CA2244189A1 - Thiazolylbenzofuran derivatives and pharmaceutical compositions containing them - Google Patents
Thiazolylbenzofuran derivatives and pharmaceutical compositions containing them Download PDFInfo
- Publication number
- CA2244189A1 CA2244189A1 CA002244189A CA2244189A CA2244189A1 CA 2244189 A1 CA2244189 A1 CA 2244189A1 CA 002244189 A CA002244189 A CA 002244189A CA 2244189 A CA2244189 A CA 2244189A CA 2244189 A1 CA2244189 A1 CA 2244189A1
- Authority
- CA
- Canada
- Prior art keywords
- substituted
- compound
- salt
- carboxy
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 5
- IQDNFLQNJPENQU-UHFFFAOYSA-N 2-(1-benzofuran-2-yl)-1,3-thiazole Chemical class C1=CSC(C=2OC3=CC=CC=C3C=2)=N1 IQDNFLQNJPENQU-UHFFFAOYSA-N 0.000 title abstract description 8
- 150000003839 salts Chemical class 0.000 claims abstract description 179
- -1 carboxy, carboxy Chemical group 0.000 claims abstract description 165
- 125000003118 aryl group Chemical group 0.000 claims abstract description 123
- 125000001424 substituent group Chemical group 0.000 claims abstract description 98
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 94
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 93
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 79
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 39
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 30
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 22
- 125000004043 oxo group Chemical group O=* 0.000 claims abstract description 17
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 claims abstract description 13
- 150000001875 compounds Chemical class 0.000 claims description 278
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 158
- 238000006243 chemical reaction Methods 0.000 claims description 117
- 238000000034 method Methods 0.000 claims description 58
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 36
- 125000002252 acyl group Chemical group 0.000 claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims description 25
- 239000001257 hydrogen Substances 0.000 claims description 24
- 229910052736 halogen Inorganic materials 0.000 claims description 23
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 22
- 150000002367 halogens Chemical class 0.000 claims description 17
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 17
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 16
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 15
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 6
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 6
- 125000005842 heteroatom Chemical group 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 230000002265 prevention Effects 0.000 claims description 6
- 241000282414 Homo sapiens Species 0.000 claims description 5
- 206010020751 Hypersensitivity Diseases 0.000 claims description 5
- 206010061218 Inflammation Diseases 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 208000026935 allergic disease Diseases 0.000 claims description 5
- 230000007815 allergy Effects 0.000 claims description 5
- 238000007257 deesterification reaction Methods 0.000 claims description 5
- 230000004054 inflammatory process Effects 0.000 claims description 5
- 241001465754 Metazoa Species 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 4
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 4
- 238000006114 decarboxylation reaction Methods 0.000 claims description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 4
- 230000001225 therapeutic effect Effects 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 230000001590 oxidative effect Effects 0.000 claims description 3
- 229920002554 vinyl polymer Polymers 0.000 claims description 3
- 125000003341 7 membered heterocyclic group Chemical group 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims description 2
- 238000006264 debenzylation reaction Methods 0.000 claims description 2
- 230000002140 halogenating effect Effects 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 238000007363 ring formation reaction Methods 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 6
- 238000004519 manufacturing process Methods 0.000 claims 2
- 230000032050 esterification Effects 0.000 claims 1
- 238000005886 esterification reaction Methods 0.000 claims 1
- 230000022244 formylation Effects 0.000 claims 1
- 238000006170 formylation reaction Methods 0.000 claims 1
- 231100000252 nontoxic Toxicity 0.000 claims 1
- 230000003000 nontoxic effect Effects 0.000 claims 1
- 239000005557 antagonist Substances 0.000 abstract description 4
- 230000000694 effects Effects 0.000 abstract description 4
- 239000003112 inhibitor Substances 0.000 abstract description 4
- 150000002617 leukotrienes Chemical class 0.000 abstract description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 378
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 359
- 239000000203 mixture Substances 0.000 description 254
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 216
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 160
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 142
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 130
- 229940093499 ethyl acetate Drugs 0.000 description 126
- 235000019439 ethyl acetate Nutrition 0.000 description 126
- 239000000243 solution Substances 0.000 description 115
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 111
- 101150041968 CDC13 gene Proteins 0.000 description 105
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 102
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 98
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 91
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 90
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 85
- 239000012267 brine Substances 0.000 description 66
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 66
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 65
- 235000019341 magnesium sulphate Nutrition 0.000 description 65
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 64
- 125000004533 benzofuran-5-yl group Chemical group O1C=CC2=C1C=CC(=C2)* 0.000 description 63
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 58
- 239000000741 silica gel Substances 0.000 description 57
- 229910002027 silica gel Inorganic materials 0.000 description 57
- 239000002904 solvent Substances 0.000 description 54
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 52
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 51
- 238000001816 cooling Methods 0.000 description 48
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 47
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 45
- 239000012044 organic layer Substances 0.000 description 45
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 45
- 238000004440 column chromatography Methods 0.000 description 42
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 40
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 36
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 34
- 238000001914 filtration Methods 0.000 description 32
- 238000002360 preparation method Methods 0.000 description 31
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 28
- 239000002244 precipitate Substances 0.000 description 28
- 238000010992 reflux Methods 0.000 description 28
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 27
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 27
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 26
- 239000012046 mixed solvent Substances 0.000 description 26
- 239000011541 reaction mixture Substances 0.000 description 25
- 239000002253 acid Substances 0.000 description 23
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 23
- 235000017557 sodium bicarbonate Nutrition 0.000 description 23
- 239000003054 catalyst Substances 0.000 description 22
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 22
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 21
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 230000002411 adverse Effects 0.000 description 21
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 21
- 239000006188 syrup Substances 0.000 description 20
- 235000020357 syrup Nutrition 0.000 description 20
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 19
- 239000000706 filtrate Substances 0.000 description 19
- 239000005457 ice water Substances 0.000 description 18
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 18
- 238000006722 reduction reaction Methods 0.000 description 18
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 17
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 16
- 239000003960 organic solvent Substances 0.000 description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 15
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 14
- 238000010792 warming Methods 0.000 description 14
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 13
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 13
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 13
- CHIFTAQVXHNVRW-UHFFFAOYSA-N 1h-indole-3-carbonitrile Chemical compound C1=CC=C2C(C#N)=CNC2=C1 CHIFTAQVXHNVRW-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 12
- 239000002585 base Substances 0.000 description 12
- 239000003638 chemical reducing agent Substances 0.000 description 12
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 11
- 125000004244 benzofuran-2-yl group Chemical group [H]C1=C(*)OC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 11
- 238000000921 elemental analysis Methods 0.000 description 11
- 229910000027 potassium carbonate Inorganic materials 0.000 description 11
- 235000011181 potassium carbonates Nutrition 0.000 description 11
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Substances C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 10
- 239000010410 layer Substances 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 9
- 235000011054 acetic acid Nutrition 0.000 description 9
- 238000010531 catalytic reduction reaction Methods 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- 239000012312 sodium hydride Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 8
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 8
- 229910052783 alkali metal Inorganic materials 0.000 description 8
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 8
- 125000005605 benzo group Chemical group 0.000 description 8
- 239000012043 crude product Substances 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 8
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 7
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 7
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- JBOPQACSHPPKEP-UHFFFAOYSA-N indoxyl acetate Natural products C1=CC=C2C(OC(=O)C)=CNC2=C1 JBOPQACSHPPKEP-UHFFFAOYSA-N 0.000 description 7
- 229910052697 platinum Inorganic materials 0.000 description 7
- 239000008096 xylene Substances 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 6
- 229910017052 cobalt Inorganic materials 0.000 description 6
- 239000010941 cobalt Substances 0.000 description 6
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 6
- 229910052802 copper Inorganic materials 0.000 description 6
- 239000010949 copper Substances 0.000 description 6
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 6
- 150000002148 esters Chemical group 0.000 description 6
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 150000007522 mineralic acids Chemical class 0.000 description 6
- 150000007530 organic bases Chemical class 0.000 description 6
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 150000007529 inorganic bases Chemical class 0.000 description 5
- 229910052742 iron Inorganic materials 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 229910052744 lithium Inorganic materials 0.000 description 5
- 239000011777 magnesium Substances 0.000 description 5
- 229910052749 magnesium Inorganic materials 0.000 description 5
- 239000012528 membrane Substances 0.000 description 5
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 5
- 239000002480 mineral oil Substances 0.000 description 5
- 235000010446 mineral oil Nutrition 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 125000004430 oxygen atom Chemical group O* 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical class CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 5
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 5
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 4
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 4
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 201000004624 Dermatitis Diseases 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 4
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 4
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- 239000003617 indole-3-acetic acid Substances 0.000 description 4
- OLNJUISKUQQNIM-UHFFFAOYSA-N indole-3-carbaldehyde Chemical compound C1=CC=C2C(C=O)=CNC2=C1 OLNJUISKUQQNIM-UHFFFAOYSA-N 0.000 description 4
- 125000002757 morpholinyl group Chemical group 0.000 description 4
- 150000007524 organic acids Chemical class 0.000 description 4
- 239000008188 pellet Substances 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 229960003975 potassium Drugs 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 125000004434 sulfur atom Chemical group 0.000 description 4
- 239000001117 sulphuric acid Substances 0.000 description 4
- 235000011149 sulphuric acid Nutrition 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 3
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- YXRUWYWSPZHKLD-UHFFFAOYSA-N 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-carbaldehyde Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(C=O)C=C3C=2)=N1 YXRUWYWSPZHKLD-UHFFFAOYSA-N 0.000 description 3
- IIXUECUXGWXIEH-UHFFFAOYSA-N 2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]ethanethioamide Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CC(N)=S)C=C3C=2)=N1 IIXUECUXGWXIEH-UHFFFAOYSA-N 0.000 description 3
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- PNZYQVLBRDFJLB-UHFFFAOYSA-N 4-tert-butyl-2-[5-(chloromethyl)-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CCl)C=C3C=2)=N1 PNZYQVLBRDFJLB-UHFFFAOYSA-N 0.000 description 3
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 150000001342 alkaline earth metals Chemical class 0.000 description 3
- 150000003973 alkyl amines Chemical class 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 3
- 208000003455 anaphylaxis Diseases 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- RDXPZTSGKLBEAS-UHFFFAOYSA-N benzyl 1-[2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]-2-oxoethyl]indole-3-carboxylate Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(C=C3C=2)C(=O)CN2C3=CC=CC=C3C(C(=O)OCC=3C=CC=CC=3)=C2)=N1 RDXPZTSGKLBEAS-UHFFFAOYSA-N 0.000 description 3
- 230000027455 binding Effects 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- 239000000872 buffer Substances 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 125000001153 fluoro group Chemical group F* 0.000 description 3
- 150000002440 hydroxy compounds Chemical class 0.000 description 3
- KMAKOBLIOCQGJP-UHFFFAOYSA-N indole-3carboxylic acid Natural products C1=CC=C2C(C(=O)O)=CNC2=C1 KMAKOBLIOCQGJP-UHFFFAOYSA-N 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 3
- HYIWXORLIDQVJJ-UHFFFAOYSA-N methyl 2-[1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-hydroxyindol-3-yl]acetate Chemical compound C12=CC=C(O)C=C2C(CC(=O)OC)=CN1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 HYIWXORLIDQVJJ-UHFFFAOYSA-N 0.000 description 3
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 3
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- HBEQXAKJSGXAIQ-UHFFFAOYSA-N oxopalladium Chemical compound [Pd]=O HBEQXAKJSGXAIQ-UHFFFAOYSA-N 0.000 description 3
- 229910003445 palladium oxide Inorganic materials 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 3
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 3
- FYZFXZPJLBELHP-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-(chloromethyl)indole-3-carbonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=C(CCl)C=C5C(C#N)=C4)C=C3C=2)=N1 FYZFXZPJLBELHP-UHFFFAOYSA-N 0.000 description 2
- XJMJNFGRXPRBBF-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-hydroxyindole-3-carbonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=C(O)C=C5C(C#N)=C4)C=C3C=2)=N1 XJMJNFGRXPRBBF-UHFFFAOYSA-N 0.000 description 2
- YHHRYDNMCQETKY-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-phenylmethoxyindazole-3-carboxamide Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=C(OCC=6C=CC=CC=6)C=C5C(C(N)=O)=N4)C=C3C=2)=N1 YHHRYDNMCQETKY-UHFFFAOYSA-N 0.000 description 2
- GTWXSZIQNTUNKR-UHFFFAOYSA-N 1-benzofuran-5-carboxylic acid Chemical compound OC(=O)C1=CC=C2OC=CC2=C1 GTWXSZIQNTUNKR-UHFFFAOYSA-N 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- IUNJCFABHJZSKB-UHFFFAOYSA-N 2,4-dihydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C(O)=C1 IUNJCFABHJZSKB-UHFFFAOYSA-N 0.000 description 2
- CLFRCXCBWIQVRN-UHFFFAOYSA-N 2,5-dihydroxybenzaldehyde Chemical compound OC1=CC=C(O)C(C=O)=C1 CLFRCXCBWIQVRN-UHFFFAOYSA-N 0.000 description 2
- FWSXVUZYZVPTIF-UHFFFAOYSA-N 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 FWSXVUZYZVPTIF-UHFFFAOYSA-N 0.000 description 2
- SGFPDPXIKAXHMB-UHFFFAOYSA-N 2-[1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-3-(2-methoxy-2-oxoethyl)indol-5-yl]oxyacetic acid Chemical compound C12=CC=C(OCC(O)=O)C=C2C(CC(=O)OC)=CN1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 SGFPDPXIKAXHMB-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- WDPGBJCCQYPBPV-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-1,3-thiazol-4-yl]acetonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CC=4SC=C(CC#N)N=4)C=C3C=2)=N1 WDPGBJCCQYPBPV-UHFFFAOYSA-N 0.000 description 2
- YUSAKOCVXOACJC-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]-6-methoxyphenoxy]propanoic acid Chemical compound COC1=CC=CC(COC=2C=C3C=C(OC3=CC=2)C=2SC=C(N=2)C(C)(C)C)=C1OC(C)C(O)=O YUSAKOCVXOACJC-UHFFFAOYSA-N 0.000 description 2
- KTZLYDQZTBNXRZ-UHFFFAOYSA-N 2-[[5-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]tetrazol-1-yl]methyl]benzoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(C=C3C=2)C=2N(N=NN=2)CC=2C(=CC=CC=2)C(O)=O)=N1 KTZLYDQZTBNXRZ-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- KSDYHMZGZUMJIM-UHFFFAOYSA-N 4-[4-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]-3-methoxyphenoxy]butanoic acid Chemical compound COC1=CC(OCCCC(O)=O)=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 KSDYHMZGZUMJIM-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- WSQPASLBENXMCE-UHFFFAOYSA-N 4-tert-butyl-2-[5-(2h-tetrazol-5-yl)-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(C=C3C=2)C=2NN=NN=2)=N1 WSQPASLBENXMCE-UHFFFAOYSA-N 0.000 description 2
- YDNPCCDKZKSDGM-UHFFFAOYSA-N 4-tert-butyl-2-[5-(3-chloropropyl)-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CCCCl)C=C3C=2)=N1 YDNPCCDKZKSDGM-UHFFFAOYSA-N 0.000 description 2
- JBZKDSMJNITUIW-UHFFFAOYSA-N 5-acetyl-2-hydroxybenzaldehyde Chemical compound CC(=O)C1=CC=C(O)C(C=O)=C1 JBZKDSMJNITUIW-UHFFFAOYSA-N 0.000 description 2
- DCSHNMUQECGXQL-UHFFFAOYSA-N 5-propan-2-yl-1h-indazole-3-carboxylic acid Chemical compound CC(C)C1=CC=C2NN=C(C(O)=O)C2=C1 DCSHNMUQECGXQL-UHFFFAOYSA-N 0.000 description 2
- QXJXPMHKYYMECP-UHFFFAOYSA-N 5-tert-butyl-1h-indole Chemical compound CC(C)(C)C1=CC=C2NC=CC2=C1 QXJXPMHKYYMECP-UHFFFAOYSA-N 0.000 description 2
- FDPUFZBJUZPCRB-UHFFFAOYSA-N 5-tert-butyl-1h-indole-2-carboxylic acid Chemical compound CC(C)(C)C1=CC=C2NC(C(O)=O)=CC2=C1 FDPUFZBJUZPCRB-UHFFFAOYSA-N 0.000 description 2
- OGMHRPVTVFRXGB-UHFFFAOYSA-N 6-methyl-1h-indole-3-carbonitrile Chemical compound CC1=CC=C2C(C#N)=CNC2=C1 OGMHRPVTVFRXGB-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 2
- 206010002199 Anaphylactic shock Diseases 0.000 description 2
- 206010003210 Arteriosclerosis Diseases 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 206010048962 Brain oedema Diseases 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- 208000018152 Cerebral disease Diseases 0.000 description 2
- 229910021555 Chromium Chloride Inorganic materials 0.000 description 2
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 2
- 206010010741 Conjunctivitis Diseases 0.000 description 2
- 206010012438 Dermatitis atopic Diseases 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 208000007882 Gastritis Diseases 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 201000005569 Gout Diseases 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- 206010030216 Oesophagitis Diseases 0.000 description 2
- 206010033645 Pancreatitis Diseases 0.000 description 2
- 208000008469 Peptic Ulcer Diseases 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 201000004681 Psoriasis Diseases 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 2
- 206010040070 Septic Shock Diseases 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 208000007107 Stomach Ulcer Diseases 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- BABDLUPRPGCEIB-UHFFFAOYSA-N [2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl] trifluoromethanesulfonate Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OS(=O)(=O)C(F)(F)F)C=C3C=2)=N1 BABDLUPRPGCEIB-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 208000011341 adult acute respiratory distress syndrome Diseases 0.000 description 2
- 201000000028 adult respiratory distress syndrome Diseases 0.000 description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 208000011775 arteriosclerosis disease Diseases 0.000 description 2
- 206010003246 arthritis Diseases 0.000 description 2
- 208000006673 asthma Diseases 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 201000008937 atopic dermatitis Diseases 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- KOOWICUYCXLLAI-UHFFFAOYSA-N benzyl 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]indazole-3-carboxylate Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=CC=C5C(C(=O)OCC=5C=CC=CC=5)=N4)C=C3C=2)=N1 KOOWICUYCXLLAI-UHFFFAOYSA-N 0.000 description 2
- SEQPSPZFEZDRLX-UHFFFAOYSA-N benzyl 1h-indole-3-carboxylate Chemical compound C=1NC2=CC=CC=C2C=1C(=O)OCC1=CC=CC=C1 SEQPSPZFEZDRLX-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 2
- 208000006752 brain edema Diseases 0.000 description 2
- 206010006451 bronchitis Diseases 0.000 description 2
- 239000001273 butane Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 2
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 239000012024 dehydrating agents Substances 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 2
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 208000006881 esophagitis Diseases 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- CADGHEANOLTJIT-UHFFFAOYSA-N ethyl 2-(2-formyl-6-methoxyphenoxy)propanoate Chemical compound CCOC(=O)C(C)OC1=C(OC)C=CC=C1C=O CADGHEANOLTJIT-UHFFFAOYSA-N 0.000 description 2
- SESVPNSGZKACAB-UHFFFAOYSA-N ethyl 2-[2-(hydroxymethyl)-6-methoxyphenoxy]propanoate Chemical compound CCOC(=O)C(C)OC1=C(CO)C=CC=C1OC SESVPNSGZKACAB-UHFFFAOYSA-N 0.000 description 2
- XBPOBCXHALHJFP-UHFFFAOYSA-N ethyl 4-bromobutanoate Chemical compound CCOC(=O)CCCBr XBPOBCXHALHJFP-UHFFFAOYSA-N 0.000 description 2
- ULMVLLISCAWCMZ-UHFFFAOYSA-N ethyl 5-tert-butyl-1h-indole-2-carboxylate Chemical compound CC(C)(C)C1=CC=C2NC(C(=O)OCC)=CC2=C1 ULMVLLISCAWCMZ-UHFFFAOYSA-N 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 2
- 201000005917 gastric ulcer Diseases 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 208000006454 hepatitis Diseases 0.000 description 2
- 231100000283 hepatitis Toxicity 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 229910000765 intermetallic Inorganic materials 0.000 description 2
- 208000001286 intracranial vasospasm Diseases 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 230000000302 ischemic effect Effects 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Inorganic materials [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- 201000008383 nephritis Diseases 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910000480 nickel oxide Inorganic materials 0.000 description 2
- JJVNINGBHGBWJH-UHFFFAOYSA-N ortho-vanillin Chemical compound COC1=CC=CC(C=O)=C1O JJVNINGBHGBWJH-UHFFFAOYSA-N 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 125000003431 oxalo group Chemical group 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- BSCHIACBONPEOB-UHFFFAOYSA-N oxolane;hydrate Chemical compound O.C1CCOC1 BSCHIACBONPEOB-UHFFFAOYSA-N 0.000 description 2
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 208000011906 peptic ulcer disease Diseases 0.000 description 2
- XCRBXWCUXJNEFX-UHFFFAOYSA-N peroxybenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1 XCRBXWCUXJNEFX-UHFFFAOYSA-N 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000005936 piperidyl group Chemical group 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- WFGGRXYBTCOCHL-UHFFFAOYSA-N propan-2-yl 2-(2-amino-5-phenylmethoxyphenyl)acetate Chemical compound C1=C(N)C(CC(=O)OC(C)C)=CC(OCC=2C=CC=CC=2)=C1 WFGGRXYBTCOCHL-UHFFFAOYSA-N 0.000 description 2
- KGSCHAPVBFJMRR-UHFFFAOYSA-N propan-2-yl 2-(2-nitro-5-phenylmethoxyphenyl)acetate Chemical compound C1=C([N+]([O-])=O)C(CC(=O)OC(C)C)=CC(OCC=2C=CC=CC=2)=C1 KGSCHAPVBFJMRR-UHFFFAOYSA-N 0.000 description 2
- 208000002815 pulmonary hypertension Diseases 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 206010039083 rhinitis Diseases 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 230000036303 septic shock Effects 0.000 description 2
- 230000035939 shock Effects 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- RXHPPLWMQHNURM-UHFFFAOYSA-N tert-butyl 2-(2-formyl-4-hydroxyphenoxy)acetate Chemical compound CC(C)(C)OC(=O)COC1=CC=C(O)C=C1C=O RXHPPLWMQHNURM-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- HNKJADCVZUBCPG-UHFFFAOYSA-N thioanisole Chemical compound CSC1=CC=CC=C1 HNKJADCVZUBCPG-UHFFFAOYSA-N 0.000 description 2
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- 239000011135 tin Substances 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- OGNVQLDIPUXYDH-ZPKKHLQPSA-N (2R,3R,4S)-3-(2-methylpropanoylamino)-4-(4-phenyltriazol-1-yl)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid Chemical compound CC(C)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(O)=O)=C[C@@H]1N1N=NC(C=2C=CC=CC=2)=C1 OGNVQLDIPUXYDH-ZPKKHLQPSA-N 0.000 description 1
- MLIWQXBKMZNZNF-KUHOPJCQSA-N (2e)-2,6-bis[(4-azidophenyl)methylidene]-4-methylcyclohexan-1-one Chemical compound O=C1\C(=C\C=2C=CC(=CC=2)N=[N+]=[N-])CC(C)CC1=CC1=CC=C(N=[N+]=[N-])C=C1 MLIWQXBKMZNZNF-KUHOPJCQSA-N 0.000 description 1
- LMFPPUVGWDZXMB-UHFFFAOYSA-N (4-propan-2-ylphenyl)hydrazine;hydrochloride Chemical compound Cl.CC(C)C1=CC=C(NN)C=C1 LMFPPUVGWDZXMB-UHFFFAOYSA-N 0.000 description 1
- QPKCNTDHLKSHGT-UHFFFAOYSA-N (4-tert-butylphenyl)hydrazine Chemical compound CC(C)(C)C1=CC=C(NN)C=C1 QPKCNTDHLKSHGT-UHFFFAOYSA-N 0.000 description 1
- VTESCYNPUGSWKG-UHFFFAOYSA-N (4-tert-butylphenyl)hydrazine;hydrochloride Chemical compound [Cl-].CC(C)(C)C1=CC=C(N[NH3+])C=C1 VTESCYNPUGSWKG-UHFFFAOYSA-N 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 1
- MAUMSNABMVEOGP-UHFFFAOYSA-N (methyl-$l^{2}-azanyl)methane Chemical compound C[N]C MAUMSNABMVEOGP-UHFFFAOYSA-N 0.000 description 1
- DHBXNPKRAUYBTH-UHFFFAOYSA-N 1,1-ethanedithiol Chemical compound CC(S)S DHBXNPKRAUYBTH-UHFFFAOYSA-N 0.000 description 1
- 125000005952 1,2,4-oxadiazolinyl group Chemical group 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- DMWBXFUFAFAYHQ-UHFFFAOYSA-N 1-[1-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]ethyl]indole-3-carbonitrile Chemical compound C1=C(C#N)C2=CC=CC=C2N1C(C)C(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 DMWBXFUFAFAYHQ-UHFFFAOYSA-N 0.000 description 1
- WKOSJRPOXICRHX-UHFFFAOYSA-N 1-[1-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]propyl]indole-3-carbonitrile Chemical compound C1=C(C#N)C2=CC=CC=C2N1C(CC)C(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 WKOSJRPOXICRHX-UHFFFAOYSA-N 0.000 description 1
- MLCHUSZMXAMOBA-UHFFFAOYSA-N 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]ethanol Chemical compound C=1C2=CC(C(O)C)=CC=C2OC=1C1=NC(C(C)(C)C)=CS1 MLCHUSZMXAMOBA-UHFFFAOYSA-N 0.000 description 1
- IIBGIPMMMQPIKL-UHFFFAOYSA-N 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]ethanone Chemical compound C=1C2=CC(C(=O)C)=CC=C2OC=1C1=NC(C(C)(C)C)=CS1 IIBGIPMMMQPIKL-UHFFFAOYSA-N 0.000 description 1
- SSFUOHOSAQFOLQ-UHFFFAOYSA-N 1-[3-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]propyl]-6-methylindole-3-carbonitrile Chemical compound C12=CC(C)=CC=C2C(C#N)=CN1CCCC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 SSFUOHOSAQFOLQ-UHFFFAOYSA-N 0.000 description 1
- VUHNDHNKHYZNRX-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-(4-ethoxy-4-oxobutoxy)indole-3-carboxylic acid Chemical compound C1=C(C(O)=O)C2=CC(OCCCC(=O)OCC)=CC=C2N1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 VUHNDHNKHYZNRX-UHFFFAOYSA-N 0.000 description 1
- OCKWEEJXGHALRG-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-(hydroxymethyl)indole-3-carbonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=C(CO)C=C5C(C#N)=C4)C=C3C=2)=N1 OCKWEEJXGHALRG-UHFFFAOYSA-N 0.000 description 1
- KWGFQOXTJYIFOR-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-(iodomethyl)indole-3-carbonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=C(CI)C=C5C(C#N)=C4)C=C3C=2)=N1 KWGFQOXTJYIFOR-UHFFFAOYSA-N 0.000 description 1
- AIPYUGPFFAOOBI-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-hydroxyindazole-3-carboxamide Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=C(O)C=C5C(C(N)=O)=N4)C=C3C=2)=N1 AIPYUGPFFAOOBI-UHFFFAOYSA-N 0.000 description 1
- OIHROQMUSQIKRX-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-methoxyindazole-3-carboxylic acid Chemical compound N1=C(C(O)=O)C2=CC(OC)=CC=C2N1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 OIHROQMUSQIKRX-UHFFFAOYSA-N 0.000 description 1
- LBFXQISGAMZVBY-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-phenylmethoxyindole-3-carbonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=C(OCC=6C=CC=CC=6)C=C5C(C#N)=C4)C=C3C=2)=N1 LBFXQISGAMZVBY-UHFFFAOYSA-N 0.000 description 1
- NKHAZOGXMKDAEI-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-propan-2-ylindazole-3-carboxamide Chemical compound N1=C(C(N)=O)C2=CC(C(C)C)=CC=C2N1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 NKHAZOGXMKDAEI-UHFFFAOYSA-N 0.000 description 1
- YANVTZTYJMYLCI-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-7-hydroxyindole-3-carbaldehyde Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=C(O)C=CC=C5C(C=O)=C4)C=C3C=2)=N1 YANVTZTYJMYLCI-UHFFFAOYSA-N 0.000 description 1
- ZDGBMQHZSCJYDX-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-7-phenylmethoxyindole-3-carbaldehyde Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=C(OCC=6C=CC=CC=6)C=CC=C5C(C=O)=C4)C=C3C=2)=N1 ZDGBMQHZSCJYDX-UHFFFAOYSA-N 0.000 description 1
- IAPNTWHXDRKHHC-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]indole-2-carbonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=CC=C5C=C4C#N)C=C3C=2)=N1 IAPNTWHXDRKHHC-UHFFFAOYSA-N 0.000 description 1
- HZUDISGJDUHAPI-UHFFFAOYSA-N 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]indole-2-carboxylic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=CC=C5C=C4C(O)=O)C=C3C=2)=N1 HZUDISGJDUHAPI-UHFFFAOYSA-N 0.000 description 1
- FTGJQLHPQGZRQW-UHFFFAOYSA-N 1-azido-2-[chloro(phenyl)phosphoryl]benzene Chemical compound N(=[N+]=[N-])C1=C(C=CC=C1)P(=O)(C1=CC=CC=C1)Cl FTGJQLHPQGZRQW-UHFFFAOYSA-N 0.000 description 1
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 1
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical compound ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- DEPDDPLQZYCHOH-UHFFFAOYSA-N 1h-imidazol-2-amine Chemical compound NC1=NC=CN1 DEPDDPLQZYCHOH-UHFFFAOYSA-N 0.000 description 1
- DITBWPUMEUDVLU-UHFFFAOYSA-N 1h-indazole-3-carboxamide Chemical compound C1=CC=C2C(C(=O)N)=NNC2=C1 DITBWPUMEUDVLU-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- GWEWXLWLWFDHJO-UHFFFAOYSA-N 2-(2-nitro-5-phenylmethoxyphenyl)acetic acid Chemical compound C1=C([N+]([O-])=O)C(CC(=O)O)=CC(OCC=2C=CC=CC=2)=C1 GWEWXLWLWFDHJO-UHFFFAOYSA-N 0.000 description 1
- MACTXVNQVZOUMX-UHFFFAOYSA-N 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-carbonyl chloride;hydrochloride Chemical compound Cl.CC(C)(C)C1=CSC(C=2OC3=CC=C(C=C3C=2)C(Cl)=O)=N1 MACTXVNQVZOUMX-UHFFFAOYSA-N 0.000 description 1
- UNHPFDQSPRCYEB-UHFFFAOYSA-N 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-carboxylic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(C=C3C=2)C(O)=O)=N1 UNHPFDQSPRCYEB-UHFFFAOYSA-N 0.000 description 1
- GKIOPUYLJUOZHJ-UHFFFAOYSA-N 2-(5-phenylmethoxy-1h-indol-3-yl)acetic acid Chemical compound C1=C2C(CC(=O)O)=CNC2=CC=C1OCC1=CC=CC=C1 GKIOPUYLJUOZHJ-UHFFFAOYSA-N 0.000 description 1
- TVKWECKQHNTPMG-UHFFFAOYSA-N 2-(bromomethyl)-4-tert-butyl-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(CBr)=N1 TVKWECKQHNTPMG-UHFFFAOYSA-N 0.000 description 1
- ZAJHYTUFMXKHKV-UHFFFAOYSA-N 2-[1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-hydroxyindol-3-yl]acetic acid;hydrochloride Chemical compound Cl.CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=C(O)C=C5C(CC(O)=O)=C4)C=C3C=2)=N1 ZAJHYTUFMXKHKV-UHFFFAOYSA-N 0.000 description 1
- PXWLNDADBCCSDH-UHFFFAOYSA-N 2-[1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-methoxyindol-3-yl]acetic acid Chemical compound C1=C(CC(O)=O)C2=CC(OC)=CC=C2N1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 PXWLNDADBCCSDH-UHFFFAOYSA-N 0.000 description 1
- ZHBYJVOTCQDMJI-UHFFFAOYSA-N 2-[1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-phenylmethoxyindol-3-yl]acetic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=C(OCC=6C=CC=CC=6)C=C5C(CC(O)=O)=C4)C=C3C=2)=N1 ZHBYJVOTCQDMJI-UHFFFAOYSA-N 0.000 description 1
- RUEFAMAAMMKZTJ-UHFFFAOYSA-N 2-[1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]indol-3-yl]-2-methylpropanoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=CC=C5C(=C4)C(C)(C)C(O)=O)C=C3C=2)=N1 RUEFAMAAMMKZTJ-UHFFFAOYSA-N 0.000 description 1
- ZDQQEAKXIZQVAW-UHFFFAOYSA-N 2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]acetonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CC#N)C=C3C=2)=N1 ZDQQEAKXIZQVAW-UHFFFAOYSA-N 0.000 description 1
- FFOVRYQXODQHOF-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-1,3-thiazol-4-yl]acetic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CC=4SC=C(CC(O)=O)N=4)C=C3C=2)=N1 FFOVRYQXODQHOF-UHFFFAOYSA-N 0.000 description 1
- FZMAHFFXLSOSTH-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]-4-(4-ethoxy-4-oxobutoxy)phenoxy]acetic acid Chemical compound CCOC(=O)CCCOC1=CC=C(OCC(O)=O)C(COC=2C=C3C=C(OC3=CC=2)C=2SC=C(N=2)C(C)(C)C)=C1 FZMAHFFXLSOSTH-UHFFFAOYSA-N 0.000 description 1
- PTCIMDRWYFFQND-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]-6-methoxyphenoxy]acetamide Chemical compound COC1=CC=CC(COC=2C=C3C=C(OC3=CC=2)C=2SC=C(N=2)C(C)(C)C)=C1OCC(N)=O PTCIMDRWYFFQND-UHFFFAOYSA-N 0.000 description 1
- IPBGSBANYFIZKV-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenoxy]-2-methylpropanenitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)OC(C)(C)C#N)C=C3C=2)=N1 IPBGSBANYFIZKV-UHFFFAOYSA-N 0.000 description 1
- FTKOFXQXIDHPIK-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenoxy]-n'-hydroxy-2-methylpropanimidamide Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)OC(C)(C)C(N)=NO)C=C3C=2)=N1 FTKOFXQXIDHPIK-UHFFFAOYSA-N 0.000 description 1
- SJEBRODZIAISDB-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenoxy]pentanamide Chemical compound CCCC(C(N)=O)OC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 SJEBRODZIAISDB-UHFFFAOYSA-N 0.000 description 1
- JZAXAQPSDBNTQZ-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenoxy]pentanenitrile Chemical compound CCCC(C#N)OC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 JZAXAQPSDBNTQZ-UHFFFAOYSA-N 0.000 description 1
- MOACRXYOPMNFHU-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenoxy]pentanoic acid Chemical compound CCCC(C(O)=O)OC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 MOACRXYOPMNFHU-UHFFFAOYSA-N 0.000 description 1
- UGHBLPUEJKALHY-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-1,3-thiazole-4-carboxylic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CC=4SC=C(N=4)C(O)=O)C=C3C=2)=N1 UGHBLPUEJKALHY-UHFFFAOYSA-N 0.000 description 1
- GXLPWAOUAKVMLC-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-4-(2h-tetrazol-5-ylmethyl)-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CC=4SC=C(CC5=NNN=N5)N=4)C=C3C=2)=N1 GXLPWAOUAKVMLC-UHFFFAOYSA-N 0.000 description 1
- GRRXCOXTURGLKU-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-n-(2-methylphenyl)sulfonyl-1,3-thiazole-4-carboxamide Chemical compound CC1=CC=CC=C1S(=O)(=O)NC(=O)C1=CSC(CC=2C=C3C=C(OC3=CC=2)C=2SC=C(N=2)C(C)(C)C)=N1 GRRXCOXTURGLKU-UHFFFAOYSA-N 0.000 description 1
- AVYZAUUYKNUTAL-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]indazole-3-carbonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C(=C5C=CC=CC5=N4)C#N)C=C3C=2)=N1 AVYZAUUYKNUTAL-UHFFFAOYSA-N 0.000 description 1
- LERAJCXOJDLYPC-UHFFFAOYSA-N 2-[[5-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]tetrazol-2-yl]methyl]benzoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(C=C3C=2)C2=NN(CC=3C(=CC=CC=3)C(O)=O)N=N2)=N1 LERAJCXOJDLYPC-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- XSJVWZAETSBXKU-UHFFFAOYSA-N 2-ethoxypropane Chemical compound CCOC(C)C XSJVWZAETSBXKU-UHFFFAOYSA-N 0.000 description 1
- NSTREUWFTAOOKS-UHFFFAOYSA-N 2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1F NSTREUWFTAOOKS-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- SLAMLWHELXOEJZ-UHFFFAOYSA-N 2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1[N+]([O-])=O SLAMLWHELXOEJZ-UHFFFAOYSA-N 0.000 description 1
- DCXIOUKSQXDUII-UHFFFAOYSA-N 3-[1-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenoxy]butyl]-2h-1,2,4-oxadiazol-5-one Chemical compound N=1C(=O)ONC=1C(CCC)OC1=CC=CC=C1COC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 DCXIOUKSQXDUII-UHFFFAOYSA-N 0.000 description 1
- UDDBAAVDLKSEIY-UHFFFAOYSA-N 3-[2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenoxy]propan-2-yl]-2h-1,2,4-oxadiazol-5-one Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)OC(C)(C)C=4NC(=O)ON=4)C=C3C=2)=N1 UDDBAAVDLKSEIY-UHFFFAOYSA-N 0.000 description 1
- RRHSCRPHTDBXEF-UHFFFAOYSA-N 3-[[1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-3-(carboxymethyl)indol-5-yl]oxymethyl]benzoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=C(OCC=6C=C(C=CC=6)C(O)=O)C=C5C(CC(O)=O)=C4)C=C3C=2)=N1 RRHSCRPHTDBXEF-UHFFFAOYSA-N 0.000 description 1
- KLDLRDSRCMJKGM-UHFFFAOYSA-N 3-[chloro-(2-oxo-1,3-oxazolidin-3-yl)phosphoryl]-1,3-oxazolidin-2-one Chemical compound C1COC(=O)N1P(=O)(Cl)N1CCOC1=O KLDLRDSRCMJKGM-UHFFFAOYSA-N 0.000 description 1
- VPUHMOLSUUYGEJ-UHFFFAOYSA-N 3-bromo-4-oxo-4-phenylbutanoic acid Chemical compound OC(=O)CC(Br)C(=O)C1=CC=CC=C1 VPUHMOLSUUYGEJ-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- TUXSUQLMUWDUDS-UHFFFAOYSA-N 3-formyl-1h-indole-5-carboxylic acid Chemical compound OC(=O)C1=CC=C2NC=C(C=O)C2=C1 TUXSUQLMUWDUDS-UHFFFAOYSA-N 0.000 description 1
- JYVPUGQZJRFFAF-UHFFFAOYSA-N 4,5-dimethyl-1h-pyrazol-3-amine Chemical compound CC=1NN=C(N)C=1C JYVPUGQZJRFFAF-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- BTOJSYRZQZOMOK-UHFFFAOYSA-N 4-chloro-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1C2=NC=NC(Cl)=C2C=C1 BTOJSYRZQZOMOK-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- KTOFLUUEVQWDHD-UHFFFAOYSA-N 4-tert-butyl-2-[5-[1-[3-(2h-tetrazol-5-yl)indol-1-yl]ethyl]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound C1=C(C=2NN=NN=2)C2=CC=CC=C2N1C(C)C(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 KTOFLUUEVQWDHD-UHFFFAOYSA-N 0.000 description 1
- DUCCFBAHKCPPIC-UHFFFAOYSA-N 4-tert-butyl-2-[5-[3-[5-methyl-3-(2h-tetrazol-5-yl)indol-1-yl]propyl]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound C1=C(C=2NN=NN=2)C2=CC(C)=CC=C2N1CCCC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 DUCCFBAHKCPPIC-UHFFFAOYSA-N 0.000 description 1
- IPXFIMUCVKAPAD-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(2h-tetrazol-5-yl)indol-1-yl]methyl]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C5=CC=CC=C5C=C4C4=NNN=N4)C=C3C=2)=N1 IPXFIMUCVKAPAD-UHFFFAOYSA-N 0.000 description 1
- LIZGGIBVYYWJJI-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-[1-(2h-tetrazol-5-yl)butoxy]phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound N=1N=NNC=1C(CCC)OC1=CC=CC=C1COC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 LIZGGIBVYYWJJI-UHFFFAOYSA-N 0.000 description 1
- PXGXFRGYFIZBQY-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[3-(2h-tetrazol-5-yl)indazol-2-yl]methyl]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CN4C(=C5C=CC=CC5=N4)C=4NN=NN=4)C=C3C=2)=N1 PXGXFRGYFIZBQY-UHFFFAOYSA-N 0.000 description 1
- HXBHZPGOEVXMDR-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[3-methoxy-2-[1-(2h-tetrazol-5-yl)ethoxy]phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound N1=NNN=C1C(C)OC=1C(OC)=CC=CC=1COC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 HXBHZPGOEVXMDR-UHFFFAOYSA-N 0.000 description 1
- KXJNGQWKXONKOT-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[5-methoxy-3-(2h-tetrazol-5-yl)indazol-1-yl]methyl]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound N1=C(C2=NNN=N2)C2=CC(OC)=CC=C2N1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 KXJNGQWKXONKOT-UHFFFAOYSA-N 0.000 description 1
- VBYLPHRVYWOQOL-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[5-methoxy-3-(2h-tetrazol-5-yl)indazol-1-yl]methyl]-1-benzofuran-2-yl]-1,3-thiazole;sodium Chemical compound [Na].N1=C(C2=NNN=N2)C2=CC(OC)=CC=C2N1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 VBYLPHRVYWOQOL-UHFFFAOYSA-N 0.000 description 1
- RSERHJPLECECPR-UHFFFAOYSA-N 5-methoxy-1h-indazole-3-carboxylic acid Chemical compound COC1=CC=C2NN=C(C(O)=O)C2=C1 RSERHJPLECECPR-UHFFFAOYSA-N 0.000 description 1
- ZTNQWTPWKNDRNF-UHFFFAOYSA-N 5-methyl-1h-indole-3-carbaldehyde Chemical compound CC1=CC=C2NC=C(C=O)C2=C1 ZTNQWTPWKNDRNF-UHFFFAOYSA-N 0.000 description 1
- JIQYBYFWPOTTCP-UHFFFAOYSA-N 5-methyl-1h-indole-3-carbonitrile Chemical compound CC1=CC=C2NC=C(C#N)C2=C1 JIQYBYFWPOTTCP-UHFFFAOYSA-N 0.000 description 1
- JCQLPDZCNSVBMS-UHFFFAOYSA-N 5-phenylmethoxy-1h-indole Chemical compound C=1C=C2NC=CC2=CC=1OCC1=CC=CC=C1 JCQLPDZCNSVBMS-UHFFFAOYSA-N 0.000 description 1
- QGEFHZMSSCENSH-UHFFFAOYSA-N 5-tert-butyl-1h-indole-3-carbonitrile Chemical compound CC(C)(C)C1=CC=C2NC=C(C#N)C2=C1 QGEFHZMSSCENSH-UHFFFAOYSA-N 0.000 description 1
- RVDLHGSZWAELAU-UHFFFAOYSA-N 5-tert-butylthiophene-2-carbonyl chloride Chemical compound CC(C)(C)C1=CC=C(C(Cl)=O)S1 RVDLHGSZWAELAU-UHFFFAOYSA-N 0.000 description 1
- USQCUKQZXOWUDF-YWZLYKJASA-N 6-chloro-n-[(3s)-1-[(2s)-1-(4-methyl-5-oxo-1,4-diazepan-1-yl)-1-oxopropan-2-yl]-2-oxopyrrolidin-3-yl]naphthalene-2-sulfonamide Chemical compound O=C([C@@H](N1C([C@@H](NS(=O)(=O)C=2C=C3C=CC(Cl)=CC3=CC=2)CC1)=O)C)N1CCN(C)C(=O)CC1 USQCUKQZXOWUDF-YWZLYKJASA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-N Dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)(O)OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- GKQLYSROISKDLL-UHFFFAOYSA-N EEDQ Chemical compound C1=CC=C2N(C(=O)OCC)C(OCC)C=CC2=C1 GKQLYSROISKDLL-UHFFFAOYSA-N 0.000 description 1
- XXRCUYVCPSWGCC-UHFFFAOYSA-N Ethyl pyruvate Chemical compound CCOC(=O)C(C)=O XXRCUYVCPSWGCC-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 208000031671 Large B-Cell Diffuse Lymphoma Diseases 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- LSGKMZLPZFPAIN-UHFFFAOYSA-N Oxime-1H-Indole-3-carboxaldehyde Natural products C1=CC=C2C(C(=O)N)=CNC2=C1 LSGKMZLPZFPAIN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 101100137208 Rattus norvegicus Pon1 gene Proteins 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- GPXUKYQJSQAVQL-UHFFFAOYSA-N [3-diphenoxyphosphorylpropyl(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)CCCP(=O)(OC=1C=CC=CC=1)OC1=CC=CC=C1 GPXUKYQJSQAVQL-UHFFFAOYSA-N 0.000 description 1
- VNMKPQLKEAYMKV-RSAXXLAASA-M [Na+].COC1=CC=CC(COC2=CC=C3OC(=CC3=C2)C2=NC(=CS2)C(C)(C)C)=C1O[C@@H](C)C([O-])=O Chemical compound [Na+].COC1=CC=CC(COC2=CC=C3OC(=CC3=C2)C2=NC(=CS2)C(C)(C)C)=C1O[C@@H](C)C([O-])=O VNMKPQLKEAYMKV-RSAXXLAASA-M 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- YDPLDMLRERBXAV-UHFFFAOYSA-N aluminum;triazide Chemical compound [Al+3].[N-]=[N+]=[N-].[N-]=[N+]=[N-].[N-]=[N+]=[N-] YDPLDMLRERBXAV-UHFFFAOYSA-N 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 235000009697 arginine Nutrition 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- OSJRGDBEYARHLX-UHFFFAOYSA-N azido(trimethyl)stannane Chemical compound [N-]=[N+]=[N-].C[Sn+](C)C OSJRGDBEYARHLX-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- NEWJCBFTUGUTTB-UHFFFAOYSA-N benzhydryl 2-bromopentanoate Chemical compound C=1C=CC=CC=1C(OC(=O)C(Br)CCC)C1=CC=CC=C1 NEWJCBFTUGUTTB-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- SNVKNXJVXFNVNR-UHFFFAOYSA-N benzyl 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-carbonyl]indole-3-carboxylate Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(C=C3C=2)C(=O)N2C3=CC=CC=C3C(C(=O)OCC=3C=CC=CC=3)=C2)=N1 SNVKNXJVXFNVNR-UHFFFAOYSA-N 0.000 description 1
- OEPSWJRQAIUXME-UHFFFAOYSA-N benzyl 1h-indazole-3-carboxylate Chemical compound N=1NC2=CC=CC=C2C=1C(=O)OCC1=CC=CC=C1 OEPSWJRQAIUXME-UHFFFAOYSA-N 0.000 description 1
- WKPCGFJWVPBYCF-UHFFFAOYSA-N benzyl 2-(1h-indol-3-yl)acetate Chemical compound C=1NC2=CC=CC=C2C=1CC(=O)OCC1=CC=CC=C1 WKPCGFJWVPBYCF-UHFFFAOYSA-N 0.000 description 1
- NYOIPOKQPNESQP-UHFFFAOYSA-N benzyl 2-[1-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-carbonyl]-5-nitroindol-3-yl]acetate Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(C=C3C=2)C(=O)N2C3=CC=C(C=C3C(CC(=O)OCC=3C=CC=CC=3)=C2)[N+]([O-])=O)=N1 NYOIPOKQPNESQP-UHFFFAOYSA-N 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- ODWXUNBKCRECNW-UHFFFAOYSA-M bromocopper(1+) Chemical compound Br[Cu+] ODWXUNBKCRECNW-UHFFFAOYSA-M 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UETLMBWMVIQIGU-UHFFFAOYSA-N calcium azide Chemical compound [Ca+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UETLMBWMVIQIGU-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- RNFNDJAIBTYOQL-UHFFFAOYSA-N chloral hydrate Chemical compound OC(O)C(Cl)(Cl)Cl RNFNDJAIBTYOQL-UHFFFAOYSA-N 0.000 description 1
- 229960002327 chloral hydrate Drugs 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- WRJWRGBVPUUDLA-UHFFFAOYSA-N chlorosulfonyl isocyanate Chemical compound ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 125000002592 cumenyl group Chemical group C1(=C(C=CC=C1)*)C(C)C 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 235000018417 cysteine Nutrition 0.000 description 1
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 1
- CCAFPWNGIUBUSD-UHFFFAOYSA-N diethyl sulfoxide Chemical compound CCS(=O)CC CCAFPWNGIUBUSD-UHFFFAOYSA-N 0.000 description 1
- VLNZUSMTOFYNPS-UHFFFAOYSA-N diethylphosphorylformonitrile Chemical compound CCP(=O)(CC)C#N VLNZUSMTOFYNPS-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- RPQVRRSJUIEITQ-UHFFFAOYSA-N ethyl 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-2-methylindole-3-carboxylate Chemical compound C12=CC=CC=C2C(C(=O)OCC)=C(C)N1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 RPQVRRSJUIEITQ-UHFFFAOYSA-N 0.000 description 1
- DBEIGPGXWYIQEH-UHFFFAOYSA-N ethyl 2-(iodomethyl)benzoate Chemical compound CCOC(=O)C1=CC=CC=C1CI DBEIGPGXWYIQEH-UHFFFAOYSA-N 0.000 description 1
- HGGFMFWUNVGYKR-UHFFFAOYSA-N ethyl 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]-6-methoxyphenoxy]propanoate Chemical compound C1=CC=C(OC)C(OC(C)C(=O)OCC)=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 HGGFMFWUNVGYKR-UHFFFAOYSA-N 0.000 description 1
- XHEMHZBWBOHPBW-UHFFFAOYSA-N ethyl 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-1,3-thiazole-4-carboxylate Chemical compound CCOC(=O)C1=CSC(CC=2C=C3C=C(OC3=CC=2)C=2SC=C(N=2)C(C)(C)C)=N1 XHEMHZBWBOHPBW-UHFFFAOYSA-N 0.000 description 1
- GHHGBXPSKXBESY-UHFFFAOYSA-N ethyl 2-[[5-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]tetrazol-2-yl]methyl]benzoate Chemical compound CCOC(=O)C1=CC=CC=C1CN1N=C(C=2C=C3C=C(OC3=CC=2)C=2SC=C(N=2)C(C)(C)C)N=N1 GHHGBXPSKXBESY-UHFFFAOYSA-N 0.000 description 1
- ARFLASKVLJTEJD-UHFFFAOYSA-N ethyl 2-bromopropanoate Chemical compound CCOC(=O)C(C)Br ARFLASKVLJTEJD-UHFFFAOYSA-N 0.000 description 1
- QAQQNGGCLQERQK-UHFFFAOYSA-N ethyl 3-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]propanoate Chemical compound C=1C2=CC(CCC(=O)OCC)=CC=C2OC=1C1=NC(C(C)(C)C)=CS1 QAQQNGGCLQERQK-UHFFFAOYSA-N 0.000 description 1
- VICYTAYPKBLQFB-UHFFFAOYSA-N ethyl 3-bromo-2-oxopropanoate Chemical compound CCOC(=O)C(=O)CBr VICYTAYPKBLQFB-UHFFFAOYSA-N 0.000 description 1
- CLASAIPTJGLYMG-UHFFFAOYSA-N ethyl 4-[3-formyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenoxy]butanoate Chemical compound CCOC(=O)CCCOC1=CC=C(OCC(=O)OC(C)(C)C)C(C=O)=C1 CLASAIPTJGLYMG-UHFFFAOYSA-N 0.000 description 1
- MXGDZWRIKQXDPY-UHFFFAOYSA-N ethyl 4-[4-(hydroxymethyl)-3-methoxyphenoxy]butanoate Chemical compound CCOC(=O)CCCOC1=CC=C(CO)C(OC)=C1 MXGDZWRIKQXDPY-UHFFFAOYSA-N 0.000 description 1
- OHLRLMWUFVDREV-UHFFFAOYSA-N ethyl 4-chloro-3-oxobutanoate Chemical compound CCOC(=O)CC(=O)CCl OHLRLMWUFVDREV-UHFFFAOYSA-N 0.000 description 1
- XUVKKQLKTJKMBQ-UHFFFAOYSA-N ethyl 5-[1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-3-(2-methoxy-2-oxoethyl)indol-5-yl]oxypentanoate Chemical compound C1=C(CC(=O)OC)C2=CC(OCCCCC(=O)OCC)=CC=C2N1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 XUVKKQLKTJKMBQ-UHFFFAOYSA-N 0.000 description 1
- AFRWBGJRWRHQOV-UHFFFAOYSA-N ethyl 5-bromopentanoate Chemical compound CCOC(=O)CCCCBr AFRWBGJRWRHQOV-UHFFFAOYSA-N 0.000 description 1
- MVEAAGBEUOMFRX-UHFFFAOYSA-N ethyl acetate;hydrochloride Chemical compound Cl.CCOC(C)=O MVEAAGBEUOMFRX-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 229940117360 ethyl pyruvate Drugs 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- 239000000852 hydrogen donor Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 125000004531 indol-5-yl group Chemical group [H]N1C([H])=C([H])C2=C([H])C(*)=C([H])C([H])=C12 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- HCUARRIEZVDMPT-UHFFFAOYSA-N indolyl-2-carboxylic acid Natural products C1=CC=C2NC(C(=O)O)=CC2=C1 HCUARRIEZVDMPT-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- YEESKJGWJFYOOK-IJHYULJSSA-N leukotriene D4 Chemical compound CCCCC\C=C/C\C=C/C=C/C=C/[C@H]([C@@H](O)CCCC(O)=O)SC[C@H](N)C(=O)NCC(O)=O YEESKJGWJFYOOK-IJHYULJSSA-N 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- CRGZYKWWYNQGEC-UHFFFAOYSA-N magnesium;methanolate Chemical compound [Mg+2].[O-]C.[O-]C CRGZYKWWYNQGEC-UHFFFAOYSA-N 0.000 description 1
- 238000002826 magnetic-activated cell sorting Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- MFSPVADDZAXXLU-UHFFFAOYSA-N methyl 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-3-cyanoindole-5-carboxylate Chemical compound C1=C(C#N)C2=CC(C(=O)OC)=CC=C2N1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 MFSPVADDZAXXLU-UHFFFAOYSA-N 0.000 description 1
- UCLJDTWKSBYIOR-UHFFFAOYSA-N methyl 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-methoxyindazole-3-carboxylate Chemical compound C12=CC=C(OC)C=C2C(C(=O)OC)=NN1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 UCLJDTWKSBYIOR-UHFFFAOYSA-N 0.000 description 1
- YUXHQQLBRWTOJV-UHFFFAOYSA-N methyl 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]indole-2-carboxylate Chemical compound COC(=O)C1=CC2=CC=CC=C2N1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 YUXHQQLBRWTOJV-UHFFFAOYSA-N 0.000 description 1
- UEOIKZLXTKGJLU-UHFFFAOYSA-N methyl 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]indole-3-carboxylate Chemical compound C12=CC=CC=C2C(C(=O)OC)=CN1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 UEOIKZLXTKGJLU-UHFFFAOYSA-N 0.000 description 1
- NQPIEWBAWBFGOB-UHFFFAOYSA-N methyl 1h-indole-2-carboxylate Chemical compound C1=CC=C2NC(C(=O)OC)=CC2=C1 NQPIEWBAWBFGOB-UHFFFAOYSA-N 0.000 description 1
- AYYOZKHMSABVRP-UHFFFAOYSA-N methyl 1h-indole-6-carboxylate Chemical compound COC(=O)C1=CC=C2C=CNC2=C1 AYYOZKHMSABVRP-UHFFFAOYSA-N 0.000 description 1
- YGTCKAXXVMBMPP-UHFFFAOYSA-N methyl 2-[5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]indol-3-yl]acetate Chemical compound C12=CC=C(OCC=3C=C(C=C(C=3)C(F)(F)F)C(F)(F)F)C=C2C(CC(=O)OC)=CN1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 YGTCKAXXVMBMPP-UHFFFAOYSA-N 0.000 description 1
- PAFUKZMNTQWTPL-UHFFFAOYSA-N methyl 3-cyano-1h-indole-5-carboxylate Chemical compound COC(=O)C1=CC=C2NC=C(C#N)C2=C1 PAFUKZMNTQWTPL-UHFFFAOYSA-N 0.000 description 1
- KJRFTNVYOAGTHK-UHFFFAOYSA-N methyl 3-hydroxy-2,2-dimethylpropanoate Chemical compound COC(=O)C(C)(C)CO KJRFTNVYOAGTHK-UHFFFAOYSA-N 0.000 description 1
- XDAUKQXMIHVKGQ-UHFFFAOYSA-N methyl 5-propan-2-yl-1h-indazole-3-carboxylate Chemical compound C1=C(C(C)C)C=C2C(C(=O)OC)=NNC2=C1 XDAUKQXMIHVKGQ-UHFFFAOYSA-N 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- NSBNSZAXNUGWDJ-UHFFFAOYSA-O monopyridin-1-ium tribromide Chemical compound Br[Br-]Br.C1=CC=[NH+]C=C1 NSBNSZAXNUGWDJ-UHFFFAOYSA-O 0.000 description 1
- 125000006518 morpholino carbonyl group Chemical group [H]C1([H])OC([H])([H])C([H])([H])N(C(*)=O)C1([H])[H] 0.000 description 1
- 230000002107 myocardial effect Effects 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- XFSSDIWLZFNNKI-UHFFFAOYSA-N n'-(4-propan-2-ylphenyl)acetohydrazide Chemical compound CC(C)C1=CC=C(NNC(C)=O)C=C1 XFSSDIWLZFNNKI-UHFFFAOYSA-N 0.000 description 1
- RRNLVICCUZTJOW-UHFFFAOYSA-N n'-hydroxypentanimidamide Chemical compound CCCCC(N)=NO RRNLVICCUZTJOW-UHFFFAOYSA-N 0.000 description 1
- ULWOJODHECIZAU-UHFFFAOYSA-N n,n-diethylpropan-2-amine Chemical compound CCN(CC)C(C)C ULWOJODHECIZAU-UHFFFAOYSA-N 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- LWFWUJCJKPUZLV-UHFFFAOYSA-N n-trimethylsilylacetamide Chemical compound CC(=O)N[Si](C)(C)C LWFWUJCJKPUZLV-UHFFFAOYSA-N 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- KPADFPAILITQBG-UHFFFAOYSA-N non-4-ene Chemical compound CCCCC=CCCC KPADFPAILITQBG-UHFFFAOYSA-N 0.000 description 1
- 230000009871 nonspecific binding Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- HLEKYJVHEBHTMR-UHFFFAOYSA-N pentanamide Chemical compound CCCCC(N)=O.CCCCC(N)=O HLEKYJVHEBHTMR-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- LCPDWSOZIOUXRV-UHFFFAOYSA-M phenoxyacetate Chemical compound [O-]C(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-M 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- NWUIWGFIBIRQOK-UHFFFAOYSA-N propan-2-yl 1-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]-5-phenylmethoxyindazole-3-carboxylate Chemical compound C12=CC=C(OCC=3C=CC=CC=3)C=C2C(C(=O)OC(C)C)=NN1CC(C=C1C=2)=CC=C1OC=2C1=NC(C(C)(C)C)=CS1 NWUIWGFIBIRQOK-UHFFFAOYSA-N 0.000 description 1
- AVJJCZQJRONPKS-UHFFFAOYSA-N propan-2-yl 5-phenylmethoxy-1h-indazole-3-carboxylate Chemical compound C1=C2C(C(=O)OC(C)C)=NNC2=CC=C1OCC1=CC=CC=C1 AVJJCZQJRONPKS-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000159 protein binding assay Methods 0.000 description 1
- 235000018102 proteins Nutrition 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 201000006845 reticulosarcoma Diseases 0.000 description 1
- 208000029922 reticulum cell sarcoma Diseases 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- VNMKPQLKEAYMKV-UHFFFAOYSA-M sodium;2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]-6-methoxyphenoxy]propanoate Chemical compound [Na+].COC1=CC=CC(COC=2C=C3C=C(OC3=CC=2)C=2SC=C(N=2)C(C)(C)C)=C1OC(C)C([O-])=O VNMKPQLKEAYMKV-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- PQBSMJYDCMUYSU-UHFFFAOYSA-N tert-butyl 2-[3-formyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenoxy]acetate Chemical compound CC(C)(C)OC(=O)COC1=CC=C(OCC(=O)OC(C)(C)C)C(C=O)=C1 PQBSMJYDCMUYSU-UHFFFAOYSA-N 0.000 description 1
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- JABYJIQOLGWMQW-UHFFFAOYSA-N undec-4-ene Chemical compound CCCCCCC=CCCC JABYJIQOLGWMQW-UHFFFAOYSA-N 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/425—Thiazoles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/535—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one oxygen as the ring hetero atoms, e.g. 1,2-oxazines
- A61K31/5375—1,4-Oxazines, e.g. morpholine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Epidemiology (AREA)
- Immunology (AREA)
- Pulmonology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB9601235.6A GB9601235D0 (en) | 1996-01-22 | 1996-01-22 | Novel compounds |
| GB9601235.6 | 1996-01-22 | ||
| AUPO1111A AUPO111196A0 (en) | 1996-07-18 | 1996-07-18 | Novel compounds |
| AUPO1111 | 1996-07-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2244189A1 true CA2244189A1 (en) | 1997-07-31 |
Family
ID=25645218
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002244189A Abandoned CA2244189A1 (en) | 1996-01-22 | 1997-01-17 | Thiazolylbenzofuran derivatives and pharmaceutical compositions containing them |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US5994378A (enExample) |
| EP (2) | EP0880519B1 (enExample) |
| JP (1) | JP2000503984A (enExample) |
| KR (1) | KR19990076788A (enExample) |
| CN (1) | CN1209809A (enExample) |
| AT (2) | ATE216384T1 (enExample) |
| CA (1) | CA2244189A1 (enExample) |
| DE (2) | DE69728581D1 (enExample) |
| EA (1) | EA199800650A1 (enExample) |
| ES (1) | ES2171878T3 (enExample) |
| HU (1) | HUP9900424A2 (enExample) |
| WO (1) | WO1997027190A1 (enExample) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9919413D0 (en) * | 1999-08-18 | 1999-10-20 | Zeneca Ltd | Chemical compounds |
| AU7962200A (en) * | 1999-10-29 | 2001-05-14 | Wakunaga Pharmaceutical Co., Ltd | Novel indole derivatives and drugs containing the same as the active ingredient |
| HUP0303829A3 (en) * | 2001-04-16 | 2006-02-28 | Tanabe Seiyaku Co | Large conductance calcium-acitvated k channel opener compounds, use thereof and pharmaceutical compositions containing them |
| IL160304A0 (en) | 2001-08-10 | 2004-07-25 | Nippon Chemiphar Co | ACTIVATOR FOR PEROXISOME PROLIFERATOR-RESPONSIVE RECEPTOR delta |
| PT1445258E (pt) | 2001-10-12 | 2009-07-02 | Nippon Chemiphar Co | Activador para o receptor delta activado por proliferador de peroxissoma |
| JP2008506702A (ja) * | 2004-07-14 | 2008-03-06 | ピーティーシー セラピューティクス,インコーポレーテッド | C型肝炎を治療するための方法 |
| AU2005296305A1 (en) * | 2004-10-12 | 2006-04-27 | Decode Genetics Ehf | Sulfonamide peri-substituted bicyclics for occlusive artery disease |
| WO2006046683A1 (en) * | 2004-10-25 | 2006-05-04 | Astellas Pharma Inc. | Thiazolylbenzofuran derivatives as leukotriene and prostaglandin d2 receptor antagonists |
| US7977359B2 (en) | 2005-11-04 | 2011-07-12 | Amira Pharmaceuticals, Inc. | 5-lipdxygenase-activating protein (FLAP) inhibitors |
| US8399666B2 (en) | 2005-11-04 | 2013-03-19 | Panmira Pharmaceuticals, Llc | 5-lipoxygenase-activating protein (FLAP) inhibitors |
| GB2431927B (en) * | 2005-11-04 | 2010-03-17 | Amira Pharmaceuticals Inc | 5-Lipoxygenase-activating protein (FLAP) inhibitors |
| CN101460458A (zh) * | 2006-02-15 | 2009-06-17 | 阿勒根公司 | 具有1-磷酸-鞘氨醇(s1p)受体拮抗剂生物活性的带芳基或者杂芳基基团的吲哚-3-羧酸的酰胺、酯、硫代酰胺和硫羟酸酯化合物 |
| EP1984334B1 (en) * | 2006-02-15 | 2014-04-09 | Allergan, Inc. | Indole-3-carboxylic acid amide, ester, thioamide and thiol ester compounds bearing aryl or heteroaryl groups having sphingosine-1-phosphate (s1p) receptor antagonist biological activity |
| NZ572268A (en) | 2006-04-18 | 2011-09-30 | Nippon Chemiphar Co | Activating agent for peroxisome proliferator activated receptor delta (ppar) |
| DE102006021733A1 (de) * | 2006-05-09 | 2007-11-22 | Bayer Healthcare Ag | 3-Tetrazolylindazole und 3-Tetrazolylpyrazolopyridine sowie ihre Verwendung |
| EP2027117A2 (en) * | 2006-05-16 | 2009-02-25 | Decode Genetics EHF | Process for preparing 7-(acryloyl)-indoles |
| DE102006043443A1 (de) * | 2006-09-15 | 2008-03-27 | Bayer Healthcare Ag | Neue aza-bicyclische Verbindungen und ihre Verwendung |
| US8524917B2 (en) | 2007-01-11 | 2013-09-03 | Allergan, Inc. | 6-substituted indole-3-carboxylic acid amide compounds having sphingosine-1-phosphate (S1P) receptor antagonist biological activity |
| JP2010515750A (ja) * | 2007-01-11 | 2010-05-13 | アラーガン インコーポレイテッド | スフィンゴシン−1−ホスフェート(s1p)受容体アンタゴニスト生物活性を有する6−置換インドール−3−カルボン酸アミド化合物 |
| BRPI0911197A2 (pt) | 2008-04-15 | 2015-10-13 | Nippon Chemiphar Co | composto, ativador de receptor ativado pelo proliferador de peroxissoma, e, medicamento para o tratamento e /ou profilaxia de uma doença. |
| US8546431B2 (en) | 2008-10-01 | 2013-10-01 | Panmira Pharmaceuticals, Llc | 5-lipoxygenase-activating protein (FLAP) inhibitors |
| DE102008063992A1 (de) | 2008-12-19 | 2010-09-02 | Lerner, Zinoviy, Dipl.-Ing. | Neue aliphatisch substituierte Pyrazolopyridine und ihre Verwendung |
| AU2011224287B2 (en) | 2010-03-12 | 2015-03-26 | Omeros Corporation | PDE10 inhibitors and related compositions and methods |
| CN103649079B (zh) | 2010-12-22 | 2016-11-16 | Abbvie公司 | 丙型肝炎抑制剂及其用途 |
| EP3760629A1 (en) | 2013-02-21 | 2021-01-06 | Adverio Pharma GmbH | Forms of methyl {4,6-diamino-2-[1-(2-fluorobenzyl)-1h-pyrazolo[3,4-b]pyridino-3-yl]pyrimidino-5-yl}methyl carbamate |
| NZ716494A (en) | 2014-04-28 | 2017-07-28 | Omeros Corp | Processes and intermediates for the preparation of a pde10 inhibitor |
| NZ630803A (en) | 2014-04-28 | 2016-03-31 | Omeros Corp | Optically active pde10 inhibitor |
| DK3186233T3 (da) | 2014-08-29 | 2021-11-22 | Chdi Foundation Inc | Prober til billeddannelse af huntingtin-protein |
| JP2018513153A (ja) | 2015-04-24 | 2018-05-24 | オメロス コーポレーション | Pde10インヒビターならびに関連する組成物および方法 |
| WO2017079678A1 (en) | 2015-11-04 | 2017-05-11 | Omeros Corporation | Solid state forms of a pde10 inhibitor |
| MX389626B (es) | 2017-11-17 | 2025-03-20 | Cellix Bio Private Ltd | Compuestos de pilocarpina con ácido lipoico para el tratamiento de trastornos oculares. |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2600644B2 (ja) * | 1991-08-16 | 1997-04-16 | 藤沢薬品工業株式会社 | チアゾリルベンゾフラン誘導体 |
| JPH07179856A (ja) * | 1993-12-21 | 1995-07-18 | Canon Inc | 液晶性化合物、これを含有する液晶組成物、該液晶組成物を用いた液晶素子並びにこれらを用いた表示方法、表示装置 |
-
1997
- 1997-01-17 KR KR1019980704913A patent/KR19990076788A/ko not_active Ceased
- 1997-01-17 CA CA002244189A patent/CA2244189A1/en not_active Abandoned
- 1997-01-17 HU HU9900424A patent/HUP9900424A2/hu unknown
- 1997-01-17 CN CN97191798A patent/CN1209809A/zh active Pending
- 1997-01-17 AT AT97900432T patent/ATE216384T1/de not_active IP Right Cessation
- 1997-01-17 US US09/101,766 patent/US5994378A/en not_active Expired - Fee Related
- 1997-01-17 EP EP97900432A patent/EP0880519B1/en not_active Expired - Lifetime
- 1997-01-17 ES ES97900432T patent/ES2171878T3/es not_active Expired - Lifetime
- 1997-01-17 EP EP01123263A patent/EP1170009B1/en not_active Expired - Lifetime
- 1997-01-17 AT AT01123263T patent/ATE263561T1/de not_active IP Right Cessation
- 1997-01-17 WO PCT/JP1997/000073 patent/WO1997027190A1/en not_active Ceased
- 1997-01-17 EA EA199800650A patent/EA199800650A1/ru unknown
- 1997-01-17 DE DE69728581T patent/DE69728581D1/de not_active Expired - Lifetime
- 1997-01-17 DE DE69712042T patent/DE69712042T2/de not_active Expired - Fee Related
- 1997-01-17 JP JP9526720A patent/JP2000503984A/ja not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| EP1170009B1 (en) | 2004-04-07 |
| EP0880519B1 (en) | 2002-04-17 |
| EP0880519A1 (en) | 1998-12-02 |
| DE69712042D1 (de) | 2002-05-23 |
| CN1209809A (zh) | 1999-03-03 |
| EA199800650A1 (ru) | 1999-02-25 |
| WO1997027190A1 (en) | 1997-07-31 |
| US5994378A (en) | 1999-11-30 |
| HUP9900424A2 (hu) | 1999-05-28 |
| KR19990076788A (ko) | 1999-10-15 |
| ES2171878T3 (es) | 2002-09-16 |
| ATE263561T1 (de) | 2004-04-15 |
| DE69728581D1 (de) | 2004-05-13 |
| EP1170009A3 (en) | 2002-01-16 |
| ATE216384T1 (de) | 2002-05-15 |
| DE69712042T2 (de) | 2002-10-02 |
| JP2000503984A (ja) | 2000-04-04 |
| EP1170009A2 (en) | 2002-01-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5994378A (en) | Thiazolylbenzofuran derivatives and pharmaceutical compositions containing them | |
| US5296495A (en) | Thiazolylbenzofuran derivatives and pharmaceutical composition comprising the same | |
| AU690620B2 (en) | Platelet activating factor antagonists: imidazopyridine indoles | |
| ES2293906T3 (es) | Compuestos de indazol y composiciones farmaceuticas para inhibir proteinas quinasas, y metodos para su uso. | |
| US6069156A (en) | Indole derivatives as cGMP-PDE inhibitors | |
| US5661159A (en) | Quinolylbenzofuran derivatives as leukotriene antagonists | |
| US20040077877A1 (en) | Indazole derivatives as JNK inhibitors and compositions and methods related thereto | |
| JPH10130147A (ja) | 異項環置換アシルアミノチアゾールを含む医薬組成物 | |
| KR20010031896A (ko) | 시클린 의존성 키나아제의 아미노티아졸 억제제 | |
| RS52396B (sr) | Derivati aminoindazola, postupak izrade i međuproizvodi ovog postupak kao medicinski produkti i farmaceutske kompozicije koje ih sadrže | |
| JP2005527463A (ja) | Cns疾患を治療するための5−ht6受容体アフィニティーを有する3−アリールスルホニル−7−ピペラジニル−インドール、−ベンゾフランおよび−ベンゾチオフェン | |
| JPH08507067A (ja) | Hiv逆転写酵素阻害剤 | |
| EP0303418A2 (en) | Substituted indolones, useful in the treatment of heart or asthmatic diseases | |
| JPH11508267A (ja) | ピラゾール化合物および医薬組成物 | |
| HUT70158A (en) | Process for producing 2-amido-4-phenyl-thiazol derivatives, and pharmaceutical compositions containing them | |
| CN101010297B (zh) | N-(1h-吲哚基)-1h-吲哚-2-羧酰胺衍生物,它们的制备方法和药用用途 | |
| JP2001526287A (ja) | 新たな薬学的に活性な化合物 | |
| JPH09509957A (ja) | 免疫調節剤としてのキノリン誘導体 | |
| CA2109498A1 (en) | Benzylidene derivatives | |
| JPH08119936A (ja) | 複素環式誘導体 | |
| JP3012338B2 (ja) | アリールおよびヘテロアリールアルコキシナフタレン誘導体 | |
| MX2007016541A (es) | Compuestos quimicos. | |
| AU1399197A (en) | Thiazolylbenzofuran derivatives and pharmaceutical compositions containing them | |
| JP2008514572A (ja) | 可溶性アデニル酸シクラーゼのインヒビターとしてのインドール誘導体 | |
| TW474811B (en) | Novel thiazolyl benzofuran derivatives having activities as leukotriene and srs-a antagonists or inhibitors and the pharmaceutical composition thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |