CA1232394A - Production of water-curable, silane modified thermoplastic polymers - Google Patents
Production of water-curable, silane modified thermoplastic polymersInfo
- Publication number
- CA1232394A CA1232394A CA000462712A CA462712A CA1232394A CA 1232394 A CA1232394 A CA 1232394A CA 000462712 A CA000462712 A CA 000462712A CA 462712 A CA462712 A CA 462712A CA 1232394 A CA1232394 A CA 1232394A
- Authority
- CA
- Canada
- Prior art keywords
- silane
- composition
- carbon atoms
- titanate
- matter
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 title claims abstract description 55
- 229910000077 silane Inorganic materials 0.000 title claims abstract description 46
- 229920001169 thermoplastic Polymers 0.000 title claims abstract description 32
- 238000004519 manufacturing process Methods 0.000 title description 3
- -1 organo titanate Chemical compound 0.000 claims abstract description 67
- 239000000203 mixture Substances 0.000 claims abstract description 55
- 229920000642 polymer Polymers 0.000 claims abstract description 33
- 239000004416 thermosoftening plastic Substances 0.000 claims abstract description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 33
- 239000004215 Carbon black (E152) Substances 0.000 claims description 27
- 229930195733 hydrocarbon Natural products 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 23
- 125000004185 ester group Chemical group 0.000 claims description 12
- 229920001577 copolymer Polymers 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical group CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 claims description 8
- 238000009833 condensation Methods 0.000 claims description 8
- 230000005494 condensation Effects 0.000 claims description 8
- 239000012975 dibutyltin dilaurate Substances 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 claims description 8
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 7
- 150000002148 esters Chemical group 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 229920006244 ethylene-ethyl acrylate Polymers 0.000 claims description 6
- ITNVWQNWHXEMNS-UHFFFAOYSA-N methanolate;titanium(4+) Chemical group [Ti+4].[O-]C.[O-]C.[O-]C.[O-]C ITNVWQNWHXEMNS-UHFFFAOYSA-N 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- JHTCDEYHVGIPAL-UHFFFAOYSA-N tridodecoxy(ethenyl)silane Chemical compound CCCCCCCCCCCCO[Si](OCCCCCCCCCCCC)(OCCCCCCCCCCCC)C=C JHTCDEYHVGIPAL-UHFFFAOYSA-N 0.000 claims description 5
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 4
- 239000005977 Ethylene Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000004698 Polyethylene Substances 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- SGCFZHOZKKQIBU-UHFFFAOYSA-N tributoxy(ethenyl)silane Chemical compound CCCCO[Si](OCCCC)(OCCCC)C=C SGCFZHOZKKQIBU-UHFFFAOYSA-N 0.000 claims description 4
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 claims description 3
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims description 3
- 229920000573 polyethylene Polymers 0.000 claims description 3
- 229920000098 polyolefin Polymers 0.000 claims 3
- DYFMAHYLCRSUHA-UHFFFAOYSA-N ethenyl-tris(2-methylpropoxy)silane Chemical compound CC(C)CO[Si](OCC(C)C)(OCC(C)C)C=C DYFMAHYLCRSUHA-UHFFFAOYSA-N 0.000 claims 2
- 238000009413 insulation Methods 0.000 abstract description 2
- 238000004132 cross linking Methods 0.000 description 14
- 239000003707 silyl modified polymer Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 11
- 150000004756 silanes Chemical class 0.000 description 8
- 150000001993 dienes Chemical class 0.000 description 5
- 150000002978 peroxides Chemical class 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- 230000032683 aging Effects 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- 229920000800 acrylic rubber Polymers 0.000 description 3
- 125000005250 alkyl acrylate group Chemical group 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 150000005673 monoalkenes Chemical class 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000000962 organic group Chemical group 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229920001296 polysiloxane Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- KFHLAQZSZAJKKJ-UHFFFAOYSA-N 2,3,4-trimethyl-1,2-dihydroquinoline Chemical compound C1=CC=C2C(C)=C(C)C(C)NC2=C1 KFHLAQZSZAJKKJ-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- RREGISFBPQOLTM-UHFFFAOYSA-N alumane;trihydrate Chemical compound O.O.O.[AlH3] RREGISFBPQOLTM-UHFFFAOYSA-N 0.000 description 2
- 239000012080 ambient air Substances 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- NKSJNEHGWDZZQF-UHFFFAOYSA-N ethenyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)C=C NKSJNEHGWDZZQF-UHFFFAOYSA-N 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000007654 immersion Methods 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 150000001451 organic peroxides Chemical class 0.000 description 2
- 229940095050 propylene Drugs 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000011369 resultant mixture Substances 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- UKRDPEFKFJNXQM-UHFFFAOYSA-N vinylsilane Chemical compound [SiH3]C=C UKRDPEFKFJNXQM-UHFFFAOYSA-N 0.000 description 2
- PRBHEGAFLDMLAL-GQCTYLIASA-N (4e)-hexa-1,4-diene Chemical compound C\C=C\CC=C PRBHEGAFLDMLAL-GQCTYLIASA-N 0.000 description 1
- HYBLFDUGSBOMPI-BQYQJAHWSA-N (4e)-octa-1,4-diene Chemical compound CCC\C=C\CC=C HYBLFDUGSBOMPI-BQYQJAHWSA-N 0.000 description 1
- OJOWICOBYCXEKR-KRXBUXKQSA-N (5e)-5-ethylidenebicyclo[2.2.1]hept-2-ene Chemical compound C1C2C(=C/C)/CC1C=C2 OJOWICOBYCXEKR-KRXBUXKQSA-N 0.000 description 1
- PRBHEGAFLDMLAL-UHFFFAOYSA-N 1,5-Hexadiene Natural products CC=CCC=C PRBHEGAFLDMLAL-UHFFFAOYSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- VBCFHWSPNHEYGE-UHFFFAOYSA-N 2,3,4-trimethylquinoline Chemical compound C1=CC=C2C(C)=C(C)C(C)=NC2=C1 VBCFHWSPNHEYGE-UHFFFAOYSA-N 0.000 description 1
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- KBXHEWMEKVZJRY-UHFFFAOYSA-N 2-(dibutoxymethylsilyl)ethyl acetate Chemical compound C(C)(=O)OCC[SiH2]C(OCCCC)OCCCC KBXHEWMEKVZJRY-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- WHBAYNMEIXUTJV-UHFFFAOYSA-N 2-chloroethyl prop-2-enoate Chemical compound ClCCOC(=O)C=C WHBAYNMEIXUTJV-UHFFFAOYSA-N 0.000 description 1
- KEKZQDIWWOXOGH-UHFFFAOYSA-N 2-tributoxysilylethyl 2-methylprop-2-enoate Chemical compound CCCCO[Si](OCCCC)(OCCCC)CCOC(=O)C(C)=C KEKZQDIWWOXOGH-UHFFFAOYSA-N 0.000 description 1
- ZRYIUBDEWXCPBV-UHFFFAOYSA-N 2-tributoxysilylethyl acetate Chemical compound CCCCO[Si](CCOC(C)=O)(OCCCC)OCCCC ZRYIUBDEWXCPBV-UHFFFAOYSA-N 0.000 description 1
- WOOQLXYCPOWSIS-UHFFFAOYSA-N 2-tripentoxysilylethyl acetate Chemical compound CCCCCO[Si](CCOC(C)=O)(OCCCCC)OCCCCC WOOQLXYCPOWSIS-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- 125000004920 4-methyl-2-pentyl group Chemical group CC(CC(C)*)C 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 239000004801 Chlorinated PVC Substances 0.000 description 1
- 239000004709 Chlorinated polyethylene Substances 0.000 description 1
- 102100024133 Coiled-coil domain-containing protein 50 Human genes 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 101000910772 Homo sapiens Coiled-coil domain-containing protein 50 Proteins 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- CGSLYBDCEGBZCG-UHFFFAOYSA-N Octicizer Chemical compound C=1C=CC=CC=1OP(=O)(OCC(CC)CCCC)OC1=CC=CC=C1 CGSLYBDCEGBZCG-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 241001296096 Probles Species 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 150000001253 acrylic acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical compound C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 150000001361 allenes Chemical class 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 1
- 150000001463 antimony compounds Chemical class 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- WHHGLZMJPXIBIX-UHFFFAOYSA-N decabromodiphenyl ether Chemical compound BrC1=C(Br)C(Br)=C(Br)C(Br)=C1OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br WHHGLZMJPXIBIX-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- FJPJIGMNFZRYIW-UHFFFAOYSA-N dibutoxymethyl(ethenyl)silane Chemical compound C(=C)[SiH2]C(OCCCC)OCCCC FJPJIGMNFZRYIW-UHFFFAOYSA-N 0.000 description 1
- AYOHIQLKSOJJQH-UHFFFAOYSA-N dibutyltin Chemical compound CCCC[Sn]CCCC AYOHIQLKSOJJQH-UHFFFAOYSA-N 0.000 description 1
- UBHZUDXTHNMNLD-UHFFFAOYSA-N dimethylsilane Chemical compound C[SiH2]C UBHZUDXTHNMNLD-UHFFFAOYSA-N 0.000 description 1
- PKMOPTPEFIPYRW-UHFFFAOYSA-N dipentoxymethyl(ethenyl)silane Chemical compound C(=C)[SiH2]C(OCCCCC)OCCCCC PKMOPTPEFIPYRW-UHFFFAOYSA-N 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- DAJRCINYWAIBNV-UHFFFAOYSA-N ethenyl(triheptoxy)silane Chemical compound CCCCCCCO[Si](OCCCCCCC)(OCCCCCCC)C=C DAJRCINYWAIBNV-UHFFFAOYSA-N 0.000 description 1
- MLVRYXJUYPBRSQ-UHFFFAOYSA-N ethenyl(trihexoxy)silane Chemical compound CCCCCCO[Si](OCCCCCC)(OCCCCCC)C=C MLVRYXJUYPBRSQ-UHFFFAOYSA-N 0.000 description 1
- KPRMNZFLEVMTKA-UHFFFAOYSA-N ethenyl(trioctoxy)silane Chemical compound CCCCCCCCO[Si](OCCCCCCCC)(OCCCCCCCC)C=C KPRMNZFLEVMTKA-UHFFFAOYSA-N 0.000 description 1
- PWOZXQOZUNMWKG-UHFFFAOYSA-N ethenyl(tripentoxy)silane Chemical compound CCCCCO[Si](OCCCCC)(OCCCCC)C=C PWOZXQOZUNMWKG-UHFFFAOYSA-N 0.000 description 1
- QKPJNRXOSGTECJ-UHFFFAOYSA-N ethenyl-dimethyl-pentoxysilane Chemical compound CCCCCO[Si](C)(C)C=C QKPJNRXOSGTECJ-UHFFFAOYSA-N 0.000 description 1
- 239000005042 ethylene-ethyl acrylate Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- PBZROIMXDZTJDF-UHFFFAOYSA-N hepta-1,6-dien-4-one Chemical compound C=CCC(=O)CC=C PBZROIMXDZTJDF-UHFFFAOYSA-N 0.000 description 1
- PYGSKMBEVAICCR-UHFFFAOYSA-N hexa-1,5-diene Chemical compound C=CCCC=C PYGSKMBEVAICCR-UHFFFAOYSA-N 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- UIUXUFNYAYAMOE-UHFFFAOYSA-N methylsilane Chemical compound [SiH3]C UIUXUFNYAYAMOE-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000019809 paraffin wax Nutrition 0.000 description 1
- QYZLKGVUSQXAMU-UHFFFAOYSA-N penta-1,4-diene Chemical compound C=CCC=C QYZLKGVUSQXAMU-UHFFFAOYSA-N 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920005638 polyethylene monopolymer Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- HSVFKFNNMLUVEY-UHFFFAOYSA-N sulfuryl diazide Chemical compound [N-]=[N+]=NS(=O)(=O)N=[N+]=[N-] HSVFKFNNMLUVEY-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- BIKXLKXABVUSMH-UHFFFAOYSA-N trizinc;diborate Chemical compound [Zn+2].[Zn+2].[Zn+2].[O-]B([O-])[O-].[O-]B([O-])[O-] BIKXLKXABVUSMH-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N vinyl methyl ketone Natural products CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/42—Introducing metal atoms or metal-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Silicon Polymers (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/534,354 US4526930A (en) | 1983-09-23 | 1983-09-23 | Production of water-curable, silane modified thermoplastic polymers |
| US534,354 | 1983-09-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1232394A true CA1232394A (en) | 1988-02-02 |
Family
ID=24129685
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000462712A Expired CA1232394A (en) | 1983-09-23 | 1984-09-07 | Production of water-curable, silane modified thermoplastic polymers |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4526930A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0135923B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS6088052A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE46521T1 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1232394A (cg-RX-API-DMAC7.html) |
| DE (1) | DE3479807D1 (cg-RX-API-DMAC7.html) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4598116A (en) * | 1984-11-09 | 1986-07-01 | Union Carbide Corporation | Scorch resistant compositions based on water-curable thermoplastic polymers having hydrolyzable, pendant silane moieties, and organo titanates |
| US4707520A (en) * | 1985-08-21 | 1987-11-17 | Union Carbide Corporation | Composition based on water-curable thermoplastic polymers and metal carboxylate silanol condensation catalysts |
| US4721747A (en) * | 1985-09-04 | 1988-01-26 | The Sherwin-Williams Company | High solid coatings containing titanates and silanes |
| US4792580A (en) * | 1985-09-04 | 1988-12-20 | The Sherwin-Williams Company | High solid coatings containing titanates and silanes |
| JPH066628B2 (ja) * | 1985-10-07 | 1994-01-26 | 財団法人相模中央化学研究所 | ポリ二置換アセチレン/ポリオルガノシロキサングラフト共重合体 |
| DE3863425D1 (de) * | 1987-02-24 | 1991-08-01 | Astro Valcour Inc | Formbare, silanvernetzte polyolefin-schaumteilchen. |
| US4870111A (en) * | 1987-02-24 | 1989-09-26 | Astro-Valcour, Incorporated | Moldable silane-crosslinked polyolefin foam beads |
| US5026736A (en) * | 1987-02-24 | 1991-06-25 | Astro-Valcour, Inc. | Moldable shrunken thermoplastic polymer foam beads |
| US4702868A (en) * | 1987-02-24 | 1987-10-27 | Valcour Incorporated | Moldable silane-crosslinked polyolefin foam beads |
| US5096942A (en) * | 1990-05-29 | 1992-03-17 | Eastman Kodak Company | Organic/inorganic composites |
| US5331049A (en) * | 1990-06-22 | 1994-07-19 | Exxon Chemical Patents Inc. | Water-curable, hot melt adhesive composition |
| FR2668159B1 (fr) * | 1990-10-19 | 1993-01-22 | Inst Francais Du Petrole | Compositions reticulables a base de polyethylene et les materiaux qui en derivent. |
| US5338609A (en) * | 1991-10-30 | 1994-08-16 | Quantum Chemical Corporation | Fractional melt flow rate polymer powders and process for their preparation |
| US5932659A (en) | 1994-09-19 | 1999-08-03 | Sentinel Products Corp. | Polymer blend |
| JP4057657B2 (ja) * | 1994-09-19 | 2008-03-05 | センチネル・プロダクツ・コープ | 線状ポリオレフィンの架橋フォーム構造及びその製造方法 |
| US5929129A (en) * | 1994-09-19 | 1999-07-27 | Sentinel Products Corp. | Crosslinked foamable compositions of silane-grafted, essentially linear polyolefins blended with polypropylene |
| US5883144A (en) | 1994-09-19 | 1999-03-16 | Sentinel Products Corp. | Silane-grafted materials for solid and foam applications |
| US6369139B1 (en) | 1995-04-12 | 2002-04-09 | Crompton Corporation | Compositions of epoxysilane emulsion additives in waterbased reactive polymer dispersions and methods of preparation |
| US6127462A (en) * | 1995-04-12 | 2000-10-03 | Osi Specialities, Inc. | Compositions of epoxysilane and reactive polymer with cure catalyst and methods of preparation |
| US5621038A (en) * | 1995-05-26 | 1997-04-15 | Osi Specialties, Inc. | Aqueous silylated polymer curable compositions |
| US5686523A (en) * | 1995-05-26 | 1997-11-11 | Osi Specialties, Inc. | Aqueous curable silane/polymer compositions |
| US6069200A (en) * | 1995-05-26 | 2000-05-30 | Ck Witco Corporation | Aqueous silylated polymer curable compositions |
| US5827922A (en) * | 1995-05-26 | 1998-10-27 | Osi Specialties, Inc. | Aqueous silylated polymer curable compositions with tin catalysts |
| US5844009A (en) * | 1996-04-26 | 1998-12-01 | Sentinel Products Corp. | Cross-linked low-density polymer foam |
| CA2203595A1 (en) | 1996-04-26 | 1997-10-26 | Robert F. Hurley | Cross-linked polyolefin tape |
| US5882776A (en) | 1996-07-09 | 1999-03-16 | Sentinel Products Corp. | Laminated foam structures with enhanced properties |
| US5876813A (en) | 1996-07-09 | 1999-03-02 | Senitnel Products Corp | Laminated foam structures with enhanced properties |
| US5938878A (en) | 1996-08-16 | 1999-08-17 | Sentinel Products Corp. | Polymer structures with enhanced properties |
| CA2190050A1 (en) * | 1996-11-12 | 1998-05-12 | G. Ronald Brown | Moisture cross-linking of vinyl chloride homopolymers and copolymers |
| US6541566B1 (en) | 1998-10-05 | 2003-04-01 | National Starch And Chemical Investment Holding Corporation | Pressure sensitive adhesive compositions prepared with a sterically hindered alkoxylated silane |
| US6710123B1 (en) | 1999-11-12 | 2004-03-23 | Atofina Chemicals, Inc. | Fluoropolymers containing organo-silanes and methods of making the same |
| US6967261B1 (en) | 2001-12-28 | 2005-11-22 | Kimberly-Clark Worldwide | Bandage, methods of producing and using same |
| US6833414B2 (en) | 2002-02-12 | 2004-12-21 | Arkema Inc. | Cross-linkable aqueous fluoropolymer based dispersions containing silanes |
| BRPI0312595B8 (pt) | 2002-07-26 | 2021-06-22 | Kimberly Clark Co | composição aglutinante absorvente, método de fabricação da composição aglutinante e combinação de um revestimento de aglutinante absorvente e um substrato |
| US6737491B2 (en) | 2002-07-26 | 2004-05-18 | Kimberly-Clark Worldwide, Inc. | Absorbent binder composition and method of making same |
| US6822135B2 (en) * | 2002-07-26 | 2004-11-23 | Kimberly-Clark Worldwide, Inc. | Fluid storage material including particles secured with a crosslinkable binder composition and method of making same |
| US6808801B2 (en) | 2002-07-26 | 2004-10-26 | Kimberly-Clark Worldwide, Inc. | Absorbent article with self-forming absorbent binder layer |
| US7205259B2 (en) * | 2002-07-26 | 2007-04-17 | Kimberly-Clark Worldwide, Inc. | Absorbent binder desiccant composition and articles incorporating it |
| US7115321B2 (en) * | 2002-07-26 | 2006-10-03 | Kimberly-Clark Worldwide, Inc. | Absorbent binder coating |
| US6964803B2 (en) | 2002-07-26 | 2005-11-15 | Kimberly-Clark Worldwide, Inc. | Absorbent structures with selectively placed flexible absorbent binder |
| US6887961B2 (en) * | 2002-07-26 | 2005-05-03 | Kimberly-Clark Worldwide, Inc. | Absorbent binder composition and method of making it |
| US20040096626A1 (en) * | 2002-11-14 | 2004-05-20 | Epoli-Espumas De Polietileno Sa | Layered structures with enhanced properties |
| US7378566B2 (en) * | 2002-12-13 | 2008-05-27 | Kimberly-Clark Worldwide, Inc. | Absorbent core including folded substrate |
| US7294591B2 (en) * | 2002-12-13 | 2007-11-13 | Kimberly-Clark Worldwide, Inc. | Absorbent composite including a folded substrate and an absorbent adhesive composition |
| US20050186427A1 (en) * | 2004-02-19 | 2005-08-25 | The Procter & Gamble Company | Lubricious coated applicator |
| DE102005000823A1 (de) * | 2005-01-05 | 2006-07-13 | Consortium für elektrochemische Industrie GmbH | Vernetzbare, silanmodifizierte Mischpolymerisate |
| US20070083175A1 (en) * | 2005-10-11 | 2007-04-12 | Kimberly-Clark Worldwide, Inc. | Transparent/translucent absorbent composites and articles |
| US7335713B2 (en) | 2005-12-02 | 2008-02-26 | Stockhausen, Inc. | Method for preparing a flexible superabsorbent binder polymer composition |
| US20070129697A1 (en) * | 2005-12-02 | 2007-06-07 | Soerens Dave A | Articles comprising flexible superabsorbent binder polymer composition |
| US7312286B2 (en) * | 2005-12-02 | 2007-12-25 | Stockhausen, Inc. | Flexible superabsorbent binder polymer composition |
| US7619131B2 (en) * | 2005-12-02 | 2009-11-17 | Kimberly-Clark Worldwide, Inc. | Articles comprising transparent/translucent polymer composition |
| DE102007000833A1 (de) | 2007-10-08 | 2009-04-09 | Wacker Chemie Ag | Silan-substituierte RAFT-Reagenzien und Silan-vernetzbare Polymere |
| EP2641935A1 (de) * | 2012-03-19 | 2013-09-25 | Sika Technology AG | Zusammensetzung auf Basis von silanterminierten Polymeren |
| US10577440B2 (en) | 2013-03-13 | 2020-03-03 | Chevron Phillips Chemical Company Lp | Radically coupled resins and methods of making and using same |
| US10654948B2 (en) | 2013-03-13 | 2020-05-19 | Chevron Phillips Chemical Company Lp | Radically coupled resins and methods of making and using same |
| KR102591753B1 (ko) * | 2017-09-26 | 2023-10-23 | 다우 글로벌 테크놀로지스 엘엘씨 | 실란-관능화된 에틸렌성 중합체의 수분 경화를 위한 주석계 촉매 및 이산화티타늄을 포함하는 조성물 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE794718Q (fr) * | 1968-12-20 | 1973-05-16 | Dow Corning Ltd | Procede de reticulation d'olefines |
| US3697551A (en) * | 1968-12-31 | 1972-10-10 | Hercules Inc | Silane sulfonyl azides |
| US4328323A (en) * | 1979-08-29 | 1982-05-04 | Union Carbide Corporation | Production of silane modified copolymers of alkylene-alkyl acrylates |
| US4291136A (en) * | 1978-03-31 | 1981-09-22 | Union Carbide Corporation | Water-curable silane modified alkylene alkylacrylate copolymer and a process for its production |
| NZ190052A (en) * | 1978-03-31 | 1980-11-14 | Union Carbide Corp | Water-curable silane-modified alkylene alkylacrylate copolymers |
| US4321263A (en) * | 1980-09-30 | 1982-03-23 | Rowell Laboratories, Inc. | Psyllium compositions |
| US4369289A (en) * | 1980-09-30 | 1983-01-18 | Union Carbide Corporation | Masterbatch composition comprising a matrix having a polysiloxane dispersed therein and a method for the preparation thereof |
| JPS58187445A (ja) * | 1982-04-27 | 1983-11-01 | ユニオン・カ−バイド・コ−ポレ−シヨン | 水で硬化可能なシラン変性アルキレン−アルキルアクリレ−ト共重合体組成物 |
-
1983
- 1983-09-23 US US06/534,354 patent/US4526930A/en not_active Expired - Lifetime
-
1984
- 1984-09-07 CA CA000462712A patent/CA1232394A/en not_active Expired
- 1984-09-21 DE DE8484111308T patent/DE3479807D1/de not_active Expired
- 1984-09-21 EP EP84111308A patent/EP0135923B1/en not_active Expired
- 1984-09-21 JP JP59196984A patent/JPS6088052A/ja active Granted
- 1984-09-21 AT AT84111308T patent/ATE46521T1/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0144254B2 (cg-RX-API-DMAC7.html) | 1989-09-26 |
| US4526930A (en) | 1985-07-02 |
| EP0135923A3 (en) | 1986-07-30 |
| DE3479807D1 (en) | 1989-10-26 |
| EP0135923A2 (en) | 1985-04-03 |
| EP0135923B1 (en) | 1989-09-20 |
| JPS6088052A (ja) | 1985-05-17 |
| ATE46521T1 (de) | 1989-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1232394A (en) | Production of water-curable, silane modified thermoplastic polymers | |
| US4446279A (en) | Compositions based on a polysiloxane and an organo titanate and the use thereof in the preparation of water curable, silane modified alkylene-alkyl acrylate copolymers | |
| US4291136A (en) | Water-curable silane modified alkylene alkylacrylate copolymer and a process for its production | |
| US4593071A (en) | Water-curable, silane modified ethylene polymers | |
| CA1220888A (en) | Water-curable, silane modified chlorosulfonated olefinic polymers and a process for the preparation thereof | |
| US4753993A (en) | Compositions based on thermoplastic polymers and metal carboxylate silanol condensation catalysts | |
| US4524201A (en) | Reactive organo titanate catalysts | |
| US4579913A (en) | Composition of a relatively stable polymer of an olefinic monomer and an unsaturated silane, and an organo titanate | |
| US4415710A (en) | Curable compositions, based on alkylene-alkyl acrylate copolymers, containing preformed, reactive organo titanate catalysts | |
| EP0150773B1 (en) | Water curable, azide sulfonyl silane modified ethylene polymers | |
| EP0073027A2 (en) | Masterbatch composition comprising a matrix having a polysiloxane dispersed therein and a method for the preparation thereof | |
| US4408011A (en) | Polysiloxanes and the use thereof in the production of silane modified alkylene-alkyl acrylate copolymers | |
| EP0169069B1 (en) | Polymer composition | |
| CA1259150A (en) | Compositions based on water-curable thermoplastic polymers and metal carboxylate silanol condensation catalysts | |
| EP0004752B1 (en) | A water curable silane modified alkylene alkylacrylate copolymer, a process for its production and products made therefrom | |
| US4767820A (en) | Compositions of a relatively water-stable thermoplastic polymer and tetramethyl titanate dispersed in an alkylene-alkyl acrylate copolymer matrix | |
| JPS6226665B2 (cg-RX-API-DMAC7.html) | ||
| US4598116A (en) | Scorch resistant compositions based on water-curable thermoplastic polymers having hydrolyzable, pendant silane moieties, and organo titanates | |
| EP0295811B1 (en) | Crosslinkable polymers | |
| US4593072A (en) | Relatively water-stable compositions based on thermoplastic polymers containing pendant silane moieties | |
| US4514545A (en) | Water curable, azide sulfonyl silane modified, alkylene-alkyl acrylate copolymers | |
| JPS6218577B2 (cg-RX-API-DMAC7.html) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |