CA1247120A - Orally effective ion chelators related to deferoxamine - Google Patents
Orally effective ion chelators related to deferoxamineInfo
- Publication number
- CA1247120A CA1247120A CA000472842A CA472842A CA1247120A CA 1247120 A CA1247120 A CA 1247120A CA 000472842 A CA000472842 A CA 000472842A CA 472842 A CA472842 A CA 472842A CA 1247120 A CA1247120 A CA 1247120A
- Authority
- CA
- Canada
- Prior art keywords
- carbon atoms
- alkyl
- acyl
- halogen
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229960000958 deferoxamine Drugs 0.000 title claims description 130
- UBQYURCVBFRUQT-UHFFFAOYSA-N N-benzoyl-Ferrioxamine B Chemical compound CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN UBQYURCVBFRUQT-UHFFFAOYSA-N 0.000 title claims description 72
- 239000002738 chelating agent Substances 0.000 title description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 103
- 125000002252 acyl group Chemical group 0.000 claims abstract description 75
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 71
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 44
- 239000001257 hydrogen Substances 0.000 claims abstract description 39
- 238000000034 method Methods 0.000 claims abstract description 31
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 29
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 26
- 125000003118 aryl group Chemical group 0.000 claims abstract description 19
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 12
- 230000008569 process Effects 0.000 claims abstract description 12
- 241000282414 Homo sapiens Species 0.000 claims abstract description 10
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 9
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims abstract description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 214
- 125000004432 carbon atom Chemical group C* 0.000 claims description 73
- 239000000203 mixture Substances 0.000 claims description 45
- 229910052736 halogen Inorganic materials 0.000 claims description 41
- 150000002367 halogens Chemical class 0.000 claims description 41
- 125000003545 alkoxy group Chemical group 0.000 claims description 37
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical group CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 24
- 239000003795 chemical substances by application Substances 0.000 claims description 23
- 125000002947 alkylene group Chemical group 0.000 claims description 21
- REEZZSHJLXOIHL-UHFFFAOYSA-N octanoyl chloride Chemical group CCCCCCCC(Cl)=O REEZZSHJLXOIHL-UHFFFAOYSA-N 0.000 claims description 18
- 238000002360 preparation method Methods 0.000 claims description 16
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 14
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 239000008194 pharmaceutical composition Substances 0.000 claims description 10
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims description 7
- 239000000543 intermediate Substances 0.000 claims description 7
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 7
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 6
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 3
- 230000000745 ion overload Effects 0.000 claims 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 abstract description 33
- 201000010099 disease Diseases 0.000 abstract description 17
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 17
- 229910052742 iron Inorganic materials 0.000 abstract description 16
- 229910052782 aluminium Inorganic materials 0.000 abstract description 12
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 abstract description 12
- 150000002500 ions Chemical class 0.000 abstract description 12
- 208000007502 anemia Diseases 0.000 abstract description 6
- 239000008280 blood Substances 0.000 abstract description 5
- 210000004369 blood Anatomy 0.000 abstract description 5
- 238000000502 dialysis Methods 0.000 abstract description 5
- 125000003107 substituted aryl group Chemical group 0.000 abstract description 5
- 208000031856 Haemosiderosis Diseases 0.000 abstract description 4
- 206010043391 Thalassaemia beta Diseases 0.000 abstract description 4
- 239000013522 chelant Substances 0.000 abstract description 4
- 208000007056 sickle cell anemia Diseases 0.000 abstract description 4
- 125000005017 substituted alkenyl group Chemical group 0.000 abstract description 4
- 125000004426 substituted alkynyl group Chemical group 0.000 abstract description 4
- 208000024827 Alzheimer disease Diseases 0.000 abstract description 3
- 208000032467 Aplastic anaemia Diseases 0.000 abstract description 3
- 208000033932 Blackfan-Diamond anemia Diseases 0.000 abstract description 3
- 201000004449 Diamond-Blackfan anemia Diseases 0.000 abstract description 3
- 208000007475 hemolytic anemia Diseases 0.000 abstract description 3
- 125000000547 substituted alkyl group Chemical group 0.000 abstract description 3
- 238000002560 therapeutic procedure Methods 0.000 abstract description 3
- 208000014644 Brain disease Diseases 0.000 abstract description 2
- 208000032274 Encephalopathy Diseases 0.000 abstract description 2
- 206010039966 Senile dementia Diseases 0.000 abstract description 2
- 210000003734 kidney Anatomy 0.000 abstract description 2
- 231100000331 toxic Toxicity 0.000 abstract description 2
- 230000002588 toxic effect Effects 0.000 abstract description 2
- -1 iron Chemical class 0.000 description 62
- 235000013350 formula milk Nutrition 0.000 description 60
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 52
- 239000000243 solution Substances 0.000 description 39
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 229960001701 chloroform Drugs 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- 239000000047 product Substances 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- 239000007787 solid Substances 0.000 description 13
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 235000011121 sodium hydroxide Nutrition 0.000 description 10
- 229940083608 sodium hydroxide Drugs 0.000 description 10
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 8
- 239000012071 phase Substances 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 150000001266 acyl halides Chemical class 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 6
- 238000000926 separation method Methods 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 5
- 239000012346 acetyl chloride Substances 0.000 description 5
- 125000003074 decanoyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(*)=O 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000005257 alkyl acyl group Chemical group 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- ARBOVOVUTSQWSS-UHFFFAOYSA-N hexadecanoyl chloride Chemical compound CCCCCCCCCCCCCCCC(Cl)=O ARBOVOVUTSQWSS-UHFFFAOYSA-N 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 3
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 3
- 230000000737 periodic effect Effects 0.000 description 3
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- XOTUAMWIFRDGMZ-UHFFFAOYSA-N 2-chloroprop-2-enoyl chloride Chemical compound ClC(=C)C(Cl)=O XOTUAMWIFRDGMZ-UHFFFAOYSA-N 0.000 description 2
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 2
- 206010065973 Iron Overload Diseases 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 2
- 229910052769 Ytterbium Inorganic materials 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000001263 acyl chlorides Chemical class 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 229960001425 deferoxamine mesylate Drugs 0.000 description 2
- IDDIJAWJANBQLJ-UHFFFAOYSA-N desferrioxamine B mesylate Chemical compound [H+].CS([O-])(=O)=O.CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN IDDIJAWJANBQLJ-UHFFFAOYSA-N 0.000 description 2
- 230000029142 excretion Effects 0.000 description 2
- 229910052733 gallium Inorganic materials 0.000 description 2
- 210000001035 gastrointestinal tract Anatomy 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 229910052738 indium Inorganic materials 0.000 description 2
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 229910021645 metal ion Inorganic materials 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000012544 monitoring process Methods 0.000 description 2
- XNLBCXGRQWUJLU-UHFFFAOYSA-N naphthalene-2-carbonyl chloride Chemical compound C1=CC=CC2=CC(C(=O)Cl)=CC=C21 XNLBCXGRQWUJLU-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 2
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 2
- 125000000962 organic group Chemical group 0.000 description 2
- 239000008177 pharmaceutical agent Substances 0.000 description 2
- 239000000651 prodrug Substances 0.000 description 2
- 229940002612 prodrug Drugs 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- NAWDYIZEMPQZHO-UHFFFAOYSA-N ytterbium Chemical compound [Yb] NAWDYIZEMPQZHO-UHFFFAOYSA-N 0.000 description 2
- JEQDSBVHLKBEIZ-REOHCLBHSA-N (2s)-2-chloropropanoyl chloride Chemical compound C[C@H](Cl)C(Cl)=O JEQDSBVHLKBEIZ-REOHCLBHSA-N 0.000 description 1
- RJUIDDKTATZJFE-NSCUHMNNSA-N (e)-but-2-enoyl chloride Chemical compound C\C=C\C(Cl)=O RJUIDDKTATZJFE-NSCUHMNNSA-N 0.000 description 1
- OTTYFDRFBJPGRW-ONEGZZNKSA-N (e)-pent-2-enoyl chloride Chemical compound CC\C=C\C(Cl)=O OTTYFDRFBJPGRW-ONEGZZNKSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- JRDMLPUXFYDSIK-KTKRTIGZSA-N (z)-2-chlorooctadec-9-enoyl chloride Chemical compound CCCCCCCC\C=C/CCCCCCC(Cl)C(Cl)=O JRDMLPUXFYDSIK-KTKRTIGZSA-N 0.000 description 1
- MLQBTMWHIOYKKC-KTKRTIGZSA-N (z)-octadec-9-enoyl chloride Chemical compound CCCCCCCC\C=C/CCCCCCCC(Cl)=O MLQBTMWHIOYKKC-KTKRTIGZSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- JEYVCWYGYRCQGR-UHFFFAOYSA-N 10-chlorodec-2-ynoyl chloride Chemical compound ClCCCCCCCC#CC(Cl)=O JEYVCWYGYRCQGR-UHFFFAOYSA-N 0.000 description 1
- ULEANATVHOUWBX-UHFFFAOYSA-N 10-cyclodecyldecanoyl chloride Chemical compound ClC(=O)CCCCCCCCCC1CCCCCCCCC1 ULEANATVHOUWBX-UHFFFAOYSA-N 0.000 description 1
- DTDXKLFYRNUBRG-UHFFFAOYSA-N 10-methoxyoctadecanoyl chloride Chemical compound CCCCCCCCC(OC)CCCCCCCCC(Cl)=O DTDXKLFYRNUBRG-UHFFFAOYSA-N 0.000 description 1
- BEBMJNQFWJUTQZ-UHFFFAOYSA-N 10-naphthalen-2-yldecanoyl chloride Chemical compound C1=CC=CC2=CC(CCCCCCCCCC(=O)Cl)=CC=C21 BEBMJNQFWJUTQZ-UHFFFAOYSA-N 0.000 description 1
- NDNCJFNRRCEIRF-UHFFFAOYSA-N 10-phenyldecanoyl chloride Chemical compound ClC(=O)CCCCCCCCCC1=CC=CC=C1 NDNCJFNRRCEIRF-UHFFFAOYSA-N 0.000 description 1
- RADWEQJQPHJCDU-UHFFFAOYSA-N 15-chloropentadec-3-ynoyl chloride Chemical compound ClCCCCCCCCCCCC#CCC(Cl)=O RADWEQJQPHJCDU-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- UMQUIRYNOVNYPA-UHFFFAOYSA-N 2-(4-chlorophenyl)acetyl chloride Chemical compound ClC(=O)CC1=CC=C(Cl)C=C1 UMQUIRYNOVNYPA-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- BKMQWLHPQKSLEC-UHFFFAOYSA-N 2-chloropentacos-2-enoyl chloride Chemical compound CCCCCCCCCCCCCCCCCCCCCCC=C(Cl)C(Cl)=O BKMQWLHPQKSLEC-UHFFFAOYSA-N 0.000 description 1
- JXPUQYMLVIWFMI-UHFFFAOYSA-N 2-cyclopentacosylacetyl chloride Chemical compound ClC(=O)CC1CCCCCCCCCCCCCCCCCCCCCCCC1 JXPUQYMLVIWFMI-UHFFFAOYSA-N 0.000 description 1
- IALGRRFZGRXFKT-UHFFFAOYSA-N 2-cyclopropylacetyl chloride Chemical compound ClC(=O)CC1CC1 IALGRRFZGRXFKT-UHFFFAOYSA-N 0.000 description 1
- 125000004810 2-methylpropylene group Chemical group [H]C([H])([H])C([H])(C([H])([H])[*:2])C([H])([H])[*:1] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- YGVAWDJEJNSUPG-UHFFFAOYSA-N 25-chloropentacos-2-ynoyl chloride Chemical compound ClCCCCCCCCCCCCCCCCCCCCCCC#CC(Cl)=O YGVAWDJEJNSUPG-UHFFFAOYSA-N 0.000 description 1
- AZPPHLVBLRYYFH-UHFFFAOYSA-N 3-chloro-3-methylbutanoyl chloride Chemical compound CC(C)(Cl)CC(Cl)=O AZPPHLVBLRYYFH-UHFFFAOYSA-N 0.000 description 1
- ATANUYPSKXKEDC-UHFFFAOYSA-N 3-chlorobutanoyl chloride Chemical compound CC(Cl)CC(Cl)=O ATANUYPSKXKEDC-UHFFFAOYSA-N 0.000 description 1
- INUNLMUAPJVRME-UHFFFAOYSA-N 3-chloropropanoyl chloride Chemical compound ClCCC(Cl)=O INUNLMUAPJVRME-UHFFFAOYSA-N 0.000 description 1
- JUADTOTVJUYCRQ-UHFFFAOYSA-N 3-cyclohexylpropanoyl chloride Chemical compound ClC(=O)CCC1CCCCC1 JUADTOTVJUYCRQ-UHFFFAOYSA-N 0.000 description 1
- FREZLSIGWNCSOQ-UHFFFAOYSA-N 3-methylbutanoyl 3-methylbutanoate Chemical compound CC(C)CC(=O)OC(=O)CC(C)C FREZLSIGWNCSOQ-UHFFFAOYSA-N 0.000 description 1
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 1
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- KBQPIDSATRHKJR-UHFFFAOYSA-N 4-chlorobut-2-enoyl chloride Chemical compound ClCC=CC(Cl)=O KBQPIDSATRHKJR-UHFFFAOYSA-N 0.000 description 1
- JCIGJEAXXYHFSY-UHFFFAOYSA-N 4-chlorobut-2-ynoyl chloride Chemical compound ClCC#CC(Cl)=O JCIGJEAXXYHFSY-UHFFFAOYSA-N 0.000 description 1
- DRRWPQAHHLLZAC-UHFFFAOYSA-N 4-chlorocyclohexane-1-carbonyl chloride Chemical compound ClC1CCC(C(Cl)=O)CC1 DRRWPQAHHLLZAC-UHFFFAOYSA-N 0.000 description 1
- WGKMMHIGIFTIJF-UHFFFAOYSA-N 4-methoxybut-2-enoyl chloride Chemical compound COCC=CC(Cl)=O WGKMMHIGIFTIJF-UHFFFAOYSA-N 0.000 description 1
- PWFGXSVRGBGOJO-UHFFFAOYSA-N 6-chlorophenanthrene-1-carbonyl chloride Chemical compound C1=CC2=CC=C(Cl)C=C2C2=C1C(C(=O)Cl)=CC=C2 PWFGXSVRGBGOJO-UHFFFAOYSA-N 0.000 description 1
- IKTDAFGJXADTPY-UHFFFAOYSA-N 6-methoxynaphthalene-2-carbonyl chloride Chemical compound C1=C(C(Cl)=O)C=CC2=CC(OC)=CC=C21 IKTDAFGJXADTPY-UHFFFAOYSA-N 0.000 description 1
- VLGFIZJPRAIWAJ-UHFFFAOYSA-N 9,10-dibromooctadecanoyl chloride Chemical compound CCCCCCCCC(Br)C(Br)CCCCCCCC(Cl)=O VLGFIZJPRAIWAJ-UHFFFAOYSA-N 0.000 description 1
- UHRQHMWATPTMBC-UHFFFAOYSA-N 9,10-dichlorooctadecanoyl chloride Chemical compound CCCCCCCCC(Cl)C(Cl)CCCCCCCC(Cl)=O UHRQHMWATPTMBC-UHFFFAOYSA-N 0.000 description 1
- UOGOPSMMAMOYAW-UHFFFAOYSA-N 9,10-dimethoxyoctadecanoyl chloride Chemical compound CCCCCCCCC(OC)C(OC)CCCCCCCC(Cl)=O UOGOPSMMAMOYAW-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- 208000031306 Rare hereditary hemochromatosis Diseases 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical group C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- UFBHSXXPAZMVSI-UHFFFAOYSA-N but-2-ynoyl chloride Chemical compound CC#CC(Cl)=O UFBHSXXPAZMVSI-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 125000003312 cerotoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 229940099112 cornstarch Drugs 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- YKGMKSIHIVVYKY-UHFFFAOYSA-N dabrafenib mesylate Chemical compound CS(O)(=O)=O.S1C(C(C)(C)C)=NC(C=2C(=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C=CC=2)F)=C1C1=CC=NC(N)=N1 YKGMKSIHIVVYKY-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 210000002249 digestive system Anatomy 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- NWADXBLMWHFGGU-UHFFFAOYSA-N dodecanoic anhydride Chemical compound CCCCCCCCCCCC(=O)OC(=O)CCCCCCCCCCC NWADXBLMWHFGGU-UHFFFAOYSA-N 0.000 description 1
- NQGIJDNPUZEBRU-UHFFFAOYSA-N dodecanoyl chloride Chemical compound CCCCCCCCCCCC(Cl)=O NQGIJDNPUZEBRU-UHFFFAOYSA-N 0.000 description 1
- 125000005066 dodecenyl group Chemical group C(=CCCCCCCCCCC)* 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- FRVMOYIBZNVRPI-UHFFFAOYSA-N hex-2-ynoyl chloride Chemical compound CCCC#CC(Cl)=O FRVMOYIBZNVRPI-UHFFFAOYSA-N 0.000 description 1
- KXHFYBWOKFEEMI-UHFFFAOYSA-N hexacosanoyl chloride Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCC(Cl)=O KXHFYBWOKFEEMI-UHFFFAOYSA-N 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 239000000797 iron chelating agent Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- VHRYZQNGTZXDNX-UHFFFAOYSA-N methacryloyl chloride Chemical compound CC(=C)C(Cl)=O VHRYZQNGTZXDNX-UHFFFAOYSA-N 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- RSIPQHOWTCNEBI-UHFFFAOYSA-N n-hydroxypropanamide Chemical compound CCC(=O)NO RSIPQHOWTCNEBI-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 125000005187 nonenyl group Chemical group C(=CCCCCCCC)* 0.000 description 1
- SUHXRRRGYUULBU-UHFFFAOYSA-N oct-2-enoyl chloride Chemical compound CCCCCC=CC(Cl)=O SUHXRRRGYUULBU-UHFFFAOYSA-N 0.000 description 1
- LTHCSWBWNVGEFE-UHFFFAOYSA-N octanamide Chemical compound CCCCCCCC(N)=O LTHCSWBWNVGEFE-UHFFFAOYSA-N 0.000 description 1
- 239000008203 oral pharmaceutical composition Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000001312 palmitoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- RJBPVIKTBSLIGY-UHFFFAOYSA-N pentacos-2-enoyl chloride Chemical compound CCCCCCCCCCCCCCCCCCCCCCC=CC(Cl)=O RJBPVIKTBSLIGY-UHFFFAOYSA-N 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- MKJZRZRIEWBTMN-UHFFFAOYSA-N prop-2-ynoyl chloride Chemical compound ClC(=O)C#C MKJZRZRIEWBTMN-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- NXLOLUFNDSBYTP-UHFFFAOYSA-N retene Chemical compound C1=CC=C2C3=CC=C(C(C)C)C=C3C=CC2=C1C NXLOLUFNDSBYTP-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008299 semisolid dosage form Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229960001407 sodium bicarbonate Drugs 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 230000000451 tissue damage Effects 0.000 description 1
- 231100000827 tissue damage Toxicity 0.000 description 1
- 239000010891 toxic waste Substances 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005065 undecenyl group Chemical group C(=CCCCCCCCCC)* 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/28—Compounds containing heavy metals
- A61K31/295—Iron group metal compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US574,482 | 1984-01-26 | ||
| US06/574,482 US4684482A (en) | 1984-01-26 | 1984-01-26 | Orally effective ion chelators |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1247120A true CA1247120A (en) | 1988-12-20 |
Family
ID=24296330
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000472842A Expired CA1247120A (en) | 1984-01-26 | 1985-01-25 | Orally effective ion chelators related to deferoxamine |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4684482A (enExample) |
| EP (1) | EP0171414B1 (enExample) |
| JP (1) | JPS61501391A (enExample) |
| AU (1) | AU3889485A (enExample) |
| CA (1) | CA1247120A (enExample) |
| DE (1) | DE3574696D1 (enExample) |
| IL (1) | IL74149A (enExample) |
| WO (1) | WO1985003290A1 (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5015664A (en) * | 1984-01-26 | 1991-05-14 | Oral D | Orally effective ion chelators related to deferoxamine |
| US5047421A (en) * | 1984-01-26 | 1991-09-10 | Oral-D | Orally effective ion chelators |
| DK77487A (da) * | 1986-03-11 | 1987-09-12 | Hoffmann La Roche | Hydroxylaminderivater |
| US4940811A (en) * | 1986-12-09 | 1990-07-10 | Ciba-Geigy Corporation | N,N-disubstituted ureas and processes for their manufacture |
| MX12394A (es) * | 1987-07-23 | 1993-12-01 | Ciba Geigy Ag | Procedimiento par la obtencion de carbamatos de polietilenglicol. |
| ES2042061T3 (es) * | 1988-06-08 | 1993-12-01 | Ciba-Geigy Ag | Procedimiento para la obtencion de derivados carbamoilados del acido hidroxamico. |
| EP0523037A4 (en) * | 1990-03-30 | 1993-07-28 | Biomedical Frontiers, Inc. | Fluid resuscitation |
| CA2084073A1 (en) * | 1990-03-30 | 1991-10-01 | Bo Erik Hedlund | Fluid resuscitation |
| US5416078A (en) * | 1990-03-30 | 1995-05-16 | Biomedical Frontiers, Inc. | Fluid resuscitation |
| WO1992020227A1 (en) * | 1991-05-13 | 1992-11-26 | Oral-D | Substituted orally effective ion chelators related to deferoxamine |
| IL98680A0 (en) * | 1991-06-30 | 1992-07-15 | Yeda Res & Dev | Hydroxamate derivatives and pharmaceutical compositions containing them |
| GB9211779D0 (en) * | 1992-06-03 | 1992-07-15 | Ciba Geigy Ag | Amine salts |
| JPH0925234A (ja) * | 1995-07-12 | 1997-01-28 | Wakunaga Pharmaceut Co Ltd | 脳疾患改善剤 |
| US6933104B1 (en) * | 1999-04-23 | 2005-08-23 | Shiva Biomedical, Llc | Diagnosis and treatment of human kidney diseases |
| US9259670B2 (en) | 2008-04-16 | 2016-02-16 | The University Of Kentucky Research Foundation | Flow-through filter to remove aluminum from medical solutions |
| US7932326B2 (en) * | 2008-04-16 | 2011-04-26 | The University Of Kentucky Research Foundation | Chelating compounds and immobilized tethered chelators |
| US9139456B2 (en) | 2008-04-16 | 2015-09-22 | The Curators Of The University Of Missouri | Chelating compounds and immobilized tethered chelators |
| WO2018085375A1 (en) | 2016-11-01 | 2018-05-11 | Ohio State Innovation Foundation | Methods for the iodination of biomolecules |
| US20220218834A1 (en) | 2019-05-20 | 2022-07-14 | Ohio State Innovation Foundation | Apohemoglobin-haptoglobin complexes and methods of using thereof |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH438351A (de) * | 1959-09-25 | 1967-06-30 | Ciba Geigy | Verfahren zur Herstellung neuer Wuchsstoffe |
| US3118823A (en) * | 1960-11-24 | 1964-01-21 | Ciba Geigy Corp | Method for producing ferrioxamine |
-
1984
- 1984-01-26 US US06/574,482 patent/US4684482A/en not_active Expired - Fee Related
-
1985
- 1985-01-24 AU AU38894/85A patent/AU3889485A/en not_active Abandoned
- 1985-01-24 IL IL74149A patent/IL74149A/xx not_active IP Right Cessation
- 1985-01-24 JP JP85500733A patent/JPS61501391A/ja active Granted
- 1985-01-24 WO PCT/US1985/000104 patent/WO1985003290A1/en not_active Ceased
- 1985-01-24 EP EP85900906A patent/EP0171414B1/en not_active Expired
- 1985-01-24 DE DE8585900906T patent/DE3574696D1/de not_active Expired - Fee Related
- 1985-01-25 CA CA000472842A patent/CA1247120A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL74149A (en) | 1989-07-31 |
| EP0171414A1 (en) | 1986-02-19 |
| WO1985003290A1 (en) | 1985-08-01 |
| JPH0576939B2 (enExample) | 1993-10-25 |
| AU3889485A (en) | 1985-08-09 |
| US4684482A (en) | 1987-08-04 |
| JPS61501391A (ja) | 1986-07-10 |
| DE3574696D1 (de) | 1990-10-31 |
| EP0171414B1 (en) | 1990-09-26 |
| IL74149A0 (en) | 1985-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1247120A (en) | Orally effective ion chelators related to deferoxamine | |
| US4671901A (en) | Orally effective ion chelators | |
| US4294832A (en) | Tetrahydroisoquinoline compounds and a pharmaceutical composition thereof | |
| CA1280369C (en) | Pharmaceutical with anti-tumor effect | |
| JPH06509335A (ja) | アシルメルカプトアルカノイルジペプチド類、その製造方法及びその治療学的使用 | |
| JPS63264442A (ja) | リポキシゲナーゼ阻害性化合物 | |
| US5202313A (en) | Bilobalide derivatives, their applications and formulations containing them | |
| US5196412A (en) | Gallium compounds | |
| JP2919867B2 (ja) | 抗腫瘍剤 | |
| US5015664A (en) | Orally effective ion chelators related to deferoxamine | |
| IE880178L (en) | 4-thiazolidinecarboxylic acids | |
| DE68911776T2 (de) | Konjugierte Oxybutenolide zur Behandlung von Ulcera. | |
| US5047421A (en) | Orally effective ion chelators | |
| US5550161A (en) | Substituted orally effective ION chelators related to deferoxamine | |
| GB2142635A (en) | Organogermanium compound and an opioid peptide-degrading enzyme inhibitor containing the same | |
| JP2919870B2 (ja) | 肝障害抑制剤 | |
| KR860001888B1 (ko) | 디하이드록시 벤조산 유도체의 제조방법 | |
| DE68904203T4 (de) | Cysteinderivate. | |
| FR2553663A1 (fr) | Derives du 1,2-dithiolanne, leur preparation et leur utilisation comme medicaments | |
| EP0013891B1 (de) | Dipeptide zur Verwendung bei der Heilung von Krankheiten, einige neue Stoffe aus dieser Verbindungsgruppe, Dipeptide enthaltende Arzneimittel und deren Herstellung | |
| WO1992020227A1 (en) | Substituted orally effective ion chelators related to deferoxamine | |
| US4611002A (en) | Carboxymethyl esters of mercaptopropanoic acids as enkephalinase inhibitors | |
| FR2526792A1 (fr) | Derives d'aletheine utiles pour le traitement des lesions hepatiques | |
| EP0055145A1 (en) | 4-(Aminomethyl)cyclohexane-1-carboxylic acid derivatives | |
| BE864450R (fr) | Compositions pharmaceutiques a base d'anthocyanidine, leur preparation et leur utilisation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |