CA1238320A - Derivatives of benzoxazepine and benzazepine having anthelmintic activity - Google Patents
Derivatives of benzoxazepine and benzazepine having anthelmintic activityInfo
- Publication number
- CA1238320A CA1238320A CA000458877A CA458877A CA1238320A CA 1238320 A CA1238320 A CA 1238320A CA 000458877 A CA000458877 A CA 000458877A CA 458877 A CA458877 A CA 458877A CA 1238320 A CA1238320 A CA 1238320A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- formula
- alkyl
- group
- benzazepine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000000507 anthelmentic effect Effects 0.000 title abstract description 7
- DQFQCHIDRBIESA-UHFFFAOYSA-N 1-benzazepine Chemical compound N1C=CC=CC2=CC=CC=C12 DQFQCHIDRBIESA-UHFFFAOYSA-N 0.000 title description 15
- ZCXLTWVZYXBHJS-UHFFFAOYSA-N 1,2-benzoxazepine Chemical class O1N=CC=CC2=CC=CC=C12 ZCXLTWVZYXBHJS-UHFFFAOYSA-N 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 52
- 238000000034 method Methods 0.000 claims abstract description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 10
- 239000001301 oxygen Substances 0.000 claims abstract description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 9
- 239000005864 Sulphur Substances 0.000 claims abstract description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 6
- 238000002360 preparation method Methods 0.000 claims abstract description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 4
- 125000000081 (C5-C8) cycloalkenyl group Chemical group 0.000 claims abstract description 3
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims abstract 2
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims abstract 2
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 claims abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 125000006239 protecting group Chemical group 0.000 claims description 10
- 238000011282 treatment Methods 0.000 claims description 10
- 239000003153 chemical reaction reagent Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical group C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 claims description 4
- -1 nitro, amino Chemical group 0.000 claims description 4
- 238000007280 thionation reaction Methods 0.000 claims description 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims 1
- LGUDKOQUWIHXOV-UHFFFAOYSA-N epsiprantel Chemical compound C1C(C2=CC=CC=C2CCC2)N2C(=O)CN1C(=O)C1CCCCC1 LGUDKOQUWIHXOV-UHFFFAOYSA-N 0.000 claims 1
- 241000242722 Cestoda Species 0.000 abstract description 4
- 239000003814 drug Substances 0.000 abstract description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- 239000000203 mixture Substances 0.000 description 25
- 239000000243 solution Substances 0.000 description 17
- 229960001701 chloroform Drugs 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 238000004440 column chromatography Methods 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- XUUSYXJGMRQBKQ-UHFFFAOYSA-N 2h-2-benzazepine Chemical compound N1C=CC=C2C=CC=CC2=C1 XUUSYXJGMRQBKQ-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 125000000217 alkyl group Chemical group 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 229910052681 coesite Inorganic materials 0.000 description 5
- 229910052906 cristobalite Inorganic materials 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 235000012239 silicon dioxide Nutrition 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 229910052682 stishovite Inorganic materials 0.000 description 5
- 229910052905 tridymite Inorganic materials 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 229940086542 triethylamine Drugs 0.000 description 4
- UWXIKAZQXAYFPT-UHFFFAOYSA-N 1,4-benzoxazepine Chemical compound O1C=CN=CC2=CC=CC=C12 UWXIKAZQXAYFPT-UHFFFAOYSA-N 0.000 description 3
- FSVJFNAIGNNGKK-UHFFFAOYSA-N 2-[cyclohexyl(oxo)methyl]-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one Chemical compound C1C(C2=CC=CC=C2CC2)N2C(=O)CN1C(=O)C1CCCCC1 FSVJFNAIGNNGKK-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical class OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 241000244155 Taenia Species 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 229960002957 praziquantel Drugs 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- 239000001117 sulphuric acid Substances 0.000 description 3
- 235000011149 sulphuric acid Nutrition 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 208000026368 Cestode infections Diseases 0.000 description 2
- 241000935794 Dipylidium Species 0.000 description 2
- 241000935792 Dipylidium caninum Species 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- 208000006968 Helminthiasis Diseases 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FEWJPZIEWOKRBE-XIXRPRMCSA-N Mesotartaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-XIXRPRMCSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 150000008038 benzoazepines Chemical class 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 208000014837 parasitic helminthiasis infectious disease Diseases 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- UJKBAUHICWNZLW-UHFFFAOYSA-N 1-benzylpiperazine-2,6-dione Chemical compound O=C1CNCC(=O)N1CC1=CC=CC=C1 UJKBAUHICWNZLW-UHFFFAOYSA-N 0.000 description 1
- SZQUPQVVCLFZLC-UHFFFAOYSA-N 2-[benzyl(carboxymethyl)amino]acetic acid Chemical compound OC(=O)CN(CC(O)=O)CC1=CC=CC=C1 SZQUPQVVCLFZLC-UHFFFAOYSA-N 0.000 description 1
- IMLAIXAZMVDRGA-UHFFFAOYSA-N 2-phenoxyethanamine Chemical compound NCCOC1=CC=CC=C1 IMLAIXAZMVDRGA-UHFFFAOYSA-N 0.000 description 1
- LYUQWQRTDLVQGA-UHFFFAOYSA-N 3-phenylpropylamine Chemical class NCCCC1=CC=CC=C1 LYUQWQRTDLVQGA-UHFFFAOYSA-N 0.000 description 1
- YQYPHIWGCYMJLP-UHFFFAOYSA-N 4-benzyl-1-(2-phenoxyethyl)piperazine-2,6-dione Chemical compound C1C(=O)N(CCOC=2C=CC=CC=2)C(=O)CN1CC1=CC=CC=C1 YQYPHIWGCYMJLP-UHFFFAOYSA-N 0.000 description 1
- ZYPCNAHFCLFZKP-UHFFFAOYSA-N 4-benzyl-6-hydroxy-1-(3-phenylpropyl)piperazin-2-one Chemical compound C1C(=O)N(CCCC=2C=CC=CC=2)C(O)CN1CC1=CC=CC=C1 ZYPCNAHFCLFZKP-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000244156 Hydatigera taeniaeformis Species 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940124339 anthelmintic agent Drugs 0.000 description 1
- 239000000921 anthelmintic agent Substances 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000002036 chloroform fraction Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- DBNDLBGFXRHHNQ-UHFFFAOYSA-N ethyl cyclohexanecarbodithioate Chemical compound C(C)SC(=S)C1CCCCC1 DBNDLBGFXRHHNQ-UHFFFAOYSA-N 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/06—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members
- C07D241/08—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members with oxygen atoms directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8319357 | 1983-07-16 | ||
| GB838319357A GB8319357D0 (en) | 1983-07-18 | 1983-07-18 | Compounds |
| GB838334502A GB8334502D0 (en) | 1983-12-24 | 1983-12-24 | Compounds |
| GB8334502 | 1983-12-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1238320A true CA1238320A (en) | 1988-06-21 |
Family
ID=26286633
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000458877A Expired CA1238320A (en) | 1983-07-16 | 1984-07-13 | Derivatives of benzoxazepine and benzazepine having anthelmintic activity |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US4661489A (enFirst) |
| EP (1) | EP0134984B1 (enFirst) |
| AU (1) | AU572864B2 (enFirst) |
| CA (1) | CA1238320A (enFirst) |
| DE (1) | DE3472678D1 (enFirst) |
| DK (1) | DK169548B1 (enFirst) |
| ES (1) | ES8604598A1 (enFirst) |
| GR (1) | GR79947B (enFirst) |
| IE (1) | IE57569B1 (enFirst) |
| MX (1) | MX161064A (enFirst) |
| NZ (1) | NZ208896A (enFirst) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0134984B1 (en) * | 1983-07-16 | 1988-07-13 | Beecham Group Plc | Benzazepine and benzoxazepine derivatives |
| EP0187012B1 (en) * | 1984-12-22 | 1989-06-21 | Beecham Group Plc | Novel compositions |
| GB8509435D0 (en) * | 1985-04-12 | 1985-05-15 | Beecham Group Plc | Intermediates & process |
| GB9024924D0 (en) * | 1990-11-16 | 1991-01-02 | Beecham Group Plc | Novel compositions |
| US5372130A (en) * | 1992-02-26 | 1994-12-13 | Djs&T Limited Partnership | Face mask assembly and method having a fan and replaceable filter |
| DE19628776A1 (de) | 1996-07-17 | 1998-01-22 | Bayer Ag | Oral applizierbare Granulate von Hexahydropyrazinderivaten |
| DE102005011779A1 (de) * | 2005-03-11 | 2006-09-14 | Bayer Healthcare Ag | Endoparasitizide Mittel |
| DE102008022520A1 (de) * | 2008-05-07 | 2009-11-12 | Bayer Animal Health Gmbh | Feste Arzneimittelformulierung mit verzögerter Freisetzung |
| WO2012081035A2 (en) * | 2010-12-13 | 2012-06-21 | Sequent Scientific Limited | A process for preparation of praziquantel |
| CN104788457B (zh) * | 2011-05-31 | 2017-08-25 | 山东大学(威海) | 新型抗寄生虫吡嗪异喹啉衍生物 |
| CN102321088A (zh) * | 2011-08-03 | 2012-01-18 | 威海秀水药物研发有限公司 | 一种新型抗血吸虫化合物 |
| CN110128325B (zh) * | 2019-04-11 | 2021-01-05 | 广州医科大学 | 取代苯基哌啶酮类化合物及其合成方法和应用 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL129434C (enFirst) * | 1966-03-12 | |||
| DE2362539C2 (de) * | 1973-12-17 | 1986-05-07 | Merck Patent Gmbh, 6100 Darmstadt | 2-Acyl-4-oxo-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isochinoline, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| DE2441261A1 (de) * | 1974-08-28 | 1976-03-18 | Merck Patent Gmbh | Ringsubstituierte pyrazino-isochinolin-derivat und verfahren zu ihrer herstellung |
| US4162319A (en) * | 1974-08-28 | 1979-07-24 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Ring substituted pyrazino-isoquinoline derivatives and their preparation |
| NL7809726A (nl) * | 1978-09-26 | 1980-03-28 | Akzo Nv | Nieuwe tetracyclische verbindingen. |
| FR2520740A1 (fr) * | 1982-01-29 | 1983-08-05 | Sanofi Sa | Procede pour la preparation d'acyl-2-hexahydro-1,3,4,6,7,11b-2h-pyrazino (2,1-a) isoquinoleinones-4 et intermediaires |
| IN157936B (enFirst) * | 1982-07-08 | 1986-07-26 | Korea Advanced Inst Sci & Tech | |
| ZW6284A1 (en) * | 1983-05-05 | 1985-10-30 | Hoffmann La Roche | Novel pyrimidone derivatives |
| EP0134984B1 (en) * | 1983-07-16 | 1988-07-13 | Beecham Group Plc | Benzazepine and benzoxazepine derivatives |
-
1984
- 1984-07-07 EP EP84107989A patent/EP0134984B1/en not_active Expired
- 1984-07-07 DE DE8484107989T patent/DE3472678D1/de not_active Expired
- 1984-07-11 MX MX6774A patent/MX161064A/es unknown
- 1984-07-13 ES ES534315A patent/ES8604598A1/es not_active Expired
- 1984-07-13 GR GR75302A patent/GR79947B/el unknown
- 1984-07-13 NZ NZ208896A patent/NZ208896A/en unknown
- 1984-07-13 US US06/630,524 patent/US4661489A/en not_active Expired - Lifetime
- 1984-07-13 CA CA000458877A patent/CA1238320A/en not_active Expired
- 1984-07-13 DK DK347284A patent/DK169548B1/da not_active IP Right Cessation
- 1984-07-13 AU AU30581/84A patent/AU572864B2/en not_active Expired
- 1984-07-16 IE IE1830/84A patent/IE57569B1/en not_active IP Right Cessation
-
1986
- 1986-09-17 US US06/908,379 patent/US4866056A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ES534315A0 (es) | 1986-02-01 |
| DE3472678D1 (de) | 1988-08-18 |
| EP0134984B1 (en) | 1988-07-13 |
| DK347284D0 (da) | 1984-07-13 |
| IE841830L (en) | 1985-01-16 |
| MX161064A (es) | 1990-07-19 |
| US4866056A (en) | 1989-09-12 |
| DK347284A (da) | 1985-01-17 |
| NZ208896A (en) | 1988-03-30 |
| US4661489A (en) | 1987-04-28 |
| AU572864B2 (en) | 1988-05-19 |
| GR79947B (enFirst) | 1984-10-31 |
| EP0134984A1 (en) | 1985-03-27 |
| DK169548B1 (da) | 1994-11-28 |
| IE57569B1 (en) | 1992-12-16 |
| ES8604598A1 (es) | 1986-02-01 |
| AU3058184A (en) | 1985-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU1433413A3 (ru) | Способ получени замещенного имидазо @ 1,5- @ пиридина или его фармацевтически приемлемой соли | |
| CA1238320A (en) | Derivatives of benzoxazepine and benzazepine having anthelmintic activity | |
| US3424762A (en) | Certain 3-ureidopyrrolidines | |
| JPH046684B2 (enFirst) | ||
| DE3935514A1 (de) | Neue bicyclo-imidazole, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| EP0204349A2 (de) | Neue heteroaromatische Aminderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| UA43853C2 (uk) | Арилалкілпіридазинони, спосіб їх отримання, фармацевтична композиція та спосіб її отримання | |
| FR2567518A1 (fr) | Nouveaux composes a noyau heterocyclique azote, leur preparation et les medicaments qui en contiennent | |
| SK147897A3 (en) | Azacycloalcane derivatives, preparation thereof and their applications in therapy | |
| MC1314A1 (fr) | Derives de benzazepine | |
| EP0323799A1 (de) | Imidazolderivate II | |
| US3903103A (en) | 4-Amino-s-triazolo-{8 4,3-a{9 {8 1,4{9 benzodiazepine | |
| US4587245A (en) | Method of treating neuropsychic disturbances by benzodiazepine derivatives and composition therefor | |
| EP0178759A1 (en) | Alkynyl derivativesof pyrazolo-(3,4-b)-pyridine lactams | |
| DE2233682A1 (de) | 2- eckige klammer auf 3-(subst. aminomethyl)-4-h-1,2,4-triazol-4-yl eckige klammer zu -benzophenone, ein verfahren zu ihrer herstellung sowie diese enthaltende arzneimittel | |
| EP0187012B1 (en) | Novel compositions | |
| EP0072029B1 (de) | Triazolobenzazepine, Verfahren und Zwischenprodukte zu deren Herstellung und diese enthaltende Arzneimittel | |
| EP0001585B1 (de) | Piperazino-pyrrolobenzodiazepine, Verfahren zu ihrer Herstellung sowie pharmazeutische Präparate enthaltend diese Verbindungen | |
| EP0299345A2 (en) | Dihydro-1,4-oxazino(2,3-c)quinolines, a process and intermediates for the preparation thereof and their use as medicaments | |
| US3772317A (en) | Certain 2-(3-substituted-4h-1,2,4-triazol-4-yl)-alpha-phenylbenzylamines | |
| EP0254527B1 (en) | Tetracyclic indole derivatives | |
| DE2216837C3 (de) | 1,4,5-Benzotrlazocinderivate, ihre Salze, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneipräparate | |
| DD283627A5 (de) | Verfahren zur herstellung von [3,2-f]benzoxazol-6-onen | |
| EP0035244B1 (de) | Cycloalka(4,5)pyrrolo(2,3-g)isochinoline, Verfahren und Zwischenprodukte für ihre Herstellung, und sie enthaltende Arzneimittel | |
| EP0268178A1 (de) | Neue Pyrrolo-benzimidazole, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |