CA2503201C - Modified release compositions of milnacipran - Google Patents
Modified release compositions of milnacipran Download PDFInfo
- Publication number
- CA2503201C CA2503201C CA2503201A CA2503201A CA2503201C CA 2503201 C CA2503201 C CA 2503201C CA 2503201 A CA2503201 A CA 2503201A CA 2503201 A CA2503201 A CA 2503201A CA 2503201 C CA2503201 C CA 2503201C
- Authority
- CA
- Canada
- Prior art keywords
- milnacipran
- release
- formulation according
- dose
- formulation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- GJJFMKBJSRMPLA-HIFRSBDPSA-N (1R,2S)-2-(aminomethyl)-N,N-diethyl-1-phenyl-1-cyclopropanecarboxamide Chemical group C=1C=CC=CC=1[C@@]1(C(=O)N(CC)CC)C[C@@H]1CN GJJFMKBJSRMPLA-HIFRSBDPSA-N 0.000 title claims abstract description 169
- 229960000600 milnacipran Drugs 0.000 title claims abstract description 159
- 239000000203 mixture Substances 0.000 title claims abstract description 93
- 238000009472 formulation Methods 0.000 claims abstract description 63
- 229940079593 drug Drugs 0.000 claims abstract description 62
- 239000003814 drug Substances 0.000 claims abstract description 62
- 238000013265 extended release Methods 0.000 claims abstract description 51
- 230000003111 delayed effect Effects 0.000 claims abstract description 42
- 230000000694 effects Effects 0.000 claims abstract description 37
- 206010028813 Nausea Diseases 0.000 claims abstract description 25
- 230000008693 nausea Effects 0.000 claims abstract description 25
- 239000012729 immediate-release (IR) formulation Substances 0.000 claims abstract description 16
- 208000008454 Hyperhidrosis Diseases 0.000 claims abstract description 13
- 206010044565 Tremor Diseases 0.000 claims abstract description 13
- 206010047700 Vomiting Diseases 0.000 claims abstract description 13
- 208000013738 Sleep Initiation and Maintenance disease Diseases 0.000 claims abstract description 12
- 206010022437 insomnia Diseases 0.000 claims abstract description 12
- 230000008673 vomiting Effects 0.000 claims abstract description 11
- 208000019901 Anxiety disease Diseases 0.000 claims abstract description 10
- 206010019233 Headaches Diseases 0.000 claims abstract description 10
- 231100000869 headache Toxicity 0.000 claims abstract description 10
- 206010041349 Somnolence Diseases 0.000 claims abstract description 9
- 206010013781 dry mouth Diseases 0.000 claims abstract description 9
- 201000006549 dyspepsia Diseases 0.000 claims abstract description 9
- 230000001965 increasing effect Effects 0.000 claims abstract description 9
- 210000002784 stomach Anatomy 0.000 claims abstract description 9
- 206010010774 Constipation Diseases 0.000 claims abstract description 8
- 208000032140 Sleepiness Diseases 0.000 claims abstract description 8
- 230000036506 anxiety Effects 0.000 claims abstract description 8
- 206010016256 fatigue Diseases 0.000 claims abstract description 8
- 230000035900 sweating Effects 0.000 claims abstract description 8
- 208000004998 Abdominal Pain Diseases 0.000 claims abstract description 7
- 208000019906 panic disease Diseases 0.000 claims abstract description 7
- 230000004584 weight gain Effects 0.000 claims abstract description 7
- 235000019786 weight gain Nutrition 0.000 claims abstract description 7
- 206010001497 Agitation Diseases 0.000 claims abstract description 6
- 206010060800 Hot flush Diseases 0.000 claims abstract description 6
- 206010029216 Nervousness Diseases 0.000 claims abstract description 6
- 206010033557 Palpitations Diseases 0.000 claims abstract description 6
- 208000012886 Vertigo Diseases 0.000 claims abstract description 6
- 238000013019 agitation Methods 0.000 claims abstract description 6
- 230000003292 diminished effect Effects 0.000 claims abstract description 6
- 231100000889 vertigo Toxicity 0.000 claims abstract description 6
- 208000008035 Back Pain Diseases 0.000 claims abstract description 5
- 206010008479 Chest Pain Diseases 0.000 claims abstract description 5
- 208000010201 Exanthema Diseases 0.000 claims abstract description 5
- 206010022998 Irritability Diseases 0.000 claims abstract description 5
- 208000001089 Multiple system atrophy Diseases 0.000 claims abstract description 5
- 206010031127 Orthostatic hypotension Diseases 0.000 claims abstract description 5
- 206010033664 Panic attack Diseases 0.000 claims abstract description 5
- 206010046555 Urinary retention Diseases 0.000 claims abstract description 5
- 208000021017 Weight Gain Diseases 0.000 claims abstract description 5
- 208000013219 diaphoresis Diseases 0.000 claims abstract description 5
- 201000005884 exanthem Diseases 0.000 claims abstract description 5
- 206010037844 rash Diseases 0.000 claims abstract description 5
- 208000019116 sleep disease Diseases 0.000 claims abstract description 5
- 208000022925 sleep disturbance Diseases 0.000 claims abstract description 5
- -1 antimigraine drugs Substances 0.000 claims description 37
- 239000002552 dosage form Substances 0.000 claims description 36
- 238000000034 method Methods 0.000 claims description 33
- 150000003839 salts Chemical class 0.000 claims description 22
- 150000001875 compounds Chemical class 0.000 claims description 21
- ZEUITGRIYCTCEM-KRWDZBQOSA-N (S)-duloxetine Chemical compound C1([C@@H](OC=2C3=CC=CC=C3C=CC=2)CCNC)=CC=CS1 ZEUITGRIYCTCEM-KRWDZBQOSA-N 0.000 claims description 9
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 7
- 239000000935 antidepressant agent Substances 0.000 claims description 7
- 229960002866 duloxetine Drugs 0.000 claims description 7
- 230000001225 therapeutic effect Effects 0.000 claims description 7
- PNVNVHUZROJLTJ-UHFFFAOYSA-N venlafaxine Chemical compound C1=CC(OC)=CC=C1C(CN(C)C)C1(O)CCCCC1 PNVNVHUZROJLTJ-UHFFFAOYSA-N 0.000 claims description 7
- UGJMXCAKCUNAIE-UHFFFAOYSA-N Gabapentin Chemical compound OC(=O)CC1(CN)CCCCC1 UGJMXCAKCUNAIE-UHFFFAOYSA-N 0.000 claims description 6
- 230000037058 blood plasma level Effects 0.000 claims description 6
- 229940005513 antidepressants Drugs 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 229960004688 venlafaxine Drugs 0.000 claims description 5
- GVJHHUAWPYXKBD-UHFFFAOYSA-N (±)-α-Tocopherol Chemical compound OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 claims description 4
- USSIQXCVUWKGNF-UHFFFAOYSA-N 6-(dimethylamino)-4,4-diphenylheptan-3-one Chemical compound C=1C=CC=CC=1C(CC(C)N(C)C)(C(=O)CC)C1=CC=CC=C1 USSIQXCVUWKGNF-UHFFFAOYSA-N 0.000 claims description 4
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 claims description 4
- MITFXPHMIHQXPI-UHFFFAOYSA-N Oraflex Chemical compound N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 claims description 4
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 claims description 4
- OROGSEYTTFOCAN-DNJOTXNNSA-N codeine Chemical compound C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC OROGSEYTTFOCAN-DNJOTXNNSA-N 0.000 claims description 4
- 206010061428 decreased appetite Diseases 0.000 claims description 4
- XLMALTXPSGQGBX-GCJKJVERSA-N dextropropoxyphene Chemical compound C([C@](OC(=O)CC)([C@H](C)CN(C)C)C=1C=CC=CC=1)C1=CC=CC=C1 XLMALTXPSGQGBX-GCJKJVERSA-N 0.000 claims description 4
- 229960004193 dextropropoxyphene Drugs 0.000 claims description 4
- XYYVYLMBEZUESM-UHFFFAOYSA-N dihydrocodeine Natural products C1C(N(CCC234)C)C2C=CC(=O)C3OC2=C4C1=CC=C2OC XYYVYLMBEZUESM-UHFFFAOYSA-N 0.000 claims description 4
- ADEBPBSSDYVVLD-UHFFFAOYSA-N donepezil Chemical compound O=C1C=2C=C(OC)C(OC)=CC=2CC1CC(CC1)CCN1CC1=CC=CC=C1 ADEBPBSSDYVVLD-UHFFFAOYSA-N 0.000 claims description 4
- 239000002702 enteric coating Substances 0.000 claims description 4
- 238000009505 enteric coating Methods 0.000 claims description 4
- ASUTZQLVASHGKV-JDFRZJQESA-N galanthamine Chemical compound O1C(=C23)C(OC)=CC=C2CN(C)CC[C@]23[C@@H]1C[C@@H](O)C=C2 ASUTZQLVASHGKV-JDFRZJQESA-N 0.000 claims description 4
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 claims description 4
- OROGSEYTTFOCAN-UHFFFAOYSA-N hydrocodone Natural products C1C(N(CCC234)C)C2C=CC(O)C3OC2=C4C1=CC=C2OC OROGSEYTTFOCAN-UHFFFAOYSA-N 0.000 claims description 4
- JYGXADMDTFJGBT-VWUMJDOOSA-N hydrocortisone Chemical compound O=C1CC[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 JYGXADMDTFJGBT-VWUMJDOOSA-N 0.000 claims description 4
- 229960004801 imipramine Drugs 0.000 claims description 4
- BCGWQEUPMDMJNV-UHFFFAOYSA-N imipramine Chemical compound C1CC2=CC=CC=C2N(CCCN(C)C)C2=CC=CC=C21 BCGWQEUPMDMJNV-UHFFFAOYSA-N 0.000 claims description 4
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 claims description 4
- 229960001797 methadone Drugs 0.000 claims description 4
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 claims description 4
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 claims description 4
- CPJSUEIXXCENMM-UHFFFAOYSA-N phenacetin Chemical compound CCOC1=CC=C(NC(C)=O)C=C1 CPJSUEIXXCENMM-UHFFFAOYSA-N 0.000 claims description 4
- FIADGNVRKBPQEU-UHFFFAOYSA-N pizotifen Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2CCC2=C1C=CS2 FIADGNVRKBPQEU-UHFFFAOYSA-N 0.000 claims description 4
- 229960004572 pizotifen Drugs 0.000 claims description 4
- 230000002829 reductive effect Effects 0.000 claims description 4
- WVYADZUPLLSGPU-UHFFFAOYSA-N salsalate Chemical compound OC(=O)C1=CC=CC=C1OC(=O)C1=CC=CC=C1O WVYADZUPLLSGPU-UHFFFAOYSA-N 0.000 claims description 4
- VGKDLMBJGBXTGI-SJCJKPOMSA-N sertraline Chemical compound C1([C@@H]2CC[C@@H](C3=CC=CC=C32)NC)=CC=C(Cl)C(Cl)=C1 VGKDLMBJGBXTGI-SJCJKPOMSA-N 0.000 claims description 4
- BNRNXUUZRGQAQC-UHFFFAOYSA-N sildenafil Chemical compound CCCC1=NN(C)C(C(N2)=O)=C1N=C2C(C(=CC=1)OCC)=CC=1S(=O)(=O)N1CCN(C)CC1 BNRNXUUZRGQAQC-UHFFFAOYSA-N 0.000 claims description 4
- 238000011287 therapeutic dose Methods 0.000 claims description 4
- YFGHCGITMMYXAQ-UHFFFAOYSA-N 2-[(diphenylmethyl)sulfinyl]acetamide Chemical compound C=1C=CC=CC=1C(S(=O)CC(=O)N)C1=CC=CC=C1 YFGHCGITMMYXAQ-UHFFFAOYSA-N 0.000 claims description 3
- 230000003291 dopaminomimetic effect Effects 0.000 claims description 3
- 229960001165 modafinil Drugs 0.000 claims description 3
- 239000000932 sedative agent Substances 0.000 claims description 3
- 229960002073 sertraline Drugs 0.000 claims description 3
- 210000000813 small intestine Anatomy 0.000 claims description 3
- AHOUBRCZNHFOSL-YOEHRIQHSA-N (+)-Casbol Chemical compound C1=CC(F)=CC=C1[C@H]1[C@H](COC=2C=C3OCOC3=CC=2)CNCC1 AHOUBRCZNHFOSL-YOEHRIQHSA-N 0.000 claims description 2
- YWPHCCPCQOJSGZ-LLVKDONJSA-N (2r)-2-[(2-ethoxyphenoxy)methyl]morpholine Chemical compound CCOC1=CC=CC=C1OC[C@@H]1OCCNC1 YWPHCCPCQOJSGZ-LLVKDONJSA-N 0.000 claims description 2
- RJMIEHBSYVWVIN-LLVKDONJSA-N (2r)-2-[4-(3-oxo-1h-isoindol-2-yl)phenyl]propanoic acid Chemical compound C1=CC([C@H](C(O)=O)C)=CC=C1N1C(=O)C2=CC=CC=C2C1 RJMIEHBSYVWVIN-LLVKDONJSA-N 0.000 claims description 2
- RDJGLLICXDHJDY-NSHDSACASA-N (2s)-2-(3-phenoxyphenyl)propanoic acid Chemical compound OC(=O)[C@@H](C)C1=CC=CC(OC=2C=CC=CC=2)=C1 RDJGLLICXDHJDY-NSHDSACASA-N 0.000 claims description 2
- YKFCISHFRZHKHY-NGQGLHOPSA-N (2s)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;trihydrate Chemical compound O.O.O.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 YKFCISHFRZHKHY-NGQGLHOPSA-N 0.000 claims description 2
- OOBHFESNSZDWIU-GXSJLCMTSA-N (2s,3s)-3-methyl-2-phenylmorpholine Chemical compound C[C@@H]1NCCO[C@H]1C1=CC=CC=C1 OOBHFESNSZDWIU-GXSJLCMTSA-N 0.000 claims description 2
- DNXIKVLOVZVMQF-UHFFFAOYSA-N (3beta,16beta,17alpha,18beta,20alpha)-17-hydroxy-11-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-yohimban-16-carboxylic acid, methyl ester Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(C(=O)OC)C(O)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 DNXIKVLOVZVMQF-UHFFFAOYSA-N 0.000 claims description 2
- FELGMEQIXOGIFQ-CYBMUJFWSA-N (3r)-9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1h-carbazol-4-one Chemical compound CC1=NC=CN1C[C@@H]1C(=O)C(C=2C(=CC=CC=2)N2C)=C2CC1 FELGMEQIXOGIFQ-CYBMUJFWSA-N 0.000 claims description 2
- DIWRORZWFLOCLC-HNNXBMFYSA-N (3s)-7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one Chemical compound N([C@H](C(NC1=CC=C(Cl)C=C11)=O)O)=C1C1=CC=CC=C1Cl DIWRORZWFLOCLC-HNNXBMFYSA-N 0.000 claims description 2
- GBBSUAFBMRNDJC-MRXNPFEDSA-N (5R)-zopiclone Chemical compound C1CN(C)CCN1C(=O)O[C@@H]1C2=NC=CN=C2C(=O)N1C1=CC=C(Cl)C=N1 GBBSUAFBMRNDJC-MRXNPFEDSA-N 0.000 claims description 2
- KPJZHOPZRAFDTN-ZRGWGRIASA-N (6aR,9R)-N-[(2S)-1-hydroxybutan-2-yl]-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@H](CO)CC)C2)=C3C2=CN(C)C3=C1 KPJZHOPZRAFDTN-ZRGWGRIASA-N 0.000 claims description 2
- WSEQXVZVJXJVFP-HXUWFJFHSA-N (R)-citalopram Chemical compound C1([C@@]2(C3=CC=C(C=C3CO2)C#N)CCCN(C)C)=CC=C(F)C=C1 WSEQXVZVJXJVFP-HXUWFJFHSA-N 0.000 claims description 2
- RTHCYVBBDHJXIQ-MRXNPFEDSA-N (R)-fluoxetine Chemical compound O([C@H](CCNC)C=1C=CC=CC=1)C1=CC=C(C(F)(F)F)C=C1 RTHCYVBBDHJXIQ-MRXNPFEDSA-N 0.000 claims description 2
- TVYLLZQTGLZFBW-ZBFHGGJFSA-N (R,R)-tramadol Chemical compound COC1=CC=CC([C@]2(O)[C@H](CCCC2)CN(C)C)=C1 TVYLLZQTGLZFBW-ZBFHGGJFSA-N 0.000 claims description 2
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 claims description 2
- PYHRZPFZZDCOPH-QXGOIDDHSA-N (S)-amphetamine sulfate Chemical compound [H+].[H+].[O-]S([O-])(=O)=O.C[C@H](N)CC1=CC=CC=C1.C[C@H](N)CC1=CC=CC=C1 PYHRZPFZZDCOPH-QXGOIDDHSA-N 0.000 claims description 2
- TZJUVVIWVWFLCD-UHFFFAOYSA-N 1,1-dioxo-2-[4-[4-(2-pyrimidinyl)-1-piperazinyl]butyl]-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC=CC=C2C(=O)N1CCCCN(CC1)CCN1C1=NC=CC=N1 TZJUVVIWVWFLCD-UHFFFAOYSA-N 0.000 claims description 2
- TZCPCKNHXULUIY-RGULYWFUSA-N 1,2-distearoyl-sn-glycero-3-phosphoserine Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@H](COP(O)(=O)OC[C@H](N)C(O)=O)OC(=O)CCCCCCCCCCCCCCCCC TZCPCKNHXULUIY-RGULYWFUSA-N 0.000 claims description 2
- FUFLCEKSBBHCMO-UHFFFAOYSA-N 11-dehydrocorticosterone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)C(=O)CO)C4C3CCC2=C1 FUFLCEKSBBHCMO-UHFFFAOYSA-N 0.000 claims description 2
- YNZFUWZUGRBMHL-UHFFFAOYSA-N 2-[4-[3-(11-benzo[b][1]benzazepinyl)propyl]-1-piperazinyl]ethanol Chemical compound C1CN(CCO)CCN1CCCN1C2=CC=CC=C2C=CC2=CC=CC=C21 YNZFUWZUGRBMHL-UHFFFAOYSA-N 0.000 claims description 2
- IVQOFBKHQCTVQV-UHFFFAOYSA-N 2-hydroxy-2,2-diphenylacetic acid 2-(diethylamino)ethyl ester Chemical compound C=1C=CC=CC=1C(O)(C(=O)OCCN(CC)CC)C1=CC=CC=C1 IVQOFBKHQCTVQV-UHFFFAOYSA-N 0.000 claims description 2
- GNXFOGHNGIVQEH-UHFFFAOYSA-N 2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate Chemical compound COC1=CC=CC=C1OCC(O)COC(N)=O GNXFOGHNGIVQEH-UHFFFAOYSA-N 0.000 claims description 2
- MXUNKHLAEDCYJL-UHFFFAOYSA-N 5-(hydroxymethyl)-3-(3-methylphenyl)-1,3-oxazolidin-2-one Chemical compound CC1=CC=CC(N2C(OC(CO)C2)=O)=C1 MXUNKHLAEDCYJL-UHFFFAOYSA-N 0.000 claims description 2
- QPGGEKPRGVJKQB-UHFFFAOYSA-N 5-[2-(dimethylamino)ethyl]-11-methyl-6-benzo[b][1,4]benzodiazepinone Chemical compound O=C1N(CCN(C)C)C2=CC=CC=C2N(C)C2=CC=CC=C21 QPGGEKPRGVJKQB-UHFFFAOYSA-N 0.000 claims description 2
- LDCYZAJDBXYCGN-VIFPVBQESA-N 5-hydroxy-L-tryptophan Chemical compound C1=C(O)C=C2C(C[C@H](N)C(O)=O)=CNC2=C1 LDCYZAJDBXYCGN-VIFPVBQESA-N 0.000 claims description 2
- CEUORZQYGODEFX-UHFFFAOYSA-N Aripirazole Chemical compound ClC1=CC=CC(N2CCN(CCCCOC=3C=C4NC(=O)CCC4=CC=3)CC2)=C1Cl CEUORZQYGODEFX-UHFFFAOYSA-N 0.000 claims description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 claims description 2
- MNIPYSSQXLZQLJ-UHFFFAOYSA-N Biofenac Chemical compound OC(=O)COC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl MNIPYSSQXLZQLJ-UHFFFAOYSA-N 0.000 claims description 2
- VOVIALXJUBGFJZ-KWVAZRHASA-N Budesonide Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1C[C@H]3OC(CCC)O[C@@]3(C(=O)CO)[C@@]1(C)C[C@@H]2O VOVIALXJUBGFJZ-KWVAZRHASA-N 0.000 claims description 2
- UDKCHVLMFQVBAA-UHFFFAOYSA-M Choline salicylate Chemical compound C[N+](C)(C)CCO.OC1=CC=CC=C1C([O-])=O UDKCHVLMFQVBAA-UHFFFAOYSA-M 0.000 claims description 2
- GDLIGKIOYRNHDA-UHFFFAOYSA-N Clomipramine Chemical compound C1CC2=CC=C(Cl)C=C2N(CCCN(C)C)C2=CC=CC=C21 GDLIGKIOYRNHDA-UHFFFAOYSA-N 0.000 claims description 2
- GJSURZIOUXUGAL-UHFFFAOYSA-N Clonidine Chemical compound ClC1=CC=CC(Cl)=C1NC1=NCCN1 GJSURZIOUXUGAL-UHFFFAOYSA-N 0.000 claims description 2
- CHBRHODLKOZEPZ-UHFFFAOYSA-N Clotiazepam Chemical compound S1C(CC)=CC2=C1N(C)C(=O)CN=C2C1=CC=CC=C1Cl CHBRHODLKOZEPZ-UHFFFAOYSA-N 0.000 claims description 2
- OMFXVFTZEKFJBZ-UHFFFAOYSA-N Corticosterone Natural products O=C1CCC2(C)C3C(O)CC(C)(C(CC4)C(=O)CO)C4C3CCC2=C1 OMFXVFTZEKFJBZ-UHFFFAOYSA-N 0.000 claims description 2
- MFYSYFVPBJMHGN-ZPOLXVRWSA-N Cortisone Chemical compound O=C1CC[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 MFYSYFVPBJMHGN-ZPOLXVRWSA-N 0.000 claims description 2
- MFYSYFVPBJMHGN-UHFFFAOYSA-N Cortisone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)(O)C(=O)CO)C4C3CCC2=C1 MFYSYFVPBJMHGN-UHFFFAOYSA-N 0.000 claims description 2
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 claims description 2
- HCYAFALTSJYZDH-UHFFFAOYSA-N Desimpramine Chemical compound C1CC2=CC=CC=C2N(CCCNC)C2=CC=CC=C21 HCYAFALTSJYZDH-UHFFFAOYSA-N 0.000 claims description 2
- IJVCSMSMFSCRME-KBQPJGBKSA-N Dihydromorphine Chemical compound O([C@H]1[C@H](CC[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O IJVCSMSMFSCRME-KBQPJGBKSA-N 0.000 claims description 2
- XRHVZWWRFMCBAZ-UHFFFAOYSA-L Endothal-disodium Chemical compound [Na+].[Na+].C1CC2C(C([O-])=O)C(C(=O)[O-])C1O2 XRHVZWWRFMCBAZ-UHFFFAOYSA-L 0.000 claims description 2
- PLDUPXSUYLZYBN-UHFFFAOYSA-N Fluphenazine Chemical compound C1CN(CCO)CCN1CCCN1C2=CC(C(F)(F)F)=CC=C2SC2=CC=CC=C21 PLDUPXSUYLZYBN-UHFFFAOYSA-N 0.000 claims description 2
- WMFSSTNVXWNLKI-UHFFFAOYSA-N Flutazolam Chemical compound O1CCN2CC(=O)N(CCO)C3=CC=C(Cl)C=C3C21C1=CC=CC=C1F WMFSSTNVXWNLKI-UHFFFAOYSA-N 0.000 claims description 2
- 244000194101 Ginkgo biloba Species 0.000 claims description 2
- ZWZWYGMENQVNFU-UHFFFAOYSA-N Glycerophosphorylserin Natural products OC(=O)C(N)COP(O)(=O)OCC(O)CO ZWZWYGMENQVNFU-UHFFFAOYSA-N 0.000 claims description 2
- ZRJBHWIHUMBLCN-SEQYCRGISA-N Huperzine A Natural products N1C(=O)C=CC2=C1C[C@H]1/C(=C/C)[C@]2(N)CC(C)=C1 ZRJBHWIHUMBLCN-SEQYCRGISA-N 0.000 claims description 2
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 claims description 2
- CBIAWPMZSFFRGN-UHFFFAOYSA-N Indiplon Chemical compound CC(=O)N(C)C1=CC=CC(C=2N3N=CC(=C3N=CC=2)C(=O)C=2SC=CC=2)=C1 CBIAWPMZSFFRGN-UHFFFAOYSA-N 0.000 claims description 2
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 claims description 2
- UETNIIAIRMUTSM-UHFFFAOYSA-N Jacareubin Natural products CC1(C)OC2=CC3Oc4c(O)c(O)ccc4C(=O)C3C(=C2C=C1)O UETNIIAIRMUTSM-UHFFFAOYSA-N 0.000 claims description 2
- WTDRDQBEARUVNC-LURJTMIESA-N L-DOPA Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-LURJTMIESA-N 0.000 claims description 2
- WTDRDQBEARUVNC-UHFFFAOYSA-N L-Dopa Natural products OC(=O)C(N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-UHFFFAOYSA-N 0.000 claims description 2
- IWVRVEIKCBFZNF-UHFFFAOYSA-N LSM-1636 Chemical compound C1CNC2CCCC3=C2N1C1=CC=C(C)C=C13 IWVRVEIKCBFZNF-UHFFFAOYSA-N 0.000 claims description 2
- 239000004367 Lipase Substances 0.000 claims description 2
- 108090001060 Lipase Proteins 0.000 claims description 2
- 102000004882 Lipase Human genes 0.000 claims description 2
- ZPXSCAKFGYXMGA-UHFFFAOYSA-N Mazindol Chemical compound N12CCN=C2C2=CC=CC=C2C1(O)C1=CC=C(Cl)C=C1 ZPXSCAKFGYXMGA-UHFFFAOYSA-N 0.000 claims description 2
- YJPIGAIKUZMOQA-UHFFFAOYSA-N Melatonin Natural products COC1=CC=C2N(C(C)=O)C=C(CCN)C2=C1 YJPIGAIKUZMOQA-UHFFFAOYSA-N 0.000 claims description 2
- XADCESSVHJOZHK-UHFFFAOYSA-N Meperidine Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 XADCESSVHJOZHK-UHFFFAOYSA-N 0.000 claims description 2
- NPPQSCRMBWNHMW-UHFFFAOYSA-N Meprobamate Chemical compound NC(=O)OCC(C)(CCC)COC(N)=O NPPQSCRMBWNHMW-UHFFFAOYSA-N 0.000 claims description 2
- IMWZZHHPURKASS-UHFFFAOYSA-N Metaxalone Chemical compound CC1=CC(C)=CC(OCC2OC(=O)NC2)=C1 IMWZZHHPURKASS-UHFFFAOYSA-N 0.000 claims description 2
- DUGOZIWVEXMGBE-UHFFFAOYSA-N Methylphenidate Chemical compound C=1C=CC=CC=1C(C(=O)OC)C1CCCCN1 DUGOZIWVEXMGBE-UHFFFAOYSA-N 0.000 claims description 2
- UEQUQVLFIPOEMF-UHFFFAOYSA-N Mianserin Chemical compound C1C2=CC=CC=C2N2CCN(C)CC2C2=CC=CC=C21 UEQUQVLFIPOEMF-UHFFFAOYSA-N 0.000 claims description 2
- KLPWJLBORRMFGK-UHFFFAOYSA-N Molindone Chemical compound O=C1C=2C(CC)=C(C)NC=2CCC1CN1CCOCC1 KLPWJLBORRMFGK-UHFFFAOYSA-N 0.000 claims description 2
- WUKZPHOXUVCQOR-UHFFFAOYSA-N N-(1-azabicyclo[2.2.2]octan-3-yl)-6-chloro-4-methyl-3-oxo-1,4-benzoxazine-8-carboxamide Chemical compound C1N(CC2)CCC2C1NC(=O)C1=CC(Cl)=CC2=C1OCC(=O)N2C WUKZPHOXUVCQOR-UHFFFAOYSA-N 0.000 claims description 2
- JTVPZMFULRWINT-UHFFFAOYSA-N N-[2-(diethylamino)ethyl]-2-methoxy-5-methylsulfonylbenzamide Chemical compound CCN(CC)CCNC(=O)C1=CC(S(C)(=O)=O)=CC=C1OC JTVPZMFULRWINT-UHFFFAOYSA-N 0.000 claims description 2
- BLXXJMDCKKHMKV-UHFFFAOYSA-N Nabumetone Chemical compound C1=C(CCC(C)=O)C=CC2=CC(OC)=CC=C21 BLXXJMDCKKHMKV-UHFFFAOYSA-N 0.000 claims description 2
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 claims description 2
- PHVGLTMQBUFIQQ-UHFFFAOYSA-N Nortryptiline Chemical compound C1CC2=CC=CC=C2C(=CCCNC)C2=CC=CC=C21 PHVGLTMQBUFIQQ-UHFFFAOYSA-N 0.000 claims description 2
- BRUQQQPBMZOVGD-XFKAJCMBSA-N Oxycodone Chemical compound O=C([C@@H]1O2)CC[C@@]3(O)[C@H]4CC5=CC=C(OC)C2=C5[C@@]13CCN4C BRUQQQPBMZOVGD-XFKAJCMBSA-N 0.000 claims description 2
- UQCNKQCJZOAFTQ-ISWURRPUSA-N Oxymorphone Chemical compound O([C@H]1C(CC[C@]23O)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O UQCNKQCJZOAFTQ-ISWURRPUSA-N 0.000 claims description 2
- 108010067035 Pancrelipase Proteins 0.000 claims description 2
- AHOUBRCZNHFOSL-UHFFFAOYSA-N Paroxetine hydrochloride Natural products C1=CC(F)=CC=C1C1C(COC=2C=C3OCOC3=CC=2)CNCC1 AHOUBRCZNHFOSL-UHFFFAOYSA-N 0.000 claims description 2
- 102000057297 Pepsin A Human genes 0.000 claims description 2
- 108090000284 Pepsin A Proteins 0.000 claims description 2
- RGCVKNLCSQQDEP-UHFFFAOYSA-N Perphenazine Chemical compound C1CN(CCO)CCN1CCCN1C2=CC(Cl)=CC=C2SC2=CC=CC=C21 RGCVKNLCSQQDEP-UHFFFAOYSA-N 0.000 claims description 2
- MFOCDFTXLCYLKU-CMPLNLGQSA-N Phendimetrazine Chemical compound O1CCN(C)[C@@H](C)[C@@H]1C1=CC=CC=C1 MFOCDFTXLCYLKU-CMPLNLGQSA-N 0.000 claims description 2
- CXOFVDLJLONNDW-UHFFFAOYSA-N Phenytoin Chemical compound N1C(=O)NC(=O)C1(C=1C=CC=CC=1)C1=CC=CC=C1 CXOFVDLJLONNDW-UHFFFAOYSA-N 0.000 claims description 2
- IKMPWMZBZSAONZ-UHFFFAOYSA-N Quazepam Chemical compound FC1=CC=CC=C1C1=NCC(=S)N(CC(F)(F)F)C2=CC=C(Cl)C=C12 IKMPWMZBZSAONZ-UHFFFAOYSA-N 0.000 claims description 2
- LCQMZZCPPSWADO-UHFFFAOYSA-N Reserpilin Natural products COC(=O)C1COCC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C3CC12 LCQMZZCPPSWADO-UHFFFAOYSA-N 0.000 claims description 2
- QEVHRUUCFGRFIF-SFWBKIHZSA-N Reserpine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cc(OC)cc3 QEVHRUUCFGRFIF-SFWBKIHZSA-N 0.000 claims description 2
- XSVMFMHYUFZWBK-NSHDSACASA-N Rivastigmine Chemical compound CCN(C)C(=O)OC1=CC=CC([C@H](C)N(C)C)=C1 XSVMFMHYUFZWBK-NSHDSACASA-N 0.000 claims description 2
- ZRJBHWIHUMBLCN-UHFFFAOYSA-N Shuangyiping Natural products N1C(=O)C=CC2=C1CC1C(=CC)C2(N)CC(C)=C1 ZRJBHWIHUMBLCN-UHFFFAOYSA-N 0.000 claims description 2
- SEQDDYPDSLOBDC-UHFFFAOYSA-N Temazepam Chemical compound N=1C(O)C(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 SEQDDYPDSLOBDC-UHFFFAOYSA-N 0.000 claims description 2
- KLBQZWRITKRQQV-UHFFFAOYSA-N Thioridazine Chemical compound C12=CC(SC)=CC=C2SC2=CC=CC=C2N1CCC1CCCCN1C KLBQZWRITKRQQV-UHFFFAOYSA-N 0.000 claims description 2
- GFBKORZTTCHDGY-UWVJOHFNSA-N Thiothixene Chemical compound C12=CC(S(=O)(=O)N(C)C)=CC=C2SC2=CC=CC=C2\C1=C\CCN1CCN(C)CC1 GFBKORZTTCHDGY-UWVJOHFNSA-N 0.000 claims description 2
- KJADKKWYZYXHBB-XBWDGYHZSA-N Topiramic acid Chemical compound C1O[C@@]2(COS(N)(=O)=O)OC(C)(C)O[C@H]2[C@@H]2OC(C)(C)O[C@@H]21 KJADKKWYZYXHBB-XBWDGYHZSA-N 0.000 claims description 2
- 229930003427 Vitamin E Natural products 0.000 claims description 2
- 229960004420 aceclofenac Drugs 0.000 claims description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 claims description 2
- 229960004538 alprazolam Drugs 0.000 claims description 2
- VREFGVBLTWBCJP-UHFFFAOYSA-N alprazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 VREFGVBLTWBCJP-UHFFFAOYSA-N 0.000 claims description 2
- DKNWSYNQZKUICI-UHFFFAOYSA-N amantadine Chemical compound C1C(C2)CC3CC2CC1(N)C3 DKNWSYNQZKUICI-UHFFFAOYSA-N 0.000 claims description 2
- 229960003805 amantadine Drugs 0.000 claims description 2
- ILKJAFIWWBXGDU-MOGDOJJUSA-N amcinonide Chemical compound O([C@@]1([C@H](O2)C[C@@H]3[C@@]1(C[C@H](O)[C@]1(F)[C@@]4(C)C=CC(=O)C=C4CC[C@H]13)C)C(=O)COC(=O)C)C12CCCC1 ILKJAFIWWBXGDU-MOGDOJJUSA-N 0.000 claims description 2
- 229960003099 amcinonide Drugs 0.000 claims description 2
- 229960000836 amitriptyline Drugs 0.000 claims description 2
- KRMDCWKBEZIMAB-UHFFFAOYSA-N amitriptyline Chemical compound C1CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 KRMDCWKBEZIMAB-UHFFFAOYSA-N 0.000 claims description 2
- 229960002519 amoxapine Drugs 0.000 claims description 2
- QWGDMFLQWFTERH-UHFFFAOYSA-N amoxapine Chemical compound C12=CC(Cl)=CC=C2OC2=CC=CC=C2N=C1N1CCNCC1 QWGDMFLQWFTERH-UHFFFAOYSA-N 0.000 claims description 2
- 229940025084 amphetamine Drugs 0.000 claims description 2
- 229940035676 analgesics Drugs 0.000 claims description 2
- 230000001539 anorectic effect Effects 0.000 claims description 2
- 239000000730 antalgic agent Substances 0.000 claims description 2
- 230000001088 anti-asthma Effects 0.000 claims description 2
- 230000003556 anti-epileptic effect Effects 0.000 claims description 2
- 229940124599 anti-inflammatory drug Drugs 0.000 claims description 2
- 230000001022 anti-muscarinic effect Effects 0.000 claims description 2
- 230000001754 anti-pyretic effect Effects 0.000 claims description 2
- 239000000924 antiasthmatic agent Substances 0.000 claims description 2
- 239000001961 anticonvulsive agent Substances 0.000 claims description 2
- 229960003965 antiepileptics Drugs 0.000 claims description 2
- 229940125715 antihistaminic agent Drugs 0.000 claims description 2
- 239000000739 antihistaminic agent Substances 0.000 claims description 2
- 229940111136 antiinflammatory and antirheumatic drug fenamates Drugs 0.000 claims description 2
- 229940124433 antimigraine drug Drugs 0.000 claims description 2
- 239000000164 antipsychotic agent Substances 0.000 claims description 2
- 229940005529 antipsychotics Drugs 0.000 claims description 2
- 239000002221 antipyretic Substances 0.000 claims description 2
- 229940125716 antipyretic agent Drugs 0.000 claims description 2
- 229960004372 aripiprazole Drugs 0.000 claims description 2
- 229960002430 atomoxetine Drugs 0.000 claims description 2
- VHGCDTVCOLNTBX-QGZVFWFLSA-N atomoxetine Chemical compound O([C@H](CCNC)C=1C=CC=CC=1)C1=CC=CC=C1C VHGCDTVCOLNTBX-QGZVFWFLSA-N 0.000 claims description 2
- 229950005951 azasetron Drugs 0.000 claims description 2
- SEBMTIQKRHYNIT-UHFFFAOYSA-N azatadine Chemical compound C1CN(C)CCC1=C1C2=NC=CC=C2CCC2=CC=CC=C21 SEBMTIQKRHYNIT-UHFFFAOYSA-N 0.000 claims description 2
- 229960000383 azatadine Drugs 0.000 claims description 2
- 229940092705 beclomethasone Drugs 0.000 claims description 2
- NBMKJKDGKREAPL-DVTGEIKXSA-N beclomethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(Cl)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O NBMKJKDGKREAPL-DVTGEIKXSA-N 0.000 claims description 2
- 229960001498 benactyzine Drugs 0.000 claims description 2
- 229960005430 benoxaprofen Drugs 0.000 claims description 2
- REHLODZXMGOGQP-UHFFFAOYSA-N bermoprofen Chemical compound C1C(=O)C2=CC(C(C(O)=O)C)=CC=C2OC2=CC=C(C)C=C21 REHLODZXMGOGQP-UHFFFAOYSA-N 0.000 claims description 2
- 229950007517 bermoprofen Drugs 0.000 claims description 2
- 229960002537 betamethasone Drugs 0.000 claims description 2
- UREBDLICKHMUKA-DVTGEIKXSA-N betamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-DVTGEIKXSA-N 0.000 claims description 2
- 229950010365 bicifadine Drugs 0.000 claims description 2
- OFYVIGTWSQPCLF-NWDGAFQWSA-N bicifadine Chemical compound C1=CC(C)=CC=C1[C@@]1(CNC2)[C@H]2C1 OFYVIGTWSQPCLF-NWDGAFQWSA-N 0.000 claims description 2
- 229960002802 bromocriptine Drugs 0.000 claims description 2
- OZVBMTJYIDMWIL-AYFBDAFISA-N bromocriptine Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@]2(C(=O)N3[C@H](C(N4CCC[C@H]4[C@]3(O)O2)=O)CC(C)C)C(C)C)C2)=C3C2=C(Br)NC3=C1 OZVBMTJYIDMWIL-AYFBDAFISA-N 0.000 claims description 2
- 229940124630 bronchodilator Drugs 0.000 claims description 2
- 239000000168 bronchodilator agent Substances 0.000 claims description 2
- 229960004436 budesonide Drugs 0.000 claims description 2
- 229960001736 buprenorphine Drugs 0.000 claims description 2
- RMRJXGBAOAMLHD-IHFGGWKQSA-N buprenorphine Chemical compound C([C@]12[C@H]3OC=4C(O)=CC=C(C2=4)C[C@@H]2[C@]11CC[C@]3([C@H](C1)[C@](C)(O)C(C)(C)C)OC)CN2CC1CC1 RMRJXGBAOAMLHD-IHFGGWKQSA-N 0.000 claims description 2
- 229960001058 bupropion Drugs 0.000 claims description 2
- SNPPWIUOZRMYNY-UHFFFAOYSA-N bupropion Chemical compound CC(C)(C)NC(C)C(=O)C1=CC=CC(Cl)=C1 SNPPWIUOZRMYNY-UHFFFAOYSA-N 0.000 claims description 2
- QWCRAEMEVRGPNT-UHFFFAOYSA-N buspirone Chemical compound C1C(=O)N(CCCCN2CCN(CC2)C=2N=CC=CN=2)C(=O)CC21CCCC2 QWCRAEMEVRGPNT-UHFFFAOYSA-N 0.000 claims description 2
- 229960002495 buspirone Drugs 0.000 claims description 2
- IFKLAQQSCNILHL-QHAWAJNXSA-N butorphanol Chemical compound N1([C@@H]2CC3=CC=C(C=C3[C@@]3([C@]2(CCCC3)O)CC1)O)CC1CCC1 IFKLAQQSCNILHL-QHAWAJNXSA-N 0.000 claims description 2
- 229960001113 butorphanol Drugs 0.000 claims description 2
- 229960004301 butriptyline Drugs 0.000 claims description 2
- ALELTFCQZDXAMQ-UHFFFAOYSA-N butriptyline Chemical compound C1CC2=CC=CC=C2C(CC(C)CN(C)C)C2=CC=CC=C21 ALELTFCQZDXAMQ-UHFFFAOYSA-N 0.000 claims description 2
- 229960001948 caffeine Drugs 0.000 claims description 2
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 claims description 2
- 229960000623 carbamazepine Drugs 0.000 claims description 2
- FFGPTBGBLSHEPO-UHFFFAOYSA-N carbamazepine Chemical compound C1=CC2=CC=CC=C2N(C(=O)N)C2=CC=CC=C21 FFGPTBGBLSHEPO-UHFFFAOYSA-N 0.000 claims description 2
- 229960004205 carbidopa Drugs 0.000 claims description 2
- TZFNLOMSOLWIDK-JTQLQIEISA-N carbidopa (anhydrous) Chemical compound NN[C@@](C(O)=O)(C)CC1=CC=C(O)C(O)=C1 TZFNLOMSOLWIDK-JTQLQIEISA-N 0.000 claims description 2
- 239000002327 cardiovascular agent Substances 0.000 claims description 2
- 229940125692 cardiovascular agent Drugs 0.000 claims description 2
- 229960004587 carisoprodol Drugs 0.000 claims description 2
- OFZCIYFFPZCNJE-UHFFFAOYSA-N carisoprodol Chemical compound NC(=O)OCC(C)(CCC)COC(=O)NC(C)C OFZCIYFFPZCNJE-UHFFFAOYSA-N 0.000 claims description 2
- 229960000590 celecoxib Drugs 0.000 claims description 2
- RZEKVGVHFLEQIL-UHFFFAOYSA-N celecoxib Chemical compound C1=CC(C)=CC=C1C1=CC(C(F)(F)F)=NN1C1=CC=C(S(N)(=O)=O)C=C1 RZEKVGVHFLEQIL-UHFFFAOYSA-N 0.000 claims description 2
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 claims description 2
- UKTAZPQNNNJVKR-KJGYPYNMSA-N chembl2368925 Chemical compound C1=CC=C2C(C(O[C@@H]3C[C@@H]4C[C@H]5C[C@@H](N4CC5=O)C3)=O)=CNC2=C1 UKTAZPQNNNJVKR-KJGYPYNMSA-N 0.000 claims description 2
- 229960004782 chlordiazepoxide Drugs 0.000 claims description 2
- ANTSCNMPPGJYLG-UHFFFAOYSA-N chlordiazepoxide Chemical compound O=N=1CC(NC)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 ANTSCNMPPGJYLG-UHFFFAOYSA-N 0.000 claims description 2
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 claims description 2
- 229960001076 chlorpromazine Drugs 0.000 claims description 2
- 229960002688 choline salicylate Drugs 0.000 claims description 2
- 229960001653 citalopram Drugs 0.000 claims description 2
- 229960004606 clomipramine Drugs 0.000 claims description 2
- DGBIGWXXNGSACT-UHFFFAOYSA-N clonazepam Chemical compound C12=CC([N+](=O)[O-])=CC=C2NC(=O)CN=C1C1=CC=CC=C1Cl DGBIGWXXNGSACT-UHFFFAOYSA-N 0.000 claims description 2
- 229960003120 clonazepam Drugs 0.000 claims description 2
- 229960002896 clonidine Drugs 0.000 claims description 2
- GPZLDQAEBHTMPG-UHFFFAOYSA-N clonitazene Chemical compound N=1C2=CC([N+]([O-])=O)=CC=C2N(CCN(CC)CC)C=1CC1=CC=C(Cl)C=C1 GPZLDQAEBHTMPG-UHFFFAOYSA-N 0.000 claims description 2
- 229950001604 clonitazene Drugs 0.000 claims description 2
- 229960004362 clorazepate Drugs 0.000 claims description 2
- 229960003622 clotiazepam Drugs 0.000 claims description 2
- ZIXNZOBDFKSQTC-UHFFFAOYSA-N cloxazolam Chemical compound C12=CC(Cl)=CC=C2NC(=O)CN2CCOC21C1=CC=CC=C1Cl ZIXNZOBDFKSQTC-UHFFFAOYSA-N 0.000 claims description 2
- 229960003932 cloxazolam Drugs 0.000 claims description 2
- 229960004170 clozapine Drugs 0.000 claims description 2
- QZUDBNBUXVUHMW-UHFFFAOYSA-N clozapine Chemical compound C1CN(C)CCN1C1=NC2=CC(Cl)=CC=C2NC2=CC=CC=C12 QZUDBNBUXVUHMW-UHFFFAOYSA-N 0.000 claims description 2
- 229960004126 codeine Drugs 0.000 claims description 2
- 239000003246 corticosteroid Substances 0.000 claims description 2
- 229960001334 corticosteroids Drugs 0.000 claims description 2
- OMFXVFTZEKFJBZ-HJTSIMOOSA-N corticosterone Chemical compound O=C1CC[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@H](CC4)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OMFXVFTZEKFJBZ-HJTSIMOOSA-N 0.000 claims description 2
- 229960004544 cortisone Drugs 0.000 claims description 2
- JURKNVYFZMSNLP-UHFFFAOYSA-N cyclobenzaprine Chemical compound C1=CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 JURKNVYFZMSNLP-UHFFFAOYSA-N 0.000 claims description 2
- 229960003572 cyclobenzaprine Drugs 0.000 claims description 2
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 claims description 2
- 229960001140 cyproheptadine Drugs 0.000 claims description 2
- SEDQWOMFMIJKCU-UHFFFAOYSA-N demexiptiline Chemical compound C1=CC2=CC=CC=C2C(=NOCCNC)C2=CC=CC=C21 SEDQWOMFMIJKCU-UHFFFAOYSA-N 0.000 claims description 2
- 229950010189 demexiptiline Drugs 0.000 claims description 2
- 229960003914 desipramine Drugs 0.000 claims description 2
- 229950003851 desomorphine Drugs 0.000 claims description 2
- LNNWVNGFPYWNQE-GMIGKAJZSA-N desomorphine Chemical compound C1C2=CC=C(O)C3=C2[C@]24CCN(C)[C@H]1[C@@H]2CCC[C@@H]4O3 LNNWVNGFPYWNQE-GMIGKAJZSA-N 0.000 claims description 2
- 229960003957 dexamethasone Drugs 0.000 claims description 2
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 claims description 2
- SSQJFGMEZBFMNV-PMACEKPBSA-N dexanabinol Chemical compound C1C(CO)=CC[C@@H]2C(C)(C)OC3=CC(C(C)(C)CCCCCC)=CC(O)=C3[C@H]21 SSQJFGMEZBFMNV-PMACEKPBSA-N 0.000 claims description 2
- 229940119751 dextroamphetamine sulfate Drugs 0.000 claims description 2
- 229960003701 dextromoramide Drugs 0.000 claims description 2
- INUNXTSAACVKJS-OAQYLSRUSA-N dextromoramide Chemical compound C([C@@H](C)C(C(=O)N1CCCC1)(C=1C=CC=CC=1)C=1C=CC=CC=1)N1CCOCC1 INUNXTSAACVKJS-OAQYLSRUSA-N 0.000 claims description 2
- 229960003461 dezocine Drugs 0.000 claims description 2
- VTMVHDZWSFQSQP-VBNZEHGJSA-N dezocine Chemical compound C1CCCC[C@H]2CC3=CC=C(O)C=C3[C@]1(C)[C@H]2N VTMVHDZWSFQSQP-VBNZEHGJSA-N 0.000 claims description 2
- NIJJYAXOARWZEE-UHFFFAOYSA-N di-n-propyl-acetic acid Natural products CCCC(C(O)=O)CCC NIJJYAXOARWZEE-UHFFFAOYSA-N 0.000 claims description 2
- 229960003529 diazepam Drugs 0.000 claims description 2
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 claims description 2
- 229960003075 dibenzepin Drugs 0.000 claims description 2
- 229960001193 diclofenac sodium Drugs 0.000 claims description 2
- 229960000616 diflunisal Drugs 0.000 claims description 2
- HUPFGZXOMWLGNK-UHFFFAOYSA-N diflunisal Chemical compound C1=C(O)C(C(=O)O)=CC(C=2C(=CC(F)=CC=2)F)=C1 HUPFGZXOMWLGNK-UHFFFAOYSA-N 0.000 claims description 2
- 229960000920 dihydrocodeine Drugs 0.000 claims description 2
- RBOXVHNMENFORY-DNJOTXNNSA-N dihydrocodeine Chemical compound C([C@H]1[C@H](N(CC[C@@]112)C)C3)C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC RBOXVHNMENFORY-DNJOTXNNSA-N 0.000 claims description 2
- 229960004704 dihydroergotamine Drugs 0.000 claims description 2
- HESHRHUZIWVEAJ-JGRZULCMSA-N dihydroergotamine Chemical compound C([C@H]1C(=O)N2CCC[C@H]2[C@]2(O)O[C@@](C(N21)=O)(C)NC(=O)[C@H]1CN([C@H]2[C@@H](C3=CC=CC4=NC=C([C]34)C2)C1)C)C1=CC=CC=C1 HESHRHUZIWVEAJ-JGRZULCMSA-N 0.000 claims description 2
- 229960003524 dimetacrine Drugs 0.000 claims description 2
- RYQOGSFEJBUZBX-UHFFFAOYSA-N dimetacrine Chemical compound C1=CC=C2N(CCCN(C)C)C3=CC=CC=C3C(C)(C)C2=C1 RYQOGSFEJBUZBX-UHFFFAOYSA-N 0.000 claims description 2
- 229960003413 dolasetron Drugs 0.000 claims description 2
- 229960003530 donepezil Drugs 0.000 claims description 2
- 229960001393 dosulepin Drugs 0.000 claims description 2
- 229960005426 doxepin Drugs 0.000 claims description 2
- ODQWQRRAPPTVAG-GZTJUZNOSA-N doxepin Chemical compound C1OC2=CC=CC=C2C(=C/CCN(C)C)/C2=CC=CC=C21 ODQWQRRAPPTVAG-GZTJUZNOSA-N 0.000 claims description 2
- 239000003792 electrolyte Substances 0.000 claims description 2
- 229940037395 electrolytes Drugs 0.000 claims description 2
- 229960004943 ergotamine Drugs 0.000 claims description 2
- OFKDAAIKGIBASY-VFGNJEKYSA-N ergotamine Chemical compound C([C@H]1C(=O)N2CCC[C@H]2[C@]2(O)O[C@@](C(N21)=O)(C)NC(=O)[C@H]1CN([C@H]2C(C3=CC=CC4=NC=C([C]34)C2)=C1)C)C1=CC=CC=C1 OFKDAAIKGIBASY-VFGNJEKYSA-N 0.000 claims description 2
- XCGSFFUVFURLIX-UHFFFAOYSA-N ergotaminine Natural products C1=C(C=2C=CC=C3NC=C(C=23)C2)C2N(C)CC1C(=O)NC(C(N12)=O)(C)OC1(O)C1CCCN1C(=O)C2CC1=CC=CC=C1 XCGSFFUVFURLIX-UHFFFAOYSA-N 0.000 claims description 2
- 229960004341 escitalopram Drugs 0.000 claims description 2
- WSEQXVZVJXJVFP-FQEVSTJZSA-N escitalopram Chemical compound C1([C@]2(C3=CC=C(C=C3CO2)C#N)CCCN(C)C)=CC=C(F)C=C1 WSEQXVZVJXJVFP-FQEVSTJZSA-N 0.000 claims description 2
- CDCHDCWJMGXXRH-UHFFFAOYSA-N estazolam Chemical compound C=1C(Cl)=CC=C(N2C=NN=C2CN=2)C=1C=2C1=CC=CC=C1 CDCHDCWJMGXXRH-UHFFFAOYSA-N 0.000 claims description 2
- 229960002336 estazolam Drugs 0.000 claims description 2
- 229960002767 ethosuximide Drugs 0.000 claims description 2
- HAPOVYFOVVWLRS-UHFFFAOYSA-N ethosuximide Chemical compound CCC1(C)CC(=O)NC1=O HAPOVYFOVVWLRS-UHFFFAOYSA-N 0.000 claims description 2
- 229960005293 etodolac Drugs 0.000 claims description 2
- XFBVBWWRPKNWHW-UHFFFAOYSA-N etodolac Chemical compound C1COC(CC)(CC(O)=O)C2=N[C]3C(CC)=CC=CC3=C21 XFBVBWWRPKNWHW-UHFFFAOYSA-N 0.000 claims description 2
- 238000013266 extended drug release Methods 0.000 claims description 2
- OJSFTALXCYKKFQ-YLJYHZDGSA-N femoxetine Chemical compound C1=CC(OC)=CC=C1OC[C@@H]1[C@@H](C=2C=CC=CC=2)CCN(C)C1 OJSFTALXCYKKFQ-YLJYHZDGSA-N 0.000 claims description 2
- 229950003930 femoxetine Drugs 0.000 claims description 2
- 229960001419 fenoprofen Drugs 0.000 claims description 2
- 229960002428 fentanyl Drugs 0.000 claims description 2
- 229960004930 fludiazepam Drugs 0.000 claims description 2
- ROYOYTLGDLIGBX-UHFFFAOYSA-N fludiazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1F ROYOYTLGDLIGBX-UHFFFAOYSA-N 0.000 claims description 2
- 229960002464 fluoxetine Drugs 0.000 claims description 2
- 229960002690 fluphenazine Drugs 0.000 claims description 2
- 229960003528 flurazepam Drugs 0.000 claims description 2
- SAADBVWGJQAEFS-UHFFFAOYSA-N flurazepam Chemical compound N=1CC(=O)N(CCN(CC)CC)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1F SAADBVWGJQAEFS-UHFFFAOYSA-N 0.000 claims description 2
- 229960002390 flurbiprofen Drugs 0.000 claims description 2
- SYTBZMRGLBWNTM-UHFFFAOYSA-N flurbiprofen Chemical compound FC1=CC(C(C(O)=O)C)=CC=C1C1=CC=CC=C1 SYTBZMRGLBWNTM-UHFFFAOYSA-N 0.000 claims description 2
- 229950009354 flutazolam Drugs 0.000 claims description 2
- 229960004038 fluvoxamine Drugs 0.000 claims description 2
- CJOFXWAVKWHTFT-XSFVSMFZSA-N fluvoxamine Chemical compound COCCCC\C(=N/OCCN)C1=CC=C(C(F)(F)F)C=C1 CJOFXWAVKWHTFT-XSFVSMFZSA-N 0.000 claims description 2
- 229960002284 frovatriptan Drugs 0.000 claims description 2
- SIBNYOSJIXCDRI-SECBINFHSA-N frovatriptan Chemical compound C1=C(C(N)=O)[CH]C2=C(C[C@H](NC)CC3)C3=NC2=C1 SIBNYOSJIXCDRI-SECBINFHSA-N 0.000 claims description 2
- 229960002870 gabapentin Drugs 0.000 claims description 2
- 229960003980 galantamine Drugs 0.000 claims description 2
- ASUTZQLVASHGKV-UHFFFAOYSA-N galanthamine hydrochloride Natural products O1C(=C23)C(OC)=CC=C2CN(C)CCC23C1CC(O)C=C2 ASUTZQLVASHGKV-UHFFFAOYSA-N 0.000 claims description 2
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 claims description 2
- 239000004083 gastrointestinal agent Substances 0.000 claims description 2
- 229940127227 gastrointestinal drug Drugs 0.000 claims description 2
- 229960000647 gepirone Drugs 0.000 claims description 2
- QOIGKGMMAGJZNZ-UHFFFAOYSA-N gepirone Chemical compound O=C1CC(C)(C)CC(=O)N1CCCCN1CCN(C=2N=CC=CN=2)CC1 QOIGKGMMAGJZNZ-UHFFFAOYSA-N 0.000 claims description 2
- MFWNKCLOYSRHCJ-BTTYYORXSA-N granisetron Chemical compound C1=CC=C2C(C(=O)N[C@H]3C[C@H]4CCC[C@@H](C3)N4C)=NN(C)C2=C1 MFWNKCLOYSRHCJ-BTTYYORXSA-N 0.000 claims description 2
- 229960003727 granisetron Drugs 0.000 claims description 2
- 229960003878 haloperidol Drugs 0.000 claims description 2
- ZRJBHWIHUMBLCN-YQEJDHNASA-N huperzine A Chemical compound N1C(=O)C=CC2=C1C[C@H]1\C(=C/C)[C@]2(N)CC(C)=C1 ZRJBHWIHUMBLCN-YQEJDHNASA-N 0.000 claims description 2
- LLPOLZWFYMWNKH-CMKMFDCUSA-N hydrocodone Chemical compound C([C@H]1[C@H](N(CC[C@@]112)C)C3)CC(=O)[C@@H]1OC1=C2C3=CC=C1OC LLPOLZWFYMWNKH-CMKMFDCUSA-N 0.000 claims description 2
- 229960000240 hydrocodone Drugs 0.000 claims description 2
- 229960000890 hydrocortisone Drugs 0.000 claims description 2
- WVLOADHCBXTIJK-YNHQPCIGSA-N hydromorphone Chemical compound O([C@H]1C(CC[C@H]23)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O WVLOADHCBXTIJK-YNHQPCIGSA-N 0.000 claims description 2
- 229960001410 hydromorphone Drugs 0.000 claims description 2
- 229960000930 hydroxyzine Drugs 0.000 claims description 2
- ZQDWXGKKHFNSQK-UHFFFAOYSA-N hydroxyzine Chemical compound C1CN(CCOCCO)CCN1C(C=1C=CC(Cl)=CC=1)C1=CC=CC=C1 ZQDWXGKKHFNSQK-UHFFFAOYSA-N 0.000 claims description 2
- 239000003326 hypnotic agent Substances 0.000 claims description 2
- 230000000147 hypnotic effect Effects 0.000 claims description 2
- 229960001680 ibuprofen Drugs 0.000 claims description 2
- 229950003867 indiplon Drugs 0.000 claims description 2
- 229960000905 indomethacin Drugs 0.000 claims description 2
- 229960004187 indoprofen Drugs 0.000 claims description 2
- 229960002844 iprindole Drugs 0.000 claims description 2
- PLIGPBGDXASWPX-UHFFFAOYSA-N iprindole Chemical compound C1CCCCCC2=C1N(CCCN(C)C)C1=CC=CC=C12 PLIGPBGDXASWPX-UHFFFAOYSA-N 0.000 claims description 2
- 229950003599 ipsapirone Drugs 0.000 claims description 2
- FPCCSQOGAWCVBH-UHFFFAOYSA-N ketanserin Chemical compound C1=CC(F)=CC=C1C(=O)C1CCN(CCN2C(C3=CC=CC=C3NC2=O)=O)CC1 FPCCSQOGAWCVBH-UHFFFAOYSA-N 0.000 claims description 2
- DKYWVDODHFEZIM-UHFFFAOYSA-N ketoprofen Chemical compound OC(=O)C(C)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 DKYWVDODHFEZIM-UHFFFAOYSA-N 0.000 claims description 2
- 229960000991 ketoprofen Drugs 0.000 claims description 2
- 229960004752 ketorolac Drugs 0.000 claims description 2
- OZWKMVRBQXNZKK-UHFFFAOYSA-N ketorolac Chemical compound OC(=O)C1CCN2C1=CC=C2C(=O)C1=CC=CC=C1 OZWKMVRBQXNZKK-UHFFFAOYSA-N 0.000 claims description 2
- AHCPKWJUALHOPH-UHFFFAOYSA-N lesopitron Chemical compound C1=C(Cl)C=NN1CCCCN1CCN(C=2N=CC=CN=2)CC1 AHCPKWJUALHOPH-UHFFFAOYSA-N 0.000 claims description 2
- 229950001590 lesopitron Drugs 0.000 claims description 2
- 229960004502 levodopa Drugs 0.000 claims description 2
- 235000019421 lipase Nutrition 0.000 claims description 2
- 229940040461 lipase Drugs 0.000 claims description 2
- 229960002813 lofepramine Drugs 0.000 claims description 2
- SAPNXPWPAUFAJU-UHFFFAOYSA-N lofepramine Chemical compound C12=CC=CC=C2CCC2=CC=CC=C2N1CCCN(C)CC(=O)C1=CC=C(Cl)C=C1 SAPNXPWPAUFAJU-UHFFFAOYSA-N 0.000 claims description 2
- 229960004391 lorazepam Drugs 0.000 claims description 2
- 229960000423 loxapine Drugs 0.000 claims description 2
- XJGVXQDUIWGIRW-UHFFFAOYSA-N loxapine Chemical compound C1CN(C)CCN1C1=NC2=CC=CC=C2OC2=CC=C(Cl)C=C12 XJGVXQDUIWGIRW-UHFFFAOYSA-N 0.000 claims description 2
- 229960004090 maprotiline Drugs 0.000 claims description 2
- QSLMDECMDJKHMQ-GSXCWMCISA-N maprotiline Chemical compound C12=CC=CC=C2[C@@]2(CCCNC)C3=CC=CC=C3[C@@H]1CC2 QSLMDECMDJKHMQ-GSXCWMCISA-N 0.000 claims description 2
- 229960000299 mazindol Drugs 0.000 claims description 2
- 229960003464 mefenamic acid Drugs 0.000 claims description 2
- HYYBABOKPJLUIN-UHFFFAOYSA-N mefenamic acid Chemical compound CC1=CC=CC(NC=2C(=CC=CC=2)C(O)=O)=C1C HYYBABOKPJLUIN-UHFFFAOYSA-N 0.000 claims description 2
- 229960003987 melatonin Drugs 0.000 claims description 2
- DRLFMBDRBRZALE-UHFFFAOYSA-N melatonin Chemical compound COC1=CC=C2NC=C(CCNC(C)=O)C2=C1 DRLFMBDRBRZALE-UHFFFAOYSA-N 0.000 claims description 2
- 229960004794 melitracen Drugs 0.000 claims description 2
- GWWLWDURRGNSRS-UHFFFAOYSA-N melitracen Chemical compound C1=CC=C2C(=CCCN(C)C)C3=CC=CC=C3C(C)(C)C2=C1 GWWLWDURRGNSRS-UHFFFAOYSA-N 0.000 claims description 2
- 229960004640 memantine Drugs 0.000 claims description 2
- BUGYDGFZZOZRHP-UHFFFAOYSA-N memantine Chemical compound C1C(C2)CC3(C)CC1(C)CC2(N)C3 BUGYDGFZZOZRHP-UHFFFAOYSA-N 0.000 claims description 2
- 229960004815 meprobamate Drugs 0.000 claims description 2
- KBOPZPXVLCULAV-UHFFFAOYSA-N mesalamine Chemical compound NC1=CC=C(O)C(C(O)=O)=C1 KBOPZPXVLCULAV-UHFFFAOYSA-N 0.000 claims description 2
- 229960004963 mesalazine Drugs 0.000 claims description 2
- YXVZOBVWVRFPTE-UHFFFAOYSA-N metapramine Chemical compound CNC1CC2=CC=CC=C2N(C)C2=CC=CC=C12 YXVZOBVWVRFPTE-UHFFFAOYSA-N 0.000 claims description 2
- 229950006180 metapramine Drugs 0.000 claims description 2
- 229960000509 metaxalone Drugs 0.000 claims description 2
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 claims description 2
- 229960001252 methamphetamine Drugs 0.000 claims description 2
- 229960002330 methocarbamol Drugs 0.000 claims description 2
- 229960001047 methyl salicylate Drugs 0.000 claims description 2
- 229960001344 methylphenidate Drugs 0.000 claims description 2
- 229960001186 methysergide Drugs 0.000 claims description 2
- 229960004503 metoclopramide Drugs 0.000 claims description 2
- TTWJBBZEZQICBI-UHFFFAOYSA-N metoclopramide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC TTWJBBZEZQICBI-UHFFFAOYSA-N 0.000 claims description 2
- 229960003955 mianserin Drugs 0.000 claims description 2
- 229960003248 mifepristone Drugs 0.000 claims description 2
- VKHAHZOOUSRJNA-GCNJZUOMSA-N mifepristone Chemical compound C1([C@@H]2C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]3CC[C@@]([C@]3(C2)C)(O)C#CC)=CC=C(N(C)C)C=C1 VKHAHZOOUSRJNA-GCNJZUOMSA-N 0.000 claims description 2
- 229960004758 minaprine Drugs 0.000 claims description 2
- LDMWSLGGVTVJPG-UHFFFAOYSA-N minaprine Chemical compound CC1=CC(C=2C=CC=CC=2)=NN=C1NCCN1CCOCC1 LDMWSLGGVTVJPG-UHFFFAOYSA-N 0.000 claims description 2
- 229960001785 mirtazapine Drugs 0.000 claims description 2
- RONZAEMNMFQXRA-UHFFFAOYSA-N mirtazapine Chemical compound C1C2=CC=CN=C2N2CCN(C)CC2C2=CC=CC=C21 RONZAEMNMFQXRA-UHFFFAOYSA-N 0.000 claims description 2
- 229960004644 moclobemide Drugs 0.000 claims description 2
- YHXISWVBGDMDLQ-UHFFFAOYSA-N moclobemide Chemical compound C1=CC(Cl)=CC=C1C(=O)NCCN1CCOCC1 YHXISWVBGDMDLQ-UHFFFAOYSA-N 0.000 claims description 2
- 229960004938 molindone Drugs 0.000 claims description 2
- 229960005181 morphine Drugs 0.000 claims description 2
- 229960005195 morphine hydrochloride Drugs 0.000 claims description 2
- XELXKCKNPPSFNN-BJWPBXOKSA-N morphine hydrochloride trihydrate Chemical compound O.O.O.Cl.O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O XELXKCKNPPSFNN-BJWPBXOKSA-N 0.000 claims description 2
- 239000003149 muscarinic antagonist Substances 0.000 claims description 2
- 229940035363 muscle relaxants Drugs 0.000 claims description 2
- 239000003158 myorelaxant agent Substances 0.000 claims description 2
- 229960004270 nabumetone Drugs 0.000 claims description 2
- 229960004255 nadolol Drugs 0.000 claims description 2
- VWPOSFSPZNDTMJ-UCWKZMIHSA-N nadolol Chemical compound C1[C@@H](O)[C@@H](O)CC2=C1C=CC=C2OCC(O)CNC(C)(C)C VWPOSFSPZNDTMJ-UCWKZMIHSA-N 0.000 claims description 2
- 229960002009 naproxen Drugs 0.000 claims description 2
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 claims description 2
- 229960005254 naratriptan Drugs 0.000 claims description 2
- UNHGSHHVDNGCFN-UHFFFAOYSA-N naratriptan Chemical compound C=12[CH]C(CCS(=O)(=O)NC)=CC=C2N=CC=1C1CCN(C)CC1 UNHGSHHVDNGCFN-UHFFFAOYSA-N 0.000 claims description 2
- 229960001800 nefazodone Drugs 0.000 claims description 2
- VRBKIVRKKCLPHA-UHFFFAOYSA-N nefazodone Chemical compound O=C1N(CCOC=2C=CC=CC=2)C(CC)=NN1CCCN(CC1)CCN1C1=CC=CC(Cl)=C1 VRBKIVRKKCLPHA-UHFFFAOYSA-N 0.000 claims description 2
- 229940072228 neurontin Drugs 0.000 claims description 2
- 229960001073 nomifensine Drugs 0.000 claims description 2
- XXPANQJNYNUNES-UHFFFAOYSA-N nomifensine Chemical compound C12=CC=CC(N)=C2CN(C)CC1C1=CC=CC=C1 XXPANQJNYNUNES-UHFFFAOYSA-N 0.000 claims description 2
- 229960001158 nortriptyline Drugs 0.000 claims description 2
- 235000016709 nutrition Nutrition 0.000 claims description 2
- 229960005017 olanzapine Drugs 0.000 claims description 2
- KVWDHTXUZHCGIO-UHFFFAOYSA-N olanzapine Chemical compound C1CN(C)CCN1C1=NC2=CC=CC=C2NC2=C1C=C(C)S2 KVWDHTXUZHCGIO-UHFFFAOYSA-N 0.000 claims description 2
- 229960004110 olsalazine Drugs 0.000 claims description 2
- QQBDLJCYGRGAKP-FOCLMDBBSA-N olsalazine Chemical compound C1=C(O)C(C(=O)O)=CC(\N=N\C=2C=C(C(O)=CC=2)C(O)=O)=C1 QQBDLJCYGRGAKP-FOCLMDBBSA-N 0.000 claims description 2
- 229960005343 ondansetron Drugs 0.000 claims description 2
- 229960005290 opipramol Drugs 0.000 claims description 2
- QVYRGXJJSLMXQH-UHFFFAOYSA-N orphenadrine Chemical compound C=1C=CC=C(C)C=1C(OCCN(C)C)C1=CC=CC=C1 QVYRGXJJSLMXQH-UHFFFAOYSA-N 0.000 claims description 2
- 229960003941 orphenadrine Drugs 0.000 claims description 2
- 229960002019 oxaflozane Drugs 0.000 claims description 2
- FVYUQFQCEOZYHZ-UHFFFAOYSA-N oxaflozane Chemical compound C1N(C(C)C)CCOC1C1=CC=CC(C(F)(F)F)=C1 FVYUQFQCEOZYHZ-UHFFFAOYSA-N 0.000 claims description 2
- ADIMAYPTOBDMTL-UHFFFAOYSA-N oxazepam Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(O)N=C1C1=CC=CC=C1 ADIMAYPTOBDMTL-UHFFFAOYSA-N 0.000 claims description 2
- 229960004535 oxazepam Drugs 0.000 claims description 2
- 229960002888 oxitriptan Drugs 0.000 claims description 2
- LDCYZAJDBXYCGN-UHFFFAOYSA-N oxitriptan Natural products C1=C(O)C=C2C(CC(N)C(O)=O)=CNC2=C1 LDCYZAJDBXYCGN-UHFFFAOYSA-N 0.000 claims description 2
- 229960002085 oxycodone Drugs 0.000 claims description 2
- 229960005118 oxymorphone Drugs 0.000 claims description 2
- 229940045258 pancrelipase Drugs 0.000 claims description 2
- 229960005489 paracetamol Drugs 0.000 claims description 2
- 239000000734 parasympathomimetic agent Substances 0.000 claims description 2
- 230000001499 parasympathomimetic effect Effects 0.000 claims description 2
- 229940005542 parasympathomimetics Drugs 0.000 claims description 2
- TZRHLKRLEZJVIJ-UHFFFAOYSA-N parecoxib Chemical compound C1=CC(S(=O)(=O)NC(=O)CC)=CC=C1C1=C(C)ON=C1C1=CC=CC=C1 TZRHLKRLEZJVIJ-UHFFFAOYSA-N 0.000 claims description 2
- 229960004662 parecoxib Drugs 0.000 claims description 2
- 229960002296 paroxetine Drugs 0.000 claims description 2
- NRNCYVBFPDDJNE-UHFFFAOYSA-N pemoline Chemical compound O1C(N)=NC(=O)C1C1=CC=CC=C1 NRNCYVBFPDDJNE-UHFFFAOYSA-N 0.000 claims description 2
- 229960000761 pemoline Drugs 0.000 claims description 2
- 229960005301 pentazocine Drugs 0.000 claims description 2
- VOKSWYLNZZRQPF-GDIGMMSISA-N pentazocine Chemical compound C1C2=CC=C(O)C=C2[C@@]2(C)[C@@H](C)[C@@H]1N(CC=C(C)C)CC2 VOKSWYLNZZRQPF-GDIGMMSISA-N 0.000 claims description 2
- 229940111202 pepsin Drugs 0.000 claims description 2
- 229960000762 perphenazine Drugs 0.000 claims description 2
- 229960000482 pethidine Drugs 0.000 claims description 2
- 229960003893 phenacetin Drugs 0.000 claims description 2
- 229960000436 phendimetrazine Drugs 0.000 claims description 2
- 229960003209 phenmetrazine Drugs 0.000 claims description 2
- 229960002895 phenylbutazone Drugs 0.000 claims description 2
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 claims description 2
- 229960002036 phenytoin Drugs 0.000 claims description 2
- 229960003634 pimozide Drugs 0.000 claims description 2
- YVUQSNJEYSNKRX-UHFFFAOYSA-N pimozide Chemical compound C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)CCCN1CCC(N2C(NC3=CC=CC=C32)=O)CC1 YVUQSNJEYSNKRX-UHFFFAOYSA-N 0.000 claims description 2
- 229950002220 pirlindole Drugs 0.000 claims description 2
- 229960002702 piroxicam Drugs 0.000 claims description 2
- QYSPLQLAKJAUJT-UHFFFAOYSA-N piroxicam Chemical compound OC=1C2=CC=CC=C2S(=O)(=O)N(C)C=1C(=O)NC1=CC=CC=N1 QYSPLQLAKJAUJT-UHFFFAOYSA-N 0.000 claims description 2
- 229960003089 pramipexole Drugs 0.000 claims description 2
- FASDKYOPVNHBLU-ZETCQYMHSA-N pramipexole Chemical compound C1[C@@H](NCCC)CCC2=C1SC(N)=N2 FASDKYOPVNHBLU-ZETCQYMHSA-N 0.000 claims description 2
- 229960005205 prednisolone Drugs 0.000 claims description 2
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 claims description 2
- 229960004618 prednisone Drugs 0.000 claims description 2
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 claims description 2
- 229960001233 pregabalin Drugs 0.000 claims description 2
- AYXYPKUFHZROOJ-ZETCQYMHSA-N pregabalin Chemical compound CC(C)C[C@H](CN)CC(O)=O AYXYPKUFHZROOJ-ZETCQYMHSA-N 0.000 claims description 2
- 229950003857 propizepine Drugs 0.000 claims description 2
- YFLBETLXDPBWTD-UHFFFAOYSA-N propizepine Chemical compound O=C1N(CC(C)N(C)C)C2=CC=CC=C2NC2=NC=CC=C21 YFLBETLXDPBWTD-UHFFFAOYSA-N 0.000 claims description 2
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 claims description 2
- 229960002601 protriptyline Drugs 0.000 claims description 2
- BWPIARFWQZKAIA-UHFFFAOYSA-N protriptyline Chemical compound C1=CC2=CC=CC=C2C(CCCNC)C2=CC=CC=C21 BWPIARFWQZKAIA-UHFFFAOYSA-N 0.000 claims description 2
- 229960001964 quazepam Drugs 0.000 claims description 2
- 229960000279 quinupramine Drugs 0.000 claims description 2
- JCBQCKFFSPGEDY-UHFFFAOYSA-N quinupramine Chemical compound C12=CC=CC=C2CCC2=CC=CC=C2N1C(C1)C2CCN1CC2 JCBQCKFFSPGEDY-UHFFFAOYSA-N 0.000 claims description 2
- ZRJBHWIHUMBLCN-BMIGLBTASA-N rac-huperzine A Natural products N1C(=O)C=CC2=C1C[C@@H]1C(=CC)[C@@]2(N)CC(C)=C1 ZRJBHWIHUMBLCN-BMIGLBTASA-N 0.000 claims description 2
- 229960003770 reboxetine Drugs 0.000 claims description 2
- CBQGYUDMJHNJBX-RTBURBONSA-N reboxetine Chemical compound CCOC1=CC=CC=C1O[C@H](C=1C=CC=CC=1)[C@@H]1OCCNC1 CBQGYUDMJHNJBX-RTBURBONSA-N 0.000 claims description 2
- 229960003147 reserpine Drugs 0.000 claims description 2
- BJOIZNZVOZKDIG-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C([C]5C=CC(OC)=CC5=N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 BJOIZNZVOZKDIG-MDEJGZGSSA-N 0.000 claims description 2
- 229960001534 risperidone Drugs 0.000 claims description 2
- RAPZEAPATHNIPO-UHFFFAOYSA-N risperidone Chemical compound FC1=CC=C2C(C3CCN(CC3)CCC=3C(=O)N4CCCCC4=NC=3C)=NOC2=C1 RAPZEAPATHNIPO-UHFFFAOYSA-N 0.000 claims description 2
- 229950009626 ritanserin Drugs 0.000 claims description 2
- JUQLTPCYUFPYKE-UHFFFAOYSA-N ritanserin Chemical compound CC=1N=C2SC=CN2C(=O)C=1CCN(CC1)CCC1=C(C=1C=CC(F)=CC=1)C1=CC=C(F)C=C1 JUQLTPCYUFPYKE-UHFFFAOYSA-N 0.000 claims description 2
- 229960004136 rivastigmine Drugs 0.000 claims description 2
- 229960000425 rizatriptan Drugs 0.000 claims description 2
- TXHZXHICDBAVJW-UHFFFAOYSA-N rizatriptan Chemical compound C=1[C]2C(CCN(C)C)=CN=C2C=CC=1CN1C=NC=N1 TXHZXHICDBAVJW-UHFFFAOYSA-N 0.000 claims description 2
- 229960000371 rofecoxib Drugs 0.000 claims description 2
- RZJQGNCSTQAWON-UHFFFAOYSA-N rofecoxib Chemical compound C1=CC(S(=O)(=O)C)=CC=C1C1=C(C=2C=CC=CC=2)C(=O)OC1 RZJQGNCSTQAWON-UHFFFAOYSA-N 0.000 claims description 2
- 229960001879 ropinirole Drugs 0.000 claims description 2
- UHSKFQJFRQCDBE-UHFFFAOYSA-N ropinirole Chemical compound CCCN(CCC)CCC1=CC=CC2=C1CC(=O)N2 UHSKFQJFRQCDBE-UHFFFAOYSA-N 0.000 claims description 2
- MDMGHDFNKNZPAU-UHFFFAOYSA-N roserpine Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(OC(C)=O)C(OC)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 MDMGHDFNKNZPAU-UHFFFAOYSA-N 0.000 claims description 2
- 229960003179 rotigotine Drugs 0.000 claims description 2
- KFQYTPMOWPVWEJ-INIZCTEOSA-N rotigotine Chemical compound CCCN([C@@H]1CC2=CC=CC(O)=C2CC1)CCC1=CC=CS1 KFQYTPMOWPVWEJ-INIZCTEOSA-N 0.000 claims description 2
- 229960000953 salsalate Drugs 0.000 claims description 2
- 229940125723 sedative agent Drugs 0.000 claims description 2
- 229960004425 sibutramine Drugs 0.000 claims description 2
- UNAANXDKBXWMLN-UHFFFAOYSA-N sibutramine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N(C)C)CC(C)C)CCC1 UNAANXDKBXWMLN-UHFFFAOYSA-N 0.000 claims description 2
- 229960003310 sildenafil Drugs 0.000 claims description 2
- JGMJQSFLQWGYMQ-UHFFFAOYSA-M sodium;2,6-dichloro-n-phenylaniline;acetate Chemical compound [Na+].CC([O-])=O.ClC1=CC=CC(Cl)=C1NC1=CC=CC=C1 JGMJQSFLQWGYMQ-UHFFFAOYSA-M 0.000 claims description 2
- 239000000021 stimulant Substances 0.000 claims description 2
- 229960001940 sulfasalazine Drugs 0.000 claims description 2
- NCEXYHBECQHGNR-QZQOTICOSA-N sulfasalazine Chemical compound C1=C(O)C(C(=O)O)=CC(\N=N\C=2C=CC(=CC=2)S(=O)(=O)NC=2N=CC=CC=2)=C1 NCEXYHBECQHGNR-QZQOTICOSA-N 0.000 claims description 2
- NCEXYHBECQHGNR-UHFFFAOYSA-N sulfasalazine Natural products C1=C(O)C(C(=O)O)=CC(N=NC=2C=CC(=CC=2)S(=O)(=O)NC=2N=CC=CC=2)=C1 NCEXYHBECQHGNR-UHFFFAOYSA-N 0.000 claims description 2
- 229960000894 sulindac Drugs 0.000 claims description 2
- MLKXDPUZXIRXEP-MFOYZWKCSA-N sulindac Chemical compound CC1=C(CC(O)=O)C2=CC(F)=CC=C2\C1=C/C1=CC=C(S(C)=O)C=C1 MLKXDPUZXIRXEP-MFOYZWKCSA-N 0.000 claims description 2
- 229960003708 sumatriptan Drugs 0.000 claims description 2
- KQKPFRSPSRPDEB-UHFFFAOYSA-N sumatriptan Chemical compound CNS(=O)(=O)CC1=CC=C2NC=C(CCN(C)C)C2=C1 KQKPFRSPSRPDEB-UHFFFAOYSA-N 0.000 claims description 2
- 229960001685 tacrine Drugs 0.000 claims description 2
- YLJREFDVOIBQDA-UHFFFAOYSA-N tacrine Chemical compound C1=CC=C2C(N)=C(CCCC3)C3=NC2=C1 YLJREFDVOIBQDA-UHFFFAOYSA-N 0.000 claims description 2
- 229960003188 temazepam Drugs 0.000 claims description 2
- 239000003451 thiazide diuretic agent Substances 0.000 claims description 2
- 229960002784 thioridazine Drugs 0.000 claims description 2
- 229960005344 tiapride Drugs 0.000 claims description 2
- 229960005013 tiotixene Drugs 0.000 claims description 2
- 229960000488 tizanidine Drugs 0.000 claims description 2
- XFYDIVBRZNQMJC-UHFFFAOYSA-N tizanidine Chemical compound ClC=1C=CC2=NSN=C2C=1NC1=NCCN1 XFYDIVBRZNQMJC-UHFFFAOYSA-N 0.000 claims description 2
- PNYKGCPSFKLFKA-UHFFFAOYSA-N tofenacin Chemical compound C=1C=CC=C(C)C=1C(OCCNC)C1=CC=CC=C1 PNYKGCPSFKLFKA-UHFFFAOYSA-N 0.000 claims description 2
- 229950010076 tofenacin Drugs 0.000 claims description 2
- 229960001017 tolmetin Drugs 0.000 claims description 2
- UPSPUYADGBWSHF-UHFFFAOYSA-N tolmetin Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1C UPSPUYADGBWSHF-UHFFFAOYSA-N 0.000 claims description 2
- 229960002309 toloxatone Drugs 0.000 claims description 2
- 229960004394 topiramate Drugs 0.000 claims description 2
- 229960004380 tramadol Drugs 0.000 claims description 2
- TVYLLZQTGLZFBW-GOEBONIOSA-N tramadol Natural products COC1=CC=CC([C@@]2(O)[C@@H](CCCC2)CN(C)C)=C1 TVYLLZQTGLZFBW-GOEBONIOSA-N 0.000 claims description 2
- LLPOLZWFYMWNKH-UHFFFAOYSA-N trans-dihydrocodeinone Natural products C1C(N(CCC234)C)C2CCC(=O)C3OC2=C4C1=CC=C2OC LLPOLZWFYMWNKH-UHFFFAOYSA-N 0.000 claims description 2
- PHTUQLWOUWZIMZ-GZTJUZNOSA-N trans-dothiepin Chemical compound C1SC2=CC=CC=C2C(=C/CCN(C)C)/C2=CC=CC=C21 PHTUQLWOUWZIMZ-GZTJUZNOSA-N 0.000 claims description 2
- 229960003991 trazodone Drugs 0.000 claims description 2
- PHLBKPHSAVXXEF-UHFFFAOYSA-N trazodone Chemical compound ClC1=CC=CC(N2CCN(CCCN3C(N4C=CC=CC4=N3)=O)CC2)=C1 PHLBKPHSAVXXEF-UHFFFAOYSA-N 0.000 claims description 2
- JOFWLTCLBGQGBO-UHFFFAOYSA-N triazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1Cl JOFWLTCLBGQGBO-UHFFFAOYSA-N 0.000 claims description 2
- 229960003386 triazolam Drugs 0.000 claims description 2
- 229960002324 trifluoperazine Drugs 0.000 claims description 2
- ZEWQUBUPAILYHI-UHFFFAOYSA-N trifluoperazine Chemical compound C1CN(C)CCN1CCCN1C2=CC(C(F)(F)F)=CC=C2SC2=CC=CC=C21 ZEWQUBUPAILYHI-UHFFFAOYSA-N 0.000 claims description 2
- FEZBIKUBAYAZIU-UHFFFAOYSA-N trimethobenzamide Chemical compound COC1=C(OC)C(OC)=CC(C(=O)NCC=2C=CC(OCCN(C)C)=CC=2)=C1 FEZBIKUBAYAZIU-UHFFFAOYSA-N 0.000 claims description 2
- 229960004161 trimethobenzamide Drugs 0.000 claims description 2
- 229960002431 trimipramine Drugs 0.000 claims description 2
- ZSCDBOWYZJWBIY-UHFFFAOYSA-N trimipramine Chemical compound C1CC2=CC=CC=C2N(CC(CN(C)C)C)C2=CC=CC=C21 ZSCDBOWYZJWBIY-UHFFFAOYSA-N 0.000 claims description 2
- 229960003688 tropisetron Drugs 0.000 claims description 2
- 229960002004 valdecoxib Drugs 0.000 claims description 2
- LNPDTQAFDNKSHK-UHFFFAOYSA-N valdecoxib Chemical compound CC=1ON=C(C=2C=CC=CC=2)C=1C1=CC=C(S(N)(=O)=O)C=C1 LNPDTQAFDNKSHK-UHFFFAOYSA-N 0.000 claims description 2
- MSRILKIQRXUYCT-UHFFFAOYSA-M valproate semisodium Chemical compound [Na+].CCCC(C(O)=O)CCC.CCCC(C([O-])=O)CCC MSRILKIQRXUYCT-UHFFFAOYSA-M 0.000 claims description 2
- 229960000604 valproic acid Drugs 0.000 claims description 2
- 229960001255 viloxazine Drugs 0.000 claims description 2
- 229930003231 vitamin Natural products 0.000 claims description 2
- 239000011782 vitamin Substances 0.000 claims description 2
- 229940088594 vitamin Drugs 0.000 claims description 2
- 235000013343 vitamin Nutrition 0.000 claims description 2
- 229940046009 vitamin E Drugs 0.000 claims description 2
- 235000019165 vitamin E Nutrition 0.000 claims description 2
- 239000011709 vitamin E Substances 0.000 claims description 2
- 229960002791 zimeldine Drugs 0.000 claims description 2
- OYPPVKRFBIWMSX-SXGWCWSVSA-N zimeldine Chemical compound C=1C=CN=CC=1C(=C/CN(C)C)\C1=CC=C(Br)C=C1 OYPPVKRFBIWMSX-SXGWCWSVSA-N 0.000 claims description 2
- 229960000607 ziprasidone Drugs 0.000 claims description 2
- MVWVFYHBGMAFLY-UHFFFAOYSA-N ziprasidone Chemical compound C1=CC=C2C(N3CCN(CC3)CCC3=CC=4CC(=O)NC=4C=C3Cl)=NSC2=C1 MVWVFYHBGMAFLY-UHFFFAOYSA-N 0.000 claims description 2
- 229960001475 zolpidem Drugs 0.000 claims description 2
- ZAFYATHCZYHLPB-UHFFFAOYSA-N zolpidem Chemical compound N1=C2C=CC(C)=CN2C(CC(=O)N(C)C)=C1C1=CC=C(C)C=C1 ZAFYATHCZYHLPB-UHFFFAOYSA-N 0.000 claims description 2
- 229960000820 zopiclone Drugs 0.000 claims description 2
- XDDJGVMJFWAHJX-UHFFFAOYSA-M clorazepic acid anion Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(C(=O)[O-])N=C1C1=CC=CC=C1 XDDJGVMJFWAHJX-UHFFFAOYSA-M 0.000 claims 1
- PJMPHNIQZUBGLI-UHFFFAOYSA-N fentanyl Chemical compound C=1C=CC=CC=1N(C(=O)CC)C(CC1)CCN1CCC1=CC=CC=C1 PJMPHNIQZUBGLI-UHFFFAOYSA-N 0.000 claims 1
- 238000004890 malting Methods 0.000 claims 1
- UIVFDCIXTSJXBB-ITGUQSILSA-N tropisetron Chemical compound C1=CC=C[C]2C(C(=O)O[C@H]3C[C@H]4CC[C@@H](C3)N4C)=CN=C21 UIVFDCIXTSJXBB-ITGUQSILSA-N 0.000 claims 1
- 229960001360 zolmitriptan Drugs 0.000 claims 1
- UTAZCRNOSWWEFR-ZDUSSCGKSA-N zolmitriptan Chemical compound C=1[C]2C(CCN(C)C)=CN=C2C=CC=1C[C@H]1COC(=O)N1 UTAZCRNOSWWEFR-ZDUSSCGKSA-N 0.000 claims 1
- 238000000576 coating method Methods 0.000 abstract description 29
- 239000011248 coating agent Substances 0.000 abstract description 28
- 230000036470 plasma concentration Effects 0.000 abstract description 14
- 210000000936 intestine Anatomy 0.000 abstract description 6
- 230000003247 decreasing effect Effects 0.000 abstract description 5
- 238000001727 in vivo Methods 0.000 abstract description 2
- 239000003826 tablet Substances 0.000 description 70
- 238000004090 dissolution Methods 0.000 description 26
- 239000000463 material Substances 0.000 description 21
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 20
- 235000002639 sodium chloride Nutrition 0.000 description 20
- 230000002411 adverse Effects 0.000 description 16
- 208000002193 Pain Diseases 0.000 description 15
- 208000001640 Fibromyalgia Diseases 0.000 description 14
- 239000011324 bead Substances 0.000 description 14
- 229940068196 placebo Drugs 0.000 description 14
- 239000000902 placebo Substances 0.000 description 14
- 239000000314 lubricant Substances 0.000 description 13
- 229920000642 polymer Polymers 0.000 description 13
- 239000004615 ingredient Substances 0.000 description 12
- 238000005550 wet granulation Methods 0.000 description 12
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 11
- 238000002156 mixing Methods 0.000 description 11
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 10
- 241000218691 Cupressaceae Species 0.000 description 10
- 239000008187 granular material Substances 0.000 description 10
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 10
- 229940124834 selective serotonin reuptake inhibitor Drugs 0.000 description 10
- 239000012896 selective serotonin reuptake inhibitor Substances 0.000 description 10
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 9
- 229920002472 Starch Polymers 0.000 description 9
- 229960002748 norepinephrine Drugs 0.000 description 9
- 235000019698 starch Nutrition 0.000 description 9
- 239000011230 binding agent Substances 0.000 description 8
- 239000003085 diluting agent Substances 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- 239000008363 phosphate buffer Substances 0.000 description 8
- 239000008107 starch Substances 0.000 description 8
- 229940032147 starch Drugs 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- 229920000609 methyl cellulose Polymers 0.000 description 7
- 235000010981 methylcellulose Nutrition 0.000 description 7
- 239000001923 methylcellulose Substances 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- 239000008194 pharmaceutical composition Substances 0.000 description 7
- 210000002381 plasma Anatomy 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 208000020401 Depressive disease Diseases 0.000 description 6
- 229920003134 Eudragit® polymer Polymers 0.000 description 6
- 241000282414 Homo sapiens Species 0.000 description 6
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 6
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 6
- 229940123445 Tricyclic antidepressant Drugs 0.000 description 6
- 239000002775 capsule Substances 0.000 description 6
- 239000001913 cellulose Substances 0.000 description 6
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 6
- 208000035475 disorder Diseases 0.000 description 6
- 238000005469 granulation Methods 0.000 description 6
- 230000003179 granulation Effects 0.000 description 6
- 239000008101 lactose Substances 0.000 description 6
- 235000019359 magnesium stearate Nutrition 0.000 description 6
- 230000001404 mediated effect Effects 0.000 description 6
- 239000004014 plasticizer Substances 0.000 description 6
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 6
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 229940083542 sodium Drugs 0.000 description 6
- 239000003381 stabilizer Substances 0.000 description 6
- 235000000346 sugar Nutrition 0.000 description 6
- 239000003029 tricyclic antidepressant agent Substances 0.000 description 6
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 229930006000 Sucrose Natural products 0.000 description 5
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 235000010980 cellulose Nutrition 0.000 description 5
- 229920002678 cellulose Polymers 0.000 description 5
- 239000003086 colorant Substances 0.000 description 5
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 5
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 5
- 231100000252 nontoxic Toxicity 0.000 description 5
- 230000003000 nontoxic effect Effects 0.000 description 5
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 5
- 229940076279 serotonin Drugs 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 229960004793 sucrose Drugs 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- 235000012222 talc Nutrition 0.000 description 5
- 239000001993 wax Substances 0.000 description 5
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000001856 Ethyl cellulose Substances 0.000 description 4
- 241000282412 Homo Species 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 206010062501 Non-cardiac chest pain Diseases 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 238000011021 bench scale process Methods 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- 239000008199 coating composition Substances 0.000 description 4
- 239000007884 disintegrant Substances 0.000 description 4
- 208000002173 dizziness Diseases 0.000 description 4
- 235000019325 ethyl cellulose Nutrition 0.000 description 4
- 229920001249 ethyl cellulose Polymers 0.000 description 4
- 210000001035 gastrointestinal tract Anatomy 0.000 description 4
- 229920001477 hydrophilic polymer Polymers 0.000 description 4
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 4
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 4
- 208000002551 irritable bowel syndrome Diseases 0.000 description 4
- 239000011159 matrix material Substances 0.000 description 4
- 239000005022 packaging material Substances 0.000 description 4
- 239000000546 pharmaceutical excipient Substances 0.000 description 4
- 239000000049 pigment Substances 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 108020003175 receptors Proteins 0.000 description 4
- 102000005962 receptors Human genes 0.000 description 4
- 238000005549 size reduction Methods 0.000 description 4
- 239000005720 sucrose Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 229920002126 Acrylic acid copolymer Polymers 0.000 description 3
- 206010067484 Adverse reaction Diseases 0.000 description 3
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- 229930195725 Mannitol Natural products 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229920000881 Modified starch Polymers 0.000 description 3
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 3
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 3
- 229920003082 Povidone K 90 Polymers 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229920002125 Sokalan® Polymers 0.000 description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 230000006838 adverse reaction Effects 0.000 description 3
- 230000001430 anti-depressive effect Effects 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 3
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 3
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 3
- 238000007906 compression Methods 0.000 description 3
- 229920006237 degradable polymer Polymers 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000007922 dissolution test Methods 0.000 description 3
- 238000012377 drug delivery Methods 0.000 description 3
- 238000007908 dry granulation Methods 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 3
- 239000000594 mannitol Substances 0.000 description 3
- 235000010355 mannitol Nutrition 0.000 description 3
- 239000002207 metabolite Substances 0.000 description 3
- 238000009521 phase II clinical trial Methods 0.000 description 3
- 238000011160 research Methods 0.000 description 3
- 239000003775 serotonin noradrenalin reuptake inhibitor Substances 0.000 description 3
- 239000007909 solid dosage form Substances 0.000 description 3
- 238000010561 standard procedure Methods 0.000 description 3
- 150000008163 sugars Chemical class 0.000 description 3
- 230000002459 sustained effect Effects 0.000 description 3
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 2
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 208000036864 Attention deficit/hyperactivity disease Diseases 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 2
- 206010008874 Chronic Fatigue Syndrome Diseases 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 2
- 206010016059 Facial pain Diseases 0.000 description 2
- 229930091371 Fructose Natural products 0.000 description 2
- 239000005715 Fructose Substances 0.000 description 2
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 208000011688 Generalised anxiety disease Diseases 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 208000005615 Interstitial Cystitis Diseases 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 2
- 240000007472 Leucaena leucocephala Species 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- 208000019695 Migraine disease Diseases 0.000 description 2
- XNCDYJFPRPDERF-PBCQUBLHSA-N Milnacipran hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1[C@@]1(C(=O)N(CC)CC)C[C@@H]1C[NH3+] XNCDYJFPRPDERF-PBCQUBLHSA-N 0.000 description 2
- 208000019022 Mood disease Diseases 0.000 description 2
- 208000021384 Obsessive-Compulsive disease Diseases 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 208000027030 Premenstrual dysphoric disease Diseases 0.000 description 2
- 229920001800 Shellac Polymers 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 206010043269 Tension headache Diseases 0.000 description 2
- 208000008548 Tension-Type Headache Diseases 0.000 description 2
- ZFOZVQLOBQUTQQ-UHFFFAOYSA-N Tributyl citrate Chemical compound CCCCOC(=O)CC(O)(C(=O)OCCCC)CC(=O)OCCCC ZFOZVQLOBQUTQQ-UHFFFAOYSA-N 0.000 description 2
- 206010046477 Urethral syndrome Diseases 0.000 description 2
- 208000003728 Vulvodynia Diseases 0.000 description 2
- 206010069055 Vulvovaginal pain Diseases 0.000 description 2
- 230000003187 abdominal effect Effects 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 210000003818 area postrema Anatomy 0.000 description 2
- 208000015802 attention deficit-hyperactivity disease Diseases 0.000 description 2
- 208000025748 atypical depressive disease Diseases 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 235000013539 calcium stearate Nutrition 0.000 description 2
- 239000008116 calcium stearate Substances 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 108091008690 chemoreceptors Proteins 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 230000001186 cumulative effect Effects 0.000 description 2
- 229940029644 cymbalta Drugs 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- RBLGLDWTCZMLRW-UHFFFAOYSA-K dicalcium;phosphate;dihydrate Chemical compound O.O.[Ca+2].[Ca+2].[O-]P([O-])([O-])=O RBLGLDWTCZMLRW-UHFFFAOYSA-K 0.000 description 2
- FLKPEMZONWLCSK-UHFFFAOYSA-N diethyl phthalate Chemical compound CCOC(=O)C1=CC=CC=C1C(=O)OCC FLKPEMZONWLCSK-UHFFFAOYSA-N 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- 150000004683 dihydrates Chemical class 0.000 description 2
- 230000003467 diminishing effect Effects 0.000 description 2
- 239000012738 dissolution medium Substances 0.000 description 2
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 2
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 2
- 208000024732 dysthymic disease Diseases 0.000 description 2
- 206010013990 dysuria Diseases 0.000 description 2
- 229940098766 effexor Drugs 0.000 description 2
- 239000002895 emetic Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 208000029364 generalized anxiety disease Diseases 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 2
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 2
- 229920000639 hydroxypropylmethylcellulose acetate succinate Polymers 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 230000007794 irritation Effects 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 210000003750 lower gastrointestinal tract Anatomy 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 208000024714 major depressive disease Diseases 0.000 description 2
- 229920003145 methacrylic acid copolymer Polymers 0.000 description 2
- 125000005395 methacrylic acid group Chemical group 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 206010027599 migraine Diseases 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 208000029766 myalgic encephalomeyelitis/chronic fatigue syndrome Diseases 0.000 description 2
- 210000005036 nerve Anatomy 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 230000003204 osmotic effect Effects 0.000 description 2
- 235000020030 perry Nutrition 0.000 description 2
- 208000019899 phobic disease Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920000136 polysorbate Polymers 0.000 description 2
- 229940068965 polysorbates Drugs 0.000 description 2
- 208000028173 post-traumatic stress disease Diseases 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000036385 rapid eye movement (rem) sleep Effects 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 229940113147 shellac Drugs 0.000 description 2
- 239000004208 shellac Substances 0.000 description 2
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 2
- 235000013874 shellac Nutrition 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 2
- WQQPDTLGLVLNOH-UHFFFAOYSA-M sodium;4-hydroxy-4-oxo-3-sulfobutanoate Chemical class [Na+].OC(=O)CC(C([O-])=O)S(O)(=O)=O WQQPDTLGLVLNOH-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 235000010356 sorbitol Nutrition 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- 238000013268 sustained release Methods 0.000 description 2
- 239000012730 sustained-release form Substances 0.000 description 2
- 208000011580 syndromic disease Diseases 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 description 2
- DCXXMTOCNZCJGO-UHFFFAOYSA-N tristearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC DCXXMTOCNZCJGO-UHFFFAOYSA-N 0.000 description 2
- 208000009935 visceral pain Diseases 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- OKMWKBLSFKFYGZ-UHFFFAOYSA-N 1-behenoylglycerol Chemical compound CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(O)CO OKMWKBLSFKFYGZ-UHFFFAOYSA-N 0.000 description 1
- FDCJDKXCCYFOCV-UHFFFAOYSA-N 1-hexadecoxyhexadecane Chemical compound CCCCCCCCCCCCCCCCOCCCCCCCCCCCCCCCC FDCJDKXCCYFOCV-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- 125000005273 2-acetoxybenzoic acid group Chemical group 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- CTXGTHVAWRBISV-UHFFFAOYSA-N 2-hydroxyethyl dodecanoate Chemical compound CCCCCCCCCCCC(=O)OCCO CTXGTHVAWRBISV-UHFFFAOYSA-N 0.000 description 1
- RFVNOJDQRGSOEL-UHFFFAOYSA-N 2-hydroxyethyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCCO RFVNOJDQRGSOEL-UHFFFAOYSA-N 0.000 description 1
- VCNPGCHIKPSUSP-UHFFFAOYSA-N 2-hydroxypropyl tetradecanoate Chemical compound CCCCCCCCCCCCCC(=O)OCC(C)O VCNPGCHIKPSUSP-UHFFFAOYSA-N 0.000 description 1
- AEDQNOLIADXSBB-UHFFFAOYSA-N 3-(dodecylazaniumyl)propanoate Chemical compound CCCCCCCCCCCCNCCC(O)=O AEDQNOLIADXSBB-UHFFFAOYSA-N 0.000 description 1
- 108060003345 Adrenergic Receptor Proteins 0.000 description 1
- 102000017910 Adrenergic receptor Human genes 0.000 description 1
- WKEMJKQOLOHJLZ-UHFFFAOYSA-N Almogran Chemical compound C1=C2C(CCN(C)C)=CNC2=CC=C1CS(=O)(=O)N1CCCC1 WKEMJKQOLOHJLZ-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 229920000856 Amylose Polymers 0.000 description 1
- 206010002869 Anxiety symptoms Diseases 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 229920003084 Avicel® PH-102 Polymers 0.000 description 1
- GUBGYTABKSRVRQ-DCSYEGIMSA-N Beta-Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-DCSYEGIMSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- PTHCMJGKKRQCBF-UHFFFAOYSA-N Cellulose, microcrystalline Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC)C(CO)O1 PTHCMJGKKRQCBF-UHFFFAOYSA-N 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- 229920001661 Chitosan Polymers 0.000 description 1
- 208000000094 Chronic Pain Diseases 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 208000028698 Cognitive impairment Diseases 0.000 description 1
- 102000002004 Cytochrome P-450 Enzyme System Human genes 0.000 description 1
- 108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- 206010012735 Diarrhoea Diseases 0.000 description 1
- PYGXAGIECVVIOZ-UHFFFAOYSA-N Dibutyl decanedioate Chemical compound CCCCOC(=O)CCCCCCCCC(=O)OCCCC PYGXAGIECVVIOZ-UHFFFAOYSA-N 0.000 description 1
- 102000015554 Dopamine receptor Human genes 0.000 description 1
- 108050004812 Dopamine receptor Proteins 0.000 description 1
- 206010013710 Drug interaction Diseases 0.000 description 1
- 206010052804 Drug tolerance Diseases 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 206010053155 Epigastric discomfort Diseases 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 229920003135 Eudragit® L 100-55 Polymers 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 208000018522 Gastrointestinal disease Diseases 0.000 description 1
- 229920002907 Guar gum Polymers 0.000 description 1
- 208000032843 Hemorrhage Diseases 0.000 description 1
- 208000033830 Hot Flashes Diseases 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- WPNJAUFVNXKLIM-UHFFFAOYSA-N Moxonidine Chemical compound COC1=NC(C)=NC(Cl)=C1NC1=NCCN1 WPNJAUFVNXKLIM-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- RVGRUAULSDPKGF-UHFFFAOYSA-N Poloxamer Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 208000029808 Psychomotor disease Diseases 0.000 description 1
- 230000010799 Receptor Interactions Effects 0.000 description 1
- 206010039897 Sedation Diseases 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- DOOTYTYQINUNNV-UHFFFAOYSA-N Triethyl citrate Chemical compound CCOC(=O)CC(O)(C(=O)OCC)CC(=O)OCC DOOTYTYQINUNNV-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 229920002494 Zein Polymers 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000001800 adrenalinergic effect Effects 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 229960002133 almotriptan Drugs 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229920003144 amino alkyl methacrylate copolymer Polymers 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 208000022531 anorexia Diseases 0.000 description 1
- 230000001078 anti-cholinergic effect Effects 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000003542 behavioural effect Effects 0.000 description 1
- 229960000686 benzalkonium chloride Drugs 0.000 description 1
- UREZNYTWGJKWBI-UHFFFAOYSA-M benzethonium chloride Chemical compound [Cl-].C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 UREZNYTWGJKWBI-UHFFFAOYSA-M 0.000 description 1
- 229960001950 benzethonium chloride Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- 208000034158 bleeding Diseases 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 235000021152 breakfast Nutrition 0.000 description 1
- SXFILQHETIJGQZ-UHFFFAOYSA-N but-3-enoic acid;phthalic acid Chemical compound OC(=O)CC=C.OC(=O)C1=CC=CC=C1C(O)=O SXFILQHETIJGQZ-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229920003123 carboxymethyl cellulose sodium Polymers 0.000 description 1
- 229940063834 carboxymethylcellulose sodium Drugs 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 210000003710 cerebral cortex Anatomy 0.000 description 1
- 210000001175 cerebrospinal fluid Anatomy 0.000 description 1
- 229960000800 cetrimonium bromide Drugs 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000001713 cholinergic effect Effects 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- XDDJGVMJFWAHJX-UHFFFAOYSA-N clorazepic acid Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(C(=O)O)N=C1C1=CC=CC=C1 XDDJGVMJFWAHJX-UHFFFAOYSA-N 0.000 description 1
- 208000010877 cognitive disease Diseases 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- 210000003792 cranial nerve Anatomy 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003405 delayed action preparation Substances 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 229940099371 diacetylated monoglycerides Drugs 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 235000013681 dietary sucrose Nutrition 0.000 description 1
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- AMTWCFIAVKBGOD-UHFFFAOYSA-N dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane Chemical compound O=[Si]=O.CO[Si](C)(C)O[Si](C)(C)C AMTWCFIAVKBGOD-UHFFFAOYSA-N 0.000 description 1
- 238000007907 direct compression Methods 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 229960003638 dopamine Drugs 0.000 description 1
- 231100000371 dose-limiting toxicity Toxicity 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000003821 enantio-separation Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 239000002662 enteric coated tablet Substances 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- GDCRSXZBSIRSFR-UHFFFAOYSA-N ethyl prop-2-enoate;2-methylprop-2-enoic acid Chemical compound CC(=C)C(O)=O.CCOC(=O)C=C GDCRSXZBSIRSFR-UHFFFAOYSA-N 0.000 description 1
- 239000005038 ethylene vinyl acetate Substances 0.000 description 1
- IVLVTNPOHDFFCJ-UHFFFAOYSA-N fentanyl citrate Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C=1C=CC=CC=1N(C(=O)CC)C(CC1)CCN1CCC1=CC=CC=C1 IVLVTNPOHDFFCJ-UHFFFAOYSA-N 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 210000001156 gastric mucosa Anatomy 0.000 description 1
- 210000005095 gastrointestinal system Anatomy 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 description 1
- 229940075529 glyceryl stearate Drugs 0.000 description 1
- 239000001087 glyceryl triacetate Substances 0.000 description 1
- 235000013773 glyceryl triacetate Nutrition 0.000 description 1
- 239000000665 guar gum Substances 0.000 description 1
- 235000010417 guar gum Nutrition 0.000 description 1
- 229960002154 guar gum Drugs 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 230000002440 hepatic effect Effects 0.000 description 1
- 230000000742 histaminergic effect Effects 0.000 description 1
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N hydroxymaleic acid group Chemical group O/C(/C(=O)O)=C/C(=O)O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- 229920003063 hydroxymethyl cellulose Polymers 0.000 description 1
- 229940031574 hydroxymethyl cellulose Drugs 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 229940094506 lauryl betaine Drugs 0.000 description 1
- IZWSFJTYBVKZNK-UHFFFAOYSA-N lauryl sulfobetaine Chemical compound CCCCCCCCCCCC[N+](C)(C)CCCS([O-])(=O)=O IZWSFJTYBVKZNK-UHFFFAOYSA-N 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- KJLLKLRVCJAFRY-UHFFFAOYSA-N mebutizide Chemical compound ClC1=C(S(N)(=O)=O)C=C2S(=O)(=O)NC(C(C)C(C)CC)NC2=C1 KJLLKLRVCJAFRY-UHFFFAOYSA-N 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 210000000412 mechanoreceptor Anatomy 0.000 description 1
- 108091008704 mechanoreceptors Proteins 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- 201000003102 mental depression Diseases 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- NXMXPVQZFYYPGD-UHFFFAOYSA-N methyl 2-methylprop-2-enoate;methyl prop-2-enoate Chemical compound COC(=O)C=C.COC(=O)C(C)=C NXMXPVQZFYYPGD-UHFFFAOYSA-N 0.000 description 1
- IQSHMXAZFHORGY-UHFFFAOYSA-N methyl prop-2-enoate;2-methylprop-2-enoic acid Chemical compound COC(=O)C=C.CC(=C)C(O)=O IQSHMXAZFHORGY-UHFFFAOYSA-N 0.000 description 1
- 229960000638 milnacipran hydrochloride Drugs 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000036651 mood Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 230000003551 muscarinic effect Effects 0.000 description 1
- 230000004118 muscle contraction Effects 0.000 description 1
- QCTVGFNUKWXQNN-UHFFFAOYSA-N n-(2-hydroxypropyl)octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NCC(C)O QCTVGFNUKWXQNN-UHFFFAOYSA-N 0.000 description 1
- DVEKCXOJTLDBFE-UHFFFAOYSA-N n-dodecyl-n,n-dimethylglycinate Chemical compound CCCCCCCCCCCC[N+](C)(C)CC([O-])=O DVEKCXOJTLDBFE-UHFFFAOYSA-N 0.000 description 1
- 230000001722 neurochemical effect Effects 0.000 description 1
- 239000002858 neurotransmitter agent Substances 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000002767 noradrenalin uptake inhibitor Substances 0.000 description 1
- 229940127221 norepinephrine reuptake inhibitor Drugs 0.000 description 1
- 229920002114 octoxynol-9 Polymers 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000012735 once-a-day formulation Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 229940126701 oral medication Drugs 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000006179 pH buffering agent Substances 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 230000008855 peristalsis Effects 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229960000502 poloxamer Drugs 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920002523 polyethylene Glycol 1000 Polymers 0.000 description 1
- 229940056099 polyglyceryl-4 oleate Drugs 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229940100467 polyvinyl acetate phthalate Drugs 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920006316 polyvinylpyrrolidine Polymers 0.000 description 1
- 238000011240 pooled analysis Methods 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 229920003124 powdered cellulose Polymers 0.000 description 1
- 235000019814 powdered cellulose Nutrition 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 229960004063 propylene glycol Drugs 0.000 description 1
- 208000020016 psychiatric disease Diseases 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 210000004189 reticular formation Anatomy 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 230000036280 sedation Effects 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229940126570 serotonin reuptake inhibitor Drugs 0.000 description 1
- 239000003772 serotonin uptake inhibitor Substances 0.000 description 1
- 229940083037 simethicone Drugs 0.000 description 1
- 238000009097 single-agent therapy Methods 0.000 description 1
- 230000007958 sleep Effects 0.000 description 1
- 230000003860 sleep quality Effects 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229920003109 sodium starch glycolate Polymers 0.000 description 1
- 239000008109 sodium starch glycolate Substances 0.000 description 1
- 229940079832 sodium starch glycolate Drugs 0.000 description 1
- IDXHDUOOTUFFOX-UHFFFAOYSA-M sodium;2-[2-hydroxyethyl-[2-(tetradecanoylamino)ethyl]amino]acetate Chemical compound [Na+].CCCCCCCCCCCCCC(=O)NCCN(CCO)CC([O-])=O IDXHDUOOTUFFOX-UHFFFAOYSA-M 0.000 description 1
- 230000000392 somatic effect Effects 0.000 description 1
- 229940100515 sorbitan Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- SFVFIFLLYFPGHH-UHFFFAOYSA-M stearalkonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SFVFIFLLYFPGHH-UHFFFAOYSA-M 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002889 sympathetic effect Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 229960002622 triacetin Drugs 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- WEAPVABOECTMGR-UHFFFAOYSA-N triethyl 2-acetyloxypropane-1,2,3-tricarboxylate Chemical compound CCOC(=O)CC(C(=O)OCC)(OC(C)=O)CC(=O)OCC WEAPVABOECTMGR-UHFFFAOYSA-N 0.000 description 1
- 239000001069 triethyl citrate Substances 0.000 description 1
- VMYFZRTXGLUXMZ-UHFFFAOYSA-N triethyl citrate Natural products CCOC(=O)C(O)(C(=O)OCC)C(=O)OCC VMYFZRTXGLUXMZ-UHFFFAOYSA-N 0.000 description 1
- 235000013769 triethyl citrate Nutrition 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 125000005591 trimellitate group Chemical group 0.000 description 1
- ZNRGQMMCGHDTEI-ITGUQSILSA-N tropisetron Chemical compound C1=CC=C2C(C(=O)O[C@H]3C[C@H]4CC[C@@H](C3)N4C)=CNC2=C1 ZNRGQMMCGHDTEI-ITGUQSILSA-N 0.000 description 1
- 210000002438 upper gastrointestinal tract Anatomy 0.000 description 1
- 230000001515 vagal effect Effects 0.000 description 1
- 210000001186 vagus nerve Anatomy 0.000 description 1
- 229940117958 vinyl acetate Drugs 0.000 description 1
- 229920006163 vinyl copolymer Polymers 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 229920003176 water-insoluble polymer Polymers 0.000 description 1
- 230000003442 weekly effect Effects 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000005019 zein Substances 0.000 description 1
- 229940093612 zein Drugs 0.000 description 1
- 229940020965 zoloft Drugs 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/28—Dragees; Coated pills or tablets, e.g. with film or compression coating
- A61K9/2806—Coating materials
- A61K9/2833—Organic macromolecular compounds
- A61K9/284—Organic macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds, e.g. polyvinyl pyrrolidone
- A61K9/2846—Poly(meth)acrylates
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2004—Excipients; Inactive ingredients
- A61K9/2022—Organic macromolecular compounds
- A61K9/205—Polysaccharides, e.g. alginate, gums; Cyclodextrin
- A61K9/2054—Cellulose; Cellulose derivatives, e.g. hydroxypropyl methylcellulose
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/24—Antidepressants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/28—Dragees; Coated pills or tablets, e.g. with film or compression coating
- A61K9/2886—Dragees; Coated pills or tablets, e.g. with film or compression coating having two or more different drug-free coatings; Tablets of the type inert core-drug layer-inactive layer
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Epidemiology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pain & Pain Management (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Psychiatry (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicinal Preparation (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42164002P | 2002-10-25 | 2002-10-25 | |
| US60/421,640 | 2002-10-25 | ||
| US43162602P | 2002-12-05 | 2002-12-05 | |
| US43162702P | 2002-12-05 | 2002-12-05 | |
| US60/431,627 | 2002-12-05 | ||
| US60/431,626 | 2002-12-05 | ||
| US43186102P | 2002-12-09 | 2002-12-09 | |
| US43190602P | 2002-12-09 | 2002-12-09 | |
| US60/431,861 | 2002-12-09 | ||
| US60/431,906 | 2002-12-09 | ||
| US44361803P | 2003-01-29 | 2003-01-29 | |
| US60/443,618 | 2003-01-29 | ||
| US45906103P | 2003-03-28 | 2003-03-28 | |
| US45899403P | 2003-03-28 | 2003-03-28 | |
| US45899503P | 2003-03-28 | 2003-03-28 | |
| US60/458,994 | 2003-03-28 | ||
| US60/459,061 | 2003-03-28 | ||
| US60/458,995 | 2003-03-28 | ||
| PCT/US2003/033492 WO2004037190A2 (en) | 2002-10-25 | 2003-10-23 | Modified release compositions of milnacipran |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2503201A1 CA2503201A1 (en) | 2004-05-06 |
| CA2503201C true CA2503201C (en) | 2010-08-03 |
Family
ID=32180880
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2503201A Expired - Fee Related CA2503201C (en) | 2002-10-25 | 2003-10-23 | Modified release compositions of milnacipran |
Country Status (7)
| Country | Link |
|---|---|
| US (3) | US20040132826A1 (enExample) |
| EP (1) | EP1578403A4 (enExample) |
| JP (1) | JP2006503918A (enExample) |
| AU (1) | AU2003301671C1 (enExample) |
| CA (1) | CA2503201C (enExample) |
| MX (1) | MXPA05004395A (enExample) |
| WO (1) | WO2004037190A2 (enExample) |
Families Citing this family (124)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8071128B2 (en) | 1996-06-14 | 2011-12-06 | Kyowa Hakko Kirin Co., Ltd. | Intrabuccally rapidly disintegrating tablet and a production method of the tablets |
| IT1319655B1 (it) | 2000-11-15 | 2003-10-23 | Eurand Int | Microsfere di enzimi pancreatici con elevata stabilita' e relativometodo di preparazione. |
| US9358214B2 (en) | 2001-10-04 | 2016-06-07 | Adare Pharmaceuticals, Inc. | Timed, sustained release systems for propranolol |
| US6602911B2 (en) * | 2001-11-05 | 2003-08-05 | Cypress Bioscience, Inc. | Methods of treating fibromyalgia |
| US20060281797A1 (en) * | 2001-12-11 | 2006-12-14 | University Of Virginia Patent Foundation | Neurorestoration with R(+) Pramipexole |
| US8679533B2 (en) * | 2002-07-25 | 2014-03-25 | Pharmacia Corporation | Pramipexole once-daily dosage form |
| US20050226926A1 (en) | 2002-07-25 | 2005-10-13 | Pfizer Inc | Sustained-release tablet composition of pramipexole |
| AU2003284005B2 (en) * | 2002-10-03 | 2009-12-17 | Forest Laboratories Holdings Limited | Dosage escalation and divided daily dose of anti-depressants to treat neurological disorders |
| EP1556024A4 (en) * | 2002-10-25 | 2007-01-17 | Collegium Pharmaceutical Inc | INTERMITTENT LIBERATION COMPOSITIONS OF MILNACIPRANE |
| CN1989968B (zh) | 2002-12-27 | 2011-05-11 | 大塚制药株式会社 | 用于治疗情绪障碍的喹诺酮衍生物和5-羟色胺再摄取抑制剂 |
| AR042806A1 (es) | 2002-12-27 | 2005-07-06 | Otsuka Pharma Co Ltd | Combinacion de derivados de carboestirilo e inhibidores de la reabsorcion de serotonina para el tratamiento de trastornos del animo |
| US8367111B2 (en) * | 2002-12-31 | 2013-02-05 | Aptalis Pharmatech, Inc. | Extended release dosage forms of propranolol hydrochloride |
| US20040228830A1 (en) * | 2003-01-28 | 2004-11-18 | Collegium Pharmaceutical, Inc. | Multiparticulate compositions of milnacipran for oral administration |
| FR2851163B1 (fr) * | 2003-02-14 | 2007-04-27 | Utilisation de l'enantiomere dextrogyre du milnacipran pour la preparation d'un medicament | |
| RU2317817C2 (ru) * | 2003-02-14 | 2008-02-27 | Пьер Фабр Медикаман | Применение (1s,2r) энантиомера милнаципрана для получения лекарственного средства |
| AR045314A1 (es) * | 2003-05-13 | 2005-10-26 | Cephalon Inc | Composiciones farmaceuticas de analepticos y antidepresivos |
| CA2524300C (en) | 2003-08-08 | 2008-10-28 | Biovail Laboratories International Srl | Modified-release tablet of bupropion hydrochloride |
| CA2538412A1 (en) * | 2003-09-12 | 2005-03-24 | Warner-Lambert Company Llc | Combination comprising an alpha-2-delta ligand and an ssri and/or snri for treatment of depression and anxiety disorders |
| EA010905B1 (ru) | 2003-09-17 | 2008-12-30 | Янссен Фармацевтика Н.В. | Сопряжённые гетероциклические соединения |
| US20050176680A1 (en) * | 2003-12-11 | 2005-08-11 | Sepracor, Inc. | Combination of sedative and a neurotransmitter modulator, and methods for improving sleep quality and treating depression |
| WO2005063248A1 (en) * | 2003-12-22 | 2005-07-14 | Sepracor Inc. | Modafinil combination therapy for improving sleep quality |
| WO2005063297A2 (en) * | 2003-12-24 | 2005-07-14 | Sepracor Inc. | Melatonin combination therapy for improving sleep quality |
| ES2390879T3 (es) * | 2003-12-31 | 2012-11-19 | Actavis Group Ptc Ehf. | Formulaciones de atomoxetina |
| US20050267176A1 (en) * | 2004-02-18 | 2005-12-01 | Sepracor Inc. | Dopamine-agonist combination therapy for improving sleep quality |
| US20060002999A1 (en) * | 2004-06-17 | 2006-01-05 | Forest Laboratories, Inc. | Immediate release formulations of 1-aminocyclohexane compounds, memantine and neramexane |
| EP2286801A3 (en) * | 2004-08-13 | 2012-05-09 | Boehringer Ingelheim International GmbH | Extended release tablet formulation containing pramipexole or a pharmaceutically acceptable salt thereof, method for manufacturing the same and use thereof |
| CN101849920A (zh) * | 2004-08-13 | 2010-10-06 | 贝林格尔·英格海姆国际有限公司 | 包含普拉克索或其可药用盐的延长释放小球制剂、其制备方法及其用途 |
| DK1781265T3 (da) | 2004-08-25 | 2010-08-02 | Essentialis Inc | Farmaceutiske formuleringer af kalium ATP-kanal-åbnere og anvendelser deraf |
| MX2007002375A (es) * | 2004-08-31 | 2007-04-23 | Pfizer Prod Inc | Formas de dosificacion de liberacion controlada combinando liberacion inmediata y liberacion sostenida de un farmaco de baja solubilidad. |
| US8747895B2 (en) * | 2004-09-13 | 2014-06-10 | Aptalis Pharmatech, Inc. | Orally disintegrating tablets of atomoxetine |
| US20070077297A1 (en) | 2004-09-30 | 2007-04-05 | Scolr Pharma, Inc. | Modified release ibuprofen dosage form |
| US20060068009A1 (en) * | 2004-09-30 | 2006-03-30 | Scolr Pharma, Inc. | Modified release ibuprofen dosage form |
| US20060240043A1 (en) * | 2004-10-08 | 2006-10-26 | Meyerson Laurence R | Methods and compositions for treating migraine pain |
| US9884014B2 (en) | 2004-10-12 | 2018-02-06 | Adare Pharmaceuticals, Inc. | Taste-masked pharmaceutical compositions |
| EP1802285B1 (en) | 2004-10-21 | 2013-02-27 | Aptalis Pharmatech, Inc. | Taste-masked pharmaceutical compositions with gastrosoluble pore-formers |
| US20060100263A1 (en) * | 2004-11-05 | 2006-05-11 | Anthony Basile | Antipyretic compositions and methods |
| US20060099262A1 (en) * | 2004-11-08 | 2006-05-11 | Biokey, Inc. | Methods and formulations for making controlled release oral dosage form |
| US8586085B2 (en) * | 2004-11-08 | 2013-11-19 | Biokey, Inc. | Methods and formulations for making pharmaceutical compositions containing bupropion |
| US20060099261A1 (en) * | 2004-11-08 | 2006-05-11 | Biokey, Inc. | Methods and formulations for making controlled release oral dosage form |
| US20060205822A1 (en) * | 2004-12-22 | 2006-09-14 | Forest Laboratories, Inc. | 1-Aminocyclohexane derivatives for the treatment of multiple sclerosis, emotional lability and pseudobulbar affect |
| US20060194869A1 (en) * | 2004-12-23 | 2006-08-31 | Santiago Ini | Process for preparing pharmaceutically acceptable salts of duloxetine and intermediates thereof |
| US20060165745A1 (en) * | 2005-01-21 | 2006-07-27 | Yiwen Chew | Sustained release tablets for treatment of aqueous environment and methods for making the same |
| US9161918B2 (en) | 2005-05-02 | 2015-10-20 | Adare Pharmaceuticals, Inc. | Timed, pulsatile release systems |
| US20060281775A1 (en) | 2005-06-14 | 2006-12-14 | Applied Pharmacy Services, Inc. | Two-component pharmaceutical composition for the treatment of pain |
| US20100285123A1 (en) * | 2005-06-20 | 2010-11-11 | Rudresha Korlakunte Virupakshalah Prasad | Controlled Release Dosage Formulation of Duloxetine |
| US7598255B2 (en) * | 2005-08-04 | 2009-10-06 | Janssen Pharmaceutica Nv | Pyrimidine compounds as serotonin receptor modulators |
| US8778395B2 (en) * | 2005-08-11 | 2014-07-15 | Andrx Labs, Llc | Diltiazem controlled release formulation and method of manufacture |
| ATE444750T1 (de) * | 2005-08-15 | 2009-10-15 | Univ Virginia | Neurorestauration mit r(+) pramipexol |
| US7994220B2 (en) * | 2005-09-28 | 2011-08-09 | Cypress Bioscience, Inc. | Milnacipran for the long-term treatment of fibromyalgia syndrome |
| US8329744B2 (en) * | 2005-11-02 | 2012-12-11 | Relmada Therapeutics, Inc. | Methods of preventing the serotonin syndrome and compositions for use thereof |
| WO2007087452A2 (en) * | 2006-01-27 | 2007-08-02 | Theraquest Biosciences, Llc | Abuse resistant and extended release formulations and method of use thereof |
| US20100210732A1 (en) * | 2005-11-02 | 2010-08-19 | Najib Babul | Methods of Preventing the Serotonin Syndrome and Compositions for Use Therefor |
| WO2008134071A1 (en) * | 2007-04-26 | 2008-11-06 | Theraquest Biosciences, Inc. | Multimodal abuse resistant extended release formulations |
| CN1961879B (zh) * | 2005-11-09 | 2011-11-30 | 上海医药工业研究院 | 组成石杉碱甲鼻用原位凝胶喷雾剂的药物组合物、其制备方法及用途 |
| US20070104788A1 (en) * | 2005-11-10 | 2007-05-10 | Seamus Mulligan | Once-daily administration of central nervous system drugs |
| US20070134322A1 (en) * | 2005-12-14 | 2007-06-14 | Forest Laboratories, Inc. | Modified and pulsatile release pharmaceutical formulations of escitalopram |
| CA2635594A1 (en) * | 2005-12-30 | 2007-07-12 | Advancis Pharmaceutical Corporation | Gastric release pulse system for drug delivery |
| EP1988875A2 (en) * | 2006-02-10 | 2008-11-12 | Boehringer Ingelheim International GmbH | Modified release formulation |
| WO2007090883A1 (en) * | 2006-02-10 | 2007-08-16 | Boehringer Ingelheim International Gmbh | Extended release formulation |
| US8518926B2 (en) * | 2006-04-10 | 2013-08-27 | Knopp Neurosciences, Inc. | Compositions and methods of using (R)-pramipexole |
| TW200806282A (en) * | 2006-05-05 | 2008-02-01 | Wyeth Corp | Solid dosage formulations |
| PL2026803T3 (pl) * | 2006-05-16 | 2012-05-31 | Knopp Neurosciences Inc | Kompozycje R(+) i S(-) pramipeksolu i sposoby ich zastosowania |
| MX2008014758A (es) * | 2006-05-22 | 2009-01-19 | Teva Pharma | Formulaciones de liberacion retardada de clorhidrato de duloxetina. |
| ES2400446T5 (es) * | 2006-08-03 | 2017-03-13 | Horizon Pharma Ag | Tratamiento con glucocorticoides de liberación retardada de una enfermedad reumática |
| WO2008027557A2 (en) * | 2006-08-31 | 2008-03-06 | Spherics, Inc. | Topiramate compositions and methods of enhancing its bioavailability |
| AU2007319141B2 (en) | 2006-11-17 | 2013-01-10 | Supernus Pharmaceuticals Inc. | Sustained-release formulations of topiramate |
| CN102218044A (zh) * | 2006-12-04 | 2011-10-19 | 苏佩努斯制药公司 | 托吡酯的增强的立即释放制剂 |
| US8524695B2 (en) * | 2006-12-14 | 2013-09-03 | Knopp Neurosciences, Inc. | Modified release formulations of (6R)-4,5,6,7-tetrahydro-N6-propyl-2,6-benzothiazole-diamine and methods of using the same |
| JP5308350B2 (ja) * | 2006-12-22 | 2013-10-09 | レコルダーティ アイルランド リミテッド | α２δリガンドおよびＮＳＡＩＤを用いた下部尿路機能障害の併用療法 |
| EP2079445B1 (en) | 2007-02-20 | 2015-11-04 | Aptalis Pharma Limited | Stable digestive enzyme compositions |
| JP2010521496A (ja) | 2007-03-14 | 2010-06-24 | ノップ ニューロサイエンシーズ、インク． | キラル精製置換ベンゾチアゾールジアミンの合成 |
| EP2150242A2 (en) * | 2007-04-20 | 2010-02-10 | Wockhardt Research Centre | Pharmaceutical compositions of duloxetine |
| US10087493B2 (en) | 2008-03-07 | 2018-10-02 | Aptalis Pharma Canada Ulc | Method for detecting infectious parvovirus in pharmaceutical preparations |
| WO2009151498A2 (en) * | 2008-03-28 | 2009-12-17 | Forest Laboratories Holdings Limited | Memantine formulations |
| CA2734491A1 (en) | 2008-08-19 | 2010-02-25 | Knopp Neurosciences, Inc. | Compositions and methods of using (r)-pramipexole |
| US20100068152A1 (en) * | 2008-09-16 | 2010-03-18 | Searete Llc, A Limited Liability Corporation Of The State Of Delaware | Ex vivo modifiable particle or polymeric based final dosage form |
| US20100068233A1 (en) * | 2008-09-16 | 2010-03-18 | Searete Llc, A Limited Liability Corporation Of The State Of Delaware | Modifiable dosage form |
| US20100069821A1 (en) * | 2008-09-16 | 2010-03-18 | Searete Llc, A Limited Liability Corporation Of The State Of Delaware | Ex vivo modifiable medicament release-sites final dosage form |
| US20100068275A1 (en) * | 2008-09-16 | 2010-03-18 | Searete Llc, A Limited Liability Corporation Of The State Of Delaware | Personalizable dosage form |
| US20100068235A1 (en) * | 2008-09-16 | 2010-03-18 | Searete LLC, a limited liability corporation of Deleware | Individualizable dosage form |
| US20100068254A1 (en) * | 2008-09-16 | 2010-03-18 | Mahalaxmi Gita Bangera | Modifying a medicament availability state of a final dosage form |
| US20100069887A1 (en) * | 2008-09-16 | 2010-03-18 | Searete Llc, A Limited Liability Corporation Of The State Of Delaware | Multiple chamber ex vivo adjustable-release final dosage form |
| US8753677B2 (en) * | 2008-09-16 | 2014-06-17 | The Invention Science Fund I, Llc | Ex vivo modifiable multiple medicament final dosage form |
| US20100068153A1 (en) * | 2008-09-16 | 2010-03-18 | Searete Llc, A Limited Liability Corporation Of The State Of Delaware | Ex vivo activatable final dosage form |
| EP2391369A1 (en) * | 2009-01-26 | 2011-12-07 | Nitec Pharma AG | Delayed-release glucocorticoid treatment of asthma |
| NZ582836A (en) * | 2009-01-30 | 2011-06-30 | Nitec Pharma Ag | Delayed-release glucocorticoid treatment of rheumatoid arthritis by improving signs and symptoms, showing major or complete clinical response and by preventing from joint damage |
| US9173845B2 (en) | 2009-08-05 | 2015-11-03 | Lupin Limited | Controlled release pharmaceutical compositions of milnacipran |
| AU2016216662B2 (en) * | 2009-09-17 | 2017-09-07 | Allergan Therapeutics LLC | Pancreatic enzyme compositions and methods for treating pancreatitis and pancreatic insufficiency |
| US8784884B2 (en) * | 2009-09-17 | 2014-07-22 | Stephen Perrett | Pancreatic enzyme compositions and methods for treating pancreatitis and pancreatic insufficiency |
| EP2496079A4 (en) * | 2009-11-06 | 2014-05-14 | Pierre Fabre Médicament Sas | NOVEL (1S, 2R) -2- (AMINOMETHYL) -N, N-DIETHYL-1-PHENYLCYCLOPROPANECARBOXAMIDE CRYSTALLINE FORMS |
| CN106389381A (zh) | 2009-12-02 | 2017-02-15 | 阿达玛斯医药公司 | 金刚烷胺组合物及其使用方法 |
| JP5309262B2 (ja) | 2009-12-02 | 2013-10-09 | アプタリス ファーマ リミテッド | フェキソフェナジン・マイクロカプセル及びそれを含む組成物 |
| WO2011107922A2 (en) | 2010-03-04 | 2011-09-09 | Ranbaxy Laboratories Limited | Extended release composition of milnacipran |
| WO2011107921A2 (en) | 2010-03-04 | 2011-09-09 | Ranbaxy Laboratories Limited | Modified release composition of milnacipran |
| WO2011132157A1 (en) * | 2010-04-22 | 2011-10-27 | Yissum Research Development Company Of The Hebrew University Of Jerusalem Ltd. | Oral sustained release formulation of huperzine a |
| CA2808630A1 (en) | 2010-08-19 | 2012-02-23 | Buck Institute For Age Research | Methods of treating mild cognitive impairment (mci) and related disorders |
| WO2012028922A2 (en) | 2010-08-30 | 2012-03-08 | Lupin Limited | Controlled release pharmaceutical compositions of milnacipran |
| HRP20140995T1 (hr) | 2010-10-01 | 2015-01-02 | Aptalis Pharma Limited | Enteriäśki obložene pankrelipazne formulacije niske jakosti |
| MX2013008946A (es) * | 2011-02-03 | 2013-10-25 | Lupin Ltd | Composiciones farmaceuticas orales de bepotastina de liberacion controlada. |
| HUE026560T2 (hu) | 2011-08-08 | 2016-06-28 | Allergan Pharmaceuticals Int Ltd | Eljárás emésztõ enzimeket tartalmazó szilárd készítmények feloldódási viselkedésének vizsgálatára |
| US9512096B2 (en) | 2011-12-22 | 2016-12-06 | Knopp Biosciences, LLP | Synthesis of amine substituted 4,5,6,7-tetrahydrobenzothiazole compounds |
| US9662313B2 (en) | 2013-02-28 | 2017-05-30 | Knopp Biosciences Llc | Compositions and methods for treating amyotrophic lateral sclerosis in responders |
| GB201309967D0 (en) * | 2013-06-04 | 2013-07-17 | Cambridge Entpr Ltd | Therapeutic combinations |
| US10154971B2 (en) | 2013-06-17 | 2018-12-18 | Adamas Pharma, Llc | Methods of administering amantadine |
| WO2015006708A1 (en) | 2013-07-12 | 2015-01-15 | Knopp Biosciences Llc | Treating elevated levels of eosinophils and/or basophils |
| US9468630B2 (en) | 2013-07-12 | 2016-10-18 | Knopp Biosciences Llc | Compositions and methods for treating conditions related to increased eosinophils |
| JP2016537387A (ja) | 2013-08-09 | 2016-12-01 | アラガン ファーマシューティカルズ インターナショナル リミテッド | 経腸投与に適した消化酵素組成物 |
| CA2919892C (en) | 2013-08-12 | 2019-06-18 | Pharmaceutical Manufacturing Research Services, Inc. | Extruded immediate release abuse deterrent pill |
| ES2871556T3 (es) | 2013-08-13 | 2021-10-29 | Knopp Biosciences Llc | Composiciones y métodos para el tratamiento de la urticaria crónica |
| EP3038467B1 (en) | 2013-08-13 | 2020-07-29 | Knopp Biosciences LLC | Compositions and methods for treating plasma cell disorders and b-cell prolymphocytic disorders |
| US9492444B2 (en) | 2013-12-17 | 2016-11-15 | Pharmaceutical Manufacturing Research Services, Inc. | Extruded extended release abuse deterrent pill |
| WO2015095391A1 (en) | 2013-12-17 | 2015-06-25 | Pharmaceutical Manufacturing Research Services, Inc. | Extruded extended release abuse deterrent pill |
| EP3157568A1 (en) | 2014-06-19 | 2017-04-26 | Aptalis Pharma Limited | Methods for removing viral contaminants from pancreatic extracts |
| DK3169315T3 (da) | 2014-07-17 | 2020-08-10 | Pharmaceutical Manufacturing Res Services In | Væskefyldt doseringsform til forhindring af misbrug med øjeblikkelig frigivelse |
| JOP20200195A1 (ar) | 2014-09-08 | 2017-06-16 | Sage Therapeutics Inc | سترويدات وتركيبات نشطة عصبياً، واستخداماتها |
| US10729685B2 (en) * | 2014-09-15 | 2020-08-04 | Ohemo Life Sciences Inc. | Orally administrable compositions and methods of deterring abuse by intranasal administration |
| JP2017531026A (ja) | 2014-10-20 | 2017-10-19 | ファーマシューティカル マニュファクチュアリング リサーチ サービシズ，インコーポレーテッド | 徐放性乱用抑止性液体充填剤形 |
| AU2016317092A1 (en) * | 2015-09-01 | 2018-04-26 | Wellesley Pharmaceuticals, Llc | Extended, delayed and immediate release formulation method of manufacturing and use thereof |
| US11464756B1 (en) | 2017-05-19 | 2022-10-11 | Jerry Darm | Mecuna pruriens, L-DOPA and 5-HTP based dietary supplements, pharmaceutical formulations and uses thereof |
| CA3064006C (en) | 2017-05-19 | 2025-09-16 | Biscayne Neurotherapeutics, Inc. | Modified-Release Pharmaceutical Compositions of Huperzine and Their Methods of Use |
| IL272834B2 (en) | 2017-08-24 | 2024-08-01 | Adamas Pharma Llc | Amantadine compositions, preparations thereof, and methods of use |
| EP4541419A3 (en) * | 2018-11-19 | 2025-05-07 | Supernus Pharmaceuticals, Inc. | Use of higher doses of modified release huperzine formulations |
| CN109503403B (zh) * | 2018-12-21 | 2021-11-16 | 卓和药业集团股份有限公司 | 一种普瑞巴林的拆分方法 |
| JP2022515528A (ja) * | 2018-12-28 | 2022-02-18 | パンダ コンサルティング エルエルシー | 短時間作用型選択的糖質コルチコイド受容体モジュレーター |
Family Cites Families (103)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US466705A (en) * | 1892-01-05 | Machine for making metal washers | ||
| US4069307A (en) * | 1970-10-01 | 1978-01-17 | Alza Corporation | Drug-delivery device comprising certain polymeric materials for controlled release of drug |
| US3948254A (en) * | 1971-11-08 | 1976-04-06 | Alza Corporation | Novel drug delivery device |
| US4135514A (en) * | 1974-12-23 | 1979-01-23 | Alza Corporation | Osmotic releasing system for administering ophthalmic drug to eye of animal |
| GB1561204A (en) * | 1977-06-01 | 1980-02-13 | Ici Ltd | Sustained release pharmaceutical composition |
| US4322311A (en) * | 1978-08-04 | 1982-03-30 | Damon Corporation | Process for producing controlled porosity microcapsules |
| US4264573A (en) * | 1979-05-21 | 1981-04-28 | Rowell Laboratories, Inc. | Pharmaceutical formulation for slow release via controlled surface erosion |
| US4249531A (en) * | 1979-07-05 | 1981-02-10 | Alza Corporation | Bioerodible system for delivering drug manufactured from poly(carboxylic acid) |
| US4252786A (en) * | 1979-11-16 | 1981-02-24 | E. R. Squibb & Sons, Inc. | Controlled release tablet |
| US4367741A (en) * | 1980-12-22 | 1983-01-11 | Alza Corporation | Dispenser powered by cross-linked hydrophilic polymer grafted to hydrophilic polymer |
| US4740198A (en) * | 1981-10-09 | 1988-04-26 | Alza Corporation | Method of administering intravenous drug using rate-controlled dosage form |
| US4428926A (en) * | 1981-12-18 | 1984-01-31 | Key Pharmaceuticals, Inc. | Sustained release propranolol system |
| US4428925A (en) * | 1981-12-18 | 1984-01-31 | Key Pharmaceuticals, Inc. | Sustained release glycerol trinitrate |
| US4649043A (en) * | 1982-03-22 | 1987-03-10 | Alza Corporation | Drug delivery system for delivering a plurality of tiny pills in the gastrointestinal tract |
| US4508702A (en) * | 1982-06-14 | 1985-04-02 | Key Pharmaceuticals, Inc. | Sustained release aspirin |
| US4634587A (en) * | 1982-07-09 | 1987-01-06 | Key Pharmaceuticals, Inc. | Sustained release quinidine dosage form |
| US4432965A (en) * | 1982-07-09 | 1984-02-21 | Key Pharmaceuticals, Inc. | Quinidine sustained release dosage formulation |
| US4503031A (en) * | 1982-12-17 | 1985-03-05 | Glassman Jacob A | Super-fast-starting-sustained release tablet |
| US4571333A (en) * | 1983-06-14 | 1986-02-18 | Syntex (U.S.A.) Inc. | Controlled release naproxen and naproxen sodium tablets |
| US4505890A (en) * | 1983-06-30 | 1985-03-19 | E. R. Squibb & Sons, Inc. | Controlled release formulation and method |
| US4795327A (en) * | 1984-03-26 | 1989-01-03 | Forest Laboratories, Inc. | Controlled release solid drug dosage forms based on mixtures of water soluble nonionic cellulose ethers and anionic surfactants |
| SE8404467D0 (sv) * | 1984-09-06 | 1984-09-06 | Ferrosan Ab | Controlled-release medical preparations |
| US4734285A (en) * | 1985-10-28 | 1988-03-29 | The Dow Chemical Company | Sustained release compositions |
| US4892742A (en) * | 1985-11-18 | 1990-01-09 | Hoffmann-La Roche Inc. | Controlled release compositions with zero order release |
| IL78017A (en) * | 1986-03-03 | 1989-06-30 | Yissum Res Dev Co | Sustained release tablets of theophylline |
| US4795642A (en) * | 1986-05-01 | 1989-01-03 | Pharmacaps, Inc. | Gelatin-encapsulated controlled-release composition |
| US4983400A (en) * | 1986-06-16 | 1991-01-08 | Merck & Co., Inc. | Controlled release combination of carbidopa/levodopa |
| US4798725A (en) * | 1986-06-16 | 1989-01-17 | Norwich Eaton Pharmaceuticals, Inc. | Sustained release capsule |
| ZA889189B (en) * | 1986-06-16 | 1989-08-30 | Merck & Co Inc | Controlled release combination of carbidopa/levodopa |
| GB8616669D0 (en) * | 1986-07-09 | 1986-08-13 | Merk Sharpe & Dohme Ltd | Pharmaceutical compositions |
| US5624683A (en) * | 1986-08-06 | 1997-04-29 | Eisai Co., Ltd. | Sustained-release multi-granule tablet |
| US4816262A (en) * | 1986-08-28 | 1989-03-28 | Universite De Montreal | Controlled release tablet |
| US4803076A (en) * | 1986-09-04 | 1989-02-07 | Pfizer Inc. | Controlled release device for an active substance |
| US4800083A (en) * | 1986-10-20 | 1989-01-24 | R. P. Scherer Corporation | Sustained release method and product |
| US4822619A (en) * | 1987-02-18 | 1989-04-18 | Ionor, Inc. | Controlled release pharmaceutical preparation containing a gastrointestinal irritant drug |
| US4806359A (en) * | 1987-04-22 | 1989-02-21 | Mcneilab, Inc. | Iburprofen sustained release matrix and process |
| US5200193A (en) * | 1987-04-22 | 1993-04-06 | Mcneilab, Inc. | Pharmaceutical sustained release matrix and process |
| US5004613A (en) * | 1987-07-27 | 1991-04-02 | Mcneil-Ppc, Inc. | Oral sustained release pharmaceutical formulation and process |
| US4820522A (en) * | 1987-07-27 | 1989-04-11 | Mcneilab, Inc. | Oral sustained release acetaminophen formulation and process |
| US4983398A (en) * | 1987-12-21 | 1991-01-08 | Forest Laboratories, Inc. | Sustained release drug dosage forms containing hydroxypropylmethylcellulose and alkali metal carboxylates |
| US4996060A (en) * | 1988-03-25 | 1991-02-26 | Alza Corporation | Device comprising liner for protecting fluid sensitive medicament |
| IE60383B1 (en) * | 1988-05-27 | 1994-07-13 | Elan Corp Plc | Controlled release pharmaceutical formulation |
| GB8813064D0 (en) * | 1988-06-02 | 1988-07-06 | Euro Celtique Sa | Controlled release dosage forms having defined water content |
| US4938763B1 (en) * | 1988-10-03 | 1995-07-04 | Atrix Lab Inc | Biodegradable in-situ forming implants and method of producing the same |
| US5186930A (en) * | 1988-11-14 | 1993-02-16 | Schering Corporation | Sustained release oral suspensions |
| US5034229A (en) * | 1988-12-13 | 1991-07-23 | Alza Corporation | Dispenser for increasing feed conversion of hog |
| EP0386440B1 (de) * | 1989-02-11 | 1992-08-05 | Bayer Ag | Arzneimittel mit kontrollierter Wirkstoffabgabe |
| US5007790A (en) * | 1989-04-11 | 1991-04-16 | Depomed Systems, Inc. | Sustained-release oral drug dosage form |
| US5085865A (en) * | 1989-04-12 | 1992-02-04 | Warner-Lambert Company | Sustained release pharmaceutical preparations containing an analgesic and a decongestant |
| US4983401A (en) * | 1989-05-22 | 1991-01-08 | Kinaform Technology, Inc. | Sustained release pharmaceutical preparations having pH controlled membrane coatings |
| US5002774A (en) * | 1989-06-08 | 1991-03-26 | Erbamont, Inc. | Sustained release pharmaceutical tablet |
| US5324519A (en) * | 1989-07-24 | 1994-06-28 | Atrix Laboratories, Inc. | Biodegradable polymer composition |
| US5487897A (en) * | 1989-07-24 | 1996-01-30 | Atrix Laboratories, Inc. | Biodegradable implant precursor |
| EP0418596A3 (en) * | 1989-09-21 | 1991-10-23 | American Cyanamid Company | Controlled release pharmaceutical compositions from spherical granules in tabletted oral dosage unit form |
| US5009895A (en) * | 1990-02-02 | 1991-04-23 | Merck & Co., Inc. | Sustained release with high and low viscosity HPMC |
| KR930006431B1 (ko) * | 1990-10-11 | 1993-07-16 | 재단법인 한국화학연구소 | 약물의 미세캡슐화 방법 |
| US5603956A (en) * | 1990-11-27 | 1997-02-18 | Labopharm Inc. | Cross-linked enzymatically controlled drug release |
| US5861166A (en) * | 1991-03-12 | 1999-01-19 | Alza Corporation | Delivery device providing beneficial agent stability |
| AU650113B2 (en) * | 1991-04-05 | 1994-06-09 | Eli Lilly And Company | Sustained release capsule and formulations |
| DE69226950T2 (de) * | 1991-04-08 | 1999-05-12 | Nippon Shinyaku Co., Ltd., Kyoto | Kapsel mit Langzeitwirkung fuer die Adhäsion im Gastrointestinaltrakt |
| EP0664118B1 (en) * | 1991-10-04 | 1999-08-25 | Yoshitomi Pharmaceutical Industries, Ltd. | Sustained-release tablet |
| US5492700A (en) * | 1991-11-26 | 1996-02-20 | Warner-Lambert Company | Process and composition for the development of controlled release gemfibrozil dosage form |
| US5407686A (en) * | 1991-11-27 | 1995-04-18 | Sidmak Laboratories, Inc. | Sustained release composition for oral administration of active ingredient |
| US5543154A (en) * | 1991-12-27 | 1996-08-06 | Merck & Co., Inc. | Controlled release nifedipine delivery device |
| US5292534A (en) * | 1992-03-25 | 1994-03-08 | Valentine Enterprises, Inc. | Sustained release composition and method utilizing xanthan gum and an active ingredient |
| US5292533A (en) * | 1992-03-27 | 1994-03-08 | Micro Flo Co. | Controlled release microcapsules |
| US5512293A (en) * | 1992-07-23 | 1996-04-30 | Alza Corporation | Oral sustained release drug delivery device |
| SE9301057L (sv) * | 1993-03-30 | 1994-10-01 | Pharmacia Ab | Beredning med kontrollerad frisättning |
| DE4329794C2 (de) * | 1993-09-03 | 1997-09-18 | Gruenenthal Gmbh | Tramadolsalz enthaltende Arzneimittel mit verzögerter Wirkstofffreisetzung |
| US5455046A (en) * | 1993-09-09 | 1995-10-03 | Edward Mendell Co., Inc. | Sustained release heterodisperse hydrogel systems for insoluble drugs |
| US5397574A (en) * | 1993-10-04 | 1995-03-14 | Andrx Pharmaceuticals, Inc. | Controlled release potassium dosage form |
| US5484607A (en) * | 1993-10-13 | 1996-01-16 | Horacek; H. Joseph | Extended release clonidine formulation |
| US5500227A (en) * | 1993-11-23 | 1996-03-19 | Euro-Celtique, S.A. | Immediate release tablet cores of insoluble drugs having sustained-release coating |
| US5393765A (en) * | 1993-12-13 | 1995-02-28 | Hoffmann-La Roche Inc. | Pharmaceutical compositions with constant erosion volume for zero order controlled release |
| EP0747348A4 (en) * | 1994-02-22 | 1999-07-07 | Asahi Chemical Ind | AMINOALKYLCYCLOPROPAN DERIVATIVES |
| DE4408326A1 (de) * | 1994-03-11 | 1995-09-14 | Hexal Pharma Gmbh | Retardtablette mit einem Gehalt an Diclofenac-Na |
| WO1997006792A1 (en) * | 1995-08-16 | 1997-02-27 | Eli Lilly And Company | Potentiation of serotonin response |
| DE19531684A1 (de) * | 1995-08-29 | 1997-03-06 | Bayer Ag | Verfahren zur Herstellung von Arzneimittelzubereitungen mit kontrollierter Freisetzung |
| US5736152A (en) * | 1995-10-27 | 1998-04-07 | Atrix Laboratories, Inc. | Non-polymeric sustained release delivery system |
| US5705190A (en) * | 1995-12-19 | 1998-01-06 | Abbott Laboratories | Controlled release formulation for poorly soluble basic drugs |
| CA2173818A1 (fr) * | 1996-04-10 | 1997-10-11 | Francois Chouinard | Comprime pharmaceutique a liberation controlee contenant un support a base d'amylose reticule et d'hydroxypropylmethylcellulose |
| US5958429A (en) * | 1996-08-16 | 1999-09-28 | Eli Lilly And Company | Potentiation of serotonin response |
| FR2752732B1 (fr) * | 1996-08-28 | 1998-11-20 | Pf Medicament | Forme galenique a liberation prolongee de milnacipran |
| US5879707A (en) * | 1996-10-30 | 1999-03-09 | Universite De Montreal | Substituted amylose as a matrix for sustained drug release |
| IT1289160B1 (it) * | 1997-01-08 | 1998-09-29 | Jagotec Ag | Compressa farmaceutica completamente rivestita per il rilascio controllato di principi attivi che presentano problemi di |
| EP0951279A1 (en) * | 1997-01-10 | 1999-10-27 | Abbott Laboratories | Tablet for the controlled release of active agents |
| US6010718A (en) * | 1997-04-11 | 2000-01-04 | Abbott Laboratories | Extended release formulations of erythromycin derivatives |
| US6030641A (en) * | 1997-06-03 | 2000-02-29 | Uni Colloid Kabushiki Kaisha | Sustained release capsule and method for preparing the same |
| US6197339B1 (en) * | 1997-09-30 | 2001-03-06 | Pharmacia & Upjohn Company | Sustained release tablet formulation to treat Parkinson's disease |
| AU9692898A (en) * | 1997-10-17 | 1999-05-10 | Eli Lilly And Company | Potentiation of pharmaceuticals |
| US6337091B1 (en) * | 1997-10-27 | 2002-01-08 | Temple University - Of The Commonwealth System Of Higher Education | Matrix for controlled delivery of highly soluble pharmaceutical agents |
| CA2321924A1 (en) * | 1998-02-25 | 1999-09-02 | Abbott Laboratories | Butorphanol sustained release formulations |
| AU3891299A (en) * | 1998-05-21 | 1999-12-06 | Eli Lilly And Company | Combination therapy for treatment of depression |
| US6174547B1 (en) * | 1999-07-14 | 2001-01-16 | Alza Corporation | Dosage form comprising liquid formulation |
| US6033686A (en) * | 1998-10-30 | 2000-03-07 | Pharma Pass Llc | Controlled release tablet of bupropion hydrochloride |
| US6342249B1 (en) * | 1998-12-23 | 2002-01-29 | Alza Corporation | Controlled release liquid active agent formulation dosage forms |
| AU1998200A (en) * | 1999-01-07 | 2000-07-24 | Elan Corporation, Plc | Multiparticulate oral dosage forms |
| US6340476B1 (en) * | 1999-04-06 | 2002-01-22 | Armaquest, Inc. | Pharmaceutical dosage form for pulsatile delivery of methylphenidate |
| US20020028240A1 (en) * | 2000-04-17 | 2002-03-07 | Toyohiro Sawada | Timed-release compression-coated solid composition for oral administration |
| JP3563070B2 (ja) * | 2000-07-17 | 2004-09-08 | 山之内製薬株式会社 | 経口吸収改善医薬組成物 |
| JP3797605B2 (ja) * | 2002-03-20 | 2006-07-19 | 旭化成ファーマ株式会社 | 粒状被覆製剤の製造方法 |
| EP1556024A4 (en) * | 2002-10-25 | 2007-01-17 | Collegium Pharmaceutical Inc | INTERMITTENT LIBERATION COMPOSITIONS OF MILNACIPRANE |
| US20040228830A1 (en) * | 2003-01-28 | 2004-11-18 | Collegium Pharmaceutical, Inc. | Multiparticulate compositions of milnacipran for oral administration |
-
2003
- 2003-10-22 US US10/690,947 patent/US20040132826A1/en not_active Abandoned
- 2003-10-22 US US10/690,872 patent/US20040121010A1/en not_active Abandoned
- 2003-10-23 AU AU2003301671A patent/AU2003301671C1/en not_active Ceased
- 2003-10-23 WO PCT/US2003/033492 patent/WO2004037190A2/en not_active Ceased
- 2003-10-23 CA CA2503201A patent/CA2503201C/en not_active Expired - Fee Related
- 2003-10-23 US US10/691,936 patent/US20040122104A1/en not_active Abandoned
- 2003-10-23 MX MXPA05004395A patent/MXPA05004395A/es active IP Right Grant
- 2003-10-23 EP EP03809613A patent/EP1578403A4/en not_active Withdrawn
- 2003-10-23 JP JP2005501653A patent/JP2006503918A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| MXPA05004395A (es) | 2006-02-10 |
| CA2503201A1 (en) | 2004-05-06 |
| US20040121010A1 (en) | 2004-06-24 |
| EP1578403A2 (en) | 2005-09-28 |
| JP2006503918A (ja) | 2006-02-02 |
| WO2004037190A3 (en) | 2004-07-15 |
| AU2003301671B2 (en) | 2006-02-09 |
| WO2004037190A2 (en) | 2004-05-06 |
| US20040122104A1 (en) | 2004-06-24 |
| US20040132826A1 (en) | 2004-07-08 |
| AU2003301671C1 (en) | 2006-08-17 |
| EP1578403A4 (en) | 2007-01-03 |
| AU2003301671A1 (en) | 2004-05-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2503201C (en) | Modified release compositions of milnacipran | |
| US7704527B2 (en) | Modified release compositions of milnacipran | |
| EP1833467B1 (en) | Pharmaceutical compositions for sleep disorders | |
| JP2006503918A5 (enExample) | ||
| AU2004207578B2 (en) | Multiparticulate compositions of milnacipran for oral administration | |
| AU2003301762B2 (en) | Pulsatile release compositions of milnacipran | |
| CA2700733A1 (en) | Bupropion hydrobromide and therapeutic applications | |
| US20060024366A1 (en) | Modified release compositions of milnacipran | |
| US20140023710A1 (en) | Milnacipran formulations | |
| US20060003004A1 (en) | Pulsatile release compositions of milnacipran | |
| CA2710838A1 (en) | Pharmaceutical compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed |
Effective date: 20141023 |