CA1249198A - Aqueous emulsions using cationic silanes - Google Patents
Aqueous emulsions using cationic silanesInfo
- Publication number
- CA1249198A CA1249198A CA000493964A CA493964A CA1249198A CA 1249198 A CA1249198 A CA 1249198A CA 000493964 A CA000493964 A CA 000493964A CA 493964 A CA493964 A CA 493964A CA 1249198 A CA1249198 A CA 1249198A
- Authority
- CA
- Canada
- Prior art keywords
- emulsion
- hydrogen
- silane
- carbon atoms
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000839 emulsion Substances 0.000 title claims abstract description 134
- -1 cationic silanes Chemical class 0.000 title claims abstract description 43
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 claims abstract description 84
- 229910000077 silane Inorganic materials 0.000 claims abstract description 84
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 74
- 239000007788 liquid Substances 0.000 claims abstract description 37
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 37
- 125000002091 cationic group Chemical group 0.000 claims description 30
- 239000001257 hydrogen Substances 0.000 claims description 25
- 229910052739 hydrogen Inorganic materials 0.000 claims description 25
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 23
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- 229910052799 carbon Inorganic materials 0.000 claims description 19
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 18
- 239000002480 mineral oil Substances 0.000 claims description 15
- 235000010446 mineral oil Nutrition 0.000 claims description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 13
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 150000003254 radicals Chemical class 0.000 claims description 8
- 229920006395 saturated elastomer Polymers 0.000 claims description 7
- 229920001296 polysiloxane Polymers 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000007764 o/w emulsion Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical group CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical group [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 3
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical group [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 3
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical group C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical group I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 3
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims description 3
- 229930195734 saturated hydrocarbon Natural products 0.000 claims description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical group CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 3
- 229930195735 unsaturated hydrocarbon Natural products 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 150000001805 chlorine compounds Chemical group 0.000 claims 1
- 239000000758 substrate Substances 0.000 abstract description 20
- 150000004756 silanes Chemical class 0.000 abstract description 14
- 238000012546 transfer Methods 0.000 abstract description 3
- 238000009736 wetting Methods 0.000 abstract description 3
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 40
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 40
- 239000004205 dimethyl polysiloxane Substances 0.000 description 39
- CXQXSVUQTKDNFP-UHFFFAOYSA-N octamethyltrisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C CXQXSVUQTKDNFP-UHFFFAOYSA-N 0.000 description 34
- 238000004987 plasma desorption mass spectroscopy Methods 0.000 description 34
- 239000000203 mixture Substances 0.000 description 33
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- 239000003921 oil Substances 0.000 description 26
- 239000003995 emulsifying agent Substances 0.000 description 19
- 239000002904 solvent Substances 0.000 description 17
- 239000004094 surface-active agent Substances 0.000 description 17
- 238000009472 formulation Methods 0.000 description 15
- 239000007787 solid Substances 0.000 description 15
- 239000000463 material Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- 230000008901 benefit Effects 0.000 description 10
- 238000012360 testing method Methods 0.000 description 10
- 230000032683 aging Effects 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 239000012153 distilled water Substances 0.000 description 8
- 239000006260 foam Substances 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 125000004122 cyclic group Chemical group 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 238000005119 centrifugation Methods 0.000 description 4
- 239000012530 fluid Substances 0.000 description 4
- 239000002304 perfume Substances 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 238000005063 solubilization Methods 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000002195 soluble material Substances 0.000 description 3
- 238000004448 titration Methods 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 125000000129 anionic group Chemical class 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- UDSAIICHUKSCKT-UHFFFAOYSA-N bromophenol blue Chemical compound C1=C(Br)C(O)=C(Br)C=C1C1(C=2C=C(Br)C(O)=C(Br)C=2)C2=CC=CC=C2S(=O)(=O)O1 UDSAIICHUKSCKT-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical class OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 150000001767 cationic compounds Chemical class 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 230000002070 germicidal effect Effects 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 230000007928 solubilization Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- OXYZDRAJMHGSMW-UHFFFAOYSA-N 3-chloropropyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)CCCCl OXYZDRAJMHGSMW-UHFFFAOYSA-N 0.000 description 1
- 229940105325 3-dimethylaminopropylamine Drugs 0.000 description 1
- OWNRRUFOJXFKCU-UHFFFAOYSA-N Bromadiolone Chemical compound C=1C=C(C=2C=CC(Br)=CC=2)C=CC=1C(O)CC(C=1C(OC2=CC=CC=C2C=1O)=O)C1=CC=CC=C1 OWNRRUFOJXFKCU-UHFFFAOYSA-N 0.000 description 1
- DCERHCFNWRGHLK-UHFFFAOYSA-N C[Si](C)C Chemical compound C[Si](C)C DCERHCFNWRGHLK-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- RUPBZQFQVRMKDG-UHFFFAOYSA-M Didecyldimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCC[N+](C)(C)CCCCCCCCCC RUPBZQFQVRMKDG-UHFFFAOYSA-M 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- MFBDBXAVPLFMNJ-UHFFFAOYSA-M N,N-Bis(2-hydroxyethyl)glycine sodium salt Chemical compound [Na+].OCCN(CCO)CC([O-])=O MFBDBXAVPLFMNJ-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 240000007591 Tilia tomentosa Species 0.000 description 1
- YSVZGWAJIHWNQK-UHFFFAOYSA-N [3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol Chemical compound C1CC2C(CO)C(CO)C1C2 YSVZGWAJIHWNQK-UHFFFAOYSA-N 0.000 description 1
- MGOSDNFDDQLVDA-UHFFFAOYSA-N [SiH4].CO Chemical compound [SiH4].CO MGOSDNFDDQLVDA-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical group 0.000 description 1
- BTBJBAZGXNKLQC-UHFFFAOYSA-N ammonium lauryl sulfate Chemical compound [NH4+].CCCCCCCCCCCCOS([O-])(=O)=O BTBJBAZGXNKLQC-UHFFFAOYSA-N 0.000 description 1
- 229940063953 ammonium lauryl sulfate Drugs 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- SXPWTBGAZSPLHA-UHFFFAOYSA-M cetalkonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SXPWTBGAZSPLHA-UHFFFAOYSA-M 0.000 description 1
- 229960000228 cetalkonium chloride Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 230000001351 cycling effect Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 229960004670 didecyldimethylammonium chloride Drugs 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 238000004851 dishwashing Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 229910001651 emery Inorganic materials 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 1
- 239000003676 hair preparation Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005649 metathesis reaction Methods 0.000 description 1
- XOCNYZFAMHDXJK-UHFFFAOYSA-N methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate Chemical compound COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F XOCNYZFAMHDXJK-UHFFFAOYSA-N 0.000 description 1
- 239000000693 micelle Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- YBXBWBBVLXZQBJ-UHFFFAOYSA-N n-[2-(5-hydroxy-2-methyl-1h-indol-3-yl)ethyl]-2-methoxyacetamide Chemical compound C1=C(O)C=C2C(CCNC(=O)COC)=C(C)NC2=C1 YBXBWBBVLXZQBJ-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- HLERILKGMXJNBU-UHFFFAOYSA-N norvaline betaine Chemical compound CCCC(C([O-])=O)[N+](C)(C)C HLERILKGMXJNBU-UHFFFAOYSA-N 0.000 description 1
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 125000005702 oxyalkylene group Chemical group 0.000 description 1
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001453 quaternary ammonium group Chemical class 0.000 description 1
- 239000012898 sample dilution Substances 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000013112 stability test Methods 0.000 description 1
- 238000012430 stability testing Methods 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 239000011269 tar Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000012384 transportation and delivery Methods 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K23/00—Use of substances as emulsifying, wetting, dispersing, or foam-producing agents
- C09K23/54—Silicon compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Colloid Chemistry (AREA)
- Medicinal Preparation (AREA)
- Silicon Polymers (AREA)
- Detergent Compositions (AREA)
- Cosmetics (AREA)
- Emulsifying, Dispersing, Foam-Producing Or Wetting Agents (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/668,047 US4631273A (en) | 1984-11-05 | 1984-11-05 | Aqueous emulsions using cationic silanes |
| US668,047 | 1984-11-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1249198A true CA1249198A (en) | 1989-01-24 |
Family
ID=24680783
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000493964A Expired CA1249198A (en) | 1984-11-05 | 1985-10-28 | Aqueous emulsions using cationic silanes |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4631273A (enExample) |
| EP (1) | EP0181182B1 (enExample) |
| JP (1) | JPS61161136A (enExample) |
| AU (1) | AU575214B2 (enExample) |
| CA (1) | CA1249198A (enExample) |
| DE (1) | DE3574679D1 (enExample) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4842766A (en) * | 1987-02-17 | 1989-06-27 | Dow Corning Corporation | Silane microemulsions |
| GB8710889D0 (en) * | 1987-05-08 | 1987-06-10 | Dow Corning Ltd | Removal of water haze from distillate fuel |
| DE3744593A1 (de) * | 1987-12-31 | 1989-07-13 | Basf Ag | Entschaeumer auf basis von oel-in-wasser-emulsionen |
| US4898957A (en) * | 1988-04-18 | 1990-02-06 | Dow Corning Corporation | Organosilicon diamine antimicrobial compound |
| US5073298A (en) * | 1988-07-20 | 1991-12-17 | Dow Corning Corporation | Antimicrobial antifoam compositions and methods |
| US5019173A (en) * | 1988-09-29 | 1991-05-28 | Dow Corning Corporation | Cleaning method for water containing vessels and systems |
| US4908355A (en) * | 1989-01-09 | 1990-03-13 | Dow Corning Corporation | Skin treatment method |
| US5145596A (en) * | 1989-08-07 | 1992-09-08 | Dow Corning Corporation | Antimicrobial rinse cycle additive |
| US5064613A (en) * | 1989-11-03 | 1991-11-12 | Dow Corning Corporation | Solid antimicrobial |
| US5013459A (en) * | 1989-11-09 | 1991-05-07 | Dow Corning Corporation | Opthalmic fluid dispensing method |
| US5017221A (en) * | 1989-12-05 | 1991-05-21 | Dow Corning Corporation | Polymethylalkylsiloxane emulsions and methods |
| US5219654A (en) * | 1990-02-06 | 1993-06-15 | Nanofilm Corporation | Film forming composition and method for modifying surfaces with ultra thin films |
| US5078791A (en) * | 1990-02-06 | 1992-01-07 | Nanofilm Corporation | Film forming composition |
| US5556629A (en) * | 1991-09-13 | 1996-09-17 | General Electric Company | Method of preparing microemulsions |
| US5244598A (en) * | 1991-09-13 | 1993-09-14 | General Electric Company | Method of preparing amine functional silicone microemulsions |
| US5431852A (en) * | 1992-01-10 | 1995-07-11 | Idemitsu Kosan Company Limited | Water-repellent emulsion composition and process for the production thereof |
| US5160494A (en) * | 1992-04-14 | 1992-11-03 | Dow Corning Corporation | Alkylmethylsiloxane containing perfume compositions |
| US5292528A (en) * | 1992-06-19 | 1994-03-08 | Sunstar Kabushiki Kaisha | Oral Composition |
| US5366810A (en) * | 1992-10-09 | 1994-11-22 | General Electric Company | Water-repellent wallboard |
| US5326557A (en) * | 1993-04-06 | 1994-07-05 | Dow Corning Corporation | Moisturizing compositions containing organosilicon compounds |
| US5959014A (en) * | 1996-05-07 | 1999-09-28 | Emory University | Water-stabilized organosilane compounds and methods for using the same |
| US6632805B1 (en) | 1996-05-07 | 2003-10-14 | Emory University | Methods for using water-stabilized organosilanes |
| US5954869A (en) | 1997-05-07 | 1999-09-21 | Bioshield Technologies, Inc. | Water-stabilized organosilane compounds and methods for using the same |
| US6762172B1 (en) | 1997-07-17 | 2004-07-13 | Nova Biogenetics, Inc. | Water-stabilized organosilane compounds and methods for using the same |
| US6113815A (en) * | 1997-07-18 | 2000-09-05 | Bioshield Technologies, Inc. | Ether-stabilized organosilane compositions and methods for using the same |
| GB2338651A (en) * | 1998-06-27 | 1999-12-29 | Woollard Trevor P | Liquid polymer composition |
| US6207720B1 (en) * | 1999-06-25 | 2001-03-27 | Crompton Corporation | Hydrolyzable silane emulsions and method for preparing the same |
| GB2374011C (en) * | 2001-01-04 | 2008-02-06 | Byotrol Llc | Anti-microbial composition |
| CN1961666B (zh) | 2001-01-04 | 2011-06-22 | 拜奥特罗尔股份有限公司 | 抗微生物组合物 |
| US6579923B2 (en) * | 2001-02-05 | 2003-06-17 | 3M Innovative Properties Company | Use of a silicone surfactant in polishing compositions |
| US6607636B2 (en) | 2001-11-01 | 2003-08-19 | Kimberly-Clark Worldwide, Inc. | Non-rewetting multi-fiber hand towel and methods of making same |
| US7203173B2 (en) * | 2002-01-25 | 2007-04-10 | Architecture Technology Corp. | Distributed packet capture and aggregation |
| US6770123B2 (en) | 2002-07-23 | 2004-08-03 | Clariant Finance (Bvi) Limited | Protective coatings having branched trimethylsilylated alkylsilsesquioxane emulsions |
| US20040151919A1 (en) * | 2003-01-31 | 2004-08-05 | Kimberly-Clark Worldwide, Inc. | Glove having reduced microbe affinity and transmission |
| AU2004243046B2 (en) * | 2003-05-22 | 2009-11-05 | Coating Systems Laboratories, Inc. | Antimicrobial quaternary ammonium organosilane coatings |
| US9364572B2 (en) | 2003-05-22 | 2016-06-14 | Coating Systems Laboratories, Inc. | Static fluid disinfecting systems and related methods |
| US9764264B2 (en) | 2003-05-22 | 2017-09-19 | Coating Systems Laboratories, Inc. | Ballast water treatment systems |
| US6994890B2 (en) * | 2003-10-31 | 2006-02-07 | Resource Development L.L.C. | Cleaning and multifunctional coating composition containing an organosilane quaternary compound and hydrogen peroxide |
| US8257780B2 (en) | 2003-10-31 | 2012-09-04 | Resource Development L.L.C. | Therapeutic composition containing an organosilane quaternary compound and hydrogen peroxide for treating skin disorders and methods of using |
| US20060134163A1 (en) * | 2004-12-16 | 2006-06-22 | Bagwell Alison S | Immobilizing anti-microbial compounds on elastomeric articles |
| WO2006102367A1 (en) | 2005-03-22 | 2006-09-28 | Biosafe Inc. | Method of creating a solvent-free polymeric silicon-containing quaternary ammonium antimicrobial agent having superior sustained antimicrobial properties |
| US7754004B2 (en) * | 2005-07-06 | 2010-07-13 | Resource Development, L.L.C. | Thickened surfactant-free cleansing and multifunctional liquid coating compositions containing nonreactive abrasive solid particles and an organosilane quaternary compound and methods of using |
| GB0518059D0 (en) * | 2005-09-06 | 2005-10-12 | Dow Corning | Delivery system for releasing active ingredients |
| WO2008076839A2 (en) | 2006-12-14 | 2008-06-26 | Church & Dwight Co., Inc. | Stable aqueous solutions of silane quat ammonium compounds |
| US7589054B2 (en) * | 2007-01-02 | 2009-09-15 | Resource Development L.L.C. | Clathrates of an organosilane quaternary ammonium compound and urea and methods of use |
| GB0713799D0 (en) | 2007-07-17 | 2007-08-22 | Byotrol Llc | Anti-microbial compositions |
| AU2008300404B8 (en) | 2007-09-17 | 2014-01-30 | Byotrol Plc | Formulations comprising an anti-microbial composition |
| US8735618B2 (en) | 2010-05-07 | 2014-05-27 | Resource Development L.L.C. | Solvent-free organosilane quaternary ammonium compositions, method of making and use |
| WO2012088113A2 (en) * | 2010-12-21 | 2012-06-28 | 3M Innovative Properties Company | Filter media treated with cationic fluorinated ether silane compositions |
| CA2910000C (en) | 2013-04-26 | 2023-01-03 | Biointeractions Limited | Bioactive coating comprising a polymer having both guandine and heparin covalently bonded thereto as pendant groups |
| USRE49528E1 (en) | 2013-04-26 | 2023-05-16 | Biointeractions Ltd. | Bioactive coatings |
| EP3866601A4 (en) | 2018-10-18 | 2022-08-17 | Topikos Pharmaceuticals, Inc. | ORGANOSILANES TO TREAT AN INFECTION |
| WO2020093111A1 (en) * | 2018-11-06 | 2020-05-14 | UBIQ Technology Pty Ltd | Improved magnesium oxychloride cement (moc) and a method of manufacturing |
| WO2021077119A1 (en) | 2019-10-18 | 2021-04-22 | Topikos Pharmaceuticals, Inc. | Antimicrobial organosilanes |
| EP4166710A1 (de) | 2021-10-12 | 2023-04-19 | Rudolf GmbH | Weichgriffzusammensetzung |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE503204A (enExample) * | 1950-06-30 | 1900-01-01 | ||
| US2715133A (en) * | 1950-06-30 | 1955-08-09 | Dow Corning | Organosil ylamines |
| US3565936A (en) * | 1963-08-27 | 1971-02-23 | Union Carbide Corp | N,n-disubstituted aminoalkoxyalkylsilicon compounds and derivatives thereof |
| BE674475A (enExample) * | 1964-12-31 | 1966-04-15 | ||
| DE1262272B (de) * | 1967-01-24 | 1968-03-07 | Bayer Ag | Verfahren zur Herstellung von Organosilylalkylammoniumbromiden |
| US3576779A (en) * | 1968-07-17 | 1971-04-27 | Gen Electric | Amine-functional organopolysiloxane, salt thereof and polish composition therefrom |
| US3734763A (en) * | 1969-05-15 | 1973-05-22 | Dow Corning | Cationic unsaturated amine-functional silane coupling agents |
| BE756928A (fr) * | 1969-10-01 | 1971-03-16 | Bayer Ag | Polysiloxanes aminomethyl-substitues comme agents d'enduction hydrofuges et de brillantage |
| US3700844A (en) * | 1971-05-07 | 1972-10-24 | Nalco Chemical Co | Quaternary fluorsilicon dispersant |
| US3852075A (en) * | 1973-10-16 | 1974-12-03 | Procter & Gamble | Hard surface rinse-coating composition and method |
| US4035411A (en) * | 1975-04-22 | 1977-07-12 | The Procter & Gamble Company | Organosilane compounds |
| US3971883A (en) * | 1975-09-12 | 1976-07-27 | National Distillers And Chemical Corporation | Silicone rubber-ethylene vinyl acetate adhesive laminates and preparation thereof |
-
1984
- 1984-11-05 US US06/668,047 patent/US4631273A/en not_active Expired - Lifetime
-
1985
- 1985-10-28 CA CA000493964A patent/CA1249198A/en not_active Expired
- 1985-11-01 JP JP60246095A patent/JPS61161136A/ja active Granted
- 1985-11-04 DE DE8585307985T patent/DE3574679D1/de not_active Expired - Lifetime
- 1985-11-04 EP EP85307985A patent/EP0181182B1/en not_active Expired
- 1985-11-06 AU AU49415/85A patent/AU575214B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| EP0181182B1 (en) | 1989-12-13 |
| AU575214B2 (en) | 1988-07-21 |
| EP0181182A3 (en) | 1987-09-16 |
| JPH0257984B2 (enExample) | 1990-12-06 |
| AU4941585A (en) | 1986-05-15 |
| DE3574679D1 (de) | 1990-01-18 |
| US4631273A (en) | 1986-12-23 |
| JPS61161136A (ja) | 1986-07-21 |
| EP0181182A2 (en) | 1986-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1249198A (en) | Aqueous emulsions using cationic silanes | |
| EP0244500B1 (en) | Water repellent composition | |
| US4788001A (en) | Oil-in-water emulsion | |
| US4501619A (en) | Aqueous emulsions of carboxyl-containing silicone fluids and a method for their preparation | |
| KR940007865B1 (ko) | 폴리디오가노실록산의 마이크로에멀젼 및 이의 제조방법 | |
| US4842766A (en) | Silane microemulsions | |
| US4354871A (en) | Cleaner-polish compositions | |
| CA1234575A (en) | Skin care formulations comprising a water-in-mineral oil emulsion and siloxane compositions therefor | |
| KR100241477B1 (ko) | 실리콘 폴리에테르 알킬 코폴리머 및 그의 제조 방법 | |
| EP0924240B1 (en) | Organopolysiloxane emulsions | |
| EP1646696B1 (en) | A mechanical inversion process for making silicone oil-in-water emulsions | |
| EP3204455B1 (en) | Hydrophilic ethylene oxide free emulsifier comprising dendrimeric polyhydroxylated ester moieties | |
| EP0638346B1 (en) | Stable dispersible silicone compositions | |
| US5914362A (en) | Silicone-based antifoam compositions cross-reference to related applications | |
| EP0200916A2 (en) | Emulsification process and emulsions therefrom | |
| EP0579455A1 (en) | Silicone emulsion for personal care application | |
| US5132047A (en) | Organopolysiloxane emulsion composition | |
| US4743648A (en) | Novel polish compositions | |
| EP0549232B1 (en) | Suds-controlling compositions for aqueous compositions | |
| US5376301A (en) | Suds-controlling composition for aqueous compositions including surfactants | |
| US5258451A (en) | Method for the preparation of an aqueous emulsion of organopolysiloxane | |
| JP4717182B2 (ja) | 大きいサイズのシリコーン粒子を含むエマルション | |
| JPH0791462B2 (ja) | 保護膜形成型シリコーンエマルジョン組成物 | |
| JPH01203466A (ja) | オルガノポリシロキサンエマルジョン組成物 | |
| Floyd | Organo-modified silicone copolymers for cosmetic use |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |