CA1267794A - Mass flow meter on the coriolis principle - Google Patents
Mass flow meter on the coriolis principleInfo
- Publication number
- CA1267794A CA1267794A CA000501950A CA501950A CA1267794A CA 1267794 A CA1267794 A CA 1267794A CA 000501950 A CA000501950 A CA 000501950A CA 501950 A CA501950 A CA 501950A CA 1267794 A CA1267794 A CA 1267794A
- Authority
- CA
- Canada
- Prior art keywords
- harmonic
- circuit
- meter according
- measuring
- mass flow
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000010355 oscillation Effects 0.000 claims abstract description 49
- 230000033228 biological regulation Effects 0.000 claims description 2
- 238000010276 construction Methods 0.000 description 5
- 230000005284 excitation Effects 0.000 description 5
- 238000006073 displacement reaction Methods 0.000 description 3
- 230000006698 induction Effects 0.000 description 3
- 230000033001 locomotion Effects 0.000 description 3
- 230000003321 amplification Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 238000003199 nucleic acid amplification method Methods 0.000 description 2
- UUQHAAWMCLITRZ-KEOOTSPTSA-N 2-[(3S,6S,12S,20R,23S)-20-carbamoyl-12-[3-(diaminomethylideneamino)propyl]-3-(1H-indol-3-ylmethyl)-2,5,8,11,14,22-hexaoxo-17,18-dithia-1,4,7,10,13,21-hexazabicyclo[21.3.0]hexacosan-6-yl]acetic acid Chemical compound N1C(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)CCSSC[C@@H](C(N)=O)NC(=O)[C@@H]2CCCN2C(=O)[C@@H]1CC1=CNC2=CC=CC=C12 UUQHAAWMCLITRZ-KEOOTSPTSA-N 0.000 description 1
- 206010001497 Agitation Diseases 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003534 oscillatory effect Effects 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01F—MEASURING VOLUME, VOLUME FLOW, MASS FLOW OR LIQUID LEVEL; METERING BY VOLUME
- G01F1/00—Measuring the volume flow or mass flow of fluid or fluent solid material wherein the fluid passes through a meter in a continuous flow
- G01F1/76—Devices for measuring mass flow of a fluid or a fluent solid material
- G01F1/78—Direct mass flowmeters
- G01F1/80—Direct mass flowmeters operating by measuring pressure, force, momentum, or frequency of a fluid flow to which a rotational movement has been imparted
- G01F1/84—Coriolis or gyroscopic mass flowmeters
- G01F1/8409—Coriolis or gyroscopic mass flowmeters constructional details
- G01F1/8431—Coriolis or gyroscopic mass flowmeters constructional details electronic circuits
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01F—MEASURING VOLUME, VOLUME FLOW, MASS FLOW OR LIQUID LEVEL; METERING BY VOLUME
- G01F1/00—Measuring the volume flow or mass flow of fluid or fluent solid material wherein the fluid passes through a meter in a continuous flow
- G01F1/76—Devices for measuring mass flow of a fluid or a fluent solid material
- G01F1/78—Direct mass flowmeters
- G01F1/80—Direct mass flowmeters operating by measuring pressure, force, momentum, or frequency of a fluid flow to which a rotational movement has been imparted
- G01F1/84—Coriolis or gyroscopic mass flowmeters
- G01F1/8409—Coriolis or gyroscopic mass flowmeters constructional details
- G01F1/8436—Coriolis or gyroscopic mass flowmeters constructional details signal processing
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01F—MEASURING VOLUME, VOLUME FLOW, MASS FLOW OR LIQUID LEVEL; METERING BY VOLUME
- G01F1/00—Measuring the volume flow or mass flow of fluid or fluent solid material wherein the fluid passes through a meter in a continuous flow
- G01F1/76—Devices for measuring mass flow of a fluid or a fluent solid material
- G01F1/78—Direct mass flowmeters
- G01F1/80—Direct mass flowmeters operating by measuring pressure, force, momentum, or frequency of a fluid flow to which a rotational movement has been imparted
- G01F1/84—Coriolis or gyroscopic mass flowmeters
- G01F1/845—Coriolis or gyroscopic mass flowmeters arrangements of measuring means, e.g., of measuring conduits
- G01F1/8468—Coriolis or gyroscopic mass flowmeters arrangements of measuring means, e.g., of measuring conduits vibrating measuring conduits
- G01F1/849—Coriolis or gyroscopic mass flowmeters arrangements of measuring means, e.g., of measuring conduits vibrating measuring conduits having straight measuring conduits
- G01F1/8495—Coriolis or gyroscopic mass flowmeters arrangements of measuring means, e.g., of measuring conduits vibrating measuring conduits having straight measuring conduits with multiple measuring conduits
Landscapes
- Physics & Mathematics (AREA)
- Fluid Mechanics (AREA)
- General Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Signal Processing (AREA)
- Measuring Volume Flow (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853505166 DE3505166A1 (de) | 1985-02-15 | 1985-02-15 | Massendurchfluss-messgeraet nach dem coriolis-prinzip |
| DEP3505166.3 | 1985-02-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1267794A true CA1267794A (en) | 1990-04-17 |
Family
ID=6262577
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000501950A Expired CA1267794A (en) | 1985-02-15 | 1986-02-14 | Mass flow meter on the coriolis principle |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4680974A (enExample) |
| JP (1) | JPS61189417A (enExample) |
| CA (1) | CA1267794A (enExample) |
| CH (1) | CH669665A5 (enExample) |
| DE (1) | DE3505166A1 (enExample) |
| DK (1) | DK163452C (enExample) |
| FR (1) | FR2577667B1 (enExample) |
| GB (1) | GB2171200B (enExample) |
| IT (2) | IT8652990V0 (enExample) |
| NL (1) | NL8600348A (enExample) |
Families Citing this family (80)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3534288A1 (de) * | 1985-09-26 | 1987-04-02 | Danfoss As | Massendurchfluss-messgeraet nach dem coriolis-prinzip |
| US5423221A (en) * | 1986-02-11 | 1995-06-13 | Abb K-Flow Inc. | Mass flow measuring device |
| GB2192714A (en) * | 1986-07-16 | 1988-01-20 | Schlumberger Electronics | Coriolis mass flow meter |
| DE3632851A1 (de) * | 1986-09-26 | 1988-04-07 | Flowtec Ag | Nach dem coriolisprinzip arbeitendes massendurchflussmessgeraet |
| DE8712331U1 (de) * | 1986-09-26 | 1988-01-28 | Flowtec AG, Reinach, Basel | Corioliskraft-Massendurchflussmesser |
| DE3632800A1 (de) * | 1986-09-26 | 1988-04-07 | Flowtec Ag | Nach dem coriolisprinzip arbeitendes massendurchflussmessgeraet |
| US4763530A (en) * | 1986-10-10 | 1988-08-16 | The Babcock & Wilcox Company | Apparatus and method for continuously measuring mass flow |
| US4782711A (en) * | 1986-10-14 | 1988-11-08 | K-Flow Division Of Kane Steel Co., Inc. | Method and apparatus for measuring mass flow |
| US5343764A (en) * | 1986-10-28 | 1994-09-06 | The Foxboro Company | Coriolis-type mass flowmeter |
| US5271281A (en) * | 1986-10-28 | 1993-12-21 | The Foxboro Company | Coriolis-type mass flowmeter |
| KR960000099B1 (ko) * | 1986-10-28 | 1996-01-03 | 더폭스보로 컴패니 | 코리올리 유형의 질량유량계 |
| US4856346A (en) * | 1986-11-13 | 1989-08-15 | K-Flow Division Of Kane Steel Company, Inc. | Dual flexures for coriolis type mass flow meters |
| GB8705758D0 (en) * | 1987-03-11 | 1987-04-15 | Schlumberger Electronics Uk | Mass flow measurement |
| US5044208A (en) * | 1987-03-18 | 1991-09-03 | Neptune Measurement Company | Double-pigtail-shaped, Coriolis-type mass flow rate meter |
| DE3738018A1 (de) * | 1987-11-09 | 1989-05-24 | Flowtec Ag | Verfahren zur fehlererkennung und -korrektur, insbesondere bei einem massendurchfluss-messgeraet |
| DE3739383A1 (de) * | 1987-11-20 | 1989-06-01 | Flowtec Ag | Verfahren und vorrichtung zur massendurchflussmessung nach dem coriolisprinzip |
| EP0316908B1 (de) * | 1987-11-20 | 1993-01-27 | Endress + Hauser Flowtec AG | Verfahren zur Massendurchflussmessung nach dem Coriolisprinzip und nach dem Coriolisprinzip arbeitendes Massendurchfluss-Messgerät |
| GB8829825D0 (en) * | 1988-12-21 | 1989-02-15 | Schlumberger Ind Ltd | A combined output and drive circuit for a mass flow transducer |
| DE3916285A1 (de) * | 1989-05-19 | 1990-11-22 | Krohne Messtechnik Massametron | Massendurchflussmessgeraet |
| DE4016907C3 (de) * | 1990-05-25 | 1998-06-10 | Krohne Ag | Massendurchflußmeßgerät |
| EP0462711A1 (en) * | 1990-06-16 | 1991-12-27 | Imperial Chemical Industries Plc | Fluid flow measurement |
| DE4124296A1 (de) * | 1990-07-28 | 1992-02-06 | Krohne Messtechnik Massametron | Massendurchflussmessgeraet |
| US5448921A (en) * | 1991-02-05 | 1995-09-12 | Direct Measurement Corporation | Coriolis mass flow rate meter |
| WO1992014123A1 (en) * | 1991-02-05 | 1992-08-20 | Donald Reed Cage | Improved coriolis mass flow rate meter |
| US5497665A (en) * | 1991-02-05 | 1996-03-12 | Direct Measurement Corporation | Coriolis mass flow rate meter having adjustable pressure and density sensitivity |
| US5373745A (en) * | 1991-02-05 | 1994-12-20 | Direct Measurement Corporation | Single path radial mode Coriolis mass flow rate meter |
| DE4124295A1 (de) | 1991-07-22 | 1993-01-28 | Krohne Ag | Massendurchflussmessgeraet |
| HU216462B (hu) * | 1991-08-01 | 1999-06-28 | Micro Motion Inc. | Eljárás és áramlásmérő tömegáramlásisebesség-információ meghatározására |
| EP0547455B1 (de) * | 1991-12-19 | 1996-09-18 | Krohne AG | Massendurchflussmessgerät |
| DE4200871C1 (en) * | 1992-01-15 | 1993-05-06 | Wolfgang 8045 Ismaning De Drahm | Determn. of mechanical stress conditions of measuring tubes of flow meter |
| HU215043B (hu) * | 1992-04-24 | 1998-10-28 | MMG Automatika Művek Rt. | Berendezés fluid áram tömegáramának Coriolis-erő hatásán alapuló mérésére |
| DE4224379C2 (de) | 1992-07-06 | 1998-05-20 | Krohne Messtechnik Kg | Massendurchflußmeßgerät |
| FR2707395B1 (fr) * | 1993-07-09 | 1995-10-06 | Facom | Outil de mesure d'un couple, tel qu'une clé dynamométrique électronique. |
| DE4413239C2 (de) * | 1993-10-28 | 2000-09-28 | Krohne Messtechnik Kg | Verfahren zur Auswertung der Meßsignale eines Massendurchflußmeßgeräts |
| EP0685712B1 (de) * | 1994-05-26 | 2000-05-10 | Endress + Hauser Flowtec AG | Massedurchflussaufnehmer nach dem Coriolis-Prinzip |
| DE4423168C2 (de) | 1994-07-04 | 1998-09-24 | Krohne Ag | Massendurchflußmeßgerät |
| DE4435809A1 (de) | 1994-10-07 | 1996-04-11 | Krohne Messtechnik Kg | Meßgerät für strömende Medien |
| US5546814A (en) * | 1994-10-26 | 1996-08-20 | The Foxboro Company | Parallel-flow coriolis-type mass flowmeter with flow-dividing manifold |
| JP3058074B2 (ja) * | 1995-08-29 | 2000-07-04 | 富士電機株式会社 | 振動型測定器 |
| US5831178A (en) * | 1995-08-29 | 1998-11-03 | Fuji Electric Co., Ltd. | Vibration type measuring instrument |
| US5753827A (en) * | 1995-10-17 | 1998-05-19 | Direct Measurement Corporation | Coriolis meteR having a geometry insensitive to changes in fluid pressure and density and method of operation thereof |
| US5907104A (en) * | 1995-12-08 | 1999-05-25 | Direct Measurement Corporation | Signal processing and field proving methods and circuits for a coriolis mass flow meter |
| DE19652002C2 (de) * | 1995-12-15 | 2003-03-27 | Flowtec Ag | Schwingungs-Meßgerät |
| US5661232A (en) * | 1996-03-06 | 1997-08-26 | Micro Motion, Inc. | Coriolis viscometer using parallel connected Coriolis mass flowmeters |
| US5827979A (en) * | 1996-04-22 | 1998-10-27 | Direct Measurement Corporation | Signal processing apparati and methods for attenuating shifts in zero intercept attributable to a changing boundary condition in a Coriolis mass flow meter |
| US5854430A (en) * | 1996-05-07 | 1998-12-29 | Endress + Hauser Flowtec Ag | Coriolis mass flow sensor |
| US5796012A (en) * | 1996-09-19 | 1998-08-18 | Oval Corporation | Error correcting Coriolis flowmeter |
| WO1999051946A1 (de) * | 1998-04-03 | 1999-10-14 | Endress + Hauser Flowtec Ag | Verfahren zum massedurchfluss-messen und entsprechende aufnehmer |
| US6227059B1 (en) | 1999-01-12 | 2001-05-08 | Direct Measurement Corporation | System and method for employing an imaginary difference signal component to compensate for boundary condition effects on a Coriolis mass flow meter |
| DE10322763A1 (de) * | 2003-05-19 | 2004-12-09 | Helios + Zaschel Gmbh | Verfahren und Vorrichtung zur Messung eines Massestroms |
| EP2966421B1 (en) * | 2006-07-28 | 2021-04-28 | Micro Motion, Inc. | Three pickoff sensor flow meter |
| US7549319B2 (en) * | 2006-11-16 | 2009-06-23 | Halliburton Energy Services, Inc. | High pressure resonant vibrating-tube densitometer |
| WO2008064459A1 (en) * | 2006-11-30 | 2008-06-05 | Hatch Ltd. | Method and apparatus for fluid leak detection |
| DE102009028006A1 (de) | 2009-07-24 | 2011-01-27 | Endress + Hauser Flowtec Ag | Meßwandler vom Vibrationstyp sowie Meßgerät mit einem solchen Meßwandler |
| DE102009046839A1 (de) | 2009-11-18 | 2011-05-19 | Endress + Hauser Flowtec Ag | Meßsystem mit einer zwei parallel durchströmte Meßrohre aufweisenden Rohranordnung sowie Verfahren zu deren Überwachung |
| EP2519805B1 (de) | 2009-12-31 | 2018-10-10 | Endress+Hauser Flowtec AG | MEßSYSTEM MIT EINEM MEßWANDLER VOM VIBRATIONSTYP UND VERFAHREN ZUM MESSEN EINER DRUCKDIFFERENZ |
| DE102010000760B4 (de) | 2010-01-11 | 2021-12-23 | Endress + Hauser Flowtec Ag | Meßsystem mit einem Meßwandler vom Vibrationstyp zum Messen eines statischen Drucks in einem strömenden Medium |
| EP2519804B1 (de) | 2009-12-31 | 2019-08-28 | Endress+Hauser Flowtec AG | Mess-system mit einem messwandler vom vibrationstyp |
| DE102010000759B4 (de) | 2010-01-11 | 2025-05-22 | Endress + Hauser Flowtec Ag | Meßsystem mit einem Meßwandler vom Vibrationstyp |
| CA2785755C (en) | 2009-12-31 | 2016-02-02 | Vivek Kumar | Measuring system having a measuring transducer of vibration-type |
| DE102010000761A1 (de) | 2010-01-11 | 2011-07-28 | Endress + Hauser Flowtec Ag | Meßsystem mit einem Meßwandler vom Vibrationstyp |
| DE102010039543A1 (de) | 2010-08-19 | 2012-02-23 | Endress + Hauser Flowtec Ag | Meßsystem mit einem Meßwandler vom Vibrationstyp |
| DE102010044179A1 (de) | 2010-11-11 | 2012-05-16 | Endress + Hauser Flowtec Ag | Meßsystem mit einem Meßwandler von Vibrationstyp |
| DE102011006971A1 (de) | 2011-04-07 | 2012-10-11 | Endress + Hauser Flowtec Ag | Meßwandler vom Vibrationstyp sowie Verfahren zu dessen Herstellung |
| DE102011006997A1 (de) | 2011-04-07 | 2012-10-11 | Endress + Hauser Flowtec Ag | Frequenzabgleichsverfahren für eine Rohranordnung |
| DE102011006919A1 (de) | 2011-04-07 | 2012-10-11 | Endress + Hauser Flowtec Ag | Verfahren zum Trimmen eines Rohrs |
| CN104204735B (zh) | 2012-04-03 | 2017-12-29 | 恩德斯+豪斯流量技术股份有限公司 | 振动型测量变换器 |
| DE102012102947B4 (de) | 2012-04-03 | 2023-12-21 | Endress + Hauser Flowtec Ag | Meßwandler vom Vibrationstyp |
| DE102013106155A1 (de) | 2013-06-13 | 2014-12-18 | Endress + Hauser Flowtec Ag | Meßsystem mit einem Druckgerät sowie Verfahren zur Überwachung und/oder Überprüfung eines solchen Druckgeräts |
| DE102013106157A1 (de) | 2013-06-13 | 2014-12-18 | Endress + Hauser Flowtec Ag | Meßsystem mit einem Druckgerät sowie Verfahren zur Überwachung und/oder Überprüfung eines solchen Druckgeräts |
| WO2016014053A1 (en) * | 2014-07-23 | 2016-01-28 | Halliburton Energy Services, Inc. | Thermal modulated vibrating sensing module for gas molecular weight detection |
| DE102015103208A1 (de) * | 2014-10-17 | 2016-04-21 | Endress + Hauser Flowtec Ag | Meßsystem zum Messen wenigstens einer Meßgröße eines Fluids sowie Verfahren zum Betreiben eines solchen Meßsystems |
| US9587971B2 (en) * | 2015-07-22 | 2017-03-07 | Honeywell International Inc. | Dual E-shaped high frequency exciter |
| DE102015112737A1 (de) * | 2015-08-03 | 2017-02-09 | Endress + Hauser Flowtec Ag | Verfahren zum Ermitteln eines physikalischen Parameters eines Gases |
| US9719826B2 (en) | 2015-08-12 | 2017-08-01 | Honeywell International Inc. | Mass flow primary with exciter |
| US12174212B2 (en) | 2018-12-20 | 2024-12-24 | Endress+Hauser Flowtec Ag | Coriolis mass flow meter |
| DE112021003296A5 (de) | 2020-06-18 | 2023-05-11 | Endress+Hauser Flowtec Ag | Vibronisches Meßsystem |
| DE102020131649A1 (de) | 2020-09-03 | 2022-03-03 | Endress + Hauser Flowtec Ag | Vibronisches Meßsystem |
| DE102020127382A1 (de) | 2020-10-16 | 2022-04-21 | Endress+Hauser Flowtec Ag | Verfahren zum Überprüfen eines vibronischen Meßsystems |
| DE102021118961A1 (de) * | 2021-07-22 | 2023-01-26 | Endress+Hauser Flowtec Ag | Verfahren zum Betreiben eines Coriolis-Massedurchflussmessgerätes |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4252028A (en) * | 1979-02-26 | 1981-02-24 | S & F Associates | Method and apparatus for measuring flow |
| SU1008617A1 (ru) * | 1980-02-13 | 1983-03-30 | Специальное Конструкторское Бюро Института Математики И Механики Ан Азсср | Способ измерени массового расхода среды |
| US4491025A (en) * | 1982-11-03 | 1985-01-01 | Micro Motion, Inc. | Parallel path Coriolis mass flow rate meter |
| GB8304783D0 (en) * | 1983-02-21 | 1983-03-23 | Shell Int Research | Coriolis-type mass flow meter |
-
1985
- 1985-02-15 DE DE19853505166 patent/DE3505166A1/de active Granted
-
1986
- 1986-01-21 CH CH220/86A patent/CH669665A5/de not_active IP Right Cessation
- 1986-02-05 US US06/826,315 patent/US4680974A/en not_active Expired - Lifetime
- 1986-02-12 DK DK067086A patent/DK163452C/da not_active IP Right Cessation
- 1986-02-12 NL NL8600348A patent/NL8600348A/nl not_active Application Discontinuation
- 1986-02-14 GB GB08603704A patent/GB2171200B/en not_active Expired
- 1986-02-14 IT IT8652990U patent/IT8652990V0/it unknown
- 1986-02-14 CA CA000501950A patent/CA1267794A/en not_active Expired
- 1986-02-14 JP JP61030603A patent/JPS61189417A/ja active Pending
- 1986-02-14 IT IT67111/86A patent/IT1187912B/it active
- 1986-02-14 FR FR868602035A patent/FR2577667B1/fr not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DK67086A (da) | 1986-08-16 |
| GB8603704D0 (en) | 1986-03-19 |
| DE3505166A1 (de) | 1986-08-21 |
| NL8600348A (nl) | 1986-09-01 |
| US4680974A (en) | 1987-07-21 |
| FR2577667B1 (fr) | 1992-02-28 |
| DE3505166C2 (enExample) | 1990-07-12 |
| JPS61189417A (ja) | 1986-08-23 |
| IT8667111A0 (it) | 1986-02-14 |
| FR2577667A1 (fr) | 1986-08-22 |
| GB2171200B (en) | 1988-07-20 |
| IT8652990V0 (it) | 1986-02-14 |
| GB2171200A (en) | 1986-08-20 |
| CH669665A5 (enExample) | 1989-03-31 |
| DK67086D0 (da) | 1986-02-12 |
| IT1187912B (it) | 1987-12-23 |
| DK163452C (da) | 1992-07-20 |
| DK163452B (da) | 1992-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1267794A (en) | Mass flow meter on the coriolis principle | |
| US5469748A (en) | Noise reduction filter system for a coriolis flowmeter | |
| US4872351A (en) | Net oil computer | |
| CA2053923C (en) | Coriolis mass flow rate meter having a substantially increased noise immunity | |
| US4996871A (en) | Coriolis densimeter having substantially increased noise immunity | |
| US4876879A (en) | Apparatus and methods for measuring the density of an unknown fluid using a Coriolis meter | |
| CA2019439C (en) | Mass flow meter working on the coriolis principle | |
| US4911006A (en) | Custody transfer meter | |
| US4760744A (en) | Mass flow meter based on the coriolis principle | |
| EP0253504A1 (en) | Mass flowmeter | |
| JP4429165B2 (ja) | 低電力レーダーレベル送信機用の発振器の安定化 | |
| EP1334334A2 (en) | Apparatus and method for compensating mass flow rate of a material when the density of the material causes an unacceptable error in flow rate | |
| US4123940A (en) | Transmission system for vortex-shedding flowmeter | |
| CA1273226A (en) | Method and apparatus for measuring a force | |
| AU609624B2 (en) | Coriolis mass flow rate meter having absolute frequency output | |
| US20160131565A1 (en) | Method of determining a fill level of an oscillator of an oscillator tube, and oscillator tube | |
| US3952592A (en) | Fluid sensing systems | |
| GB2173308A (en) | Weight measuring apparatus of vibration type | |
| US5029268A (en) | Circuit arrangement for self-excitation of a mechanical oscillation system to natural resonant oscillations | |
| RU2362126C1 (ru) | Кориолисов массовый расходомер, способ компенсации фазовой разности или разности времени прохождения сигналов, способ определения фазовой разности или разности времени прохождения сигналов датчиков, а также способ определения времени прохождения сигнала датчика | |
| US5122764A (en) | Circuit for exciting a resonator | |
| SU310578A1 (ru) | УСТРОЙСТВО дл ИЗМЕРЕНИЯ ПАРАМЕТРОВ КОЛЕБАТЕЛЬНОЙ СИСТЕМЫ | |
| SU930071A1 (ru) | Вибрационный плотномер жидких сред | |
| RU2113693C1 (ru) | Массовый расходомер | |
| SU734582A1 (ru) | Устройство дл измерени диэлектрических характеристик |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |