CA1295340C - Process for the preparation of n,n-diaryl-ureas - Google Patents
Process for the preparation of n,n-diaryl-ureasInfo
- Publication number
- CA1295340C CA1295340C CA000549951A CA549951A CA1295340C CA 1295340 C CA1295340 C CA 1295340C CA 000549951 A CA000549951 A CA 000549951A CA 549951 A CA549951 A CA 549951A CA 1295340 C CA1295340 C CA 1295340C
- Authority
- CA
- Canada
- Prior art keywords
- diarylamine
- process according
- formula
- isocyanate
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title claims abstract description 29
- 238000002360 preparation method Methods 0.000 title claims abstract description 7
- 239000002253 acid Substances 0.000 claims abstract description 27
- 150000001875 compounds Chemical class 0.000 claims abstract description 26
- 125000005266 diarylamine group Chemical group 0.000 claims abstract description 23
- 239000012948 isocyanate Substances 0.000 claims abstract description 21
- 150000002513 isocyanates Chemical class 0.000 claims abstract description 21
- 125000003118 aryl group Chemical group 0.000 claims abstract description 15
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 5
- 238000006243 chemical reaction Methods 0.000 claims description 25
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 125000001624 naphthyl group Chemical group 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 5
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 4
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 239000007848 Bronsted acid Substances 0.000 claims description 2
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 2
- 125000003944 tolyl group Chemical group 0.000 claims description 2
- 239000003701 inert diluent Substances 0.000 abstract description 2
- 239000012442 inert solvent Substances 0.000 abstract description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 20
- 229940035422 diphenylamine Drugs 0.000 description 10
- 239000002904 solvent Substances 0.000 description 9
- 239000003085 diluting agent Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- 239000004202 carbamide Substances 0.000 description 6
- 235000013877 carbamide Nutrition 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- JYFHYPJRHGVZDY-UHFFFAOYSA-N Dibutyl phosphate Chemical compound CCCCOP(O)(=O)OCCCC JYFHYPJRHGVZDY-UHFFFAOYSA-N 0.000 description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 239000005711 Benzoic acid Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- -1 methoxy, ethoxy, propoxy, isopropoxy, butoxy Chemical group 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- IMFYAZJNDOZIFV-UHFFFAOYSA-N 3-methyl-1,1-diphenylurea Chemical compound C=1C=CC=CC=1N(C(=O)NC)C1=CC=CC=C1 IMFYAZJNDOZIFV-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000006575 electron-withdrawing group Chemical group 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 2
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 229960004838 phosphoric acid Drugs 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000004064 recycling Methods 0.000 description 2
- COSWCAGTKRUTQV-UHFFFAOYSA-N 1,1,3-trimethylurea Chemical compound CNC(=O)N(C)C COSWCAGTKRUTQV-UHFFFAOYSA-N 0.000 description 1
- HKQGDIKHDDGEOE-UHFFFAOYSA-N 1,1,3-triphenylurea Chemical compound C=1C=CC=CC=1N(C=1C=CC=CC=1)C(=O)NC1=CC=CC=C1 HKQGDIKHDDGEOE-UHFFFAOYSA-N 0.000 description 1
- WONYVCKUEUULQN-UHFFFAOYSA-N 2-methyl-n-(2-methylphenyl)aniline Chemical compound CC1=CC=CC=C1NC1=CC=CC=C1C WONYVCKUEUULQN-UHFFFAOYSA-N 0.000 description 1
- WOPDLBNNBJCXFA-UHFFFAOYSA-N 3-butyl-1,1-diphenylurea Chemical compound C=1C=CC=CC=1N(C(=O)NCCCC)C1=CC=CC=C1 WOPDLBNNBJCXFA-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XQVWYOYUZDUNRW-UHFFFAOYSA-N N-Phenyl-1-naphthylamine Chemical compound C=1C=CC2=CC=CC=C2C=1NC1=CC=CC=C1 XQVWYOYUZDUNRW-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910052500 inorganic mineral Chemical class 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- ZDGGJQMSELMHLK-UHFFFAOYSA-N m-Trifluoromethylhippuric acid Chemical compound OC(=O)CNC(=O)C1=CC=CC(C(F)(F)F)=C1 ZDGGJQMSELMHLK-UHFFFAOYSA-N 0.000 description 1
- OHZZTXYKLXZFSZ-UHFFFAOYSA-I manganese(3+) 5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(1-methylpyridin-4-ylidene)porphyrin-22-ide pentachloride Chemical class [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Mn+3].C1=CN(C)C=CC1=C1C(C=C2)=NC2=C(C=2C=C[N+](C)=CC=2)C([N-]2)=CC=C2C(C=2C=C[N+](C)=CC=2)=C(C=C2)N=C2C(C=2C=C[N+](C)=CC=2)=C2N=C1C=C2 OHZZTXYKLXZFSZ-UHFFFAOYSA-I 0.000 description 1
- 239000011707 mineral Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004998 naphthylethyl group Chemical group C1(=CC=CC2=CC=CC=C12)CC* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 150000007519 polyprotic acids Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 230000004224 protection Effects 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical class [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 238000005829 trimerization reaction Methods 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1809—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas with formation of the N-C(O)-N moiety
- C07C273/1818—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas with formation of the N-C(O)-N moiety from -N=C=O and XNR'R"
- C07C273/1827—X being H
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863636190 DE3636190A1 (de) | 1986-10-24 | 1986-10-24 | Verfahren zur herstellung von n,n-diaryl-harnstoffen |
| DEP3636190.9 | 1986-10-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1295340C true CA1295340C (en) | 1992-02-04 |
Family
ID=6312378
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000549951A Expired - Lifetime CA1295340C (en) | 1986-10-24 | 1987-10-22 | Process for the preparation of n,n-diaryl-ureas |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4820871A (enExample) |
| EP (1) | EP0264752B1 (enExample) |
| JP (1) | JPS63122660A (enExample) |
| CA (1) | CA1295340C (enExample) |
| DE (2) | DE3636190A1 (enExample) |
| DK (1) | DK555687A (enExample) |
| ES (1) | ES2016957B3 (enExample) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5248755A (en) * | 1989-07-28 | 1993-09-28 | Chemie Linz Gesellschaft M.B.H. | Process for the preparation of asymmetrically substituted ureas, carbamates or thiocarbamates |
| ES2066049T3 (es) * | 1989-07-28 | 1995-03-01 | Chemie Linz Gmbh | Procedimiento para la obtencion de ureas asimetricamente substituidas. |
| US5220061A (en) * | 1992-02-07 | 1993-06-15 | Arco Chemical Technology, L.P. | Selective process for the preparation of diphenylmethane bis-(dialkyl ureas |
| JP3372436B2 (ja) * | 1996-11-28 | 2003-02-04 | オークマ株式会社 | インバータの制御装置 |
| US6344476B1 (en) | 1997-05-23 | 2002-02-05 | Bayer Corporation | Inhibition of p38 kinase activity by aryl ureas |
| US20080300281A1 (en) * | 1997-12-22 | 2008-12-04 | Jacques Dumas | Inhibition of p38 Kinase Activity Using Aryl and Heteroaryl Substituted Heterocyclic Ureas |
| US7517880B2 (en) | 1997-12-22 | 2009-04-14 | Bayer Pharmaceuticals Corporation | Inhibition of p38 kinase using symmetrical and unsymmetrical diphenyl ureas |
| US7329670B1 (en) | 1997-12-22 | 2008-02-12 | Bayer Pharmaceuticals Corporation | Inhibition of RAF kinase using aryl and heteroaryl substituted heterocyclic ureas |
| US20080269265A1 (en) * | 1998-12-22 | 2008-10-30 | Scott Miller | Inhibition Of Raf Kinase Using Symmetrical And Unsymmetrical Substituted Diphenyl Ureas |
| ME00275B (me) * | 1999-01-13 | 2011-02-10 | Bayer Corp | ω-KARBOKSIARIL SUPSTITUISANI DIFENIL KARBAMIDI KAO INHIBITORI RAF KINAZE |
| EP1140840B1 (en) | 1999-01-13 | 2006-03-22 | Bayer Pharmaceuticals Corp. | -g(v)-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| US8124630B2 (en) * | 1999-01-13 | 2012-02-28 | Bayer Healthcare Llc | ω-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| US7928239B2 (en) | 1999-01-13 | 2011-04-19 | Bayer Healthcare Llc | Inhibition of RAF kinase using quinolyl, isoquinolyl or pyridyl ureas |
| ATE556713T1 (de) * | 1999-01-13 | 2012-05-15 | Bayer Healthcare Llc | Omega-carboxyarylsubstituierte-diphenyl- harnstoffe als p38-kinasehemmer |
| CA2383086A1 (en) | 1999-09-08 | 2001-03-15 | Joseph P. Steiner | Non-peptidic cyclophilin binding compounds and their use |
| US7235576B1 (en) | 2001-01-12 | 2007-06-26 | Bayer Pharmaceuticals Corporation | Omega-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| MXPA03006666A (es) | 2001-01-25 | 2004-05-31 | Guilford Pharm Inc | Compuestos de union de ciclofilina carbociclicos trisubstituidos y su uso. |
| US7371763B2 (en) * | 2001-04-20 | 2008-05-13 | Bayer Pharmaceuticals Corporation | Inhibition of raf kinase using quinolyl, isoquinolyl or pyridyl ureas |
| DE60216139T3 (de) * | 2001-12-03 | 2018-11-15 | Bayer Healthcare Llc | Arylharnstoff-verbindungen in kombination mit anderen zytostatisch oder zytotoxisch wirksamen stoffen zur behandlungen menschlicher krebserkrankungen |
| US20080108672A1 (en) * | 2002-01-11 | 2008-05-08 | Bernd Riedl | Omega-Carboxyaryl Substituted Diphenyl Ureas As Raf Kinase Inhibitors |
| AU2003210969A1 (en) * | 2002-02-11 | 2003-09-04 | Bayer Corporation | Aryl ureas with raf kinase and angiogenesis inhibiting activity |
| WO2003068229A1 (en) | 2002-02-11 | 2003-08-21 | Bayer Pharmaceuticals Corporation | Pyridine, quinoline, and isoquinoline n-oxides as kinase inhibitors |
| SI1580188T1 (sl) * | 2002-02-11 | 2012-02-29 | Bayer Healthcare Llc | Aril sečnine kot kinazni inhibitorji |
| AU2003209116A1 (en) * | 2002-02-11 | 2003-09-04 | Bayer Pharmaceuticals Corporation | Aryl ureas with angiogenesis inhibiting activity |
| US7557129B2 (en) | 2003-02-28 | 2009-07-07 | Bayer Healthcare Llc | Cyanopyridine derivatives useful in the treatment of cancer and other disorders |
| PT1636585E (pt) * | 2003-05-20 | 2008-03-27 | Bayer Pharmaceuticals Corp | Diarilureias com actividade inibidora de cinase |
| PL1663978T3 (pl) * | 2003-07-23 | 2008-04-30 | Bayer Healthcare Llc | Fluoropodstawiony omega-karboksyarylodifenylomocznik do leczenia i profilaktyki chorób i stanów |
| US7838524B2 (en) * | 2004-04-30 | 2010-11-23 | Bayer Healthcare Llc | Substituted pyrazolyl urea derivatives useful in the treatment of cancer |
| CN102924336A (zh) * | 2012-09-28 | 2013-02-13 | 黎明化工研究设计院有限责任公司 | 一种制备n-甲基-n’,n’-二苯基脲的方法 |
| CN103232371B (zh) * | 2013-04-26 | 2014-11-26 | 黎明化工研究设计院有限责任公司 | 一种制备n-甲基-n’,n’-二苯基脲的方法 |
| EP3652230A1 (de) * | 2017-07-11 | 2020-05-20 | Covestro Deutschland AG | Weichschaumstoff mit halogenfreiem flammschutz |
| KR102790008B1 (ko) * | 2018-12-07 | 2025-04-07 | 다우 글로벌 테크놀로지스 엘엘씨 | 모노이소시아네이트를 요소로 전환하는 방법 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2683727A (en) * | 1954-07-13 | Secondary aromatic amines | ||
| CH513134A (de) * | 1968-06-10 | 1971-09-30 | Bayer Ag | Verfahren zur Herstellung von N-Arylharnstoffen |
| JPS5419937A (en) * | 1977-07-12 | 1979-02-15 | Showa Denko Kk | Preparation of urea substitution product |
| DE2928485A1 (de) * | 1979-07-14 | 1981-01-29 | Bayer Ag | Verwendung von harnstoffderivaten als arzneimittel bei der behandlung von fettstoffwechselstoerungen |
| WO1981002156A1 (en) * | 1980-01-25 | 1981-08-06 | Reanal Finomvegyszergyar | Process for the preparation of n-aryl-n'-(mono-or disubstiuted)-urea derivatives |
| IT1137177B (it) * | 1981-06-02 | 1986-09-03 | Anic Spa | Processo per la preparazione di uree asimmetriche a partire da uretani ed ammine |
| US4473579A (en) * | 1982-01-26 | 1984-09-25 | American Cyanamid Company | Antiatherosclerotic tetrasubstituted ureas and thioureas |
-
1986
- 1986-10-24 DE DE19863636190 patent/DE3636190A1/de not_active Withdrawn
-
1987
- 1987-10-07 US US07/105,856 patent/US4820871A/en not_active Expired - Fee Related
- 1987-10-10 EP EP87114817A patent/EP0264752B1/de not_active Expired - Lifetime
- 1987-10-10 DE DE8787114817T patent/DE3764602D1/de not_active Expired - Lifetime
- 1987-10-10 ES ES87114817T patent/ES2016957B3/es not_active Expired - Lifetime
- 1987-10-21 JP JP62264043A patent/JPS63122660A/ja active Granted
- 1987-10-22 CA CA000549951A patent/CA1295340C/en not_active Expired - Lifetime
- 1987-10-23 DK DK555687A patent/DK555687A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DK555687D0 (da) | 1987-10-23 |
| EP0264752B1 (de) | 1990-08-29 |
| ES2016957B3 (es) | 1990-12-16 |
| US4820871A (en) | 1989-04-11 |
| JPH0360817B2 (enExample) | 1991-09-17 |
| DE3764602D1 (de) | 1990-10-04 |
| JPS63122660A (ja) | 1988-05-26 |
| EP0264752A1 (de) | 1988-04-27 |
| DK555687A (da) | 1988-04-25 |
| DE3636190A1 (de) | 1988-04-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1295340C (en) | Process for the preparation of n,n-diaryl-ureas | |
| EP0212058B1 (de) | N-Silylpropyl-N'Acyl-Harnstoffe und Verfahren zur Herstellung | |
| Kogon | New Reactions of Phenyl Isocyanate and Ethyl Alcohol1 | |
| US2683144A (en) | Polymerization of isocyanates | |
| US3484466A (en) | Preparation of aromatic sulfonyl isocyanates | |
| CS241125B2 (en) | Method of substituted n-fluoroalkylendioxyphenyl-n-benzoyl/(thio/)-urea production | |
| US4096334A (en) | Process for the manufacture of carbodiimides | |
| US2838511A (en) | Preparation of triaryl isocyanates | |
| JPS6042346A (ja) | 新規なフルオロピバリン酸フルオライド類およびそれらの製造方法 | |
| US3108100A (en) | Polymerization of organic isocyanates with organic hydroxides | |
| US3278492A (en) | Polymerization of organic isocyanates using an organometallic catalyst | |
| US4421694A (en) | Process for the preparation of nitroanilines | |
| US3509198A (en) | Preparation of 2-chlorocarbonyl-phenylisocyanates | |
| US5705594A (en) | Polyamine crosslinking agent formulation and its preparation | |
| FI84597C (fi) | Foerfarande foer framstaellning av en trisubstituerad fenylurea. | |
| KR890005037B1 (ko) | 디페닐 메탄디칼바민산 에스테르류의 제조방법 | |
| US3919221A (en) | Process for the manufacture of s-triazinyl-monoisocyanates or s-triazinyl-diisocyanates | |
| US5672765A (en) | Process for the preparation of aromatic fluorinated compounds and novel diamides | |
| US3100790A (en) | Isocyanoaryl esters of phosphonic, phosphinic, thiophosphonic, and thiophosphinic acids | |
| US3453310A (en) | Preparation of ether-containing isocyanates | |
| US2714105A (en) | Benzoxazine diones and methods of preparing the same | |
| US4263221A (en) | Process for the preparation of aromatic carbodiimides | |
| US3444231A (en) | Process for the preparation of isocyanates and isothiocyanates | |
| US4359426A (en) | Process for the production of aromatic isocyanates containing aromatically bound sulfochloride groups | |
| US3328398A (en) | Isocyanuric acid (carbamyl n-substituted) bis-or tris-n-derivatives and their preparation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |