquid chromatography Methods 0.000 description 1
- 241000701161 unidentified adenovirus Species 0.000 description 1
- 241001529453 unidentified herpesvirus Species 0.000 description 1
- 241000712461 unidentified influenza virus Species 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 229960005486 vaccine Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 210000000605 viral structure Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/70—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/72—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton with the carbon atoms of the carboxamide groups bound to acyclic carbon atoms
- C07C235/74—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton with the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of a saturated carbon skeleton
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
- A61P31/14—Antivirals for RNA viruses
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton
- C07C237/22—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton having nitrogen atoms of amino groups bound to the carbon skeleton of the acid part, further acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/24—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a ring other than a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/02—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C311/03—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atoms of the sulfonamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/02—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C311/03—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atoms of the sulfonamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C311/06—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atoms of the sulfonamide groups bound to hydrogen atoms or to acyclic carbon atoms to acyclic carbon atoms of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/10—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of a saturated carbon skeleton containing rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/12—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings
- C07C311/13—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings the carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
- C07C311/19—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/22—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound oxygen atoms
- C07C311/29—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound oxygen atoms having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/04—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/27—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/26—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D215/14—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/64—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms, e.g. histidine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/12—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/18—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/14—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/04—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/14—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/04—Systems containing only non-condensed rings with a four-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02A—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE
- Y02A50/00—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE in human health protection, e.g. against extreme weather
- Y02A50/30—Against vector-borne diseases, e.g. mosquito-borne, fly-borne, tick-borne or waterborne diseases whose impact is exacerbated by climate change
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Virology (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Molecular Biology (AREA)
- Public Health (AREA)
- Communicable Diseases (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Pyrane Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Furan Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP16188559.5 | 2016-09-13 | ||
| EP16188559 | 2016-09-13 | ||
| PCT/EP2017/072880 WO2018050631A1 (en) | 2016-09-13 | 2017-09-12 | Antiviral compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA3036428A1 true CA3036428A1 (en) | 2018-03-22 |
Family
ID=56926065
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA3036428A Pending CA3036428A1 (en) | 2016-09-13 | 2017-09-12 | Antiviral compounds |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US11091428B2 (enExample) |
| EP (1) | EP3512836A1 (enExample) |
| JP (2) | JP2019533007A (enExample) |
| CN (1) | CN110062753A (enExample) |
| CA (1) | CA3036428A1 (enExample) |
| WO (1) | WO2018050631A1 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US11091428B2 (en) * | 2016-09-13 | 2021-08-17 | Haplogen Gmbh | Antiviral compounds |
| CN111303005B (zh) * | 2020-03-24 | 2023-09-08 | 乌海青石化学有限公司 | 含邻苯二甲酰亚胺结构的偶合组分及其制备方法和应用 |
| EP4649086A1 (en) * | 2023-01-09 | 2025-11-19 | Merck Sharp & Dohme LLC | Protease inhibitors for treating or preventing coronavirus infection |
| WO2025171103A1 (en) * | 2024-02-08 | 2025-08-14 | Luxvitae Therapeutics Inc. | Amino acid derivatives and method of making the same |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5681543A (en) * | 1979-10-10 | 1981-07-03 | Ciba Geigy Ag | Manufacture of diether |
| JPH06273417A (ja) * | 1993-01-20 | 1994-09-30 | Ono Pharmaceut Co Ltd | メバロン酸に対する抗体、および該抗体を用いるメバロン酸の定量法 |
| RU2054000C1 (ru) * | 1994-03-02 | 1996-02-10 | Товарищество с ограниченной ответственностью "Пант" | Кетопантенол, обладающий ацетилирующей активностью d-пантотената кальция |
| RU2054415C1 (ru) * | 1994-03-02 | 1996-02-20 | Товарищество с ограниченной ответственностью "Пант" | Кетопантотенат кальция, обладающий ацетилирующей активностью d-пантотената кальция |
| EP0938477A4 (en) * | 1996-11-13 | 1999-12-29 | Cephalon Inc | BENZOTHIAZOLO AND RELATED HETEROCYCLIC GROUPS CONTAINING CYSTEIN AND SERINE PROTEASE INHIBITORS |
| IL130124A0 (en) * | 1996-12-11 | 2000-06-01 | Basf Ag | Ketobenzamides as calpain inhibitors |
| JP3892187B2 (ja) * | 1998-11-12 | 2007-03-14 | 生化学工業株式会社 | 環状アミド誘導体 |
| EP1206484B1 (en) * | 1999-08-04 | 2004-10-06 | Agouron Pharmaceuticals, Inc. | Antipicornaviral compounds and compositions, their pharmaceutical uses, and materials for their synthesis |
| US20030045710A1 (en) * | 2000-04-06 | 2003-03-06 | Bruice Thomas C. | Methods for identifying, obtaining and using new polyketide compounds |
| ES2324594T3 (es) * | 2000-12-12 | 2009-08-11 | Schering Corporation | Diaril peptidicos utilizados como inhibidores de la serina proteasa ns3 del virus de la hepatitis c. |
| US20020177594A1 (en) * | 2001-03-14 | 2002-11-28 | Curtin Michael L. | Inhibitors of histone deacetylase |
| US20100330063A1 (en) * | 2007-12-17 | 2010-12-30 | Gliamed, Inc. | Stem-like cells, method for de-differentiating mammalian somatic cells into stem-like cells, and method for differentiating stem-like cells |
| US8236798B2 (en) * | 2009-05-07 | 2012-08-07 | Abbott Gmbh & Co. Kg | Carboxamide compounds and their use as calpain inhibitors |
| US8653025B2 (en) * | 2010-01-27 | 2014-02-18 | AB Pharma Ltd. | Polyheterocyclic compounds highly potent as HCV inhibitors |
| AU2011268127B2 (en) | 2010-06-18 | 2016-01-14 | Whitehead Institute For Biomedical Research | PLA2G16 as a target for antiviral compounds |
| US20140249073A1 (en) * | 2011-05-27 | 2014-09-04 | Rqx Pharmaceuticals, Inc | Broad spectrum antibiotics |
| CA2850003C (en) * | 2011-09-27 | 2020-01-07 | Kansas State University Research Foundation | Broad-spectrum antivirals against 3c or 3c-like proteases of picornavirus-like supercluster: picornaviruses, caliciviruses and coronaviruses |
| US20140256698A1 (en) * | 2013-03-11 | 2014-09-11 | Virobay, Inc. | Cathepsin inhibitors |
| GB201305750D0 (en) | 2013-03-28 | 2013-05-15 | Syngenta Ltd | Herbicidal Compounds |
| AU2015240535A1 (en) | 2014-04-04 | 2016-10-20 | Syros Pharmaceuticals, Inc. | Inhibitors of cyclin-dependent kinase 7 (CDK7) |
| US11091428B2 (en) * | 2016-09-13 | 2021-08-17 | Haplogen Gmbh | Antiviral compounds |
-
2017
- 2017-09-12 US US16/333,159 patent/US11091428B2/en active Active
- 2017-09-12 CN CN201780069960.5A patent/CN110062753A/zh active Pending
- 2017-09-12 CA CA3036428A patent/CA3036428A1/en active Pending
- 2017-09-12 JP JP2019535971A patent/JP2019533007A/ja active Pending
- 2017-09-12 EP EP17771706.3A patent/EP3512836A1/en not_active Withdrawn
- 2017-09-12 WO PCT/EP2017/072880 patent/WO2018050631A1/en not_active Ceased
-
2021
- 2021-06-28 US US17/361,246 patent/US20220356148A1/en not_active Abandoned
-
2022
- 2022-06-29 JP JP2022104373A patent/JP2022137120A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CN110062753A (zh) | 2019-07-26 |
| US11091428B2 (en) | 2021-08-17 |
| JP2019533007A (ja) | 2019-11-14 |
| EP3512836A1 (en) | 2019-07-24 |
| US20220356148A1 (en) | 2022-11-10 |
| JP2022137120A (ja) | 2022-09-21 |
| US20190225575A1 (en) | 2019-07-25 |
| WO2018050631A1 (en) | 2018-03-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CN104922128B (zh) | 流感病毒复制抑制剂 | |
| EP3328855B1 (en) | Novel tetracyclic 4-oxo-pyridine-3-carboxylic acid derivatives for the treatment and prophylaxis of hepatitis b virus infection | |
| WO2018039310A1 (en) | Amino-pyrrolopyrimidinone compounds and methods of use thereof | |
| CA3036428A1 (en) | Antiviral compounds | |
| EP4499638A1 (en) | Pyrido-[3,4-d]pyridazine amine derivatives useful as nlrp3 derivatives | |
| CA3226758A1 (en) | Compounds and compositions for the treatment of coronaviral related diseases | |
| EP4341252A1 (en) | Oxoindoline compound for the treatment of inflammatory diseases or cancer | |
| CA3075812A1 (en) | Antiviral compounds | |
| JP2024532729A (ja) | フェロトーシス調節物質、その調製及び使用 | |
| WO2023114379A1 (en) | Plpro inhibitors | |
| WO2018106519A1 (en) | Heterocyclic compounds as hiv protease inhibitors | |
| CN106065018B (zh) | 取代的吲哚化合物及其使用方法和用途 | |
| AU2023301691A1 (en) | Compounds and methods for degrading casein kinase 1 alpha | |
| HK40020057A (en) | Inhibitors of influenza viruses replication | |
| AU2018200219B2 (en) | Inhibitors of Influenza Viruses Replication | |
| HK1204322B (en) | Inhibitors of influenza viruses replication | |
| HK1215530B (zh) | 流感病毒复制抑制剂 | |
| HK1215675B (zh) | 流感病毒复制抑制剂 | |
| OA16260A (en) | Inhibitors of influenza viruses replication. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request |
Effective date: 20220615 |
|
| EEER | Examination request |
Effective date: 20220615 |
|
| EEER | Examination request |
Effective date: 20220615 |
|
| EEER | Examination request |
Effective date: 20220615 |
|
| EEER | Examination request |
Effective date: 20220615 |