CA2111026A1 - Process for the preparation of predominantly unbranched higher primary alcohols - Google Patents
Process for the preparation of predominantly unbranched higher primary alcoholsInfo
- Publication number
- CA2111026A1 CA2111026A1 CA002111026A CA2111026A CA2111026A1 CA 2111026 A1 CA2111026 A1 CA 2111026A1 CA 002111026 A CA002111026 A CA 002111026A CA 2111026 A CA2111026 A CA 2111026A CA 2111026 A1 CA2111026 A1 CA 2111026A1
- Authority
- CA
- Canada
- Prior art keywords
- radical
- anion
- water
- sulfonated
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 150000003138 primary alcohols Chemical class 0.000 title claims abstract description 12
- 238000002360 preparation method Methods 0.000 title claims abstract description 10
- 238000000034 method Methods 0.000 title claims description 32
- 230000008569 process Effects 0.000 title claims description 29
- -1 phosphonium ion Chemical class 0.000 claims abstract description 23
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims abstract description 22
- 150000001336 alkenes Chemical class 0.000 claims abstract description 19
- 150000001450 anions Chemical class 0.000 claims abstract description 16
- 239000003054 catalyst Substances 0.000 claims abstract description 15
- 150000001875 compounds Chemical class 0.000 claims abstract description 15
- 239000010948 rhodium Substances 0.000 claims abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 12
- 239000001257 hydrogen Substances 0.000 claims abstract description 12
- 229910052703 rhodium Inorganic materials 0.000 claims abstract description 12
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims abstract description 12
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims abstract description 11
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 9
- 230000015572 biosynthetic process Effects 0.000 claims abstract description 8
- 150000001768 cations Chemical class 0.000 claims abstract description 8
- 238000003786 synthesis reaction Methods 0.000 claims abstract description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000000203 mixture Substances 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 10
- 150000001299 aldehydes Chemical class 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 150000001298 alcohols Chemical class 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 229910052698 phosphorus Inorganic materials 0.000 claims description 6
- 239000011574 phosphorus Substances 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 150000002500 ions Chemical class 0.000 claims description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- VURFVHCLMJOLKN-UHFFFAOYSA-N diphosphane Chemical compound PP VURFVHCLMJOLKN-UHFFFAOYSA-N 0.000 claims description 3
- UVGYYTMNCMPJQM-UHFFFAOYSA-N 4-[4,5-dimethyl-2,6-bis(4-sulfophenyl)-1-phosphabicyclo[2.2.1]hepta-2,5-dien-3-yl]benzenesulfonic acid Chemical compound CC1=C(C=2C=CC(=CC=2)S(O)(=O)=O)P2CC1(C)C(C=1C=CC(=CC=1)S(O)(=O)=O)=C2C1=CC=C(S(O)(=O)=O)C=C1 UVGYYTMNCMPJQM-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- CMIHWILCIPLTFO-UHFFFAOYSA-N [1-[2-(diphenylphosphanylmethyl)naphthalen-1-yl]naphthalen-2-yl]methyl-diphenylphosphane Chemical group C=1C=C2C=CC=CC2=C(C=2C3=CC=CC=C3C=CC=2CP(C=2C=CC=CC=2)C=2C=CC=CC=2)C=1CP(C=1C=CC=CC=1)C1=CC=CC=C1 CMIHWILCIPLTFO-UHFFFAOYSA-N 0.000 claims description 2
- SZKMTZNASRXXCE-UHFFFAOYSA-N [2-[2-(diphenylphosphanylmethyl)phenyl]phenyl]methyl-diphenylphosphane Chemical group C=1C=CC=C(C=2C(=CC=CC=2)CP(C=2C=CC=CC=2)C=2C=CC=CC=2)C=1CP(C=1C=CC=CC=1)C1=CC=CC=C1 SZKMTZNASRXXCE-UHFFFAOYSA-N 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- VBQDSLGFSUGBBE-UHFFFAOYSA-N benzyl(triethyl)azanium Chemical compound CC[N+](CC)(CC)CC1=CC=CC=C1 VBQDSLGFSUGBBE-UHFFFAOYSA-N 0.000 claims description 2
- RLGQACBPNDBWTB-UHFFFAOYSA-N cetyltrimethylammonium ion Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)C RLGQACBPNDBWTB-UHFFFAOYSA-N 0.000 claims description 2
- BPSQMWSZGQGXHF-UHFFFAOYSA-N dodecyl-ethyl-dimethylazanium Chemical compound CCCCCCCCCCCC[N+](C)(C)CC BPSQMWSZGQGXHF-UHFFFAOYSA-N 0.000 claims description 2
- VICYBMUVWHJEFT-UHFFFAOYSA-N dodecyltrimethylammonium ion Chemical compound CCCCCCCCCCCC[N+](C)(C)C VICYBMUVWHJEFT-UHFFFAOYSA-N 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 238000006277 sulfonation reaction Methods 0.000 claims description 2
- 125000003944 tolyl group Chemical group 0.000 claims description 2
- OHTNPTBMCUYMRQ-UHFFFAOYSA-N trimethyl(tetradecyl)phosphanium Chemical compound CCCCCCCCCCCCCC[P+](C)(C)C OHTNPTBMCUYMRQ-UHFFFAOYSA-N 0.000 claims description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 239000007791 liquid phase Substances 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 abstract description 7
- 150000003003 phosphines Chemical class 0.000 abstract description 5
- 125000001453 quaternary ammonium group Chemical group 0.000 abstract description 3
- 238000006243 chemical reaction Methods 0.000 description 18
- 239000000243 solution Substances 0.000 description 10
- JRZJOMJEPLMPRA-UHFFFAOYSA-N 1-nonene Chemical compound CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 238000007037 hydroformylation reaction Methods 0.000 description 7
- 238000005984 hydrogenation reaction Methods 0.000 description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- 235000014786 phosphorus Nutrition 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- ZWRUINPWMLAQRD-UHFFFAOYSA-N nonan-1-ol Chemical compound CCCCCCCCCO ZWRUINPWMLAQRD-UHFFFAOYSA-N 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000000875 corresponding effect Effects 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 2
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
- 238000006471 dimerization reaction Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003284 rhodium compounds Chemical class 0.000 description 2
- SVOOVMQUISJERI-UHFFFAOYSA-K rhodium(3+);triacetate Chemical compound [Rh+3].CC([O-])=O.CC([O-])=O.CC([O-])=O SVOOVMQUISJERI-UHFFFAOYSA-K 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- RLPSARLYTKXVSE-UHFFFAOYSA-N 1-(1,3-thiazol-5-yl)ethanamine Chemical compound CC(N)C1=CN=CS1 RLPSARLYTKXVSE-UHFFFAOYSA-N 0.000 description 1
- BMTDZORNBFQUEA-UHFFFAOYSA-K 2-ethylhexanoate;rhodium(3+) Chemical compound [Rh+3].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O BMTDZORNBFQUEA-UHFFFAOYSA-K 0.000 description 1
- DDFNIWBATAORBX-UHFFFAOYSA-N 3-bis(3-sulfophenyl)phosphanylbenzenesulfonic acid;sodium Chemical compound [Na].[Na].[Na].OS(=O)(=O)C1=CC=CC(P(C=2C=C(C=CC=2)S(O)(=O)=O)C=2C=C(C=CC=2)S(O)(=O)=O)=C1 DDFNIWBATAORBX-UHFFFAOYSA-N 0.000 description 1
- PLLBRTOLHQQAQQ-UHFFFAOYSA-N 8-methylnonan-1-ol Chemical compound CC(C)CCCCCCCO PLLBRTOLHQQAQQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000370685 Arge Species 0.000 description 1
- VVPKOUNLVSNLMU-UHFFFAOYSA-N CC(C)(C)CCCCCCCCCCCCCN(CCCCCCCCCCCCCC(C)(C)C)CCCCCCCCCCCCCC(C)(C)C.OS(C1=CC=CC(P(C2=CC(S(O)(=O)=O)=CC=C2)C2=CC(S(O)(=O)=O)=CC=C2)=C1)(=O)=O Chemical compound CC(C)(C)CCCCCCCCCCCCCN(CCCCCCCCCCCCCC(C)(C)C)CCCCCCCCCCCCCC(C)(C)C.OS(C1=CC=CC(P(C2=CC(S(O)(=O)=O)=CC=C2)C2=CC(S(O)(=O)=O)=CC=C2)=C1)(=O)=O VVPKOUNLVSNLMU-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000005882 aldol condensation reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- DROMNWUQASBTFM-UHFFFAOYSA-N dinonyl benzene-1,2-dicarboxylate Chemical compound CCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCC DROMNWUQASBTFM-UHFFFAOYSA-N 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 150000004010 onium ions Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- DJFBJKSMACBYBD-UHFFFAOYSA-N phosphane;hydrate Chemical compound O.P DJFBJKSMACBYBD-UHFFFAOYSA-N 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 150000003021 phthalic acid derivatives Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- YWFDDXXMOPZFFM-UHFFFAOYSA-H rhodium(3+);trisulfate Chemical compound [Rh+3].[Rh+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O YWFDDXXMOPZFFM-UHFFFAOYSA-H 0.000 description 1
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 description 1
- MWZNPHHDRLXXHO-UHFFFAOYSA-N rhodium;hydrate Chemical compound O.[Rh] MWZNPHHDRLXXHO-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 230000002226 simultaneous effect Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- ZMUVCOYLTZPCKC-UHFFFAOYSA-N tributyl(dodecyl)azanium Chemical compound CCCCCCCCCCCC[N+](CCCC)(CCCC)CCCC ZMUVCOYLTZPCKC-UHFFFAOYSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- ABDKAPXRBAPSQN-UHFFFAOYSA-N veratrole Chemical compound COC1=CC=CC=C1OC ABDKAPXRBAPSQN-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/16—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by oxo-reaction combined with reduction
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/14—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of a —CHO group
- C07C29/141—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of a —CHO group with hydrogen or hydrogen-containing gases
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
- C07C45/50—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide by oxo-reactions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP4242725.8 | 1992-12-17 | ||
| DE4242725A DE4242725A1 (de) | 1992-12-17 | 1992-12-17 | Verfahren zur Herstellung von höheren, vorwiegend unverzweigten, primären Alkoholen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2111026A1 true CA2111026A1 (en) | 1994-06-18 |
Family
ID=6475615
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002111026A Abandoned CA2111026A1 (en) | 1992-12-17 | 1993-12-09 | Process for the preparation of predominantly unbranched higher primary alcohols |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US6051743A (enExample) |
| EP (1) | EP0602442A3 (enExample) |
| JP (1) | JPH0739362B2 (enExample) |
| KR (1) | KR100304328B1 (enExample) |
| AU (1) | AU664126B2 (enExample) |
| BR (1) | BR9305007A (enExample) |
| CA (1) | CA2111026A1 (enExample) |
| DE (1) | DE4242725A1 (enExample) |
| MX (1) | MX9307868A (enExample) |
| SG (1) | SG44829A1 (enExample) |
| TW (1) | TW257752B (enExample) |
| ZA (1) | ZA939292B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6756411B2 (en) | 1995-06-29 | 2004-06-29 | Sasol Technology (Proprietary) Limited | Process for producing oxygenated products |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4221472A1 (de) * | 1992-06-30 | 1994-01-05 | Hoechst Ag | Gemische isomerer Decylalkohole, daraus erhältliche Phthalsäureester und ihre Verwendung als Weichmacher |
| CZ411997A3 (cs) * | 1995-06-29 | 1998-07-15 | Sasol Technology (Proprietary) Limited | Způsob výroby kyslíkatých látek ze suroviny bohaté na olefiny |
| DE19610869A1 (de) * | 1996-03-20 | 1997-09-25 | Hoechst Ag | Verfahren zur Herstellung von Aldehyden |
| US6172269B1 (en) | 1996-04-24 | 2001-01-09 | Union Carbide Chemicals & Plastics Technology Corporation | Processes for producing 1,6-hexanediols |
| US6187970B1 (en) | 1996-04-24 | 2001-02-13 | Union Carbide Chemicals & Plastics Technology Corporation | Processes for producing 1,6-hexanediols |
| US5925754A (en) * | 1997-04-15 | 1999-07-20 | Union Carbide Chemicals & Plastics Technology Corporation | Epsilon caprolactam compositions |
| KR100308731B1 (ko) * | 1998-06-17 | 2001-11-14 | 박호군 | 로듐촉매/염조촉매시스템을사용한이산화탄소의수소화방법 |
| KR100322616B1 (ko) * | 2000-08-29 | 2002-03-18 | 박호군 | 로듐 촉매/염 조촉매 시스템을 사용한 올레핀의하이드로포밀화 방법 |
| GR20000100460A (el) * | 2000-12-27 | 2002-10-09 | Celanese Chemicals Europe Gmbh | Μεθοδος για την παρασκευη αλδευδων |
| WO2002094746A1 (en) * | 2001-05-25 | 2002-11-28 | Shell Internationale Research Maatschappij B.V. | Process for the preparation of linear olefins and use thereof to prepare linear alcohols |
| DE10161597B4 (de) * | 2001-12-14 | 2005-10-20 | Celanese Chem Europe Gmbh | Verfahren zur Reinigung alicyclischer Alkohole |
| US6982355B2 (en) * | 2003-08-25 | 2006-01-03 | Syntroleum Corporation | Integrated Fischer-Tropsch process for production of linear and branched alcohols and olefins |
| JP2007511599A (ja) * | 2003-11-18 | 2007-05-10 | サソール テクノロジー(プロプライエタリー)リミテッド | 酸素化生成物の製造 |
| RU2602239C1 (ru) * | 2015-07-23 | 2016-11-10 | Открытое акционерное общество "Нефтяная компания "Роснефть" | Способ гидроформилирования олефинов с6-с9 в спирты с7-с10 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2560360A (en) * | 1947-06-11 | 1951-07-10 | Standard Oil Dev Co | Synthesis of oxygenated organic compounds |
| US2755308A (en) * | 1950-09-09 | 1956-07-17 | Ruhrchemie Ag | Method for obtaining aliphatic alcohols |
| DE3413427A1 (de) * | 1984-04-10 | 1985-10-17 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3420491A1 (de) * | 1984-06-01 | 1985-12-05 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| US4578523A (en) * | 1985-05-29 | 1986-03-25 | Ruhrchemie Aktiengesellschaft | Process for the preparation of aldehydes |
| DE3546123A1 (de) * | 1985-12-24 | 1987-06-25 | Ruhrchemie Ag | Verfahren zur herstellung von aldehyden |
| DE3616057A1 (de) * | 1986-05-13 | 1987-11-19 | Ruhrchemie Ag | Verfahren zur herstellung von aldehyden |
| DE3640615A1 (de) * | 1986-11-27 | 1988-06-09 | Ruhrchemie Ag | Verfahren zur herstellung von aldehyden |
| DE3640614A1 (de) * | 1986-11-27 | 1988-06-09 | Ruhrchemie Ag | Verfahren zur herstellung von aldehyden |
| DE3726128A1 (de) * | 1987-08-06 | 1989-02-16 | Ruhrchemie Ag | Verfahren zur herstellung von aldehyden |
| JPH0669974B2 (ja) * | 1987-12-17 | 1994-09-07 | 三菱化成株式会社 | 可塑剤用アルコールの製造法 |
| DE4040315A1 (de) * | 1990-12-17 | 1992-06-25 | Hoechst Ag | Verfahren zur herstellung von aldehyden |
| KR980001353A (ko) * | 1996-06-19 | 1998-03-30 | 김영귀 | 차량항법시스템 장착 차량의 속도제한 경보방법 |
-
1992
- 1992-12-17 DE DE4242725A patent/DE4242725A1/de not_active Withdrawn
-
1993
- 1993-11-08 TW TW082109334A patent/TW257752B/zh active
- 1993-11-30 EP EP19930119242 patent/EP0602442A3/de not_active Ceased
- 1993-11-30 SG SG1996008352A patent/SG44829A1/en unknown
- 1993-12-07 US US08/163,086 patent/US6051743A/en not_active Expired - Fee Related
- 1993-12-09 CA CA002111026A patent/CA2111026A1/en not_active Abandoned
- 1993-12-09 JP JP5309456A patent/JPH0739362B2/ja not_active Expired - Lifetime
- 1993-12-10 ZA ZA939292A patent/ZA939292B/xx unknown
- 1993-12-10 KR KR1019930027168A patent/KR100304328B1/ko not_active Expired - Fee Related
- 1993-12-10 MX MX9307868A patent/MX9307868A/es not_active IP Right Cessation
- 1993-12-10 BR BR9305007A patent/BR9305007A/pt not_active Application Discontinuation
- 1993-12-15 AU AU52439/93A patent/AU664126B2/en not_active Ceased
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6756411B2 (en) | 1995-06-29 | 2004-06-29 | Sasol Technology (Proprietary) Limited | Process for producing oxygenated products |
Also Published As
| Publication number | Publication date |
|---|---|
| AU5243993A (en) | 1994-06-30 |
| BR9305007A (pt) | 1994-07-05 |
| JPH0739362B2 (ja) | 1995-05-01 |
| KR100304328B1 (ko) | 2001-11-30 |
| DE4242725A1 (de) | 1994-06-23 |
| EP0602442A3 (de) | 1994-11-09 |
| JPH06279334A (ja) | 1994-10-04 |
| MX9307868A (es) | 1994-06-30 |
| AU664126B2 (en) | 1995-11-02 |
| US6051743A (en) | 2000-04-18 |
| KR940014281A (ko) | 1994-07-18 |
| EP0602442A2 (de) | 1994-06-22 |
| SG44829A1 (en) | 1997-12-19 |
| TW257752B (enExample) | 1995-09-21 |
| ZA939292B (en) | 1994-08-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5312951A (en) | 3,4-dimethyl-2,5,6-tris(p-sulfonatophenyl)-1-phosphanorbornadiene, process for the preparation thereof and process for the hydroformylation of olefinnically unsaturated compounds | |
| US4139565A (en) | Hydroformylation using improved catalysts comprising rhodium and diphosphino ligands | |
| CA2111026A1 (en) | Process for the preparation of predominantly unbranched higher primary alcohols | |
| US4740626A (en) | Process for the preparation of aldehydes | |
| EP2114568A1 (en) | Phosphonite-containing catalysts for hydroformylation processes | |
| US5756854A (en) | Process for the hydroformylation of olefinically unsaturated compounds | |
| KR19990022086A (ko) | 플루오로-치환된 두자리 포스핀 리간드의 합성 및 이를 사용한하이드로포르밀화반응 | |
| US4795727A (en) | Rhodium catalysts and methods of preparation and use thereof | |
| JPH0140019B2 (enExample) | ||
| US4727200A (en) | Alcohol homologation | |
| US6025529A (en) | Process for preparing aldehydes | |
| PL177092B1 (pl) | Sposób hydroformylowania butadienu-1,3 | |
| CA1292246C (en) | Process for the preparation of aldehydes | |
| US5200380A (en) | Process for producing aldehydes | |
| US5223648A (en) | Process for producing aldehydes | |
| US4723047A (en) | Process for the preparation of nonadecanediols | |
| JP3410120B2 (ja) | アルコールの製造方法 | |
| US6037506A (en) | Hydroformylation process | |
| US5741941A (en) | Process for preparing aldehydes | |
| DE19630536C2 (de) | Katalysator und dessen Verwendung für die Herstellung von Aldehyden durch Hydroformylierung olefinischer Verbindungen | |
| US5801291A (en) | Process for the preparation of aldehydes by means of a catalyst system comprising rhodium and substituted diphenyldiphospines | |
| US5281744A (en) | Process for the preparation of nitriles | |
| EP0900779A2 (de) | Einstufiges Verfahren zur Herstellung von Aminen | |
| GB2256641A (en) | Hydroformylation of alpha olefins | |
| US6114588A (en) | Hydroformylation of alpha-alcohol-diolefins to dialcohols |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |