CA2086348A1 - 2-saccharinylmethyl aryl and aryloxy acetates useful as proteolytic enzyme inhibitors and compositions and method of use thereof - Google Patents
2-saccharinylmethyl aryl and aryloxy acetates useful as proteolytic enzyme inhibitors and compositions and method of use thereofInfo
- Publication number
- CA2086348A1 CA2086348A1 CA002086348A CA2086348A CA2086348A1 CA 2086348 A1 CA2086348 A1 CA 2086348A1 CA 002086348 A CA002086348 A CA 002086348A CA 2086348 A CA2086348 A CA 2086348A CA 2086348 A1 CA2086348 A1 CA 2086348A1
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- alkoxy
- hydrogen
- phenyl
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- -1 aryloxy acetates Chemical class 0.000 title claims abstract description 129
- 239000000203 mixture Substances 0.000 title claims description 93
- 238000000034 method Methods 0.000 title claims description 73
- 102000035195 Peptidases Human genes 0.000 title claims description 13
- 108091005804 Peptidases Proteins 0.000 title claims description 13
- 239000002532 enzyme inhibitor Substances 0.000 title description 3
- 208000015122 neurodegenerative disease Diseases 0.000 claims abstract description 10
- 239000001257 hydrogen Substances 0.000 claims description 68
- 229910052739 hydrogen Inorganic materials 0.000 claims description 68
- 150000001875 compounds Chemical class 0.000 claims description 66
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 40
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 39
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical group C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 claims description 38
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 34
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 33
- 150000003839 salts Chemical class 0.000 claims description 33
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 32
- 150000002431 hydrogen Chemical group 0.000 claims description 26
- 229910052736 halogen Inorganic materials 0.000 claims description 24
- 150000002367 halogens Chemical class 0.000 claims description 24
- 239000002585 base Substances 0.000 claims description 20
- 229910052757 nitrogen Inorganic materials 0.000 claims description 19
- 239000000460 chlorine Substances 0.000 claims description 13
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 13
- 125000002947 alkylene group Chemical group 0.000 claims description 12
- 229920006395 saturated elastomer Polymers 0.000 claims description 11
- 229910052783 alkali metal Inorganic materials 0.000 claims description 10
- 230000002401 inhibitory effect Effects 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 8
- 125000005518 carboxamido group Chemical group 0.000 claims description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 8
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 8
- 125000001624 naphthyl group Chemical group 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 230000002378 acidificating effect Effects 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 125000005842 heteroatom Chemical group 0.000 claims description 6
- 230000008569 process Effects 0.000 claims description 6
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 150000001242 acetic acid derivatives Chemical class 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 claims description 3
- IPZJQDSFZGZEOY-UHFFFAOYSA-N dimethylmethylene Chemical group C[C]C IPZJQDSFZGZEOY-UHFFFAOYSA-N 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000002346 iodo group Chemical group I* 0.000 claims description 2
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims 6
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 3
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 3
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- 239000002253 acid Substances 0.000 abstract description 36
- 125000003118 aryl group Chemical group 0.000 abstract description 19
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 157
- 238000006243 chemical reaction Methods 0.000 description 129
- 239000000243 solution Substances 0.000 description 117
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 109
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 91
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 88
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 87
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 85
- 238000002360 preparation method Methods 0.000 description 85
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 67
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 54
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 52
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 39
- 229940081974 saccharin Drugs 0.000 description 37
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 37
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- 229960000583 acetic acid Drugs 0.000 description 36
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 35
- 239000007787 solid Substances 0.000 description 34
- 235000019204 saccharin Nutrition 0.000 description 33
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 32
- 239000011541 reaction mixture Substances 0.000 description 32
- 235000019439 ethyl acetate Nutrition 0.000 description 31
- 239000000047 product Substances 0.000 description 29
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 26
- 239000000741 silica gel Substances 0.000 description 25
- 229910002027 silica gel Inorganic materials 0.000 description 25
- 239000002904 solvent Substances 0.000 description 25
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 238000003756 stirring Methods 0.000 description 23
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 22
- VVPUIKNICYCXJZ-UHFFFAOYSA-N 4-iodobutyl benzoate Chemical compound ICCCCOC(=O)C1=CC=CC=C1 VVPUIKNICYCXJZ-UHFFFAOYSA-N 0.000 description 21
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
- 239000012362 glacial acetic acid Substances 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- 239000012267 brine Substances 0.000 description 20
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 20
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 19
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 17
- 238000010992 reflux Methods 0.000 description 17
- 235000011054 acetic acid Nutrition 0.000 description 16
- 150000007942 carboxylates Chemical class 0.000 description 16
- 238000010438 heat treatment Methods 0.000 description 15
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- 238000000746 purification Methods 0.000 description 14
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 13
- 238000001914 filtration Methods 0.000 description 13
- 229910003002 lithium salt Inorganic materials 0.000 description 13
- 159000000002 lithium salts Chemical class 0.000 description 13
- 239000012044 organic layer Substances 0.000 description 13
- 229960004132 diethyl ether Drugs 0.000 description 12
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical class CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 12
- 239000000284 extract Substances 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- 102000004190 Enzymes Human genes 0.000 description 11
- 108090000790 Enzymes Proteins 0.000 description 11
- 229940088598 enzyme Drugs 0.000 description 11
- 238000003818 flash chromatography Methods 0.000 description 11
- 150000003254 radicals Chemical class 0.000 description 11
- ZTMWHBJKVKHBTO-UHFFFAOYSA-M sodium amino sulfate Chemical compound [Na+].NOS([O-])(=O)=O ZTMWHBJKVKHBTO-UHFFFAOYSA-M 0.000 description 11
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 10
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 10
- 125000000217 alkyl group Chemical group 0.000 description 10
- 229910021529 ammonia Inorganic materials 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 10
- 239000000543 intermediate Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 9
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 9
- 229910052744 lithium Inorganic materials 0.000 description 9
- 229910052938 sodium sulfate Inorganic materials 0.000 description 9
- 235000011152 sodium sulphate Nutrition 0.000 description 9
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 8
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- 150000007513 acids Chemical class 0.000 description 8
- DQPBABKTKYNPMH-UHFFFAOYSA-N amino hydrogen sulfate Chemical compound NOS(O)(=O)=O DQPBABKTKYNPMH-UHFFFAOYSA-N 0.000 description 8
- 235000011114 ammonium hydroxide Nutrition 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- 239000012074 organic phase Substances 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 8
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 7
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 7
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 239000000908 ammonium hydroxide Substances 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- 239000003480 eluent Substances 0.000 description 7
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 7
- OBWFJXLKRAFEDI-UHFFFAOYSA-N methyl cyanoformate Chemical compound COC(=O)C#N OBWFJXLKRAFEDI-UHFFFAOYSA-N 0.000 description 7
- 230000003647 oxidation Effects 0.000 description 7
- 238000007254 oxidation reaction Methods 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- PUYQLJDNZIEPCV-UHFFFAOYSA-N 1,1-dioxo-3a,4,5,6-tetrahydro-1,2-benzothiazol-3-one Chemical compound S1(=O)(=O)NC(=O)C2CCCC=C12 PUYQLJDNZIEPCV-UHFFFAOYSA-N 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- 206010014561 Emphysema Diseases 0.000 description 6
- 101000856199 Homo sapiens Chymotrypsin-like protease CTRL-1 Proteins 0.000 description 6
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 6
- 239000007832 Na2SO4 Substances 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 150000001450 anions Chemical class 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 6
- 238000006264 debenzylation reaction Methods 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- 235000011181 potassium carbonates Nutrition 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- SGQJHTPAGPKONZ-UHFFFAOYSA-N 6-methoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(OC)=CC2=C1C(=O)NS2(=O)=O SGQJHTPAGPKONZ-UHFFFAOYSA-N 0.000 description 5
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 102000012479 Serine Proteases Human genes 0.000 description 5
- 108010022999 Serine Proteases Proteins 0.000 description 5
- 150000003863 ammonium salts Chemical class 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 230000003197 catalytic effect Effects 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 5
- 150000003475 thallium Chemical class 0.000 description 5
- LWVDCUCGKCOXLT-UHFFFAOYSA-N 4-methyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=CC=CC2=C1C(=O)NS2(=O)=O LWVDCUCGKCOXLT-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 102100025566 Chymotrypsin-like protease CTRL-1 Human genes 0.000 description 4
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- 101000851058 Homo sapiens Neutrophil elastase Proteins 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- 102100033174 Neutrophil elastase Human genes 0.000 description 4
- 240000007594 Oryza sativa Species 0.000 description 4
- 235000007164 Oryza sativa Nutrition 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 4
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 4
- 239000011260 aqueous acid Substances 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-M benzoate Chemical compound [O-]C(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-M 0.000 description 4
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical compound O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 239000012954 diazonium Substances 0.000 description 4
- 150000001989 diazonium salts Chemical class 0.000 description 4
- 230000002901 elastaselike Effects 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 230000002779 inactivation Effects 0.000 description 4
- 238000002955 isolation Methods 0.000 description 4
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 4
- 206010039073 rheumatoid arthritis Diseases 0.000 description 4
- 235000009566 rice Nutrition 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- DVSLBDBGAXXLKZ-UHFFFAOYSA-N 2,3-diethylbenzamide Chemical compound CCC1=CC=CC(C(N)=O)=C1CC DVSLBDBGAXXLKZ-UHFFFAOYSA-N 0.000 description 3
- BXQOWUSZAWCFIL-UHFFFAOYSA-N 2-benzyl-5-chloro-1,2-thiazol-3-one Chemical compound S1C(Cl)=CC(=O)N1CC1=CC=CC=C1 BXQOWUSZAWCFIL-UHFFFAOYSA-N 0.000 description 3
- QZHSLVWCHZTCPQ-UHFFFAOYSA-N 2-benzyl-5-chloro-1-oxo-1,2-thiazol-3-one Chemical compound O=S1C(Cl)=CC(=O)N1CC1=CC=CC=C1 QZHSLVWCHZTCPQ-UHFFFAOYSA-N 0.000 description 3
- DDIIAJRLFATEEE-UHFFFAOYSA-N 2-methyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(C)C(=O)C2=C1 DDIIAJRLFATEEE-UHFFFAOYSA-N 0.000 description 3
- NNNBYOYSLQUCNI-UHFFFAOYSA-N 4-chloro-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound ClC1=CC=CC2=C1C(=O)NS2(=O)=O NNNBYOYSLQUCNI-UHFFFAOYSA-N 0.000 description 3
- IELNXGPPRWLPCZ-UHFFFAOYSA-N 4-methoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC=CC2=C1C(=O)NS2(=O)=O IELNXGPPRWLPCZ-UHFFFAOYSA-N 0.000 description 3
- QBZUIAHJZRGHRJ-UHFFFAOYSA-N 6-hydroxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(O)=CC2=C1C(=O)NS2(=O)=O QBZUIAHJZRGHRJ-UHFFFAOYSA-N 0.000 description 3
- HZZFBUZSKAVIOV-UHFFFAOYSA-N 6-nitro-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound [O-][N+](=O)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 HZZFBUZSKAVIOV-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 3
- DIWVBIXQCNRCFE-UHFFFAOYSA-N DL-alpha-Methoxyphenylacetic acid Chemical compound COC(C(O)=O)C1=CC=CC=C1 DIWVBIXQCNRCFE-UHFFFAOYSA-N 0.000 description 3
- 238000000023 Kugelrohr distillation Methods 0.000 description 3
- 229910017974 NH40H Inorganic materials 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 206010033645 Pancreatitis Diseases 0.000 description 3
- 229930040373 Paraformaldehyde Natural products 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 125000000539 amino acid group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000010533 azeotropic distillation Methods 0.000 description 3
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000012512 characterization method Methods 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 229960003280 cupric chloride Drugs 0.000 description 3
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 3
- DZFYOYRNBGNPJW-UHFFFAOYSA-N ethoxythallium Chemical compound [Tl+].CC[O-] DZFYOYRNBGNPJW-UHFFFAOYSA-N 0.000 description 3
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 3
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 125000001072 heteroaryl group Chemical group 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- OFCCYDUUBNUJIB-UHFFFAOYSA-N n,n-diethylcarbamoyl chloride Chemical compound CCN(CC)C(Cl)=O OFCCYDUUBNUJIB-UHFFFAOYSA-N 0.000 description 3
- 229920002866 paraformaldehyde Polymers 0.000 description 3
- 150000004965 peroxy acids Chemical class 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 150000003462 sulfoxides Chemical class 0.000 description 3
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 3
- 238000012546 transfer Methods 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- HUXJXNSHCKHFIL-UHFFFAOYSA-N 1-(2-bromoethoxy)-2-methoxyethane Chemical compound COCCOCCBr HUXJXNSHCKHFIL-UHFFFAOYSA-N 0.000 description 2
- IFCXRNRLQRXPJP-UHFFFAOYSA-N 1-oxo-1-sulfanylidene-6-(trifluoromethyl)-1,2-benzothiazol-3-one Chemical compound FC(F)(F)C1=CC=C2C(=O)NS(=O)(=S)C2=C1 IFCXRNRLQRXPJP-UHFFFAOYSA-N 0.000 description 2
- CUTVBDNGHSDKJQ-UHFFFAOYSA-N 2-(bromomethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(CBr)C(=O)C2=C1 CUTVBDNGHSDKJQ-UHFFFAOYSA-N 0.000 description 2
- RFAHYFCQZDZXLP-UHFFFAOYSA-N 2-(chloromethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(CCl)C(=O)C2=C1 RFAHYFCQZDZXLP-UHFFFAOYSA-N 0.000 description 2
- IAVWIJNTOZKJNL-UHFFFAOYSA-N 2-(chloromethyl)-6-methoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(OC)=CC2=C1C(=O)N(CCl)S2(=O)=O IAVWIJNTOZKJNL-UHFFFAOYSA-N 0.000 description 2
- HHDDUPZAXJPTQF-UHFFFAOYSA-N 2-(chloromethyl)-6-methoxy-1,1-dioxo-4-propan-2-yl-4,5,6,7-tetrahydro-1,2-benzothiazol-3-one Chemical compound C1C(OC)CC(C(C)C)C2=C1S(=O)(=O)N(CCl)C2=O HHDDUPZAXJPTQF-UHFFFAOYSA-N 0.000 description 2
- PZWPTWZDBJUEMM-UHFFFAOYSA-N 2-(hydroxymethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(CO)C(=O)C2=C1 PZWPTWZDBJUEMM-UHFFFAOYSA-N 0.000 description 2
- VRIWDDSMUSKLDG-UHFFFAOYSA-N 2-benzyl-1,1-dioxo-4-propan-2-yl-4,5,7,7a-tetrahydro-3ah-1,2-benzothiazole-3,6-dione Chemical compound CC(C)C1CC(=O)CC(S2(=O)=O)C1C(=O)N2CC1=CC=CC=C1 VRIWDDSMUSKLDG-UHFFFAOYSA-N 0.000 description 2
- KUKANSABISBCHB-UHFFFAOYSA-N 2-benzyl-6-hydroxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(O)=CC(S2(=O)=O)=C1C(=O)N2CC1=CC=CC=C1 KUKANSABISBCHB-UHFFFAOYSA-N 0.000 description 2
- INDJCCHBFRVERC-UHFFFAOYSA-N 2-ethenyl-n,n-diethyl-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(C=C)C=CC=C1S(N)(=O)=O INDJCCHBFRVERC-UHFFFAOYSA-N 0.000 description 2
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 2
- IITQJMYAYSNIMI-UHFFFAOYSA-N 3-Methyl-2-cyclohexen-1-one Chemical compound CC1=CC(=O)CCC1 IITQJMYAYSNIMI-UHFFFAOYSA-N 0.000 description 2
- BANIKQOYSWTYOZ-UHFFFAOYSA-N 4,7-dimethyl-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound CC1=CC=C(C)C(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 BANIKQOYSWTYOZ-UHFFFAOYSA-N 0.000 description 2
- LKDMKWNDBAVNQZ-UHFFFAOYSA-N 4-[[1-[[1-[2-[[1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)NC(C)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(C(=O)NC=1C=CC(=CC=1)[N+]([O-])=O)CC1=CC=CC=C1 LKDMKWNDBAVNQZ-UHFFFAOYSA-N 0.000 description 2
- JQSVXJNTPDVVKM-UHFFFAOYSA-N 4-amino-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound NC1=CC=CC2=C1C(=O)NS2(=O)=O JQSVXJNTPDVVKM-UHFFFAOYSA-N 0.000 description 2
- IBGQMFDJANKDLZ-UHFFFAOYSA-N 4-bromobicyclo[2.2.1]heptane Chemical compound C1CC2CCC1(Br)C2 IBGQMFDJANKDLZ-UHFFFAOYSA-N 0.000 description 2
- AZGZINIKGIDBPR-UHFFFAOYSA-N 4-chloro-2-(hydroxymethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=S1(=O)N(CO)C(=O)C2=C1C=CC=C2Cl AZGZINIKGIDBPR-UHFFFAOYSA-N 0.000 description 2
- ZTNXVVOWKTYVFQ-UHFFFAOYSA-N 4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CCC1=CC=CC2=C1C(=O)NS2(=O)=O ZTNXVVOWKTYVFQ-UHFFFAOYSA-N 0.000 description 2
- NRPFNQUDKRYCNX-UHFFFAOYSA-N 4-methoxyphenylacetic acid Chemical compound COC1=CC=C(CC(O)=O)C=C1 NRPFNQUDKRYCNX-UHFFFAOYSA-N 0.000 description 2
- SGXKWDMCEXVTQI-UHFFFAOYSA-N 6-(dimethylamino)-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(N(C)C)=CC2=C1C(=O)NS2(=O)=O SGXKWDMCEXVTQI-UHFFFAOYSA-N 0.000 description 2
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 206010006458 Bronchitis chronic Diseases 0.000 description 2
- 108090000617 Cathepsin G Proteins 0.000 description 2
- 102100025975 Cathepsin G Human genes 0.000 description 2
- 201000003883 Cystic fibrosis Diseases 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 2
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000283891 Kobus Species 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 108010067372 Pancreatic elastase Proteins 0.000 description 2
- 102000016387 Pancreatic elastase Human genes 0.000 description 2
- 206010034277 Pemphigoid Diseases 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 201000004681 Psoriasis Diseases 0.000 description 2
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 2
- LGPYGVFCRQDPEQ-UHFFFAOYSA-N S-chloro N,N-dimethylcarbamothioate Chemical compound CN(C(=O)SCl)C LGPYGVFCRQDPEQ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 208000011341 adult acute respiratory distress syndrome Diseases 0.000 description 2
- 201000000028 adult respiratory distress syndrome Diseases 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 238000005574 benzylation reaction Methods 0.000 description 2
- 125000001743 benzylic group Chemical group 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 206010006451 bronchitis Diseases 0.000 description 2
- 208000000594 bullous pemphigoid Diseases 0.000 description 2
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical class [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- LLSMWLJPWFSMCP-UHFFFAOYSA-N chloromethylsulfanylbenzene Chemical compound ClCSC1=CC=CC=C1 LLSMWLJPWFSMCP-UHFFFAOYSA-N 0.000 description 2
- 208000007451 chronic bronchitis Diseases 0.000 description 2
- 229960002376 chymotrypsin Drugs 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 2
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000003602 elastase inhibitor Substances 0.000 description 2
- 230000002849 elastaseinhibitory effect Effects 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 229940052303 ethers for general anesthesia Drugs 0.000 description 2
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- RBBOWEDMXHTEPA-UHFFFAOYSA-N hexane;toluene Chemical compound CCCCCC.CC1=CC=CC=C1 RBBOWEDMXHTEPA-UHFFFAOYSA-N 0.000 description 2
- 210000003630 histaminocyte Anatomy 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- BXRYSXCIRIKKJV-UHFFFAOYSA-N methyl 2-amino-6-chlorobenzoate Chemical compound COC(=O)C1=C(N)C=CC=C1Cl BXRYSXCIRIKKJV-UHFFFAOYSA-N 0.000 description 2
- HCLLOQLXKCCWLJ-UHFFFAOYSA-N methyl 2-amino-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1N HCLLOQLXKCCWLJ-UHFFFAOYSA-N 0.000 description 2
- 229940095102 methyl benzoate Drugs 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 230000007420 reactivation Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- XSNIGDABGWCQOG-UHFFFAOYSA-N (1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl) acetate Chemical compound CC(C)C1=CC(OC(C)=O)=CC2=C1C(=O)NS2(=O)=O XSNIGDABGWCQOG-UHFFFAOYSA-N 0.000 description 1
- JALHAHUHYYTNHP-UHFFFAOYSA-N (1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl) naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OC=3C=C(C4=C(S(NC4=O)(=O)=O)C=3)C(C)C)=CC=CC2=C1 JALHAHUHYYTNHP-UHFFFAOYSA-N 0.000 description 1
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- MAUMSNABMVEOGP-UHFFFAOYSA-N (methyl-$l^{2}-azanyl)methane Chemical compound C[N]C MAUMSNABMVEOGP-UHFFFAOYSA-N 0.000 description 1
- ZVKSLBGDPPAOOB-UHFFFAOYSA-N 1,1,3-trioxo-1,2-benzothiazole-4-carbonitrile Chemical compound C1=CC(C#N)=C2C(=O)NS(=O)(=O)C2=C1 ZVKSLBGDPPAOOB-UHFFFAOYSA-N 0.000 description 1
- XKFVBPBRLDQVSH-UHFFFAOYSA-N 1,1,3-trioxo-1,2-benzothiazole-6-carbaldehyde Chemical compound O=CC1=CC=C2C(=O)NS(=O)(=O)C2=C1 XKFVBPBRLDQVSH-UHFFFAOYSA-N 0.000 description 1
- ITNOKSZSFCACOE-UHFFFAOYSA-N 1,1,3-trioxo-1,2-benzothiazole-6-carbonitrile Chemical compound N#CC1=CC=C2C(=O)NS(=O)(=O)C2=C1 ITNOKSZSFCACOE-UHFFFAOYSA-N 0.000 description 1
- CRSHTYPFKXPVRE-UHFFFAOYSA-N 1,1,3-trioxo-1,2-benzothiazole-6-sulfonamide Chemical compound NS(=O)(=O)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CRSHTYPFKXPVRE-UHFFFAOYSA-N 0.000 description 1
- NIIUOWMRLBGYAG-UHFFFAOYSA-N 1,1-dioxo-2-(2-trimethylsilylethyl)-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(CC[Si](C)(C)C)C(=O)C2=C1 NIIUOWMRLBGYAG-UHFFFAOYSA-N 0.000 description 1
- ZSWYICNLNOGISL-UHFFFAOYSA-N 1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical class O=S1(=O)C2=CC=CC=C2C(=O)N1CSC1=CC=CC=C1 ZSWYICNLNOGISL-UHFFFAOYSA-N 0.000 description 1
- ZQYWVWZVMZOZIB-UHFFFAOYSA-N 1,1-dioxo-4,5,6,7-tetrahydro-1,2-benzothiazol-3-one Chemical class C1CCCC2=C1C(=O)NS2(=O)=O ZQYWVWZVMZOZIB-UHFFFAOYSA-N 0.000 description 1
- RGYWIBZTUKOCGE-UHFFFAOYSA-N 1,1-dioxo-4-pentan-3-yl-1,2-benzothiazol-3-one Chemical compound CCC(CC)C1=CC=CC2=C1C(=O)NS2(=O)=O RGYWIBZTUKOCGE-UHFFFAOYSA-N 0.000 description 1
- KMBDZHBHOCMZAX-UHFFFAOYSA-N 1,1-dioxo-4-phenyl-1,2-benzothiazol-3-one Chemical compound C=12C(=O)NS(=O)(=O)C2=CC=CC=1C1=CC=CC=C1 KMBDZHBHOCMZAX-UHFFFAOYSA-N 0.000 description 1
- HKRGCFFQZCGKRD-UHFFFAOYSA-N 1,1-dioxo-4-phenyl-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC=CC(C=3C=CC=CC=3)=C2C(=O)N1CSC1=CC=CC=C1 HKRGCFFQZCGKRD-UHFFFAOYSA-N 0.000 description 1
- RKGSYHBHQGNXAU-UHFFFAOYSA-N 1,1-dioxo-4-propan-2-yl-6-pyrrolidin-1-yl-1,2-benzothiazol-3-one Chemical compound C=1C(S(NC2=O)(=O)=O)=C2C(C(C)C)=CC=1N1CCCC1 RKGSYHBHQGNXAU-UHFFFAOYSA-N 0.000 description 1
- RITZCUCBOPEGKB-UHFFFAOYSA-N 1,1-dioxo-6-piperazin-1-yl-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound C=1C(S(NC2=O)(=O)=O)=C2C(C(C)C)=CC=1N1CCNCC1 RITZCUCBOPEGKB-UHFFFAOYSA-N 0.000 description 1
- NPTUSVCPIWQPHQ-UHFFFAOYSA-N 1,1-dioxo-6-piperidin-1-yl-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound C=1C(S(NC2=O)(=O)=O)=C2C(C(C)C)=CC=1N1CCCCC1 NPTUSVCPIWQPHQ-UHFFFAOYSA-N 0.000 description 1
- TVFJIXAFZXREJQ-UHFFFAOYSA-N 1,2-thiazole-5-carbaldehyde Chemical compound O=CC1=CC=NS1 TVFJIXAFZXREJQ-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 1
- LISSJQBGLGIZPW-UHFFFAOYSA-N 1-butan-2-yloxy-n-(butan-2-yloxymethyl)-n-methylmethanamine Chemical compound CCC(C)OCN(C)COC(C)CC LISSJQBGLGIZPW-UHFFFAOYSA-N 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- WGUXTQDCAZNJIF-UHFFFAOYSA-N 1-methyl-3,5-bis(trifluoromethyl)benzene Chemical compound CC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 WGUXTQDCAZNJIF-UHFFFAOYSA-N 0.000 description 1
- ILNRXPSWGKLNPY-UHFFFAOYSA-N 1-oxo-6-phenyl-4-propan-2-yl-1-sulfanylidene-1,2-benzothiazol-3-one Chemical compound C=1C(S(NC2=O)(=O)=S)=C2C(C(C)C)=CC=1C1=CC=CC=C1 ILNRXPSWGKLNPY-UHFFFAOYSA-N 0.000 description 1
- NMCDNQJLWNTMJH-UHFFFAOYSA-N 12,12-dioxo-2,4-dioxa-12lambda6-thia-1-azatricyclo[7.2.1.05,10]dodeca-5(10),6,8-trien-11-one Chemical compound C1ON2S(=O)(=O)C3=CC=CC(=C3C2=O)O1 NMCDNQJLWNTMJH-UHFFFAOYSA-N 0.000 description 1
- KVIUXRJCBBXEGJ-UHFFFAOYSA-N 2,4-dimethoxybenzoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C(OC)=C1 KVIUXRJCBBXEGJ-UHFFFAOYSA-N 0.000 description 1
- GXXXUZIRGXYDFP-UHFFFAOYSA-N 2-(4-methylphenyl)acetic acid Chemical compound CC1=CC=C(CC(O)=O)C=C1 GXXXUZIRGXYDFP-UHFFFAOYSA-N 0.000 description 1
- KFHDKNYCWMFARS-UHFFFAOYSA-N 2-(chloromethyl)-1,1-dioxo-3a,4,5,6-tetrahydro-1,2-benzothiazol-3-one Chemical class C1CCC=C2S(=O)(=O)N(CCl)C(=O)C21 KFHDKNYCWMFARS-UHFFFAOYSA-N 0.000 description 1
- YVUYZGVGQHCNPN-UHFFFAOYSA-N 2-(chloromethyl)-1,1-dioxo-4-pentan-3-yl-1,2-benzothiazol-3-one Chemical compound CCC(CC)C1=CC=CC2=C1C(=O)N(CCl)S2(=O)=O YVUYZGVGQHCNPN-UHFFFAOYSA-N 0.000 description 1
- DTRAMHZJAGWMIU-UHFFFAOYSA-N 2-(chloromethyl)-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC=CC2=C1C(=O)N(CCl)S2(=O)=O DTRAMHZJAGWMIU-UHFFFAOYSA-N 0.000 description 1
- JGUVRAIJJVSETO-UHFFFAOYSA-N 2-(chloromethyl)-4,7-dimethyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=CC=C(C)C2=C1C(=O)N(CCl)S2(=O)=O JGUVRAIJJVSETO-UHFFFAOYSA-N 0.000 description 1
- SZVHEAIPGDZOAG-UHFFFAOYSA-N 2-(chloromethyl)-4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CCC1=CC=CC2=C1C(=O)N(CCl)S2(=O)=O SZVHEAIPGDZOAG-UHFFFAOYSA-N 0.000 description 1
- OVRHSSRDYIYHTO-UHFFFAOYSA-N 2-(chloromethyl)-4-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound OC1=CC=CC2=C1C(=O)N(CCl)S2(=O)=O OVRHSSRDYIYHTO-UHFFFAOYSA-N 0.000 description 1
- MXYHEVHFDJKNHN-UHFFFAOYSA-N 2-(chloromethyl)-6-hydroxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(O)=CC2=C1C(=O)N(CCl)S2(=O)=O MXYHEVHFDJKNHN-UHFFFAOYSA-N 0.000 description 1
- XBGHUXIIPRPVRF-UHFFFAOYSA-N 2-(chloromethyl)-6-nitro-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound [O-][N+](=O)C1=CC=C2C(=O)N(CCl)S(=O)(=O)C2=C1 XBGHUXIIPRPVRF-UHFFFAOYSA-N 0.000 description 1
- YEVUJTJCNAOPEF-UHFFFAOYSA-N 2-(dibenzylamino)benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 YEVUJTJCNAOPEF-UHFFFAOYSA-N 0.000 description 1
- UZUPYNAQIMGZMO-UHFFFAOYSA-N 2-(dimethylamino)-n,n-diethylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1N(C)C UZUPYNAQIMGZMO-UHFFFAOYSA-N 0.000 description 1
- DLYXOFNUYLZPCF-UHFFFAOYSA-N 2-(iodomethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical class C1=CC=C2S(=O)(=O)N(CI)C(=O)C2=C1 DLYXOFNUYLZPCF-UHFFFAOYSA-N 0.000 description 1
- LWTXRSWGLSFPSU-UHFFFAOYSA-N 2-(trichloromethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(Cl)(Cl)Cl LWTXRSWGLSFPSU-UHFFFAOYSA-N 0.000 description 1
- MXIUWSYTQJLIKE-UHFFFAOYSA-N 2-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=CC=C1C(Cl)=O MXIUWSYTQJLIKE-UHFFFAOYSA-N 0.000 description 1
- LAZKSSYOKYWMRN-UHFFFAOYSA-N 2-[(2,2,2-trifluoroacetyl)amino]benzoic acid Chemical class OC(=O)C1=CC=CC=C1NC(=O)C(F)(F)F LAZKSSYOKYWMRN-UHFFFAOYSA-N 0.000 description 1
- HNORVZDAANCHAY-UHFFFAOYSA-N 2-[4-(trifluoromethyl)phenyl]acetic acid Chemical compound OC(=O)CC1=CC=C(C(F)(F)F)C=C1 HNORVZDAANCHAY-UHFFFAOYSA-N 0.000 description 1
- SZCPTRGBOVXVCA-UHFFFAOYSA-N 2-amino-6-chlorobenzoic acid Chemical compound NC1=CC=CC(Cl)=C1C(O)=O SZCPTRGBOVXVCA-UHFFFAOYSA-N 0.000 description 1
- XHYVBIXKORFHFM-UHFFFAOYSA-N 2-amino-6-methylbenzoic acid Chemical compound CC1=CC=CC(N)=C1C(O)=O XHYVBIXKORFHFM-UHFFFAOYSA-N 0.000 description 1
- XHKUSCPWTGRCHR-UHFFFAOYSA-N 2-benzyl-1,1,3-trioxo-1,2-benzothiazole-6-carbonitrile Chemical compound O=S1(=O)C2=CC(C#N)=CC=C2C(=O)N1CC1=CC=CC=C1 XHKUSCPWTGRCHR-UHFFFAOYSA-N 0.000 description 1
- JLGPMOJYECOCEP-UHFFFAOYSA-N 2-benzyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC=CC=C2C(=O)N1CC1=CC=CC=C1 JLGPMOJYECOCEP-UHFFFAOYSA-N 0.000 description 1
- XFYAYXIMRLTTOH-UHFFFAOYSA-N 2-benzyl-1,1-dioxo-4-propan-2-yl-6-sulfanyl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(S)=CC(S2(=O)=O)=C1C(=O)N2CC1=CC=CC=C1 XFYAYXIMRLTTOH-UHFFFAOYSA-N 0.000 description 1
- UJFZDOCYWCYDMB-UHFFFAOYSA-N 2-benzyl-1,2-thiazol-3-one Chemical compound O=C1C=CSN1CC1=CC=CC=C1 UJFZDOCYWCYDMB-UHFFFAOYSA-N 0.000 description 1
- RWTYHCVZDFSHBD-UHFFFAOYSA-N 2-benzyl-4,7-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC=C(OC)C(S2(=O)=O)=C1C(=O)N2CC1=CC=CC=C1 RWTYHCVZDFSHBD-UHFFFAOYSA-N 0.000 description 1
- UOXVVFAKFSWMME-UHFFFAOYSA-N 2-benzyl-6-methoxy-1,1-dioxo-4-propan-2-yl-3a,4,5,6-tetrahydro-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC(OC)CC(C(C)C)C2C(=O)N1CC1=CC=CC=C1 UOXVVFAKFSWMME-UHFFFAOYSA-N 0.000 description 1
- AYFDJVUCZAHQPT-UHFFFAOYSA-N 2-benzyl-6-nitro-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC([N+](=O)[O-])=CC=C2C(=O)N1CC1=CC=CC=C1 AYFDJVUCZAHQPT-UHFFFAOYSA-N 0.000 description 1
- ZFPNXMCVMCSIJD-UHFFFAOYSA-N 2-benzyl-7-hydroxy-4-methoxy-1-oxo-1,2-benzothiazol-3-one Chemical compound COC1=CC=C(O)C(S2=O)=C1C(=O)N2CC1=CC=CC=C1 ZFPNXMCVMCSIJD-UHFFFAOYSA-N 0.000 description 1
- TUBMCKKTQQWJAN-UHFFFAOYSA-N 2-benzylsulfanylcyclohexane-1-carboxylic acid Chemical class OC(=O)C1CCCCC1SCC1=CC=CC=C1 TUBMCKKTQQWJAN-UHFFFAOYSA-N 0.000 description 1
- ONMSBNJJCUCYED-UHFFFAOYSA-N 2-bromo-n,n-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1Br ONMSBNJJCUCYED-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- OIMCPRDFGPEXAU-UHFFFAOYSA-N 2-ethenyl-n,n-diethylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1C=C OIMCPRDFGPEXAU-UHFFFAOYSA-N 0.000 description 1
- XUDBVJCTLZTSDC-UHFFFAOYSA-N 2-ethenylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C=C XUDBVJCTLZTSDC-UHFFFAOYSA-N 0.000 description 1
- VFOZPUQEFHZHBT-UHFFFAOYSA-N 2-ethenylbenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1C=C VFOZPUQEFHZHBT-UHFFFAOYSA-N 0.000 description 1
- FHUFFVIITDISHQ-UHFFFAOYSA-N 2-ethoxyfuran Chemical compound CCOC1=CC=CO1 FHUFFVIITDISHQ-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- MFSJUURIAOOSJR-UHFFFAOYSA-N 2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)benzoic acid Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(O)C(C(O)=O)=C1 MFSJUURIAOOSJR-UHFFFAOYSA-N 0.000 description 1
- YYEROYLAYAVZNW-UHFFFAOYSA-N 2-methyl-2-phenylpropanoic acid Chemical compound OC(=O)C(C)(C)C1=CC=CC=C1 YYEROYLAYAVZNW-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- IQANHWBWTVLDTP-UHFFFAOYSA-N 2-methylhex-3-ene Chemical compound CCC=CC(C)C IQANHWBWTVLDTP-UHFFFAOYSA-N 0.000 description 1
- WCIYEHWFYVYBCD-UHFFFAOYSA-N 2-propan-2-yl-1,3-dioxole Chemical compound CC(C)C1OC=CO1 WCIYEHWFYVYBCD-UHFFFAOYSA-N 0.000 description 1
- HUGIJKFCHAUNBD-UHFFFAOYSA-N 2-t-butyl-4,5, 6, 7-tetrahydro-4,7-methano-1,2-benzisothiazol-3(2h) one 1,1-dioxide Chemical compound C1CC2C(C(=O)N(S3(=O)=O)C(C)(C)C)=C3C1C2 HUGIJKFCHAUNBD-UHFFFAOYSA-N 0.000 description 1
- NGQWLJWMSAFWFI-UHFFFAOYSA-N 3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)piperidine-2,6-dione Chemical class O=S1(=O)C2=CC=CC=C2C(=O)N1C1CCC(=O)NC1=O NGQWLJWMSAFWFI-UHFFFAOYSA-N 0.000 description 1
- QDFXRVAOBHEBGJ-UHFFFAOYSA-N 3-(cyclononen-1-yl)-4,5,6,7,8,9-hexahydro-1h-diazonine Chemical compound C1CCCCCCC=C1C1=NNCCCCCC1 QDFXRVAOBHEBGJ-UHFFFAOYSA-N 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- KMESBORVLUNDRD-UHFFFAOYSA-N 4,6-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC(OC)=CC2=C1C(=O)NS2(=O)=O KMESBORVLUNDRD-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical group CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- BHHUJKQASFYDMY-UHFFFAOYSA-N 4,7-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC=C(OC)C2=C1C(=O)NS2(=O)=O BHHUJKQASFYDMY-UHFFFAOYSA-N 0.000 description 1
- SLRSBRRNLBPRSE-UHFFFAOYSA-N 4,7-dimethoxy-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound COC1=CC=C(OC)C(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 SLRSBRRNLBPRSE-UHFFFAOYSA-N 0.000 description 1
- YRWHBHJLSKSUGV-UHFFFAOYSA-N 4,7-dimethyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=CC=C(C)C2=C1C(=O)NS2(=O)=O YRWHBHJLSKSUGV-UHFFFAOYSA-N 0.000 description 1
- XOAKQCOPHMCADA-UHFFFAOYSA-N 4,8-dioxatricyclo[5.1.0.03,5]octane Chemical compound C1C2OC2CC2OC12 XOAKQCOPHMCADA-UHFFFAOYSA-N 0.000 description 1
- WRZQODRUZZFIIS-UHFFFAOYSA-N 4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzene-1,3-dicarbonitrile Chemical compound O=S1(=O)C2=CC=CC=C2C(=O)N1C1=CC=C(C#N)C=C1C#N WRZQODRUZZFIIS-UHFFFAOYSA-N 0.000 description 1
- VHABQMJQVSVXLO-UHFFFAOYSA-N 4-(1,2-thiazol-5-yl)but-3-enoic acid Chemical compound OC(=O)CC=CC1=CC=NS1 VHABQMJQVSVXLO-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- ADRXLXWTOCCETF-UHFFFAOYSA-N 4-(chloromethyl)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one Chemical compound O=C1N(CCl)S(=O)(=O)C2=C1C1C(C)(C)C2CC1 ADRXLXWTOCCETF-UHFFFAOYSA-N 0.000 description 1
- WWKXYISWIVLMJW-UHFFFAOYSA-N 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.2.02,6]undec-2(6)-en-5-one Chemical compound C1CC2CCC1C1=C2SN(CCl)C1=O WWKXYISWIVLMJW-UHFFFAOYSA-N 0.000 description 1
- DVMYPDXIXIJXLA-UHFFFAOYSA-N 4-(dimethylamino)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CN(C)C1=CC=CC2=C1C(=O)NS2(=O)=O DVMYPDXIXIJXLA-UHFFFAOYSA-N 0.000 description 1
- URXOMQYPMBJYBN-UHFFFAOYSA-N 4-(methylamino)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CNC1=CC=CC2=C1C(=O)NS2(=O)=O URXOMQYPMBJYBN-UHFFFAOYSA-N 0.000 description 1
- LNIAVCRNJMPGGT-UHFFFAOYSA-N 4-(trichloromethyl)benzoyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)(Cl)Cl)C=C1 LNIAVCRNJMPGGT-UHFFFAOYSA-N 0.000 description 1
- KWXVDUACPKJCCN-UHFFFAOYSA-N 4-[(3,4-diethoxyphenyl)methylamino]benzenecarboximidamide Chemical compound C1=C(OCC)C(OCC)=CC=C1CNC1=CC=C(C(N)=N)C=C1 KWXVDUACPKJCCN-UHFFFAOYSA-N 0.000 description 1
- FCBABQMEBSCFOO-UHFFFAOYSA-N 4-bromo-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound BrC1=CC=CC2=C1C(=O)NS2(=O)=O FCBABQMEBSCFOO-UHFFFAOYSA-N 0.000 description 1
- ZPCKQBQECBZKGN-UHFFFAOYSA-N 4-bromo-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound BrC1=CC=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 ZPCKQBQECBZKGN-UHFFFAOYSA-N 0.000 description 1
- PBBOILKYLRUPDE-UHFFFAOYSA-N 4-bromo-2-(chloromethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=S1(=O)N(CCl)C(=O)C2=C1C=CC=C2Br PBBOILKYLRUPDE-UHFFFAOYSA-N 0.000 description 1
- ZKIUBOCVOSYTQM-UHFFFAOYSA-N 4-cyclohexyl-n,n-diethyl-2-sulfamoylbenzamide Chemical compound C1=C(S(N)(=O)=O)C(C(=O)N(CC)CC)=CC=C1C1CCCCC1 ZKIUBOCVOSYTQM-UHFFFAOYSA-N 0.000 description 1
- SXTPWXBNAVFJOU-UHFFFAOYSA-N 4-cyclohexyl-n,n-diethylbenzamide Chemical compound C1=CC(C(=O)N(CC)CC)=CC=C1C1CCCCC1 SXTPWXBNAVFJOU-UHFFFAOYSA-N 0.000 description 1
- QCIWHVKGVVQHIY-UHFFFAOYSA-N 4-cyclohexylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1CCCCC1 QCIWHVKGVVQHIY-UHFFFAOYSA-N 0.000 description 1
- MWLQEWDQXQHQED-UHFFFAOYSA-N 4-cyclohexylbenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1CCCCC1 MWLQEWDQXQHQED-UHFFFAOYSA-N 0.000 description 1
- OBMBHMCHENCLTH-UHFFFAOYSA-N 4-ethenyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C=CC1=CC=CC2=C1C(=O)NS2(=O)=O OBMBHMCHENCLTH-UHFFFAOYSA-N 0.000 description 1
- OYVPFSNXVMVCFC-UHFFFAOYSA-N 4-ethyl-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound CCC1=CC=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 OYVPFSNXVMVCFC-UHFFFAOYSA-N 0.000 description 1
- KJJBFZOTCYGZIF-UHFFFAOYSA-N 4-ethynyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC(C#C)=C2C(=O)NS(=O)(=O)C2=C1 KJJBFZOTCYGZIF-UHFFFAOYSA-N 0.000 description 1
- DWWDNPIWPBIMOA-UHFFFAOYSA-N 4-fluoro-2-propan-2-ylbenzoic acid Chemical compound CC(C)C1=CC(F)=CC=C1C(O)=O DWWDNPIWPBIMOA-UHFFFAOYSA-N 0.000 description 1
- VLIFCVKBFRCCQT-UHFFFAOYSA-N 4-fluoro-2-propan-2-ylbenzoyl chloride Chemical compound CC(C)C1=CC(F)=CC=C1C(Cl)=O VLIFCVKBFRCCQT-UHFFFAOYSA-N 0.000 description 1
- MWZZSFRLIDAWLU-UHFFFAOYSA-N 4-methoxy-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound COC1=CC=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 MWZZSFRLIDAWLU-UHFFFAOYSA-N 0.000 description 1
- RZDVCYHZYFLUNA-UHFFFAOYSA-N 4-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC(C)(C)C1=CC=CC2=C1C(=O)NS2(=O)=O RZDVCYHZYFLUNA-UHFFFAOYSA-N 0.000 description 1
- MXSDZUWKKIYILM-UHFFFAOYSA-N 4-tert-butyl-2-(chloromethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC(C)(C)C1=CC=CC2=C1C(=O)N(CCl)S2(=O)=O MXSDZUWKKIYILM-UHFFFAOYSA-N 0.000 description 1
- QWJWPDHACGGABF-UHFFFAOYSA-N 5,5-dimethylcyclopenta-1,3-diene Chemical compound CC1(C)C=CC=C1 QWJWPDHACGGABF-UHFFFAOYSA-N 0.000 description 1
- DHKUQTIUQLTJRK-UHFFFAOYSA-N 6,7-dihydro-5h-1,2-benzothiazol-4-one Chemical compound O=C1CCCC2=C1C=NS2 DHKUQTIUQLTJRK-UHFFFAOYSA-N 0.000 description 1
- QXISDZNLLFCPLK-UHFFFAOYSA-N 6,7-dimethoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound COC1=CC(C(C)C)=C2C(=O)NS(=O)(=O)C2=C1OC QXISDZNLLFCPLK-UHFFFAOYSA-N 0.000 description 1
- KGMKPKJIDKCOOI-UHFFFAOYSA-N 6-(4-methoxyphenyl)sulfanyl-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound C1=CC(OC)=CC=C1SC(C=C1C(C)C)=CC2=C1C(=O)NS2(=O)=O KGMKPKJIDKCOOI-UHFFFAOYSA-N 0.000 description 1
- HKOLJVACHOHPOA-UHFFFAOYSA-N 6-(4-methylnaphthalen-1-yl)sulfanyl-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound C1=CC=C2C(SC=3C=C(C4=C(S(NC4=O)(=O)=O)C=3)C(C)C)=CC=C(C)C2=C1 HKOLJVACHOHPOA-UHFFFAOYSA-N 0.000 description 1
- XBEAZYBDMYCIND-UHFFFAOYSA-N 6-(4-methylphenyl)sulfonyl-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound C=1C(S(NC2=O)(=O)=O)=C2C(C(C)C)=CC=1S(=O)(=O)C1=CC=C(C)C=C1 XBEAZYBDMYCIND-UHFFFAOYSA-N 0.000 description 1
- TZHSOKUMRLKHCT-UHFFFAOYSA-N 6-(aminomethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound NCC1=CC=C2C(=O)NS(=O)(=O)C2=C1 TZHSOKUMRLKHCT-UHFFFAOYSA-N 0.000 description 1
- IYNMCOLTNXUUOH-UHFFFAOYSA-N 6-(benzenesulfonyl)-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound C=1C(S(NC2=O)(=O)=O)=C2C(C(C)C)=CC=1S(=O)(=O)C1=CC=CC=C1 IYNMCOLTNXUUOH-UHFFFAOYSA-N 0.000 description 1
- NORHTNDKSPORRY-UHFFFAOYSA-N 6-(hydroxymethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound OCC1=CC=C2C(=O)NS(=O)(=O)C2=C1 NORHTNDKSPORRY-UHFFFAOYSA-N 0.000 description 1
- MUWHYUUQBYGDEG-UHFFFAOYSA-N 6-amino-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(N)=CC2=C1C(=O)NS2(=O)=O MUWHYUUQBYGDEG-UHFFFAOYSA-N 0.000 description 1
- MACQRECUDXHEMB-UHFFFAOYSA-N 6-ethoxy-1,1-dioxo-2-(phenylsulfanylmethyl)-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(OCC)=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 MACQRECUDXHEMB-UHFFFAOYSA-N 0.000 description 1
- CNRNMBAPSVPGCJ-UHFFFAOYSA-N 6-fluoro-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(F)=CC2=C1C(=O)NS2(=O)=O CNRNMBAPSVPGCJ-UHFFFAOYSA-N 0.000 description 1
- HXSLXSMKOXQSHZ-UHFFFAOYSA-N 6-hydroxy-1,1-dioxo-2-(phenylsulfanylmethyl)-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(O)=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 HXSLXSMKOXQSHZ-UHFFFAOYSA-N 0.000 description 1
- ORCUFCMGTYHZAU-UHFFFAOYSA-N 6-imidazol-1-yl-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound C=1C(S(NC2=O)(=O)=O)=C2C(C(C)C)=CC=1N1C=CN=C1 ORCUFCMGTYHZAU-UHFFFAOYSA-N 0.000 description 1
- RRRGMXLPAKHDMX-UHFFFAOYSA-N 6-methyl-1-oxo-1-sulfanylidene-1,2-benzothiazol-3-one Chemical compound CC1=CC=C2C(=O)NS(=O)(=S)C2=C1 RRRGMXLPAKHDMX-UHFFFAOYSA-N 0.000 description 1
- JOQYJAMJVBTUAO-UHFFFAOYSA-N 6-methyl-1-oxo-4-propan-2-yl-1-sulfanylidene-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(C)=CC2=C1C(=O)NS2(=O)=S JOQYJAMJVBTUAO-UHFFFAOYSA-N 0.000 description 1
- SLGKNTRLTGMBCU-UHFFFAOYSA-N 6-methylsulfinyl-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(S(C)=O)=CC2=C1C(=O)NS2(=O)=O SLGKNTRLTGMBCU-UHFFFAOYSA-N 0.000 description 1
- RTRQYTQKLSTOAB-UHFFFAOYSA-N 6-methylsulfonyl-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(S(C)(=O)=O)=CC2=C1C(=O)NS2(=O)=O RTRQYTQKLSTOAB-UHFFFAOYSA-N 0.000 description 1
- KRDVDPHEVPSWPS-UHFFFAOYSA-N 6-nitro-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC([N+](=O)[O-])=CC=C2C(=O)N1CSC1=CC=CC=C1 KRDVDPHEVPSWPS-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 235000006491 Acacia senegal Nutrition 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- KSGJVBSONKYXKJ-UHFFFAOYSA-N C1=CC(C)=CC=C1OC(=O)N1S(=O)(=O)C2=CC=CC=C2C1=O Chemical compound C1=CC(C)=CC=C1OC(=O)N1S(=O)(=O)C2=CC=CC=C2C1=O KSGJVBSONKYXKJ-UHFFFAOYSA-N 0.000 description 1
- UWYDDRRDIHFNTB-UHFFFAOYSA-N CC(C)C1=CC(N(C)C(=O)C(=O)OC(C)(C)C)=CC2=C1C(=O)NS2(=O)=O Chemical compound CC(C)C1=CC(N(C)C(=O)C(=O)OC(C)(C)C)=CC2=C1C(=O)NS2(=O)=O UWYDDRRDIHFNTB-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- 102100024539 Chymase Human genes 0.000 description 1
- 108090000227 Chymases Proteins 0.000 description 1
- 108090000317 Chymotrypsin Proteins 0.000 description 1
- 239000012027 Collins reagent Substances 0.000 description 1
- 206010011416 Croup infectious Diseases 0.000 description 1
- 241000371644 Curvularia ravenelii Species 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 1
- 101100260565 Dictyostelium discoideum thyA gene Proteins 0.000 description 1
- 238000005698 Diels-Alder reaction Methods 0.000 description 1
- TWLLPUMZVVGILS-UHFFFAOYSA-N Ethyl 2-aminobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1N TWLLPUMZVVGILS-UHFFFAOYSA-N 0.000 description 1
- PSCXEUSWZWRCMQ-UHFFFAOYSA-N F[S](F)F Chemical compound F[S](F)F PSCXEUSWZWRCMQ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- FTQUMYVWFCBLRK-UHFFFAOYSA-N O=C(C=C1)N(CC2=CC=CC=C2)[S+]1Cl Chemical compound O=C(C=C1)N(CC2=CC=CC=C2)[S+]1Cl FTQUMYVWFCBLRK-UHFFFAOYSA-N 0.000 description 1
- MJFKCEMCWOYWMX-UHFFFAOYSA-N O=C1C2CCCC=C2S(=O)(=O)N1CC1=CC=CC=C1 Chemical compound O=C1C2CCCC=C2S(=O)(=O)N1CC1=CC=CC=C1 MJFKCEMCWOYWMX-UHFFFAOYSA-N 0.000 description 1
- MNQITOYQZFGOTG-UHFFFAOYSA-N O=S=O.ONOS(O)(=O)=O Chemical compound O=S=O.ONOS(O)(=O)=O MNQITOYQZFGOTG-UHFFFAOYSA-N 0.000 description 1
- 241000282320 Panthera leo Species 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 229910005948 SO2Cl Inorganic materials 0.000 description 1
- 229910006074 SO2NH2 Inorganic materials 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 238000006932 Simmons-Smith cyclopropanation reaction Methods 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 101100162169 Xenopus laevis adrm1-a gene Proteins 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 208000006682 alpha 1-Antitrypsin Deficiency Diseases 0.000 description 1
- 108010027597 alpha-chymotrypsin Proteins 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000002785 anti-thrombosis Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- DMSMPAJRVJJAGA-UHFFFAOYSA-N benzo[d]isothiazol-3-one Chemical class C1=CC=C2C(=O)NSC2=C1 DMSMPAJRVJJAGA-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- JHVLLYQQQYIWKX-UHFFFAOYSA-N benzyl 2-bromoacetate Chemical compound BrCC(=O)OCC1=CC=CC=C1 JHVLLYQQQYIWKX-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 150000003939 benzylamines Chemical class 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 230000021235 carbamoylation Effects 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 150000001805 chlorine compounds Chemical group 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 201000010549 croup Diseases 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000003412 degenerative effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- GEATWTXBCNOEFI-UHFFFAOYSA-N ethyl 2-(dibenzylamino)benzoate Chemical compound CCOC(=O)C1=CC=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 GEATWTXBCNOEFI-UHFFFAOYSA-N 0.000 description 1
- YIUMLILLUMQKHK-UHFFFAOYSA-N ethyl 2-chlorosulfonyl-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1S(Cl)(=O)=O YIUMLILLUMQKHK-UHFFFAOYSA-N 0.000 description 1
- KWXBNUYCDMPLEQ-UHFFFAOYSA-N ethyl 2-hydroxy-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1O KWXBNUYCDMPLEQ-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000004968 inflammatory condition Effects 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 238000006138 lithiation reaction Methods 0.000 description 1
- TWWRFGHXMHBSBA-UHFFFAOYSA-M lithium;3-(triphenyl-$l^{5}-phosphanylidene)propanoate Chemical compound [Li+].C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CCC(=O)[O-])C1=CC=CC=C1 TWWRFGHXMHBSBA-UHFFFAOYSA-M 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- CYCHFUMPPITFHT-UHFFFAOYSA-N methyl 1,1,3-trioxo-1,2-benzothiazole-4-carboxylate Chemical compound COC(=O)C1=CC=CC2=C1C(=O)NS2(=O)=O CYCHFUMPPITFHT-UHFFFAOYSA-N 0.000 description 1
- QCHGUEIECOASJU-UHFFFAOYSA-N methyl 1,3-benzodioxole-5-carboxylate Chemical compound COC(=O)C1=CC=C2OCOC2=C1 QCHGUEIECOASJU-UHFFFAOYSA-N 0.000 description 1
- BNQRSYFOIRGRKV-UHFFFAOYSA-N methyl 2-(2-methoxyphenyl)acetate Chemical compound COC(=O)CC1=CC=CC=C1OC BNQRSYFOIRGRKV-UHFFFAOYSA-N 0.000 description 1
- SMBUMGOKJMDVNK-UHFFFAOYSA-N methyl 2-benzylsulfanyl-6-phenylcyclohex-2-ene-1-carboxylate Chemical compound COC(=O)C1C(C=2C=CC=CC=2)CCC=C1SCC1=CC=CC=C1 SMBUMGOKJMDVNK-UHFFFAOYSA-N 0.000 description 1
- NVWMLRKLTPMMJE-UHFFFAOYSA-N methyl 2-benzylsulfanyl-6-tert-butylcyclohex-2-ene-1-carboxylate Chemical compound COC(=O)C1C(C(C)(C)C)CCC=C1SCC1=CC=CC=C1 NVWMLRKLTPMMJE-UHFFFAOYSA-N 0.000 description 1
- JCWPOAFRJQXRKG-UHFFFAOYSA-N methyl 2-chloro-6-chlorosulfonylbenzoate Chemical compound COC(=O)C1=C(Cl)C=CC=C1S(Cl)(=O)=O JCWPOAFRJQXRKG-UHFFFAOYSA-N 0.000 description 1
- TWTIKIBYZKYPLP-UHFFFAOYSA-N methyl 2-chlorosulfonyl-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1S(Cl)(=O)=O TWTIKIBYZKYPLP-UHFFFAOYSA-N 0.000 description 1
- QAWGWFCCHVLJJG-UHFFFAOYSA-N methyl 2-chlorosulfonyl-6-phenylbenzoate Chemical compound C1=CC=C(S(Cl)(=O)=O)C(C(=O)OC)=C1C1=CC=CC=C1 QAWGWFCCHVLJJG-UHFFFAOYSA-N 0.000 description 1
- BQYQXMDHKIIPQU-UHFFFAOYSA-N methyl 2-tert-butyl-6-chlorosulfonylbenzoate Chemical compound COC(=O)C1=C(C(C)(C)C)C=CC=C1S(Cl)(=O)=O BQYQXMDHKIIPQU-UHFFFAOYSA-N 0.000 description 1
- KMYMQRONBYGRFP-UHFFFAOYSA-N methyl 2-tert-butyl-6-oxocyclohexane-1-carboxylate Chemical compound COC(=O)C1C(C(C)(C)C)CCCC1=O KMYMQRONBYGRFP-UHFFFAOYSA-N 0.000 description 1
- XYDYWTJEGDZLTH-UHFFFAOYSA-N methylenetriphenylphosphorane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=C)C1=CC=CC=C1 XYDYWTJEGDZLTH-UHFFFAOYSA-N 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- PLSYPGKOSAWICF-UHFFFAOYSA-N n,n,2-triethylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1CC PLSYPGKOSAWICF-UHFFFAOYSA-N 0.000 description 1
- UQMOFOIGNYOFLH-UHFFFAOYSA-N n,n-diethyl-2-(trichloromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1C(Cl)(Cl)Cl UQMOFOIGNYOFLH-UHFFFAOYSA-N 0.000 description 1
- UFBUQJKJLZYJBY-UHFFFAOYSA-N n,n-diethyl-2-ethynyl-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(C#C)C=CC=C1S(N)(=O)=O UFBUQJKJLZYJBY-UHFFFAOYSA-N 0.000 description 1
- QUXJDVRBIKNFKD-UHFFFAOYSA-N n,n-diethyl-2-methoxy-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(OC)C=CC=C1S(N)(=O)=O QUXJDVRBIKNFKD-UHFFFAOYSA-N 0.000 description 1
- ZFIIUAIWXACNKN-UHFFFAOYSA-N n,n-diethyl-2-methoxybenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1OC ZFIIUAIWXACNKN-UHFFFAOYSA-N 0.000 description 1
- XUJWEGBRMWSBLI-UHFFFAOYSA-N n,n-diethyl-2-pentan-3-yl-6-sulfamoylbenzamide Chemical compound CCC(CC)C1=CC=CC(S(N)(=O)=O)=C1C(=O)N(CC)CC XUJWEGBRMWSBLI-UHFFFAOYSA-N 0.000 description 1
- GCYCIZXGEFVREK-UHFFFAOYSA-N n,n-diethyl-2-propylbenzamide Chemical compound CCCC1=CC=CC=C1C(=O)N(CC)CC GCYCIZXGEFVREK-UHFFFAOYSA-N 0.000 description 1
- NOJMEBSLFMCECA-UHFFFAOYSA-N n,n-diethyl-2-sulfamoyl-4-(trichloromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=C(C(Cl)(Cl)Cl)C=C1S(N)(=O)=O NOJMEBSLFMCECA-UHFFFAOYSA-N 0.000 description 1
- MUENLESMFGCZMO-UHFFFAOYSA-N n,n-diethyl-2-sulfamoyl-6-(trichloromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=C(C(Cl)(Cl)Cl)C=CC=C1S(N)(=O)=O MUENLESMFGCZMO-UHFFFAOYSA-N 0.000 description 1
- TUMBBYOKEOPGDW-UHFFFAOYSA-N n,n-diethyl-2-sulfamoyl-6-(trifluoromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=C(C(F)(F)F)C=CC=C1S(N)(=O)=O TUMBBYOKEOPGDW-UHFFFAOYSA-N 0.000 description 1
- IZJDHAOECWYYOP-UHFFFAOYSA-N n,n-diethyl-2-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1S(N)(=O)=O IZJDHAOECWYYOP-UHFFFAOYSA-N 0.000 description 1
- CYOBYGVYQIXLPM-UHFFFAOYSA-N n,n-diethyl-3,4-dimethoxy-2-propan-2-yl-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(S(N)(=O)=O)C=C(OC)C(OC)=C1C(C)C CYOBYGVYQIXLPM-UHFFFAOYSA-N 0.000 description 1
- OXTGQBUZGBZLPS-UHFFFAOYSA-N n,n-diethyl-3,4-dimethoxy-2-propan-2-ylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=C(OC)C(OC)=C1C(C)C OXTGQBUZGBZLPS-UHFFFAOYSA-N 0.000 description 1
- JIINXSMAUVPAPI-UHFFFAOYSA-N n,n-diethyl-3,4-dimethoxy-2-propylbenzamide Chemical compound CCCC1=C(OC)C(OC)=CC=C1C(=O)N(CC)CC JIINXSMAUVPAPI-UHFFFAOYSA-N 0.000 description 1
- NRTUBAKONZTQMO-UHFFFAOYSA-N n,n-diethyl-4,5-dimethoxy-2-propan-2-ylbenzamide Chemical compound CCN(CC)C(=O)C1=CC(OC)=C(OC)C=C1C(C)C NRTUBAKONZTQMO-UHFFFAOYSA-N 0.000 description 1
- QDLFLVWJFFVBSL-UHFFFAOYSA-N n,n-diethyl-4-fluoro-2-propan-2-ylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=C(F)C=C1C(C)C QDLFLVWJFFVBSL-UHFFFAOYSA-N 0.000 description 1
- IZUSLUJUTFMNLS-UHFFFAOYSA-N n,n-diethyl-4-methoxy-2-propan-2-yl-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(C(C)C)C=C(OC)C=C1S(N)(=O)=O IZUSLUJUTFMNLS-UHFFFAOYSA-N 0.000 description 1
- HUUSTUALCPTCGJ-UHFFFAOYSA-N n,n-diethylcarbamothioyl chloride Chemical compound CCN(CC)C(Cl)=S HUUSTUALCPTCGJ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- NSNPSJGHTQIXDO-UHFFFAOYSA-N naphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC=CC2=C1 NSNPSJGHTQIXDO-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- JFNLZVQOOSMTJK-KNVOCYPGSA-N norbornene Chemical compound C1[C@@H]2CC[C@H]1C=C2 JFNLZVQOOSMTJK-KNVOCYPGSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- HVFSJXUIRWUHRG-UHFFFAOYSA-N oic acid Natural products C1CC2C3CC=C4CC(OC5C(C(O)C(O)C(CO)O5)O)CC(O)C4(C)C3CCC2(C)C1C(C)C(O)CC(C)=C(C)C(=O)OC1OC(COC(C)=O)C(O)C(O)C1OC(C(C1O)O)OC(COC(C)=O)C1OC1OC(CO)C(O)C(O)C1O HVFSJXUIRWUHRG-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- 210000001819 pancreatic juice Anatomy 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- SNZXFRFQGXSSGN-UHFFFAOYSA-N phenylsulfanyloxysulfanylbenzene Chemical compound C=1C=CC=CC=1SOSC1=CC=CC=C1 SNZXFRFQGXSSGN-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000017854 proteolysis Effects 0.000 description 1
- NPRDHMWYZHSAHR-UHFFFAOYSA-N pyridine;trioxochromium Chemical compound O=[Cr](=O)=O.C1=CC=NC=C1.C1=CC=NC=C1 NPRDHMWYZHSAHR-UHFFFAOYSA-N 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000006965 reversible inhibition Effects 0.000 description 1
- 239000013037 reversible inhibitor Substances 0.000 description 1
- ULRYTKINJINOOS-UHFFFAOYSA-N s-[(2-benzyl-1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl)] n,n-diethylcarbamothioate Chemical compound CC(C)C1=CC(SC(=O)N(CC)CC)=CC(S2(=O)=O)=C1C(=O)N2CC1=CC=CC=C1 ULRYTKINJINOOS-UHFFFAOYSA-N 0.000 description 1
- IXTYVGVNWHFZBK-UHFFFAOYSA-N s-benzyl benzenecarbothioate Chemical compound C=1C=CC=CC=1C(=O)SCC1=CC=CC=C1 IXTYVGVNWHFZBK-UHFFFAOYSA-N 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000000527 sonication Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- FKDRRMVMNHSFLQ-UHFFFAOYSA-N tert-butyl 2-[(1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl)amino]acetate Chemical compound CC(C)C1=CC(NCC(=O)OC(C)(C)C)=CC2=C1C(=O)NS2(=O)=O FKDRRMVMNHSFLQ-UHFFFAOYSA-N 0.000 description 1
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 1
- YZUAOVCUGSBIPP-UHFFFAOYSA-N tert-butyl N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]carbamate Chemical compound C1=CC=CN2C(C(NC(=O)OC(C)(C)C)C)=NN=C21 YZUAOVCUGSBIPP-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 101150068774 thyX gene Proteins 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000009901 transfer hydrogenation reaction Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- ZGNCNUVMSLHPQH-UHFFFAOYSA-N trimethyl(5-methylhexa-1,3-dien-2-yloxy)silane Chemical compound CC(C)C=CC(=C)O[Si](C)(C)C ZGNCNUVMSLHPQH-UHFFFAOYSA-N 0.000 description 1
- HCTBXWTVGRRILT-UHFFFAOYSA-N trimethyl-(1-methylpyrrol-2-yl)stannane Chemical compound CN1C=CC=C1[Sn](C)(C)C HCTBXWTVGRRILT-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 239000002753 trypsin inhibitor Substances 0.000 description 1
- ABDKAPXRBAPSQN-UHFFFAOYSA-N veratrole Chemical compound COC1=CC=CC=C1OC ABDKAPXRBAPSQN-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
- C07D275/06—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to the ring sulfur atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/425—Thiazoles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Epidemiology (AREA)
- Pulmonology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US81574091A | 1991-12-30 | 1991-12-30 | |
| US815,740 | 1991-12-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2086348A1 true CA2086348A1 (en) | 1993-07-01 |
Family
ID=25218721
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002086348A Abandoned CA2086348A1 (en) | 1991-12-30 | 1992-12-29 | 2-saccharinylmethyl aryl and aryloxy acetates useful as proteolytic enzyme inhibitors and compositions and method of use thereof |
Country Status (17)
| Country | Link |
|---|---|
| US (3) | US5385923A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0550112A1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPH05255286A (cg-RX-API-DMAC7.html) |
| AU (1) | AU651746B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA2086348A1 (cg-RX-API-DMAC7.html) |
| CZ (1) | CZ386992A3 (cg-RX-API-DMAC7.html) |
| FI (1) | FI925946L (cg-RX-API-DMAC7.html) |
| HU (2) | HUT65736A (cg-RX-API-DMAC7.html) |
| IL (1) | IL104259A (cg-RX-API-DMAC7.html) |
| MX (1) | MX9207274A (cg-RX-API-DMAC7.html) |
| MY (1) | MY108926A (cg-RX-API-DMAC7.html) |
| NO (1) | NO303446B1 (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ245586A (cg-RX-API-DMAC7.html) |
| PH (1) | PH30411A (cg-RX-API-DMAC7.html) |
| RU (1) | RU2081871C1 (cg-RX-API-DMAC7.html) |
| SG (1) | SG48025A1 (cg-RX-API-DMAC7.html) |
| TW (1) | TW226016B (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN106662430A (zh) * | 2014-03-04 | 2017-05-10 | 霍尼韦尔有限公司 | 通过中红外波长扫描干涉测量的织物产品的厚度确定 |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5380737A (en) * | 1989-05-04 | 1995-01-10 | Sterling Winthrop Inc. | Saccharin derivative proteolytic enzyme inhibitors |
| US5306818A (en) * | 1990-11-01 | 1994-04-26 | Sterling Winthrop Inc. | Tetrahydro 2-saccharinylmerthyl aryl carboxylates |
| DE19533643A1 (de) * | 1995-09-12 | 1997-03-13 | Nycomed Arzneimittel Gmbh | Neue cyclische Derivate von Benzolsulfonamiden |
| DE19748470A1 (de) * | 1997-11-03 | 1999-05-06 | Hoechst Schering Agrevo Gmbh | Carbamoylphenylsulfonylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide und Pflanzenwachstumsregulatoren |
| US20090053221A1 (en) * | 2006-01-17 | 2009-02-26 | Cheung Nai-Kong V | Immune response enhancing glucan |
| PL2445502T5 (pl) | 2009-06-25 | 2023-03-13 | Alkermes Pharma Ireland Limited | Związki heterocykliczne do leczenia zaburzeń neurologicznych i psychologicznych |
| JP5732453B2 (ja) | 2009-06-25 | 2015-06-10 | アルカーメス ファーマ アイルランド リミテッド | Nh酸性化合物のプロドラッグ |
| US9670200B2 (en) * | 2010-01-07 | 2017-06-06 | Alkermes Pharma Ireland Limited | Quaternary ammonium salt prodrugs |
| US8592427B2 (en) | 2010-06-24 | 2013-11-26 | Alkermes Pharma Ireland Limited | Prodrugs of NH-acidic compounds: ester, carbonate, carbamate and phosphonate derivatives |
| PL2685979T3 (pl) | 2011-03-18 | 2017-02-28 | Alkermes Pharma Ireland Limited | Kompozycje farmaceutyczne do wstrzykiwania zawierające środek nierozpuszczalny w wodzie, środek przeciwpsychotyczny, laurynian sorbitanu i polisorbat 20 |
| US8969337B2 (en) | 2011-12-15 | 2015-03-03 | Alkermes Pharma Ireland Limited | Prodrugs of secondary amine compounds |
| NZ630703A (en) | 2012-03-19 | 2017-02-24 | Alkermes Pharma Ireland Ltd | Pharmaceutical compositions comprising glycerol esters |
| WO2013142205A1 (en) | 2012-03-19 | 2013-09-26 | Alkermes Pharma Ireland Limited | Pharmaceutical compositions comprising benzyl alcohol |
| EP2827868B8 (en) | 2012-03-19 | 2019-12-18 | Alkermes Pharma Ireland Limited | Pharmaceutical compositions comprising fatty acid esters |
| NZ631345A (en) | 2012-09-19 | 2017-06-30 | Alkermes Pharma Ireland Ltd | Pharmaceutical compositions having improved storage stability |
| JP6290428B2 (ja) | 2013-12-31 | 2018-03-07 | サンーゴバン アブレイシブズ,インコーポレイティド | 成形研磨粒子を含む研磨物品 |
| JP6524110B2 (ja) | 2014-03-20 | 2019-06-05 | アルカームス ファーマ アイルランド リミテッド | 注射速度が増大したアリピプラゾール調合物 |
| US10346168B2 (en) | 2015-06-26 | 2019-07-09 | Microsoft Technology Licensing, Llc | Decoupled processor instruction window and operand buffer |
| CA3092335A1 (en) | 2018-03-05 | 2019-09-12 | Alkermes Pharma Ireland Limited | Aripiprazole dosing strategy |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3002884A (en) * | 1959-04-15 | 1961-10-03 | Rohm & Haas | Horticultural process with n-halomethyl-1,2-benzisothiazolin - 3 - one-1,1-dioxides for controlling fungus diseases |
| US3314960A (en) * | 1964-08-25 | 1967-04-18 | American Home Prod | Benzisothiazol glutarimides |
| FR1451417A (fr) * | 1965-07-15 | 1966-01-07 | Roussel Uclaf | Nouveaux esters d'acides cycliques et leur procédé de préparation |
| JPS4835457A (cg-RX-API-DMAC7.html) * | 1971-09-02 | 1973-05-24 | ||
| US4195023A (en) * | 1975-08-20 | 1980-03-25 | Merck & Co., Inc. | 2-(2-Furoyl)1,2-benzisothiazole-3-one, 2-(2-furoyl) saccharin, and 2-(2-thenoyl) saccharin |
| US4276298A (en) * | 1978-03-24 | 1981-06-30 | Merck & Co., Inc. | 2-Aryl-1,2-benzisothiazolinone-1,1-dioxides and their use as selective protease inhibitors |
| US4263393A (en) * | 1979-09-06 | 1981-04-21 | Eastman Kodak Company | Novel electron donor precursors and photographic element containing them |
| US4350752A (en) * | 1980-12-29 | 1982-09-21 | Eastman Kodak Company | Photographic elements and film units containing imidomethyl blocked photographic reagents |
| US4363865A (en) * | 1981-03-04 | 1982-12-14 | Eastman Kodak Company | Imido methyl blocked photographic dyes and dye releasing compounds |
| US4410618A (en) * | 1982-06-11 | 1983-10-18 | Eastman Kodak Company | Blocked photographic reagents |
| US4623645A (en) * | 1983-04-18 | 1986-11-18 | Merck & Co., Inc. | Substituted cephalosporin sulfoxides as anti-inflammatory and antidegenerative agents |
| US4547371A (en) * | 1983-04-18 | 1985-10-15 | Merck & Co., Inc. | Substituted cephalosporin sulfones as anti-inflammatory and anti-degenerative agents |
| US4659855A (en) * | 1983-05-09 | 1987-04-21 | Georgia Tech Research Corporation | Aryl sulfonyl fluoride compounds |
| DE3617976A1 (de) * | 1986-05-28 | 1988-01-14 | Alter Sa | 1,4-dihydropyridin, verfahren zu dessen herstellung und dessen verwendung in antithrombotischen medikamenten |
| EP0253029A1 (en) * | 1986-07-10 | 1988-01-20 | Keng-Ben Wang | A distilled drinking water fountain |
| ES2110414T3 (es) * | 1989-05-04 | 1998-02-16 | Sanofi Sa | Derivados de sacarina utiles como inhibidores de enzimas proteoliticas y su preparacion. |
| US5128339A (en) * | 1990-11-01 | 1992-07-07 | Sterling Winthrop Inc. | Proteolytic enzyme inhibition method |
| FR2659327A1 (fr) * | 1990-03-08 | 1991-09-13 | Centre Nat Rech Scient | Derives du benzisothiazolinone-1-dioxyde, utilisables comme inhibiteurs des elastases. |
| AU642537B2 (en) * | 1990-11-01 | 1993-10-21 | Sanofi | 2-saccharinylmethyl aryl carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use thereof |
| US5279758A (en) * | 1991-10-22 | 1994-01-18 | The Clorox Company | Thickened aqueous cleaning compositions |
| AU656027B2 (en) * | 1991-11-15 | 1995-01-19 | Sanofi | Saccharin derivative proteolytic enzime inhibitors |
| AU653279B2 (en) * | 1991-12-30 | 1994-09-22 | Sanofi | Novel 2-saccharinylmethyl heterocyclic carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use thereof |
| JPH07200419A (ja) * | 1993-12-28 | 1995-08-04 | Nec Corp | バスインタフェース装置 |
| DE4420271B4 (de) * | 1994-06-10 | 2007-09-27 | Robert Bosch Gmbh | Zündspulensatz für eine Mehrzylinder-Brennkraftmaschine |
-
1992
- 1992-11-20 TW TW081109302A patent/TW226016B/zh active
- 1992-11-27 AU AU29669/92A patent/AU651746B2/en not_active Ceased
- 1992-12-15 MX MX9207274A patent/MX9207274A/es not_active IP Right Cessation
- 1992-12-23 SG SG1996006248A patent/SG48025A1/en unknown
- 1992-12-23 EP EP92204072A patent/EP0550112A1/en not_active Withdrawn
- 1992-12-23 NZ NZ245586A patent/NZ245586A/en unknown
- 1992-12-23 CZ CS923869A patent/CZ386992A3/cs unknown
- 1992-12-23 PH PH45501A patent/PH30411A/en unknown
- 1992-12-28 JP JP4349483A patent/JPH05255286A/ja not_active Withdrawn
- 1992-12-29 RU RU9292016490A patent/RU2081871C1/ru active
- 1992-12-29 IL IL104259A patent/IL104259A/xx not_active IP Right Cessation
- 1992-12-29 CA CA002086348A patent/CA2086348A1/en not_active Abandoned
- 1992-12-30 NO NO925041A patent/NO303446B1/no unknown
- 1992-12-30 FI FI925946A patent/FI925946L/fi unknown
- 1992-12-30 HU HU9204166A patent/HUT65736A/hu unknown
- 1992-12-30 MY MYPI92002397A patent/MY108926A/en unknown
-
1993
- 1993-08-20 US US08/109,849 patent/US5385923A/en not_active Expired - Fee Related
-
1994
- 1994-08-08 US US08/287,372 patent/US5489604A/en not_active Expired - Fee Related
-
1995
- 1995-05-24 US US08/449,641 patent/US5783589A/en not_active Expired - Fee Related
- 1995-06-30 HU HU95P/P00619P patent/HU211625A9/hu unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN106662430A (zh) * | 2014-03-04 | 2017-05-10 | 霍尼韦尔有限公司 | 通过中红外波长扫描干涉测量的织物产品的厚度确定 |
Also Published As
| Publication number | Publication date |
|---|---|
| NO925041L (no) | 1993-07-01 |
| IL104259A (en) | 1997-09-30 |
| PH30411A (en) | 1997-05-09 |
| NO303446B1 (no) | 1998-07-13 |
| EP0550112A1 (en) | 1993-07-07 |
| SG48025A1 (en) | 1998-04-17 |
| US5783589A (en) | 1998-07-21 |
| AU2966992A (en) | 1993-07-01 |
| NO925041D0 (no) | 1992-12-30 |
| MX9207274A (es) | 1993-06-01 |
| HU211625A9 (en) | 1995-12-28 |
| TW226016B (cg-RX-API-DMAC7.html) | 1994-07-01 |
| FI925946A7 (fi) | 1993-07-01 |
| IL104259A0 (en) | 1993-05-13 |
| JPH05255286A (ja) | 1993-10-05 |
| FI925946L (fi) | 1993-07-01 |
| NZ245586A (en) | 1994-11-25 |
| US5489604A (en) | 1996-02-06 |
| HUT65736A (en) | 1994-07-28 |
| US5385923A (en) | 1995-01-31 |
| CZ386992A3 (en) | 1993-09-15 |
| RU2081871C1 (ru) | 1997-06-20 |
| FI925946A0 (fi) | 1992-12-30 |
| MY108926A (en) | 1996-11-30 |
| AU651746B2 (en) | 1994-07-28 |
| HU9204166D0 (en) | 1993-04-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2086348A1 (en) | 2-saccharinylmethyl aryl and aryloxy acetates useful as proteolytic enzyme inhibitors and compositions and method of use thereof | |
| US5596012A (en) | Saccharin derivatives useful as proteolytic enzyme inhibitors and compositions and method of use thereof | |
| US5652254A (en) | 2-saccharinylmethyl heterocyclic carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use thereof | |
| EP0471756A1 (en) | SACCHARIN DERIVATIVES USEFUL AS INHIBITORS OF PROTEOLYTIC ENZYMES AND THEIR PREPARATION. | |
| CA2054653A1 (en) | Novel 2-saccharinylmethyl aryl carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use therefor | |
| US5128339A (en) | Proteolytic enzyme inhibition method | |
| EP0594257B1 (en) | 2-Saccharinylmethyl aryl carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use thereof | |
| AU648938B2 (en) | Novel 2-saccharinylmethyl and 4,5,6,7-tetrahydro -2-saccharinylmethyl phosphates, phosphonates and phosphinates useful as proteolytic enzyme inhibitors and compositions and method of use thereof | |
| US5250696A (en) | 2-saccharinylmethyl aryl carboxylate | |
| US5296496A (en) | 2-saccharinylmethyl phosphates, phosphonates and phosphinates useful as proteolytic enzyme inhibitors and compositions and method of use thereof | |
| IL119685A (en) | 4,5,6,7-tetrahydro-2-saccharinylmethyl aryl and aryloxy acetates | |
| IL119905A (en) | 4,5,6,7-Tetrahydro-2- saccharinylmethyl heterocyclic carboxylates and pharmaceutical compositions containing them | |
| IL114773A (en) | 2-Tetrahydro-saccharinylmethyl aryl carboxylates their preparation and pharmaceutical compositions containing them |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |