CA2581580A1 - Novel substituted thiophencarboxylic acid amides, production thereof and use thereof as medicaments - Google Patents
Novel substituted thiophencarboxylic acid amides, production thereof and use thereof as medicaments Download PDFInfo
- Publication number
- CA2581580A1 CA2581580A1 CA002581580A CA2581580A CA2581580A1 CA 2581580 A1 CA2581580 A1 CA 2581580A1 CA 002581580 A CA002581580 A CA 002581580A CA 2581580 A CA2581580 A CA 2581580A CA 2581580 A1 CA2581580 A1 CA 2581580A1
- Authority
- CA
- Canada
- Prior art keywords
- group
- alkyl
- methyl
- atom
- thiophene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000003814 drug Substances 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title description 3
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical class OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 title description 2
- 239000000203 mixture Substances 0.000 claims abstract description 44
- 150000003839 salts Chemical class 0.000 claims abstract description 39
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims abstract description 24
- DENPQNAWGQXKCU-UHFFFAOYSA-N thiophene-2-carboxamide Chemical class NC(=O)C1=CC=CS1 DENPQNAWGQXKCU-UHFFFAOYSA-N 0.000 claims abstract description 13
- -1 sulphonyl group Chemical group 0.000 claims description 268
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 152
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 104
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 103
- 125000004432 carbon atom Chemical group C* 0.000 claims description 97
- 150000001875 compounds Chemical class 0.000 claims description 91
- 229910052760 oxygen Inorganic materials 0.000 claims description 91
- 239000001301 oxygen Substances 0.000 claims description 84
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 82
- 229910052757 nitrogen Inorganic materials 0.000 claims description 79
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 77
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 72
- 125000005842 heteroatom Chemical group 0.000 claims description 70
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 70
- 125000001153 fluoro group Chemical group F* 0.000 claims description 68
- 229910052799 carbon Inorganic materials 0.000 claims description 60
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 59
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 57
- 125000001072 heteroaryl group Chemical group 0.000 claims description 54
- 229910052801 chlorine Inorganic materials 0.000 claims description 51
- 239000000460 chlorine Substances 0.000 claims description 51
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 50
- 125000005843 halogen group Chemical group 0.000 claims description 47
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 44
- 229910052731 fluorine Inorganic materials 0.000 claims description 43
- 229910052739 hydrogen Inorganic materials 0.000 claims description 41
- 239000001257 hydrogen Substances 0.000 claims description 40
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 39
- 229910052794 bromium Inorganic materials 0.000 claims description 38
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 38
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 37
- 125000004122 cyclic group Chemical group 0.000 claims description 36
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 36
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 36
- 239000005864 Sulphur Substances 0.000 claims description 35
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims description 33
- 125000000217 alkyl group Chemical group 0.000 claims description 30
- 125000001424 substituent group Chemical group 0.000 claims description 30
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 26
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 26
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 26
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 26
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 26
- 239000011737 fluorine Substances 0.000 claims description 26
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 24
- 229910052740 iodine Inorganic materials 0.000 claims description 22
- 125000006698 (C1-C3) dialkylamino group Chemical group 0.000 claims description 21
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 21
- 125000004076 pyridyl group Chemical group 0.000 claims description 21
- 125000006715 (C1-C5) alkylthio group Chemical group 0.000 claims description 20
- 125000006559 (C1-C3) alkylamino group Chemical group 0.000 claims description 19
- 125000006560 (C1-C5)alkylcarbonylamino group Chemical group 0.000 claims description 19
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims description 19
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 18
- 150000002825 nitriles Chemical class 0.000 claims description 18
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 17
- 125000002950 monocyclic group Chemical group 0.000 claims description 17
- 238000002360 preparation method Methods 0.000 claims description 17
- 230000008569 process Effects 0.000 claims description 17
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 16
- 125000006561 (C1-C5) alkylsulphonylamino group Chemical group 0.000 claims description 14
- 125000003545 alkoxy group Chemical group 0.000 claims description 14
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 14
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 14
- 125000006553 (C3-C8) cycloalkenyl group Chemical group 0.000 claims description 13
- 125000006564 (C4-C8) cycloalkyl group Chemical group 0.000 claims description 13
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 13
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 claims description 13
- 125000004429 atom Chemical group 0.000 claims description 12
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 12
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 11
- 125000006843 cycloalkyl-C1-5-alkyl Chemical group 0.000 claims description 11
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000001174 sulfone group Chemical group 0.000 claims description 10
- 108010074860 Factor Xa Proteins 0.000 claims description 9
- 125000000623 heterocyclic group Chemical group 0.000 claims description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 9
- 125000006555 (C3-C5) cycloalkyl group Chemical group 0.000 claims description 8
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 8
- 125000006163 5-membered heteroaryl group Chemical group 0.000 claims description 8
- 125000006164 6-membered heteroaryl group Chemical group 0.000 claims description 8
- 125000000304 alkynyl group Chemical group 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 230000002401 inhibitory effect Effects 0.000 claims description 8
- 125000006845 C1-5-alkyloxycarbonyl-C1-5-alkyl group Chemical group 0.000 claims description 7
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 7
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- 125000002541 furyl group Chemical group 0.000 claims description 7
- 125000002883 imidazolyl group Chemical group 0.000 claims description 7
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 7
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 7
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 7
- 125000000335 thiazolyl group Chemical group 0.000 claims description 7
- 125000001544 thienyl group Chemical group 0.000 claims description 7
- 125000006554 (C4-C8) cycloalkenyl group Chemical group 0.000 claims description 6
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 6
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 claims description 5
- 125000006558 (C6-C8) cycloalkyl group Chemical group 0.000 claims description 5
- 229910052786 argon Inorganic materials 0.000 claims description 5
- 239000003085 diluting agent Substances 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 125000006597 (C1-C3) alkylcarbonylamino group Chemical group 0.000 claims description 4
- 239000000969 carrier Substances 0.000 claims description 4
- 125000006556 (C1-C5) alkylsulphonyl group Chemical group 0.000 claims description 3
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 3
- OGVOOJYYMZQMLV-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(2-methyl-5-oxopyrrolidin-1-yl)phenyl]oxolane-3-carboxamide Chemical compound CC1CCC(=O)N1C(C(=C1)C)=CC=C1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)COCC1 OGVOOJYYMZQMLV-UHFFFAOYSA-N 0.000 claims description 3
- XMCFFBGVPHPIRE-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]oxolane-3-carboxamide Chemical compound C=1C=C(N2C(OCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCOC1 XMCFFBGVPHPIRE-UHFFFAOYSA-N 0.000 claims description 3
- XUYMCZTZHZNLGP-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(3-methyl-2-oxoimidazolidin-1-yl)phenyl]oxolane-3-carboxamide Chemical compound O=C1N(C)CCN1C(C(=C1)C)=CC=C1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)COCC1 XUYMCZTZHZNLGP-UHFFFAOYSA-N 0.000 claims description 3
- XQYIEEKWIWSJCP-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]oxolane-3-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCOC1 XQYIEEKWIWSJCP-UHFFFAOYSA-N 0.000 claims description 3
- KMEAFRDMRLUYQT-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(4-methyl-2-oxo-1,3-oxazolidin-3-yl)phenyl]oxolane-3-carboxamide Chemical compound CC1COC(=O)N1C(C(=C1)C)=CC=C1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)COCC1 KMEAFRDMRLUYQT-UHFFFAOYSA-N 0.000 claims description 3
- ALHZVIQBVVYQQX-UHFFFAOYSA-N 5-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]-2-oxo-1,3-dioxane-5-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)COC(=O)OC1 ALHZVIQBVVYQQX-UHFFFAOYSA-N 0.000 claims description 3
- FQSMKSUTZCNNDL-UHFFFAOYSA-N 5-ethynyl-n-[1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxo-3-phenylpropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(NC(=O)C=1SC(=CC=1)C#C)CC1=CC=CC=C1 FQSMKSUTZCNNDL-UHFFFAOYSA-N 0.000 claims description 3
- JIIROTQOYNBAIP-UHFFFAOYSA-N 5-ethynyl-n-[1-[4-(2-iminoazepan-1-yl)-3-methylanilino]-2-methyl-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(CCCCC2)=N)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 JIIROTQOYNBAIP-UHFFFAOYSA-N 0.000 claims description 3
- VLKBMMHYTREAFI-UHFFFAOYSA-N 5-ethynyl-n-[1-[4-(2-iminopiperidin-1-yl)-3-methylanilino]-2-methyl-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(CCCC2)=N)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 VLKBMMHYTREAFI-UHFFFAOYSA-N 0.000 claims description 3
- QKZFGDPEQQPVML-UHFFFAOYSA-N 5-ethynyl-n-[1-[4-(5-hydroxyimino-1,4-oxazepan-4-yl)-3-methylanilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(CCOCC2)=NO)C(C)=CC=1NC(=O)C(C)NC(=O)C1=CC=C(C#C)S1 QKZFGDPEQQPVML-UHFFFAOYSA-N 0.000 claims description 3
- CSDQRJTULUWZMT-UHFFFAOYSA-N 5-ethynyl-n-[1-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]cyclopentyl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCCC1 CSDQRJTULUWZMT-UHFFFAOYSA-N 0.000 claims description 3
- NGUTZLUHIKQLFZ-UHFFFAOYSA-N 5-ethynyl-n-[2-methyl-1-[3-methyl-4-(2-oxo-1,3-oxazepan-3-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(OCCCC2)=O)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 NGUTZLUHIKQLFZ-UHFFFAOYSA-N 0.000 claims description 3
- QBPMSBIOBINFTO-UHFFFAOYSA-N 5-ethynyl-n-[2-methyl-1-[3-methyl-4-(2-oxopiperidin-1-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(CCCC2)=O)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 QBPMSBIOBINFTO-UHFFFAOYSA-N 0.000 claims description 3
- SNKDFAHLYPMEFM-UHFFFAOYSA-N 5-ethynyl-n-[2-methyl-1-[3-methyl-4-(4-methyl-2-oxopiperazin-1-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound O=C1CN(C)CCN1C(C(=C1)C)=CC=C1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 SNKDFAHLYPMEFM-UHFFFAOYSA-N 0.000 claims description 3
- CTEJUPQACHBQDO-UHFFFAOYSA-N 5-ethynyl-n-[2-methyl-1-[3-methyl-4-(5-oxo-1,4-oxazepan-4-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(CCOCC2)=O)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 CTEJUPQACHBQDO-UHFFFAOYSA-N 0.000 claims description 3
- 108010022999 Serine Proteases Proteins 0.000 claims description 3
- 102000012479 Serine Proteases Human genes 0.000 claims description 3
- MCHQSTRCLPEETR-UHFFFAOYSA-N n-[1-[3-bromo-4-(3-oxomorpholin-4-yl)anilino]-2-methyl-1-oxopropan-2-yl]-5-ethynylthiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(Br)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 MCHQSTRCLPEETR-UHFFFAOYSA-N 0.000 claims description 3
- PACJZLWLFGYHOD-UHFFFAOYSA-N n-[1-[3-chloro-4-(5-cyanoimino-1,4-oxazepan-4-yl)anilino]-1-oxopropan-2-yl]-5-ethynylthiophene-2-carboxamide Chemical compound C=1C=C(N2C(CCOCC2)=NC#N)C(Cl)=CC=1NC(=O)C(C)NC(=O)C1=CC=C(C#C)S1 PACJZLWLFGYHOD-UHFFFAOYSA-N 0.000 claims description 3
- AMBHZHXYSREBFF-UHFFFAOYSA-N n-[4-(2,2-dimethyl-5-oxopyrrolidin-1-yl)-3-methylphenyl]-3-[(5-ethynylthiophene-2-carbonyl)amino]oxolane-3-carboxamide Chemical compound C=1C=C(N2C(CCC2=O)(C)C)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCOC1 AMBHZHXYSREBFF-UHFFFAOYSA-N 0.000 claims description 3
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 3
- 125000006563 (C1-3) alkylaminocarbonyl group Chemical group 0.000 claims description 2
- 125000006596 (C1-C3) alkylcarbonyloxy group Chemical group 0.000 claims description 2
- 125000006602 (C1-C3) alkylsulfonylamino group Chemical group 0.000 claims description 2
- IEZVPYVCPWGWCD-UHFFFAOYSA-N 1-acetyl-3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-3-carboxamide Chemical compound C1N(C(=O)C)CCC1(C(=O)NC=1C=C(C)C(N2C(COCC2)=O)=CC=1)NC(=O)C1=CC=C(C#C)S1 IEZVPYVCPWGWCD-UHFFFAOYSA-N 0.000 claims description 2
- KMRYIRCSAKYDNF-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-1-methyl-n-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-3-carboxamide Chemical compound C1N(C)CCC1(C(=O)NC=1C=C(C)C(N2C(COCC2)=O)=CC=1)NC(=O)C1=CC=C(C#C)S1 KMRYIRCSAKYDNF-UHFFFAOYSA-N 0.000 claims description 2
- WBBCDXCPAYUDLP-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(2-oxoimidazolidin-1-yl)phenyl]oxolane-3-carboxamide Chemical compound C=1C=C(N2C(NCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCOC1 WBBCDXCPAYUDLP-UHFFFAOYSA-N 0.000 claims description 2
- CGCNUJKSBYNBRB-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]oxolane-3-carboxamide Chemical compound C=1C=C(N2C(CCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCOC1 CGCNUJKSBYNBRB-UHFFFAOYSA-N 0.000 claims description 2
- CHRSOOGJXAYMNI-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]oxetane-3-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)COC1 CHRSOOGJXAYMNI-UHFFFAOYSA-N 0.000 claims description 2
- JTHKUWCAPIEESS-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[4-(3-oxomorpholin-4-yl)phenyl]oxolane-3-carboxamide Chemical compound C=1C=C(C#C)SC=1C(=O)NC1(C(=O)NC=2C=CC(=CC=2)N2C(COCC2)=O)CCOC1 JTHKUWCAPIEESS-UHFFFAOYSA-N 0.000 claims description 2
- SKUFLJWIDJKJFR-UHFFFAOYSA-N 4-[(5-ethynylthiophene-2-carbonyl)amino]-5-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-5-oxopentanoic acid Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(CCC(O)=O)NC(=O)C1=CC=C(C#C)S1 SKUFLJWIDJKJFR-UHFFFAOYSA-N 0.000 claims description 2
- CHOZOGHWMHZTCQ-UHFFFAOYSA-N 5-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]-2-oxo-1,3-diazinane-5-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CNC(=O)NC1 CHOZOGHWMHZTCQ-UHFFFAOYSA-N 0.000 claims description 2
- JMPYLNJOJPKVRJ-UHFFFAOYSA-N 5-ethynyl-n-[1,1,1-trifluoro-2-methyl-3-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-3-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C)(C(F)(F)F)NC(=O)C1=CC=C(C#C)S1 JMPYLNJOJPKVRJ-UHFFFAOYSA-N 0.000 claims description 2
- XZGQLTGFESBUKK-UHFFFAOYSA-N 5-ethynyl-n-[1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxo-3-pyridin-3-ylpropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(NC(=O)C=1SC(=CC=1)C#C)CC1=CC=CN=C1 XZGQLTGFESBUKK-UHFFFAOYSA-N 0.000 claims description 2
- HXIHUYGNDVMYEA-UHFFFAOYSA-N 5-ethynyl-n-[1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxo-4-(2h-tetrazol-5-yl)butan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(NC(=O)C=1SC(=CC=1)C#C)CCC1=NN=NN1 HXIHUYGNDVMYEA-UHFFFAOYSA-N 0.000 claims description 2
- USHKKXFHAUVHGO-UHFFFAOYSA-N 5-ethynyl-n-[1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-3-methylsulfanyl-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(CSC)NC(=O)C1=CC=C(C#C)S1 USHKKXFHAUVHGO-UHFFFAOYSA-N 0.000 claims description 2
- JEGAZPLYBHINGA-UHFFFAOYSA-N 5-ethynyl-n-[1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-3-methylsulfinyl-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(CS(C)=O)NC(=O)C1=CC=C(C#C)S1 JEGAZPLYBHINGA-UHFFFAOYSA-N 0.000 claims description 2
- FDGHNUQFBRSMHS-UHFFFAOYSA-N 5-ethynyl-n-[1-[4-(3-iminomorpholin-4-yl)-3-methylanilino]-2-methyl-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=N)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 FDGHNUQFBRSMHS-UHFFFAOYSA-N 0.000 claims description 2
- DMWADLPNKISOPQ-UHFFFAOYSA-N 5-ethynyl-n-[1-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]cyclohexyl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCCCC1 DMWADLPNKISOPQ-UHFFFAOYSA-N 0.000 claims description 2
- UZPXATLYAGXNMY-UHFFFAOYSA-N 5-ethynyl-n-[2-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-2-oxo-1-pyridin-3-ylethyl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C=1C=NC=CC=1)NC(=O)C1=CC=C(C#C)S1 UZPXATLYAGXNMY-UHFFFAOYSA-N 0.000 claims description 2
- CGDOGZSUWXDYBV-UHFFFAOYSA-N 5-ethynyl-n-[2-methyl-1-[3-methyl-4-(2-oxo-1,3-diazinan-1-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(NCCC2)=O)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 CGDOGZSUWXDYBV-UHFFFAOYSA-N 0.000 claims description 2
- MRPOTABCMBBBPZ-UHFFFAOYSA-N 5-ethynyl-n-[2-methyl-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 MRPOTABCMBBBPZ-UHFFFAOYSA-N 0.000 claims description 2
- RLHRZHRCGVLNOH-UHFFFAOYSA-N 5-ethynyl-n-[2-methyl-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-3-methylsulfanyl-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C)(CSC)NC(=O)C1=CC=C(C#C)S1 RLHRZHRCGVLNOH-UHFFFAOYSA-N 0.000 claims description 2
- DVTQEHKNDJGWGX-UHFFFAOYSA-N 5-ethynyl-n-[2-methyl-1-oxo-1-[4-(3-oxomorpholin-4-yl)-3-(trifluoromethyl)anilino]propan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C(F)(F)F)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 DVTQEHKNDJGWGX-UHFFFAOYSA-N 0.000 claims description 2
- XWURJUPIIBAXDG-UHFFFAOYSA-N 5-ethynyl-n-[3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]-1,1-dioxothietan-3-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CS(=O)(=O)C1 XWURJUPIIBAXDG-UHFFFAOYSA-N 0.000 claims description 2
- RQCQFSURWYHSPB-UHFFFAOYSA-N 5-ethynyl-n-[3-methoxy-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(COC)NC(=O)C1=CC=C(C#C)S1 RQCQFSURWYHSPB-UHFFFAOYSA-N 0.000 claims description 2
- AEZUOCSKFAKUFK-UHFFFAOYSA-N 5-ethynyl-n-[3-methoxy-2-methyl-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C)(COC)NC(=O)C1=CC=C(C#C)S1 AEZUOCSKFAKUFK-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 125000005336 allyloxy group Chemical group 0.000 claims description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 2
- 125000006576 di-(C1-C3-alkyl)-aminocarbonyl group Chemical group 0.000 claims description 2
- WVGQFQSUVWVAGV-UHFFFAOYSA-N methyl 4-[(5-ethynylthiophene-2-carbonyl)amino]-5-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-5-oxopentanoate Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(CCC(=O)OC)NC(=O)C1=CC=C(C#C)S1 WVGQFQSUVWVAGV-UHFFFAOYSA-N 0.000 claims description 2
- KEHCCGDYXHTINW-UHFFFAOYSA-N n-[1-[4-(1,1-dioxothiazinan-2-yl)-3-methylanilino]-2-methyl-1-oxopropan-2-yl]-5-ethynylthiophene-2-carboxamide Chemical compound C=1C=C(N2S(CCCC2)(=O)=O)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 KEHCCGDYXHTINW-UHFFFAOYSA-N 0.000 claims description 2
- WNWFUYVHCUWNKH-UHFFFAOYSA-N n-[3-bromo-4-(3-oxomorpholin-4-yl)phenyl]-3-[(5-ethynylthiophene-2-carbonyl)amino]oxolane-3-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(Br)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCOC1 WNWFUYVHCUWNKH-UHFFFAOYSA-N 0.000 claims description 2
- FSICYRSFPCNNBI-UHFFFAOYSA-N n-[4-(4,4-dimethyl-2-oxo-1,3-oxazolidin-3-yl)-3-methylphenyl]-3-[(5-ethynylthiophene-2-carbonyl)amino]oxolane-3-carboxamide Chemical compound C=1C=C(N2C(COC2=O)(C)C)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCOC1 FSICYRSFPCNNBI-UHFFFAOYSA-N 0.000 claims description 2
- 125000002560 nitrile group Chemical group 0.000 claims description 2
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 2
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims 7
- 125000006526 (C1-C2) alkyl group Chemical group 0.000 claims 4
- 125000006592 (C2-C3) alkenyl group Chemical group 0.000 claims 1
- 125000006593 (C2-C3) alkynyl group Chemical group 0.000 claims 1
- VOKJHKDBAALDKN-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-1-methyl-n-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]-5-oxopyrrolidine-3-carboxamide Chemical compound C1C(=O)N(C)CC1(C(=O)NC=1C=C(C)C(N2C(COCC2)=O)=CC=1)NC(=O)C1=CC=C(C#C)S1 VOKJHKDBAALDKN-UHFFFAOYSA-N 0.000 claims 1
- YNTTVCODLMWPOK-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]-5-oxopyrrolidine-3-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CNC(=O)C1 YNTTVCODLMWPOK-UHFFFAOYSA-N 0.000 claims 1
- JLWVTYUSIHIVQM-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-3-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCNC1 JLWVTYUSIHIVQM-UHFFFAOYSA-N 0.000 claims 1
- QXNYLXYTSAXKSG-UHFFFAOYSA-N 5-ethynyl-n-[1-(1h-imidazol-5-yl)-2-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-2-oxoethyl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C=1N=CNC=1)NC(=O)C1=CC=C(C#C)S1 QXNYLXYTSAXKSG-UHFFFAOYSA-N 0.000 claims 1
- RJIWBUHVJKWMPD-UHFFFAOYSA-N 5-ethynyl-n-[1-(furan-2-yl)-2-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-2-oxoethyl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C=1OC=CC=1)NC(=O)C1=CC=C(C#C)S1 RJIWBUHVJKWMPD-UHFFFAOYSA-N 0.000 claims 1
- LZXFOPCFDITQSO-UHFFFAOYSA-N 5-ethynyl-n-[1-[2-fluoro-5-methyl-4-(3-oxomorpholin-4-yl)anilino]-2-methyl-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound FC=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 LZXFOPCFDITQSO-UHFFFAOYSA-N 0.000 claims 1
- XMXGRFNXFUYUGW-UHFFFAOYSA-N 5-ethynyl-n-[1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopentan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(CCC)NC(=O)C1=CC=C(C#C)S1 XMXGRFNXFUYUGW-UHFFFAOYSA-N 0.000 claims 1
- SAUASVLNQBBNGJ-UHFFFAOYSA-N 5-ethynyl-n-[1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C)NC(=O)C1=CC=C(C#C)S1 SAUASVLNQBBNGJ-UHFFFAOYSA-N 0.000 claims 1
- SBUCNINBVBZFKP-UHFFFAOYSA-N 5-ethynyl-n-[1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-3-methylsulfonyl-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(CS(C)(=O)=O)NC(=O)C1=CC=C(C#C)S1 SBUCNINBVBZFKP-UHFFFAOYSA-N 0.000 claims 1
- OSYJGBNJNKNTAM-UHFFFAOYSA-N 5-ethynyl-n-[1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-4-methylsulfanyl-1-oxobutan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(CCSC)NC(=O)C1=CC=C(C#C)S1 OSYJGBNJNKNTAM-UHFFFAOYSA-N 0.000 claims 1
- OPZKRBKQFAMJPS-UHFFFAOYSA-N 5-ethynyl-n-[1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-4-methylsulfinyl-1-oxobutan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(CCS(C)=O)NC(=O)C1=CC=C(C#C)S1 OPZKRBKQFAMJPS-UHFFFAOYSA-N 0.000 claims 1
- PKHUUGVMNCXRJZ-UHFFFAOYSA-N 5-ethynyl-n-[1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-4-methylsulfonyl-1-oxobutan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(CCS(C)(=O)=O)NC(=O)C1=CC=C(C#C)S1 PKHUUGVMNCXRJZ-UHFFFAOYSA-N 0.000 claims 1
- QAUXUXBXRHLGBV-UHFFFAOYSA-N 5-ethynyl-n-[1-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]cyclobutyl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCC1 QAUXUXBXRHLGBV-UHFFFAOYSA-N 0.000 claims 1
- XZLVCPFFIPBTIU-UHFFFAOYSA-N 5-ethynyl-n-[2-methyl-1-[3-methyl-4-(2-oxo-1,3-oxazinan-3-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(OCCC2)=O)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 XZLVCPFFIPBTIU-UHFFFAOYSA-N 0.000 claims 1
- UHRYVBSHOCHKGJ-UHFFFAOYSA-N 5-ethynyl-n-[2-methyl-1-[3-methyl-4-(2-oxopiperazin-1-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(CNCC2)=O)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C)S1 UHRYVBSHOCHKGJ-UHFFFAOYSA-N 0.000 claims 1
- KDSIAEAENJHDOG-UHFFFAOYSA-N 5-ethynyl-n-[3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]thietan-3-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CSC1 KDSIAEAENJHDOG-UHFFFAOYSA-N 0.000 claims 1
- IZEDRHIBZYWAFP-UHFFFAOYSA-N 5-ethynyl-n-[3-methoxy-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxobutan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C(C)OC)NC(=O)C1=CC=C(C#C)S1 IZEDRHIBZYWAFP-UHFFFAOYSA-N 0.000 claims 1
- FKQNPAGPKBMGEG-UHFFFAOYSA-N n-[3-dimethoxyphosphoryl-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopropan-2-yl]-5-ethynylthiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(CP(=O)(OC)OC)NC(=O)C1=CC=C(C#C)S1 FKQNPAGPKBMGEG-UHFFFAOYSA-N 0.000 claims 1
- 150000007522 mineralic acids Chemical class 0.000 abstract description 4
- 150000007524 organic acids Chemical class 0.000 abstract description 4
- 235000005985 organic acids Nutrition 0.000 abstract description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 88
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 73
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 68
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 57
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 51
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 48
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 44
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 33
- 239000002904 solvent Substances 0.000 description 32
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- 235000019441 ethanol Nutrition 0.000 description 30
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 28
- 239000000741 silica gel Substances 0.000 description 28
- 229910002027 silica gel Inorganic materials 0.000 description 28
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 27
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 26
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 25
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 24
- 230000029936 alkylation Effects 0.000 description 23
- 238000005804 alkylation reaction Methods 0.000 description 23
- 229940073584 methylene chloride Drugs 0.000 description 23
- 239000002585 base Substances 0.000 description 22
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 20
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 20
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 20
- 230000008030 elimination Effects 0.000 description 18
- 238000003379 elimination reaction Methods 0.000 description 18
- 239000000243 solution Substances 0.000 description 18
- 239000011877 solvent mixture Substances 0.000 description 18
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 18
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 17
- 239000004480 active ingredient Substances 0.000 description 17
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 16
- 229950005499 carbon tetrachloride Drugs 0.000 description 16
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 14
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 14
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 14
- 229960001701 chloroform Drugs 0.000 description 14
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 14
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 14
- 125000006239 protecting group Chemical group 0.000 description 14
- 239000008096 xylene Substances 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- 230000010933 acylation Effects 0.000 description 13
- 238000005917 acylation reaction Methods 0.000 description 13
- 229910000027 potassium carbonate Inorganic materials 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 12
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- 238000011282 treatment Methods 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- 238000001819 mass spectrum Methods 0.000 description 11
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 10
- 235000011167 hydrochloric acid Nutrition 0.000 description 10
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 10
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 10
- 229910000029 sodium carbonate Inorganic materials 0.000 description 10
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 10
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 230000000875 corresponding effect Effects 0.000 description 9
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 9
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 9
- PMZURENOXWZQFD-UHFFFAOYSA-L sodium sulphate Substances [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 9
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical group CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 8
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 8
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 8
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 8
- 238000005859 coupling reaction Methods 0.000 description 8
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 8
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 8
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 8
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 150000002466 imines Chemical class 0.000 description 7
- 230000002265 prevention Effects 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 7
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 6
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 6
- GMPKIPWJBDOURN-UHFFFAOYSA-N Methoxyamine Chemical compound CON GMPKIPWJBDOURN-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000012317 TBTU Substances 0.000 description 6
- CLZISMQKJZCZDN-UHFFFAOYSA-N [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium Chemical compound C1=CC=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 CLZISMQKJZCZDN-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- GRKUXCWELVWVMZ-UHFFFAOYSA-N amino acetate Chemical compound CC(=O)ON GRKUXCWELVWVMZ-UHFFFAOYSA-N 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 230000008878 coupling Effects 0.000 description 6
- 238000010168 coupling process Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 238000011321 prophylaxis Methods 0.000 description 6
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 6
- 239000001117 sulphuric acid Substances 0.000 description 6
- 235000011149 sulphuric acid Nutrition 0.000 description 6
- 239000003826 tablet Substances 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 6
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- 229920002261 Corn starch Polymers 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- 235000019759 Maize starch Nutrition 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 125000001309 chloro group Chemical group Cl* 0.000 description 5
- 238000005828 desilylation reaction Methods 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- 235000019359 magnesium stearate Nutrition 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 4
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-bis(diphenylphosphino)propane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 4
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 229930195725 Mannitol Natural products 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 150000001491 aromatic compounds Chemical class 0.000 description 4
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229910000024 caesium carbonate Inorganic materials 0.000 description 4
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 4
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 4
- 239000003112 inhibitor Substances 0.000 description 4
- 238000003402 intramolecular cyclocondensation reaction Methods 0.000 description 4
- 239000000594 mannitol Substances 0.000 description 4
- 235000010355 mannitol Nutrition 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 229910000160 potassium phosphate Inorganic materials 0.000 description 4
- 235000011009 potassium phosphates Nutrition 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 239000000829 suppository Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 4
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 4
- BWHDROKFUHTORW-UHFFFAOYSA-N tritert-butylphosphane Chemical compound CC(C)(C)P(C(C)(C)C)C(C)(C)C BWHDROKFUHTORW-UHFFFAOYSA-N 0.000 description 4
- 239000008215 water for injection Substances 0.000 description 4
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- CBDSPXPVZWMEOH-UHFFFAOYSA-N 5-ethynylthiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=C(C#C)S1 CBDSPXPVZWMEOH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- FYJKEHKQUPSJDH-UHFFFAOYSA-N [dimethyl-(trimethylsilylamino)silyl]methane;potassium Chemical compound [K].C[Si](C)(C)N[Si](C)(C)C FYJKEHKQUPSJDH-UHFFFAOYSA-N 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 230000002785 anti-thrombosis Effects 0.000 description 3
- 239000003125 aqueous solvent Substances 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000008139 complexing agent Substances 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 3
- 229940093915 gynecological organic acid Drugs 0.000 description 3
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 150000007529 inorganic bases Chemical class 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 3
- 230000000269 nucleophilic effect Effects 0.000 description 3
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 3
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 235000011007 phosphoric acid Nutrition 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000006268 reductive amination reaction Methods 0.000 description 3
- 229910052703 rhodium Inorganic materials 0.000 description 3
- 239000010948 rhodium Substances 0.000 description 3
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 3
- WPFGFHJALYCVMO-UHFFFAOYSA-L rubidium carbonate Chemical compound [Rb+].[Rb+].[O-]C([O-])=O WPFGFHJALYCVMO-UHFFFAOYSA-L 0.000 description 3
- 229910000026 rubidium carbonate Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000011975 tartaric acid Substances 0.000 description 3
- 235000002906 tartaric acid Nutrition 0.000 description 3
- 229910052723 transition metal Inorganic materials 0.000 description 3
- 150000003624 transition metals Chemical class 0.000 description 3
- 125000002827 triflate group Chemical group FC(S(=O)(=O)O*)(F)F 0.000 description 3
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- NOOLISFMXDJSKH-KXUCPTDWSA-N (-)-Menthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O NOOLISFMXDJSKH-KXUCPTDWSA-N 0.000 description 2
- KQJTXYQXRHCWKW-PJSBSAQXSA-N (4s)-4-[[(2s,3s)-2-benzamido-3-methylpentanoyl]amino]-5-[[2-[[(2s)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid;hydrochloride Chemical compound Cl.N([C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)NC=1C=CC(=CC=1)[N+]([O-])=O)C(=O)C1=CC=CC=C1 KQJTXYQXRHCWKW-PJSBSAQXSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- KGPAZBJHRVLNJU-UHFFFAOYSA-N 4-(4-amino-2-methylphenyl)morpholin-3-one Chemical compound CC1=CC(N)=CC=C1N1C(=O)COCC1 KGPAZBJHRVLNJU-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- NOOLISFMXDJSKH-UHFFFAOYSA-N DL-menthol Natural products CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 2
- 108090000190 Thrombin Proteins 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- FNAWJOBKLWLHTA-UHFFFAOYSA-N [4-(trifluoromethyl)benzoyl] 4-(trifluoromethyl)benzoate Chemical compound C1=CC(C(F)(F)F)=CC=C1C(=O)OC(=O)C1=CC=C(C(F)(F)F)C=C1 FNAWJOBKLWLHTA-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 150000003931 anilides Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000003146 anticoagulant agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- AZWXAPCAJCYGIA-UHFFFAOYSA-N bis(2-methylpropyl)alumane Chemical compound CC(C)C[AlH]CC(C)C AZWXAPCAJCYGIA-UHFFFAOYSA-N 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 2
- 230000021235 carbamoylation Effects 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 239000003593 chromogenic compound Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 238000005661 deetherification reaction Methods 0.000 description 2
- 239000012024 dehydrating agents Substances 0.000 description 2
- YNHIGQDRGKUECZ-UHFFFAOYSA-N dichloropalladium;triphenylphosphanium Chemical compound Cl[Pd]Cl.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-N 0.000 description 2
- SIPUZPBQZHNSDW-UHFFFAOYSA-N diisobutylaluminium hydride Substances CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 2
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 125000001261 isocyanato group Chemical group *N=C=O 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- XMFOQHDPRMAJNU-UHFFFAOYSA-N lead(ii,iv) oxide Chemical compound O1[Pb]O[Pb]11O[Pb]O1 XMFOQHDPRMAJNU-UHFFFAOYSA-N 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- VUYVXCJTTQJVKJ-UHFFFAOYSA-L palladium(2+);tricyclohexylphosphane;dichloride Chemical compound Cl[Pd]Cl.C1CCCCC1P(C1CCCCC1)C1CCCCC1.C1CCCCC1P(C1CCCCC1)C1CCCCC1 VUYVXCJTTQJVKJ-UHFFFAOYSA-L 0.000 description 2
- OTYPIDNRISCWQY-UHFFFAOYSA-L palladium(2+);tris(2-methylphenyl)phosphane;dichloride Chemical compound Cl[Pd]Cl.CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C.CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C OTYPIDNRISCWQY-UHFFFAOYSA-L 0.000 description 2
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 239000003444 phase transfer catalyst Substances 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 2
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 2
- 239000001587 sorbitan monostearate Substances 0.000 description 2
- 235000011076 sorbitan monostearate Nutrition 0.000 description 2
- 229940035048 sorbitan monostearate Drugs 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- VEPTXBCIDSFGBF-UHFFFAOYSA-M tetrabutylazanium;fluoride;trihydrate Chemical compound O.O.O.[F-].CCCC[N+](CCCC)(CCCC)CCCC VEPTXBCIDSFGBF-UHFFFAOYSA-M 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 229960004072 thrombin Drugs 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 2
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 2
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 239000012224 working solution Substances 0.000 description 2
- 229940075966 (+)- menthol Drugs 0.000 description 1
- NOOLISFMXDJSKH-AEJSXWLSSA-N (+)-menthol Chemical compound CC(C)[C@H]1CC[C@H](C)C[C@@H]1O NOOLISFMXDJSKH-AEJSXWLSSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- GOVWVIWSDUKYDQ-GFCCVEGCSA-N (2r)-2-amino-3-methoxy-n-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]propanamide Chemical compound CC1=CC(NC(=O)[C@H](N)COC)=CC=C1N1C(=O)COCC1 GOVWVIWSDUKYDQ-GFCCVEGCSA-N 0.000 description 1
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- CRPTXKKKIGGDBX-UHFFFAOYSA-N (z)-but-2-ene Chemical group [CH2]C=CC CRPTXKKKIGGDBX-UHFFFAOYSA-N 0.000 description 1
- KYVBNYUBXIEUFW-UHFFFAOYSA-N 1,1,3,3-tetramethylguanidine Chemical compound CN(C)C(=N)N(C)C KYVBNYUBXIEUFW-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- QLOKJRIVRGCVIM-UHFFFAOYSA-N 1-[(4-methylsulfanylphenyl)methyl]piperazine Chemical compound C1=CC(SC)=CC=C1CN1CCNCC1 QLOKJRIVRGCVIM-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- LNSCNEJNLACZPA-UHFFFAOYSA-N 2,3-dihydroxy-2,3-bis(2-methylphenyl)butanedioic acid Chemical compound CC1=CC=CC=C1C(O)(C(O)=O)C(O)(C(O)=O)C1=CC=CC=C1C LNSCNEJNLACZPA-UHFFFAOYSA-N 0.000 description 1
- WCJZGROLUZOQJZ-UHFFFAOYSA-N 2-amino-2-methyl-n-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]propanamide Chemical compound CC1=CC(NC(=O)C(C)(C)N)=CC=C1N1C(=O)COCC1 WCJZGROLUZOQJZ-UHFFFAOYSA-N 0.000 description 1
- DCAZBVBOURLQQO-UHFFFAOYSA-N 2-amino-3-[(2-methylpropan-2-yl)oxycarbonyl]oxolane-3-carboxylic acid Chemical compound CC(C)(C)OC(=O)C1(C(O)=O)CCOC1N DCAZBVBOURLQQO-UHFFFAOYSA-N 0.000 description 1
- KMGUEILFFWDGFV-UHFFFAOYSA-N 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid Chemical compound C=1C=CC=CC=1C(=O)C(C(C(O)=O)O)(C(O)=O)OC(=O)C1=CC=CC=C1 KMGUEILFFWDGFV-UHFFFAOYSA-N 0.000 description 1
- 125000004922 2-methyl-3-pentyl group Chemical group CC(C)C(CC)* 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- NKNYRBXOXBBCNY-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[4-(2-oxopyrrolidin-1-yl)phenyl]oxolane-3-carboxamide Chemical compound C=1C=C(C#C)SC=1C(=O)NC1(C(=O)NC=2C=CC(=CC=2)N2C(CCC2)=O)CCOC1 NKNYRBXOXBBCNY-UHFFFAOYSA-N 0.000 description 1
- CEBMUOHBQTYYLF-UHFFFAOYSA-N 3-[(5-ethynylthiophene-2-carbonyl)amino]-n-[4-(3-methyl-2-oxoimidazolidin-1-yl)phenyl]oxolane-3-carboxamide Chemical compound O=C1N(C)CCN1C(C=C1)=CC=C1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)COCC1 CEBMUOHBQTYYLF-UHFFFAOYSA-N 0.000 description 1
- YIZPAPBJYSPHSU-UHFFFAOYSA-N 3-amino-n-[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]oxolane-3-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(N)CCOC1 YIZPAPBJYSPHSU-UHFFFAOYSA-N 0.000 description 1
- 125000004917 3-methyl-2-butyl group Chemical group CC(C(C)*)C 0.000 description 1
- 125000004919 3-methyl-2-pentyl group Chemical group CC(C(C)*)CC 0.000 description 1
- 125000004921 3-methyl-3-pentyl group Chemical group CC(CC)(CC)* 0.000 description 1
- 125000004920 4-methyl-2-pentyl group Chemical group CC(CC(C)*)C 0.000 description 1
- SCIPSGHTMUHDHT-UHFFFAOYSA-N 5-bromo-n-[2-methyl-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(Br)S1 SCIPSGHTMUHDHT-UHFFFAOYSA-N 0.000 description 1
- COWZPSUDTMGBAT-UHFFFAOYSA-N 5-bromothiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=C(Br)S1 COWZPSUDTMGBAT-UHFFFAOYSA-N 0.000 description 1
- PKHUUGVMNCXRJZ-GOSISDBHSA-N 5-ethynyl-n-[(2r)-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-4-methylsulfonyl-1-oxobutan-2-yl]thiophene-2-carboxamide Chemical compound N([C@H](CCS(C)(=O)=O)C(=O)NC=1C=C(C(=CC=1)N1C(COCC1)=O)C)C(=O)C1=CC=C(C#C)S1 PKHUUGVMNCXRJZ-GOSISDBHSA-N 0.000 description 1
- RQCQFSURWYHSPB-QGZVFWFLSA-N 5-ethynyl-n-[(2r)-3-methoxy-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopropan-2-yl]thiophene-2-carboxamide Chemical compound N([C@H](COC)C(=O)NC=1C=C(C)C(N2C(COCC2)=O)=CC=1)C(=O)C1=CC=C(C#C)S1 RQCQFSURWYHSPB-QGZVFWFLSA-N 0.000 description 1
- SJAVGOLHVSSJHK-UHFFFAOYSA-N 5-ethynyl-n-[2-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-2-oxo-1-piperidin-4-ylethyl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C1CCNCC1)NC(=O)C1=CC=C(C#C)S1 SJAVGOLHVSSJHK-UHFFFAOYSA-N 0.000 description 1
- IZDGNJCOKNMYHZ-UHFFFAOYSA-N 5-ethynyl-n-[3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]-1-oxothiolan-3-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCS(=O)C1 IZDGNJCOKNMYHZ-UHFFFAOYSA-N 0.000 description 1
- LXUBZIPDWFKTRA-UHFFFAOYSA-N 5-ethynyl-n-[3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]thiolan-3-yl]thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCSC1 LXUBZIPDWFKTRA-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005552 B01AC04 - Clopidogrel Substances 0.000 description 1
- 239000005528 B01AC05 - Ticlopidine Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- XFSCQMMDDLBDFJ-UHFFFAOYSA-N C1=CC=C[C-]1P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C[C-]1P(C1=CC=CC=C1)C1=CC=CC=C1.Cl.[Fe+2] Chemical compound C1=CC=C[C-]1P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C[C-]1P(C1=CC=CC=C1)C1=CC=CC=C1.Cl.[Fe+2] XFSCQMMDDLBDFJ-UHFFFAOYSA-N 0.000 description 1
- FOOCQVGJNWFYMC-UHFFFAOYSA-N C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(CCC)NC(=O)C1=CC=C(C#C)S1.C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C(C)OC)NC(=O)C1=CC=C(C#C)S1 Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(CCC)NC(=O)C1=CC=C(C#C)S1.C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C(C)OC)NC(=O)C1=CC=C(C#C)S1 FOOCQVGJNWFYMC-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 102100022641 Coagulation factor IX Human genes 0.000 description 1
- 229910021580 Cobalt(II) chloride Inorganic materials 0.000 description 1
- 206010009900 Colitis ulcerative Diseases 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- 206010011091 Coronary artery thrombosis Diseases 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- 206010051055 Deep vein thrombosis Diseases 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 108010056764 Eptifibatide Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 108010076282 Factor IX Proteins 0.000 description 1
- 108010074864 Factor XI Proteins 0.000 description 1
- 108010080865 Factor XII Proteins 0.000 description 1
- 102000000429 Factor XII Human genes 0.000 description 1
- 102000009123 Fibrin Human genes 0.000 description 1
- 108010073385 Fibrin Proteins 0.000 description 1
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 102000008100 Human Serum Albumin Human genes 0.000 description 1
- 108091006905 Human Serum Albumin Proteins 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 102000003960 Ligases Human genes 0.000 description 1
- 108090000364 Ligases Proteins 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- 108091007262 P2T receptors Proteins 0.000 description 1
- 208000005764 Peripheral Arterial Disease Diseases 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 101800004937 Protein C Proteins 0.000 description 1
- 102000017975 Protein C Human genes 0.000 description 1
- 208000010378 Pulmonary Embolism Diseases 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 206010038563 Reocclusion Diseases 0.000 description 1
- 101800001700 Saposin-D Proteins 0.000 description 1
- 206010040047 Sepsis Diseases 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 101710145796 Staphylokinase Proteins 0.000 description 1
- 108010023197 Streptokinase Proteins 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 108010039185 Tenecteplase Proteins 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 102000003938 Thromboxane Receptors Human genes 0.000 description 1
- 108090000300 Thromboxane Receptors Proteins 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 208000031737 Tissue Adhesions Diseases 0.000 description 1
- 108090000373 Tissue Plasminogen Activator Proteins 0.000 description 1
- 102000003978 Tissue Plasminogen Activator Human genes 0.000 description 1
- 102100030951 Tissue factor pathway inhibitor Human genes 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 201000006704 Ulcerative Colitis Diseases 0.000 description 1
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 1
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 description 1
- 229910021542 Vanadium(IV) oxide Inorganic materials 0.000 description 1
- 206010047249 Venous thrombosis Diseases 0.000 description 1
- 102100023038 WD and tetratricopeptide repeats protein 1 Human genes 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- ZGSDJMADBJCNPN-UHFFFAOYSA-N [S-][NH3+] Chemical compound [S-][NH3+] ZGSDJMADBJCNPN-UHFFFAOYSA-N 0.000 description 1
- 229960000446 abciximab Drugs 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229960003318 alteplase Drugs 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000002399 angioplasty Methods 0.000 description 1
- 239000004019 antithrombin Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- QFFVPLLCYGOFPU-UHFFFAOYSA-N barium chromate Chemical compound [Ba+2].[O-][Cr]([O-])(=O)=O QFFVPLLCYGOFPU-UHFFFAOYSA-N 0.000 description 1
- 239000010953 base metal Substances 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000005872 benzooxazolyl group Chemical group 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- RLECCBFNWDXKPK-UHFFFAOYSA-N bis(trimethylsilyl)sulfide Chemical compound C[Si](C)(C)S[Si](C)(C)C RLECCBFNWDXKPK-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- PAEBIVWUMLRPSK-IDTAVKCVSA-N cangrelor Chemical compound C1=NC=2C(NCCSC)=NC(SCCC(F)(F)F)=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)C(Cl)(Cl)P(O)(O)=O)[C@@H](O)[C@H]1O PAEBIVWUMLRPSK-IDTAVKCVSA-N 0.000 description 1
- 229960001080 cangrelor Drugs 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- XMPZTFVPEKAKFH-UHFFFAOYSA-P ceric ammonium nitrate Chemical compound [NH4+].[NH4+].[Ce+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O XMPZTFVPEKAKFH-UHFFFAOYSA-P 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- GKTWGGQPFAXNFI-HNNXBMFYSA-N clopidogrel Chemical compound C1([C@H](N2CC=3C=CSC=3CC2)C(=O)OC)=CC=CC=C1Cl GKTWGGQPFAXNFI-HNNXBMFYSA-N 0.000 description 1
- 229960003009 clopidogrel Drugs 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 208000029078 coronary artery disease Diseases 0.000 description 1
- 208000002528 coronary thrombosis Diseases 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- JZBWUTVDIDNCMW-UHFFFAOYSA-L dipotassium;oxido sulfate Chemical compound [K+].[K+].[O-]OS([O-])(=O)=O JZBWUTVDIDNCMW-UHFFFAOYSA-L 0.000 description 1
- 208000009190 disseminated intravascular coagulation Diseases 0.000 description 1
- CLLYAFZCYGRLGE-UHFFFAOYSA-N dithiadiphosphetane Chemical compound P1PSS1 CLLYAFZCYGRLGE-UHFFFAOYSA-N 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- GLGOPUHVAZCPRB-LROMGURASA-N eptifibatide Chemical compound N1C(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CCCCNC(=N)N)NC(=O)CCSSC[C@@H](C(N)=O)NC(=O)[C@@H]2CCCN2C(=O)[C@@H]1CC1=CN=C2[C]1C=CC=C2 GLGOPUHVAZCPRB-LROMGURASA-N 0.000 description 1
- 229960004468 eptifibatide Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000005713 exacerbation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229960004222 factor ix Drugs 0.000 description 1
- 229950003499 fibrin Drugs 0.000 description 1
- 239000002319 fibrinogen receptor antagonist Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229940116364 hard fat Drugs 0.000 description 1
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- 125000002462 isocyano group Chemical group *[N+]#[C-] 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 1
- 229960004873 levomenthol Drugs 0.000 description 1
- 108010013555 lipoprotein-associated coagulation inhibitor Proteins 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- IRAXRQFCCSHQDX-WBVHZDCISA-N methyl (2s)-2-(butoxycarbonylamino)-3-[[2-[(5r)-3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoate Chemical compound O1[C@@H](CC(=O)NC[C@H](NC(=O)OCCCC)C(=O)OC)CC(C=2C=CC(=CC=2)C(N)=N)=N1 IRAXRQFCCSHQDX-WBVHZDCISA-N 0.000 description 1
- 229940017219 methyl propionate Drugs 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- ULWOJODHECIZAU-UHFFFAOYSA-N n,n-diethylpropan-2-amine Chemical compound CCN(CC)C(C)C ULWOJODHECIZAU-UHFFFAOYSA-N 0.000 description 1
- CSJJFCWMENYEBO-UHFFFAOYSA-N n-[2-methyl-1-[3-methyl-4-(3-oxomorpholin-4-yl)anilino]-1-oxopropan-2-yl]-5-(2-trimethylsilylethynyl)thiophene-2-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C(C)(C)NC(=O)C1=CC=C(C#C[Si](C)(C)C)S1 CSJJFCWMENYEBO-UHFFFAOYSA-N 0.000 description 1
- ILBGVTFODALEDB-UHFFFAOYSA-N n-[3-chloro-4-(3-oxomorpholin-4-yl)phenyl]-3-[(5-ethynylthiophene-2-carbonyl)amino]oxolane-3-carboxamide Chemical compound C=1C=C(N2C(COCC2)=O)C(Cl)=CC=1NC(=O)C1(NC(=O)C=2SC(=CC=2)C#C)CCOC1 ILBGVTFODALEDB-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- WOOWBQQQJXZGIE-UHFFFAOYSA-N n-ethyl-n-propan-2-ylpropan-2-amine Chemical compound CCN(C(C)C)C(C)C.CCN(C(C)C)C(C)C WOOWBQQQJXZGIE-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005484 neopentoxy group Chemical group 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- PSACHCMMPFMFAJ-UHFFFAOYSA-N nmm n-methylmorpholine Chemical compound CN1CCOCC1.CN1CCOCC1 PSACHCMMPFMFAJ-UHFFFAOYSA-N 0.000 description 1
- 238000007339 nucleophilic aromatic substitution reaction Methods 0.000 description 1
- AQFWNELGMODZGC-UHFFFAOYSA-N o-ethylhydroxylamine Chemical compound CCON AQFWNELGMODZGC-UHFFFAOYSA-N 0.000 description 1
- PRAARDGLAWZXML-UHFFFAOYSA-N o-propylhydroxylamine Chemical compound CCCON PRAARDGLAWZXML-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- DUSYNUCUMASASA-UHFFFAOYSA-N oxygen(2-);vanadium(4+) Chemical compound [O-2].[O-2].[V+4] DUSYNUCUMASASA-UHFFFAOYSA-N 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- QJPQVXSHYBGQGM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QJPQVXSHYBGQGM-UHFFFAOYSA-N 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 238000005375 photometry Methods 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 229960000856 protein c Drugs 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 208000005069 pulmonary fibrosis Diseases 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229960002917 reteplase Drugs 0.000 description 1
- 108010051412 reteplase Proteins 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229950002267 roxifiban Drugs 0.000 description 1
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 231100000241 scar Toxicity 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 1
- QRUBYZBWAOOHSV-UHFFFAOYSA-M silver trifluoromethanesulfonate Chemical compound [Ag+].[O-]S(=O)(=O)C(F)(F)F QRUBYZBWAOOHSV-UHFFFAOYSA-M 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229960005202 streptokinase Drugs 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 229960000216 tenecteplase Drugs 0.000 description 1
- XUTLOCQNGLJNSA-RGVLZGJSSA-N terbogrel Chemical compound CC(C)(C)\N=C(/NC#N)NC1=CC=CC(C(=C/CCCC(O)=O)\C=2C=NC=CC=2)=C1 XUTLOCQNGLJNSA-RGVLZGJSSA-N 0.000 description 1
- 229950006665 terbogrel Drugs 0.000 description 1
- DUKHIXRHUALBNI-UHFFFAOYSA-N tert-butyl 2-amino-3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]oxolane-3-carboxylate Chemical compound C=1C=C(N2C(COCC2)=O)C(C)=CC=1NC(=O)C1(C(=O)OC(C)(C)C)CCOC1N DUKHIXRHUALBNI-UHFFFAOYSA-N 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 150000003564 thiocarbonyl compounds Chemical class 0.000 description 1
- 230000002537 thrombolytic effect Effects 0.000 description 1
- PHWBOXQYWZNQIN-UHFFFAOYSA-N ticlopidine Chemical compound ClC1=CC=CC=C1CN1CC(C=CS2)=C2CC1 PHWBOXQYWZNQIN-UHFFFAOYSA-N 0.000 description 1
- 229960005001 ticlopidine Drugs 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- COKMIXFXJJXBQG-NRFANRHFSA-N tirofiban Chemical compound C1=CC(C[C@H](NS(=O)(=O)CCCC)C(O)=O)=CC=C1OCCCCC1CCNCC1 COKMIXFXJJXBQG-NRFANRHFSA-N 0.000 description 1
- 229960003425 tirofiban Drugs 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- AHZJKOKFZJYCLG-UHFFFAOYSA-K trifluoromethanesulfonate;ytterbium(3+) Chemical compound [Yb+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F AHZJKOKFZJYCLG-UHFFFAOYSA-K 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 229960005356 urokinase Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 230000029663 wound healing Effects 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE102004047840A DE102004047840A1 (de) | 2004-09-29 | 2004-09-29 | Neue substituierte Thiophencarbonsäureamide, deren Herstellung und deren Verwendung als Arzneimittel |
| DE102004047840.6 | 2004-09-29 | ||
| PCT/EP2005/010307 WO2006034822A1 (de) | 2004-09-29 | 2005-09-23 | Neue substituierte thiophencarbonsäureamide, deren herstellung und deren verwendung als arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2581580A1 true CA2581580A1 (en) | 2006-04-06 |
Family
ID=35385703
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002581580A Abandoned CA2581580A1 (en) | 2004-09-29 | 2005-09-23 | Novel substituted thiophencarboxylic acid amides, production thereof and use thereof as medicaments |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US7563786B2 (enExample) |
| EP (1) | EP1797080A1 (enExample) |
| JP (1) | JP2008514665A (enExample) |
| CA (1) | CA2581580A1 (enExample) |
| DE (1) | DE102004047840A1 (enExample) |
| WO (1) | WO2006034822A1 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8741890B2 (en) | 2007-11-15 | 2014-06-03 | Boehringer Ingelheim International Gmbh | Substituted amides, manufacturing and use thereof as medicaments |
| US9062034B2 (en) | 2005-06-30 | 2015-06-23 | Boehringer Ingelheim International Gmbh | Substituted glycinamides, process for their manufacture and use thereof as medicaments |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2007537179A (ja) * | 2004-05-13 | 2007-12-20 | ベーリンガー インゲルハイム インターナショナル ゲゼルシャフト ミット ベシュレンクテル ハフツング | 置換チオフェン−2−カルボン酸アミド、その製法及び薬物としての使用 |
| PE20081834A1 (es) * | 2006-12-31 | 2009-01-16 | Boehringer Ingelheim Int | Proceso para la sintesis de derivados de acido 3-amino-tetrahidrofuran-3-carboxilico y uso de los mismos como medicamentos |
| MX2011000628A (es) * | 2008-07-15 | 2011-02-25 | Novartis Ag | Derivados de heteroarilo como inhibidores de dgat1. |
| EP2480531B1 (en) | 2009-09-21 | 2014-11-05 | ChemoCentryx, Inc. | Pyrrolidinone carboxamide derivatives as chemerin-r (chemr23) modulators |
| US8912221B2 (en) * | 2010-12-27 | 2014-12-16 | Hoffmann-La Roche Inc. | Biaryl amide derivatives |
| CN105294669B (zh) * | 2014-10-24 | 2019-01-22 | 山东凯森制药有限公司 | 一种第十因子抑制剂及其制备方法和应用 |
| EP3078378B1 (en) | 2015-04-08 | 2020-06-24 | Vaiomer | Use of factor xa inhibitors for regulating glycemia |
| US11691960B2 (en) | 2020-11-06 | 2023-07-04 | Boehringer Ingelheim International Gmbh | 2-[thiophen-2-yl)formamido]-N-(phenyl)-2-methylpropanamide derivatives and the use thereof as medicament |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19962924A1 (de) * | 1999-12-24 | 2001-07-05 | Bayer Ag | Substituierte Oxazolidinone und ihre Verwendung |
| GB0030305D0 (en) * | 2000-12-13 | 2001-01-24 | Lilly Co Eli | Compounds |
| JP4266092B2 (ja) * | 2001-10-09 | 2009-05-20 | 第一三共株式会社 | ジアミン誘導体 |
| EP1558606A4 (en) * | 2002-10-02 | 2008-05-07 | Bristol Myers Squibb Co | DIAMINOALKYL CONTAINING LACTAM, BETA AMINO ACIDS, ALPHA AMINO ACIDS AND DERIVATIVES THEREOF AS FACTOR XA INHIBITORS |
| DE10254336A1 (de) * | 2002-11-21 | 2004-06-03 | Merck Patent Gmbh | Carbonsäureamide |
-
2004
- 2004-09-29 DE DE102004047840A patent/DE102004047840A1/de not_active Withdrawn
-
2005
- 2005-09-23 WO PCT/EP2005/010307 patent/WO2006034822A1/de not_active Ceased
- 2005-09-23 JP JP2007533923A patent/JP2008514665A/ja active Pending
- 2005-09-23 EP EP05788511A patent/EP1797080A1/de not_active Withdrawn
- 2005-09-23 CA CA002581580A patent/CA2581580A1/en not_active Abandoned
- 2005-09-29 US US11/238,599 patent/US7563786B2/en active Active
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9062034B2 (en) | 2005-06-30 | 2015-06-23 | Boehringer Ingelheim International Gmbh | Substituted glycinamides, process for their manufacture and use thereof as medicaments |
| US9676781B2 (en) | 2005-06-30 | 2017-06-13 | Boehringer Ingelheim International Gmbh | Substituted glycinamides, process for their manufacture and use thereof as medicaments |
| US8741890B2 (en) | 2007-11-15 | 2014-06-03 | Boehringer Ingelheim International Gmbh | Substituted amides, manufacturing and use thereof as medicaments |
Also Published As
| Publication number | Publication date |
|---|---|
| EP1797080A1 (de) | 2007-06-20 |
| DE102004047840A1 (de) | 2006-03-30 |
| US20060069082A1 (en) | 2006-03-30 |
| WO2006034822A8 (de) | 2006-06-15 |
| WO2006034822A1 (de) | 2006-04-06 |
| US7563786B2 (en) | 2009-07-21 |
| JP2008514665A (ja) | 2008-05-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US9676781B2 (en) | Substituted glycinamides, process for their manufacture and use thereof as medicaments | |
| CA2551788C (en) | Novel carboxamides for use as xa inhibitors | |
| NZ573573A (en) | Substituted prolinamides, production thereof and their use as drugs | |
| US7476663B2 (en) | Substituted thiophene carboxamides | |
| US7563786B2 (en) | Substituted thiophenecarboxamides, their preparation and their use as medicaments | |
| CA2641912A1 (en) | Substituted prolinamides, their preparation and their use as pharmaceuticals | |
| WO2008135525A2 (en) | Substituted azetidines, manufacturing and use thereof as medicaments | |
| US7615549B2 (en) | Substituted pyrrolidinones, their manufacture and their use as medicaments | |
| US20050256107A1 (en) | New substituted thiophene carboxamides, process for their preparation and their use as medicaments | |
| CA2615447A1 (en) | Substituted amides, their preparation and their use as pharmaceuticals | |
| US7732466B2 (en) | Substituted thiophene carboxamides, process for their preparation and their use as medicaments | |
| CN101014591A (zh) | 新颖被取代的噻吩羧酰胺,其制备方法及作为药物的用途 | |
| WO2009063028A2 (en) | Substituted amides, manufacturing and use thereof as medicaments | |
| CA2599021A1 (en) | Novel antithrombotic substituted pyrrolidinones, the production and use thereof in the form of medicaments |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |