CA1323874C - Pyroglutamide derivatives - Google Patents
Pyroglutamide derivativesInfo
- Publication number
- CA1323874C CA1323874C CA000527706A CA527706A CA1323874C CA 1323874 C CA1323874 C CA 1323874C CA 000527706 A CA000527706 A CA 000527706A CA 527706 A CA527706 A CA 527706A CA 1323874 C CA1323874 C CA 1323874C
- Authority
- CA
- Canada
- Prior art keywords
- moiety
- pyrrolidone
- carbonyl
- compound
- piperazine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- WGOIHPRRFBCVBZ-VKHMYHEASA-N (2s)-5-oxopyrrolidine-2-carboxamide Chemical class NC(=O)[C@@H]1CCC(=O)N1 WGOIHPRRFBCVBZ-VKHMYHEASA-N 0.000 title abstract description 7
- 241001465754 Metazoa Species 0.000 claims abstract description 16
- 150000001875 compounds Chemical class 0.000 claims description 85
- -1 diarylalkyl Chemical group 0.000 claims description 62
- 238000000034 method Methods 0.000 claims description 53
- 125000000217 alkyl group Chemical group 0.000 claims description 51
- 235000013350 formula milk Nutrition 0.000 claims description 29
- 239000000203 mixture Substances 0.000 claims description 28
- 125000003118 aryl group Chemical group 0.000 claims description 26
- 125000001424 substituent group Chemical group 0.000 claims description 25
- 125000003545 alkoxy group Chemical group 0.000 claims description 23
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 21
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 21
- 125000005843 halogen group Chemical group 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 17
- 125000005842 heteroatom Chemical group 0.000 claims description 17
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 16
- 229910052757 nitrogen Inorganic materials 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 15
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 12
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 11
- 125000001589 carboacyl group Chemical group 0.000 claims description 11
- 125000003342 alkenyl group Chemical group 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 9
- 239000005864 Sulphur Chemical group 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 9
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 229910052760 oxygen Chemical group 0.000 claims description 9
- 239000001301 oxygen Chemical group 0.000 claims description 9
- 125000003277 amino group Chemical group 0.000 claims description 8
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 8
- 125000000623 heterocyclic group Chemical group 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 6
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 claims description 6
- 125000005242 carbamoyl alkyl group Chemical group 0.000 claims description 6
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000005505 thiomorpholino group Chemical group 0.000 claims description 6
- GOWRRBABHQUJMX-MRVPVSSYSA-N Fasoracetam Chemical compound C1CCCCN1C(=O)[C@H]1CCC(=O)N1 GOWRRBABHQUJMX-MRVPVSSYSA-N 0.000 claims description 5
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 5
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 claims description 5
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 5
- 125000005160 aryl oxy alkyl group Chemical group 0.000 claims description 5
- 125000006517 heterocyclyl carbonyl group Chemical group 0.000 claims description 5
- 125000004043 oxo group Chemical group O=* 0.000 claims description 5
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 5
- 150000004820 halides Chemical class 0.000 claims description 4
- 230000001777 nootropic effect Effects 0.000 claims description 4
- ZNGHTCSIUZKPCF-UHFFFAOYSA-N 5-[4-(2-morpholin-4-ylacetyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CN(C(=O)C2NC(=O)CC2)CCN1C(=O)CN1CCOCC1 ZNGHTCSIUZKPCF-UHFFFAOYSA-N 0.000 claims description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- 230000008569 process Effects 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 4
- WNISGGBLKVYPLT-UHFFFAOYSA-N 5-(4-benzylpiperidine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CC(CC=2C=CC=CC=2)CCN1C(=O)C1CCC(=O)N1 WNISGGBLKVYPLT-UHFFFAOYSA-N 0.000 claims 2
- IGUYYHAFNYFSEJ-UHFFFAOYSA-N 5-[4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1COCCN1C(=O)CN(CC1)CCN1C(=O)C1CCC(=O)N1 IGUYYHAFNYFSEJ-UHFFFAOYSA-N 0.000 claims 2
- HQYBYAAQJMRRKD-UHFFFAOYSA-N 5-[4-(2-oxo-2-thiomorpholin-4-ylethyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CSCCN1C(=O)CN(CC1)CCN1C(=O)C1CCC(=O)N1 HQYBYAAQJMRRKD-UHFFFAOYSA-N 0.000 claims 2
- JIICDYRNQKVXFR-UHFFFAOYSA-N 5-[4-[(4-methylphenyl)methyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(C)=CC=C1CN1CCN(C(=O)C2NC(=O)CC2)CC1 JIICDYRNQKVXFR-UHFFFAOYSA-N 0.000 claims 2
- RFRUXGCVYWNHJO-HEKVCFEKSA-N C(\C=C/C(=O)O)(=O)O.O1CCN(CC1)C(=O)CN1CCN(CC1)C(=O)[C@H]1CCC(N1)=O Chemical compound C(\C=C/C(=O)O)(=O)O.O1CCN(CC1)C(=O)CN1CCN(CC1)C(=O)[C@H]1CCC(N1)=O RFRUXGCVYWNHJO-HEKVCFEKSA-N 0.000 claims 2
- DBOVLSFOWGQEEH-UHFFFAOYSA-N 5-(4-hydroxypiperidine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CC(O)CCN1C(=O)C1NC(=O)CC1 DBOVLSFOWGQEEH-UHFFFAOYSA-N 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- UNNWZHOQBNHIPV-UHFFFAOYSA-N ethyl 4-(5-oxopyrrolidine-2-carbonyl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C(=O)C1NC(=O)CC1 UNNWZHOQBNHIPV-UHFFFAOYSA-N 0.000 claims 1
- 239000002664 nootropic agent Substances 0.000 abstract description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 36
- 239000002904 solvent Substances 0.000 description 32
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 20
- 229960005141 piperazine Drugs 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 229910001868 water Inorganic materials 0.000 description 12
- 230000000694 effects Effects 0.000 description 11
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 229940079593 drug Drugs 0.000 description 8
- 239000003814 drug Substances 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 239000000843 powder Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 238000007912 intraperitoneal administration Methods 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 206010070863 Toxicity to various agents Diseases 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 238000010898 silica gel chromatography Methods 0.000 description 6
- ZXNRTKGTQJPIJK-UHFFFAOYSA-N aniracetam Chemical compound C1=CC(OC)=CC=C1C(=O)N1C(=O)CCC1 ZXNRTKGTQJPIJK-UHFFFAOYSA-N 0.000 description 5
- 229960000793 aniracetam Drugs 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 229940093956 potassium carbonate Drugs 0.000 description 5
- 235000011181 potassium carbonates Nutrition 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- MDMAUEITTFGEIK-UHFFFAOYSA-N 5-(piperazine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CNCCN1C(=O)C1CCC(=O)N1 MDMAUEITTFGEIK-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 4
- 150000008282 halocarbons Chemical class 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- 239000002798 polar solvent Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- 241000905957 Channa melasoma Species 0.000 description 3
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- ODHCTXKNWHHXJC-GSVOUGTGSA-N Pyroglutamic acid Natural products OC(=O)[C@H]1CCC(=O)N1 ODHCTXKNWHHXJC-GSVOUGTGSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 235000011087 fumaric acid Nutrition 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 229960004592 isopropanol Drugs 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 3
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- STECJAGHUSJQJN-FWXGHANASA-N scopolamine Chemical compound C1([C@@H](CO)C(=O)O[C@H]2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-FWXGHANASA-N 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- ULSDMUVEXKOYBU-ZDUSSCGKSA-N zolmitriptan Chemical compound C1=C2C(CCN(C)C)=CNC2=CC=C1C[C@H]1COC(=O)N1 ULSDMUVEXKOYBU-ZDUSSCGKSA-N 0.000 description 3
- LUZOFMGZMUZSSK-LRDDRELGSA-N (-)-indolactam V Chemical compound C1[C@@H](CO)NC(=O)[C@H](C(C)C)N(C)C2=CC=CC3=C2C1=CN3 LUZOFMGZMUZSSK-LRDDRELGSA-N 0.000 description 2
- FQUYSHZXSKYCSY-UHFFFAOYSA-N 1,4-diazepane Chemical compound C1CNCCNC1 FQUYSHZXSKYCSY-UHFFFAOYSA-N 0.000 description 2
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 2
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical compound OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 description 2
- 229930000680 A04AD01 - Scopolamine Natural products 0.000 description 2
- 208000024827 Alzheimer disease Diseases 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- 206010010904 Convulsion Diseases 0.000 description 2
- STECJAGHUSJQJN-GAUPFVANSA-N Hyoscine Natural products C1([C@H](CO)C(=O)OC2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-GAUPFVANSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- STECJAGHUSJQJN-UHFFFAOYSA-N N-Methyl-scopolamin Natural products C1C(C2C3O2)N(C)C3CC1OC(=O)C(CO)C1=CC=CC=C1 STECJAGHUSJQJN-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- ODHCTXKNWHHXJC-UHFFFAOYSA-N acide pyroglutamique Natural products OC(=O)C1CCC(=O)N1 ODHCTXKNWHHXJC-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 230000002490 cerebral effect Effects 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 229940125898 compound 5 Drugs 0.000 description 2
- 230000036461 convulsion Effects 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- CXHHBNMLPJOKQD-UHFFFAOYSA-M methyl carbonate Chemical compound COC([O-])=O CXHHBNMLPJOKQD-UHFFFAOYSA-M 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000011259 mixed solution Substances 0.000 description 2
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229960002646 scopolamine Drugs 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- JEOVABNPJMHXGZ-QMMMGPOBSA-N (2S)-5-oxo-1-piperidin-1-ylpyrrolidine-2-carboxamide Chemical class NC(=O)[C@@H]1CCC(=O)N1N1CCCCC1 JEOVABNPJMHXGZ-QMMMGPOBSA-N 0.000 description 1
- YQXLOVXVWICTBX-ZETCQYMHSA-N (2S)-5-oxo-1-pyrrolidin-1-ylpyrrolidine-2-carboxamide Chemical class NC(=O)[C@@H]1CCC(=O)N1N1CCCC1 YQXLOVXVWICTBX-ZETCQYMHSA-N 0.000 description 1
- JIICDYRNQKVXFR-OAHLLOKOSA-N (5R)-5-[4-[(4-methylphenyl)methyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(C)=CC=C1CN1CCN(C(=O)[C@@H]2NC(=O)CC2)CC1 JIICDYRNQKVXFR-OAHLLOKOSA-N 0.000 description 1
- WPDJMBAXQKFEOI-SSDOTTSWSA-N (5r)-5-(morpholine-4-carbonyl)pyrrolidin-2-one Chemical compound C1COCCN1C(=O)[C@H]1CCC(=O)N1 WPDJMBAXQKFEOI-SSDOTTSWSA-N 0.000 description 1
- IWMYEQSITOXBMZ-SSDOTTSWSA-N (5r)-5-(pyrrolidine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CCCN1C(=O)[C@H]1CCC(=O)N1 IWMYEQSITOXBMZ-SSDOTTSWSA-N 0.000 description 1
- QKAHRFPPZHTKGH-SSDOTTSWSA-N (5r)-5-(thiomorpholine-4-carbonyl)pyrrolidin-2-one Chemical compound C1CSCCN1C(=O)[C@H]1CCC(=O)N1 QKAHRFPPZHTKGH-SSDOTTSWSA-N 0.000 description 1
- ZNGHTCSIUZKPCF-GFCCVEGCSA-N (5r)-5-[4-(2-morpholin-4-ylacetyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CN(C(=O)[C@@H]2NC(=O)CC2)CCN1C(=O)CN1CCOCC1 ZNGHTCSIUZKPCF-GFCCVEGCSA-N 0.000 description 1
- VYHFDUROTYBGCQ-BTJKTKAUSA-N (z)-but-2-enedioic acid;5-[4-(2-oxo-2-piperazin-1-ylethyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound OC(=O)\C=C/C(O)=O.C1CNCCN1C(=O)CN(CC1)CCN1C(=O)C1CCC(=O)N1 VYHFDUROTYBGCQ-BTJKTKAUSA-N 0.000 description 1
- HIHIPVLXLNHUSL-UHFFFAOYSA-N 1-(5-oxopyrrolidine-2-carbonyl)piperidin-4-one Chemical compound C1CC(=O)CCN1C(=O)C1CCC(=O)N1 HIHIPVLXLNHUSL-UHFFFAOYSA-N 0.000 description 1
- YMQRPXBBBOXHNZ-UHFFFAOYSA-N 2-chloro-1-morpholin-4-ylethanone Chemical compound ClCC(=O)N1CCOCC1 YMQRPXBBBOXHNZ-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- NPUKDXXFDDZOKR-UHFFFAOYSA-N 3-(1-phenylethyl)-4-imidazolecarboxylic acid ethyl ester Chemical compound CCOC(=O)C1=CN=CN1C(C)C1=CC=CC=C1 NPUKDXXFDDZOKR-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- VLVACYFVIIGDTH-UHFFFAOYSA-N 4-(5-oxopyrrolidine-2-carbonyl)piperazin-2-one Chemical compound C1CNC(=O)CN1C(=O)C1CCC(=O)N1 VLVACYFVIIGDTH-UHFFFAOYSA-N 0.000 description 1
- ABGXADJDTPFFSZ-UHFFFAOYSA-N 4-benzylpiperidine Chemical compound C=1C=CC=CC=1CC1CCNCC1 ABGXADJDTPFFSZ-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- ROCRRDYGWLIXBS-UHFFFAOYSA-N 5-(4-phenylpiperazine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CN(C=2C=CC=CC=2)CCN1C(=O)C1CCC(=O)N1 ROCRRDYGWLIXBS-UHFFFAOYSA-N 0.000 description 1
- FSTXETIGWBGVMD-UHFFFAOYSA-N 5-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CN(CC=2C=C3OCOC3=CC=2)CCN1C(=O)C1CCC(=O)N1 FSTXETIGWBGVMD-UHFFFAOYSA-N 0.000 description 1
- IIGFRCNOTWWJGY-UHFFFAOYSA-N 5-[4-(2-chlorophenyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound ClC1=CC=CC=C1N1CCN(C(=O)C2NC(=O)CC2)CC1 IIGFRCNOTWWJGY-UHFFFAOYSA-N 0.000 description 1
- IGIUDHVUOGPVHA-UHFFFAOYSA-N 5-[4-(2-morpholin-4-yl-2-oxoethyl)-1,4-diazepane-1-carbonyl]pyrrolidin-2-one Chemical compound C1COCCN1C(=O)CN(CC1)CCCN1C(=O)C1CCC(=O)N1 IGIUDHVUOGPVHA-UHFFFAOYSA-N 0.000 description 1
- NJXNTDNNCUBXAK-UHFFFAOYSA-N 5-[4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CCCCN1C(=O)CN(CC1)CCN1C(=O)C1CCC(=O)N1 NJXNTDNNCUBXAK-UHFFFAOYSA-N 0.000 description 1
- NPTIKHBPOQKTIF-UHFFFAOYSA-N 5-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CCCN1C(=O)CN(CC1)CCN1C(=O)C1CCC(=O)N1 NPTIKHBPOQKTIF-UHFFFAOYSA-N 0.000 description 1
- YSPPUFHSWPTYKV-UHFFFAOYSA-N 5-[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CN(CCN2CCCCC2)CCN1C(=O)C1CCC(=O)N1 YSPPUFHSWPTYKV-UHFFFAOYSA-N 0.000 description 1
- PZBWOBAOBFBOHM-UHFFFAOYSA-N 5-[4-(3,4,5-trimethoxybenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound COC1=C(OC)C(OC)=CC(C(=O)N2CCN(CC2)C(=O)C2NC(=O)CC2)=C1 PZBWOBAOBFBOHM-UHFFFAOYSA-N 0.000 description 1
- XVXADNBHUWJEBA-UHFFFAOYSA-N 5-[4-(3-chlorophenyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound ClC1=CC=CC(N2CCN(CC2)C(=O)C2NC(=O)CC2)=C1 XVXADNBHUWJEBA-UHFFFAOYSA-N 0.000 description 1
- YVHFCHRSYUAVBN-UHFFFAOYSA-N 5-[4-(3-methylbenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound CC1=CC=CC(C(=O)N2CCN(CC2)C(=O)C2NC(=O)CC2)=C1 YVHFCHRSYUAVBN-UHFFFAOYSA-N 0.000 description 1
- GXBWYXPPOPTXDK-UHFFFAOYSA-N 5-[4-(3-morpholin-4-yl-3-oxopropyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1COCCN1C(=O)CCN(CC1)CCN1C(=O)C1CCC(=O)N1 GXBWYXPPOPTXDK-UHFFFAOYSA-N 0.000 description 1
- BSJIRKUPILRBRO-UHFFFAOYSA-N 5-[4-(3-morpholin-4-ylpropanoyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CN(C(=O)C2NC(=O)CC2)CCN1C(=O)CCN1CCOCC1 BSJIRKUPILRBRO-UHFFFAOYSA-N 0.000 description 1
- NUABEVGQIIOGPG-UHFFFAOYSA-N 5-[4-(4-chlorophenyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1N1CCN(C(=O)C2NC(=O)CC2)CC1 NUABEVGQIIOGPG-UHFFFAOYSA-N 0.000 description 1
- DDHFMUFPFQWZSE-UHFFFAOYSA-N 5-[4-(4-fluorobenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(F)=CC=C1C(=O)N1CCN(C(=O)C2NC(=O)CC2)CC1 DDHFMUFPFQWZSE-UHFFFAOYSA-N 0.000 description 1
- MEGGLDUKDVEZML-UHFFFAOYSA-N 5-[4-(4-methylbenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(C)=CC=C1C(=O)N1CCN(C(=O)C2NC(=O)CC2)CC1 MEGGLDUKDVEZML-UHFFFAOYSA-N 0.000 description 1
- RKOLHIMNEWIGFW-UHFFFAOYSA-N 5-[4-(4-nitrobenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)N1CCN(C(=O)C2NC(=O)CC2)CC1 RKOLHIMNEWIGFW-UHFFFAOYSA-N 0.000 description 1
- VDXQJKGFWCCXRL-UHFFFAOYSA-N 5-[4-[2-(2-chlorophenoxy)ethyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound ClC1=CC=CC=C1OCCN1CCN(C(=O)C2NC(=O)CC2)CC1 VDXQJKGFWCCXRL-UHFFFAOYSA-N 0.000 description 1
- HNEHHUXARMOTEE-UHFFFAOYSA-N 5-[4-[3-(4-methylphenoxy)propyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(C)=CC=C1OCCCN1CCN(C(=O)C2NC(=O)CC2)CC1 HNEHHUXARMOTEE-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- BKHGHAJVGVBDBE-ZDUSSCGKSA-N CC1=CC=CC=C1N1CCN(C(=O)[C@H]2NC(=O)CC2)CC1 Chemical compound CC1=CC=CC=C1N1CCN(C(=O)[C@H]2NC(=O)CC2)CC1 BKHGHAJVGVBDBE-ZDUSSCGKSA-N 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 206010065559 Cerebral arteriosclerosis Diseases 0.000 description 1
- 206010008190 Cerebrovascular accident Diseases 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- 206010012289 Dementia Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 239000004129 EU approved improving agent Substances 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 241000237858 Gastropoda Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- 101000958041 Homo sapiens Musculin Proteins 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- HQGPKMSGXAUKHT-UHFFFAOYSA-N L-pyroglutamic acid methyl ester Natural products COC(=O)C1CCC(=O)N1 HQGPKMSGXAUKHT-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000428533 Rhis Species 0.000 description 1
- 206010039966 Senile dementia Diseases 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 208000006011 Stroke Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 102000011923 Thyrotropin Human genes 0.000 description 1
- 108010061174 Thyrotropin Proteins 0.000 description 1
- 206010052428 Wound Diseases 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940046545 animal allergen extract Drugs 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 230000000767 anti-ulcer Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- QPZJXYPDBUSTMG-UHFFFAOYSA-N benzyl 4-(5-oxopyrrolidine-2-carbonyl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)C2NC(=O)CC2)CCN1C(=O)OCC1=CC=CC=C1 QPZJXYPDBUSTMG-UHFFFAOYSA-N 0.000 description 1
- OFLKLFCGDNCMFY-UHFFFAOYSA-N benzyl 4-[2-[4-(5-oxopyrrolidine-2-carbonyl)piperazin-1-yl]acetyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC=2C=CC=CC=2)CCN1C(=O)CN(CC1)CCN1C(=O)C1CCC(=O)N1 OFLKLFCGDNCMFY-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- CTOUWUYDDUSBQE-UHFFFAOYSA-N benzyl piperazine-1-carboxylate Chemical compound C1CNCCN1C(=O)OCC1=CC=CC=C1 CTOUWUYDDUSBQE-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- UXXXZMDJQLPQPH-UHFFFAOYSA-N bis(2-methylpropyl) carbonate Chemical compound CC(C)COC(=O)OCC(C)C UXXXZMDJQLPQPH-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 230000003727 cerebral blood flow Effects 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 230000001713 cholinergic effect Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 231100000870 cognitive problem Toxicity 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 206010014599 encephalitis Diseases 0.000 description 1
- RBISEIMZVBJUQE-UHFFFAOYSA-N ethyl 1-(5-oxopyrrolidine-2-carbonyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)CCN1C(=O)C1NC(=O)CC1 RBISEIMZVBJUQE-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- GOWRRBABHQUJMX-UHFFFAOYSA-N fasoracetam Chemical compound C1CCCCN1C(=O)C1CCC(=O)N1 GOWRRBABHQUJMX-UHFFFAOYSA-N 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 125000000268 heptanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 102000046949 human MSC Human genes 0.000 description 1
- 201000005851 intracranial arteriosclerosis Diseases 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000005921 isopentoxy group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 230000003340 mental effect Effects 0.000 description 1
- 239000001525 mentha piperita l. herb oil Substances 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- HQGPKMSGXAUKHT-BYPYZUCNSA-N methyl (2s)-5-oxopyrrolidine-2-carboxylate Chemical compound COC(=O)[C@@H]1CCC(=O)N1 HQGPKMSGXAUKHT-BYPYZUCNSA-N 0.000 description 1
- UPPPILNTMCMVRO-UHFFFAOYSA-N methyl 4-[3-[4-(5-oxopyrrolidine-2-carbonyl)piperazin-1-yl]propoxy]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1OCCCN1CCN(C(=O)C2NC(=O)CC2)CC1 UPPPILNTMCMVRO-UHFFFAOYSA-N 0.000 description 1
- KXEPBEZAFZGAGH-UHFFFAOYSA-N methyl 4-[[4-(5-oxopyrrolidine-2-carbonyl)piperazin-1-yl]methyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1CN1CCN(C(=O)C2NC(=O)CC2)CC1 KXEPBEZAFZGAGH-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- MAFJXAYWVBYUEH-UHFFFAOYSA-N n,n'-bis(4-methoxyphenyl)ethane-1,2-diamine Chemical compound C1=CC(OC)=CC=C1NCCNC1=CC=C(OC)C=C1 MAFJXAYWVBYUEH-UHFFFAOYSA-N 0.000 description 1
- CEUVYVBWZIVIEM-UHFFFAOYSA-N n,n-dimethyl-4-(5-oxopyrrolidine-2-carbonyl)piperazine-1-carboxamide Chemical compound C1CN(C(=O)N(C)C)CCN1C(=O)C1NC(=O)CC1 CEUVYVBWZIVIEM-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004998 naphthylethyl group Chemical group C1(=CC=CC2=CC=CC=C12)CC* 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 235000019477 peppermint oil Nutrition 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000003488 releasing hormone Substances 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 231100000161 signs of toxicity Toxicity 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 238000009491 slugging Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 229960000874 thyrotropin Drugs 0.000 description 1
- 230000001748 thyrotropin Effects 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
- C07D207/277—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D207/28—2-Pyrrolidone-5- carboxylic acids; Functional derivatives thereof, e.g. esters, nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1135986 | 1986-01-21 | ||
| JP61-011360 | 1986-01-21 | ||
| JP1136086 | 1986-01-21 | ||
| JP61-011359 | 1986-01-21 | ||
| JP61-175168 | 1986-07-24 | ||
| JP17516886 | 1986-07-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1323874C true CA1323874C (en) | 1993-11-02 |
Family
ID=27279384
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000527706A Expired - Fee Related CA1323874C (en) | 1986-01-21 | 1987-01-20 | Pyroglutamide derivatives |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US5102882A (enExample) |
| BE (1) | BE1003248A5 (enExample) |
| CA (1) | CA1323874C (enExample) |
| CH (1) | CH675418A5 (enExample) |
| DE (2) | DE3744947C2 (enExample) |
| ES (1) | ES2002083A6 (enExample) |
| FR (2) | FR2597100A1 (enExample) |
| GB (1) | GB2185483B (enExample) |
| IT (1) | IT1205715B (enExample) |
| NL (1) | NL192304C (enExample) |
| SE (1) | SE503436C2 (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0367393A3 (en) * | 1988-10-31 | 1991-03-27 | Takeda Chemical Industries, Ltd. | New heterocyclic compounds, production and use thereof |
| IT1244507B (it) * | 1991-04-11 | 1994-07-15 | Sigma Tau Ind Farmaceuti | Derivati dell'acido piroglutammico quali attivatori dei processi di apprendimento e della memoria e composizioni farmaceutiche comprendenti tali composti |
| FR2680508B1 (fr) * | 1991-08-20 | 1995-03-03 | Adir | Nouveaux composes amidiques des 1-(alcoxybenzyl)piperazines, leurs procedes de preparation et les compositions pharmaceutiques qui les contiennent. |
| EP0711554A4 (en) * | 1993-07-28 | 1997-07-23 | Nippon Shinyaku Co Ltd | ANTIDEPRESSANT |
| CA2157348A1 (en) * | 1994-09-01 | 1996-03-02 | Aventis Pharmaceuticals Inc. | 3-¬4-(1-substituted-4-piperazinyl)butyl|-4-thiazolidinone and related compounds |
| GB9420784D0 (en) * | 1994-10-14 | 1994-11-30 | Glaxo Group Ltd | Medicaments |
| EP0869793A4 (en) * | 1995-11-13 | 1999-02-03 | Smithkline Beecham Corp | HEMOREGULATORY COMPOUNDS |
| PL357177A1 (en) * | 2000-02-11 | 2004-07-26 | Vertex Pharmaceuticals Incorporated | Piperazine and piperidine derivatives for treatment or prevention of neuronal damage |
| ES2324293T3 (es) * | 2002-10-03 | 2009-08-04 | Vertex Pharmaceuticals Incorporated | Derivados de piperacina y piperidina para el tratamiento de enfermedades neurologicas. |
| RU2530900C2 (ru) | 2007-01-12 | 2014-10-20 | Новартис Аг | Способ получения 5-бифенил-4-амино-2-метилпентановой кислоты |
| DE102008003826B4 (de) * | 2008-01-10 | 2010-07-22 | Clariant International Limited | Verwendung von Salzen als Korrosionsinhibitoren mit erhöhter biologischer Abbaubarkeit und verminderter Toxizität und diese Salze |
| DE102008003828B3 (de) | 2008-01-10 | 2009-09-03 | Clariant International Limited | Verwendung von Salzen als Korrosionsinhibitoren mit erhöhter biologischer Abbaubarkeit und verminderter Toxizität und diese Salze |
| WO2012025501A1 (en) | 2010-08-23 | 2012-03-01 | Novartis Ag | Process for the preparation of intermediates for the manufacture of nep inhibitors |
| WO2016205348A1 (en) | 2015-06-15 | 2016-12-22 | The Children's Hospital Of Philadelphia | Methods of diagnosing and treating autism |
| US11608324B2 (en) * | 2018-01-18 | 2023-03-21 | The Children's Hospital Of Philadelphia | Solid forms of fasoracetam |
| CA3088970A1 (en) | 2018-01-18 | 2019-07-25 | The Children's Hospital Of Philadelphia | Fasoracetam crystalline forms |
| GB202300833D0 (en) * | 2023-01-19 | 2023-03-08 | Nrg Therapeutics Ltd | Novel compounds |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3051722A (en) * | 1960-10-21 | 1962-08-28 | Lakeside Lab Inc | 5-pyrrolidone-2-carboxamides |
| JPS5015793B2 (enExample) * | 1972-06-07 | 1975-06-07 | ||
| JPS518266A (en) * | 1974-07-10 | 1976-01-23 | Sakai Chemical Industry Co | Piroridonjudotaino seizohoho |
| GB1492640A (en) * | 1975-07-08 | 1977-11-23 | Ucb Sa | L-pyroglutamyl-l-prolinamide |
| BE864269A (fr) * | 1977-03-03 | 1978-06-16 | Parke Davis & Co | Nouveaux n-(aminoalkyl substitue)-2-oxo-1-pyrrolidine-acetamides et procedes pour les produire |
| DE2924011C2 (de) * | 1979-06-13 | 1982-04-08 | A. Nattermann & Cie GmbH, 5000 Köln | Pyrrolidin-(2)-on-(1)-ylessigsäure-2,6,-dimethylanilid, Verfahren zur Herstellung und Arzneimittel, welche diese Verbindung enthalten |
| HU180925B (en) * | 1979-06-28 | 1983-05-30 | Richter Gedeon Vegyeszet | Process for producing tripeptide-amides trh-analogues,effectives on the central nerve systhem |
| JPS56147766A (en) * | 1980-04-17 | 1981-11-16 | Sakai Chem Ind Co Ltd | Preparation of lactam |
| DE3031118A1 (de) * | 1980-08-18 | 1982-04-01 | Meditest Institut für medizinisch-pharmazeutische Untersuchungen GmbH & Co KG, 7958 Laupheim | N,n'-bis(5-oxo-1-methyl-pyrrolidin-2-yl-essigsaeure)-hydrazid, verfahren zu dessen herstellung und seine verwendung als arzneimittel |
| HU184481B (en) * | 1981-10-02 | 1984-08-28 | Richter Gedeon Vegyeszet | Process for producing tripeptides for diminishing appetite |
| GB2130590B (en) * | 1982-11-10 | 1986-01-08 | Erba Farmitalia | Peptides |
| US4483991A (en) * | 1983-01-17 | 1984-11-20 | American Home Products Corporation | Hypotensive agents |
| US4525476A (en) * | 1983-05-26 | 1985-06-25 | Warner-Lambert Company | N-[1-oxo-3-(5-oxo-2-pyrrolidinyl)propyl]-alpha-aminoacids and derivatives as cognition activators |
| IT1172391B (it) * | 1983-12-23 | 1987-06-18 | Polifarma Spa | Composti tirpeptidici contenenti acido piroglutaminico e triptofano,procedimentio di produzione ed applicazioni terapeutiche |
| DE3420193A1 (de) * | 1984-05-30 | 1985-12-05 | Boehringer Ingelheim KG, 6507 Ingelheim | Neue substituierte pyrrolidinone, verfahren zu ihrer herstellung und arzneimittel |
-
1987
- 1987-01-16 FR FR8700485A patent/FR2597100A1/fr active Granted
- 1987-01-20 SE SE8700203A patent/SE503436C2/xx not_active IP Right Cessation
- 1987-01-20 CH CH195/87A patent/CH675418A5/de not_active IP Right Cessation
- 1987-01-20 DE DE3744947A patent/DE3744947C2/de not_active Expired - Fee Related
- 1987-01-20 DE DE19873701494 patent/DE3701494A1/de active Granted
- 1987-01-20 ES ES8700128A patent/ES2002083A6/es not_active Expired
- 1987-01-20 IT IT47545/87A patent/IT1205715B/it active
- 1987-01-20 CA CA000527706A patent/CA1323874C/en not_active Expired - Fee Related
- 1987-01-20 NL NL8700119A patent/NL192304C/nl not_active IP Right Cessation
- 1987-01-21 GB GB8701245A patent/GB2185483B/en not_active Expired - Fee Related
- 1987-01-21 BE BE8700036A patent/BE1003248A5/fr not_active IP Right Cessation
- 1987-09-28 FR FR8713376A patent/FR2613366A1/fr active Granted
-
1991
- 1991-02-26 US US07/661,523 patent/US5102882A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| NL8700119A (nl) | 1987-08-17 |
| FR2597100A1 (fr) | 1987-10-16 |
| IT1205715B (it) | 1989-03-31 |
| US5102882A (en) | 1992-04-07 |
| SE8700203L (sv) | 1987-07-22 |
| SE8700203D0 (sv) | 1987-01-20 |
| DE3701494A1 (de) | 1987-07-23 |
| NL192304B (nl) | 1997-01-06 |
| GB2185483B (en) | 1990-10-24 |
| SE503436C2 (sv) | 1996-06-17 |
| IT8747545A0 (it) | 1987-01-20 |
| GB8701245D0 (en) | 1987-02-25 |
| ES2002083A6 (es) | 1988-07-01 |
| DE3744947C2 (enExample) | 1992-07-16 |
| FR2597100B1 (enExample) | 1994-08-19 |
| NL192304C (nl) | 1997-05-07 |
| CH675418A5 (enExample) | 1990-09-28 |
| BE1003248A5 (fr) | 1992-02-11 |
| GB2185483A (en) | 1987-07-22 |
| FR2613366B1 (enExample) | 1994-08-19 |
| FR2613366A1 (fr) | 1988-10-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1323874C (en) | Pyroglutamide derivatives | |
| CA1242439A (en) | 1-¬(AMINOALKYL AND AMINOALKYLAMINO)CARBONYL AND THIOCARBONYL|-.alpha.,.alpha.-DIARYLPYRROLIDINE, PIPERIDINE AND HOMOPIPERIDINEACETAMIDES AND ACETONITRILES | |
| AU2003209514A1 (en) | N-aminoacetyl-pyrrolidine-2-carbonitriles and their use as DDP-IV inhibitors | |
| CA1119593A (en) | Lactam-n-acetic acids and their amides | |
| EP0654023B1 (en) | 5-(2-oxyphenyl)-pyrrole derivatives as dopamine d3 receptor antagonists | |
| FI78462B (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla pyrrolidinoner. | |
| CA1317943C (en) | Butynylamine derivatives and their production | |
| SE503436C3 (sv) | Pyroglutamidderivat | |
| CA1166256A (en) | Sulphonamide derivatives, a process for their preparation and their use as medicines | |
| CA1079277A (en) | 10(.omega.-(BENZOYLPIPERIDINYL)ALKYL) PHENOTHIAZINES | |
| JPH05506249A (ja) | ビスーベンゾシクロヘプタピペリジリデン、ピペリジンおよびピペラジン化合物、組成物および使用法 | |
| US4324791A (en) | Heterocyclic antidiarrheal compositions & methods of use | |
| US5401744A (en) | Useful hemi-hydrate form of a cerebral function enhancing agent | |
| US4703055A (en) | Benzamides and therapeutic use thereof | |
| AU636972B2 (en) | 4-{3-(4-oxothiazoldinyl)}butynylamines, a process for their preparation and their use as medicaments | |
| CA2679317A1 (en) | Novel crystal forms of pyrrolylheptanoic acid derivatives | |
| JP2513197B2 (ja) | ピログルタミド誘導体 | |
| JPS6157586A (ja) | 認識力活性剤としてのジヒドロ‐1H‐ピロロ〔1,2‐c〕イミダゾール‐3,5‐ジオンの誘導体 | |
| CA1123852A (en) | Cyclododecane derivatives and a process for the preparation thereof | |
| FI56831C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara pyrrolidyliden- piperidyliden- och hexahydroazepinyliden-urinaemnen | |
| USRE28141E (en) | Marshall dann | |
| GB2040931A (en) | 1 - substituted - 3 - arylthio - 4 - hydroxypyrrolidines | |
| JP2005343805A (ja) | 新規1,2,5−チアジアゾール化合物、およびその医薬用途 | |
| SK88293A3 (en) | Process for preparation 1-unsubstituted 3-aminopyroles | |
| DE1915484A1 (de) | Alpha-Substituierte 2-Amino-methylbenzylalkohole und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed | ||
| MKLA | Lapsed |
Effective date: 20001102 |