CA1231652A - Aqueous enzyme-containing compositions with improved stability - Google Patents
Aqueous enzyme-containing compositions with improved stabilityInfo
- Publication number
- CA1231652A CA1231652A CA000452693A CA452693A CA1231652A CA 1231652 A CA1231652 A CA 1231652A CA 000452693 A CA000452693 A CA 000452693A CA 452693 A CA452693 A CA 452693A CA 1231652 A CA1231652 A CA 1231652A
- Authority
- CA
- Canada
- Prior art keywords
- weight
- acid
- enzyme
- amount
- enzymes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 64
- 102000004190 Enzymes Human genes 0.000 title claims description 27
- 108090000790 Enzymes Proteins 0.000 title claims description 27
- 239000003599 detergent Substances 0.000 claims abstract description 23
- -1 boric acid or borax Chemical class 0.000 claims abstract description 22
- 239000007788 liquid Substances 0.000 claims abstract description 16
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 claims abstract description 14
- 150000003839 salts Chemical class 0.000 claims abstract description 12
- 229910021538 borax Inorganic materials 0.000 claims abstract description 7
- 230000002255 enzymatic effect Effects 0.000 claims abstract description 7
- 235000010265 sodium sulphite Nutrition 0.000 claims abstract description 7
- 239000004328 sodium tetraborate Substances 0.000 claims abstract description 7
- 235000010339 sodium tetraborate Nutrition 0.000 claims abstract description 7
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims abstract description 6
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000004327 boric acid Substances 0.000 claims abstract description 5
- 150000001639 boron compounds Chemical class 0.000 claims abstract description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 17
- 125000000129 anionic group Chemical group 0.000 claims description 7
- 150000001340 alkali metals Chemical class 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 5
- 230000001580 bacterial effect Effects 0.000 claims description 5
- 239000004615 ingredient Substances 0.000 claims description 5
- 239000000271 synthetic detergent Substances 0.000 claims description 5
- 229910011255 B2O3 Inorganic materials 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 239000000344 soap Substances 0.000 claims description 4
- 125000002091 cationic group Chemical group 0.000 claims description 3
- 239000005864 Sulphur Substances 0.000 claims description 2
- 230000003625 amylolytic effect Effects 0.000 claims description 2
- 230000002797 proteolythic effect Effects 0.000 claims description 2
- 230000000087 stabilizing effect Effects 0.000 claims 3
- HFVMEOPYDLEHBR-UHFFFAOYSA-N (2-fluorophenyl)-phenylmethanol Chemical compound C=1C=CC=C(F)C=1C(O)C1=CC=CC=C1 HFVMEOPYDLEHBR-UHFFFAOYSA-N 0.000 claims 1
- NAOLWIGVYRIGTP-UHFFFAOYSA-N 1,3,5-trihydroxyanthracene-9,10-dione Chemical compound C1=CC(O)=C2C(=O)C3=CC(O)=CC(O)=C3C(=O)C2=C1 NAOLWIGVYRIGTP-UHFFFAOYSA-N 0.000 claims 1
- 229920000388 Polyphosphate Polymers 0.000 claims 1
- 239000002280 amphoteric surfactant Substances 0.000 claims 1
- 239000003945 anionic surfactant Substances 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 239000003093 cationic surfactant Substances 0.000 claims 1
- 230000002538 fungal effect Effects 0.000 claims 1
- 150000002484 inorganic compounds Chemical class 0.000 claims 1
- 229910010272 inorganic material Inorganic materials 0.000 claims 1
- 239000002736 nonionic surfactant Substances 0.000 claims 1
- 239000001205 polyphosphate Substances 0.000 claims 1
- 235000011176 polyphosphates Nutrition 0.000 claims 1
- KZQSXALQTHVPDQ-UHFFFAOYSA-M sodium;butanedioate;hydron Chemical compound [Na+].OC(=O)CCC([O-])=O KZQSXALQTHVPDQ-UHFFFAOYSA-M 0.000 claims 1
- 239000002888 zwitterionic surfactant Substances 0.000 claims 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 abstract description 13
- 229920005862 polyol Polymers 0.000 abstract description 8
- 150000003077 polyols Chemical class 0.000 abstract description 8
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 abstract description 5
- 229940088598 enzyme Drugs 0.000 description 22
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 15
- 239000002253 acid Substances 0.000 description 15
- 230000000694 effects Effects 0.000 description 9
- 239000003381 stabilizer Substances 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- 102000035195 Peptidases Human genes 0.000 description 4
- 108091005804 Peptidases Proteins 0.000 description 4
- 241000208465 Proteaceae Species 0.000 description 4
- 239000004365 Protease Substances 0.000 description 4
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 4
- 229930006000 Sucrose Natural products 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 229920000180 alkyd Polymers 0.000 description 4
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- 235000019419 proteases Nutrition 0.000 description 4
- 239000001384 succinic acid Substances 0.000 description 4
- 239000005720 sucrose Substances 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 150000001991 dicarboxylic acids Chemical class 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- 102000013142 Amylases Human genes 0.000 description 2
- 108010065511 Amylases Proteins 0.000 description 2
- 241000194108 Bacillus licheniformis Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- 102000005158 Subtilisins Human genes 0.000 description 2
- 108010056079 Subtilisins Proteins 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 235000019418 amylase Nutrition 0.000 description 2
- 229940025131 amylases Drugs 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- VAGAHQGPIKRLLK-UHFFFAOYSA-N diplamine Chemical compound C1=NC(C(C(SC)=C2CCNC(C)=O)=O)=C3C2=NC2=CC=CC=C2C3=C1 VAGAHQGPIKRLLK-UHFFFAOYSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- ROBFUDYVXSDBQM-UHFFFAOYSA-N hydroxymalonic acid Chemical compound OC(=O)C(O)C(O)=O ROBFUDYVXSDBQM-UHFFFAOYSA-N 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical class CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 1
- OIYFAQRHWMVENL-UHFFFAOYSA-N 2-(4-oxopyran-3-yl)acetic acid Chemical compound OC(=O)CC1=COC=CC1=O OIYFAQRHWMVENL-UHFFFAOYSA-N 0.000 description 1
- 235000009434 Actinidia chinensis Nutrition 0.000 description 1
- 244000298697 Actinidia deliciosa Species 0.000 description 1
- 235000009436 Actinidia deliciosa Nutrition 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- 102000005575 Cellulases Human genes 0.000 description 1
- 108010084185 Cellulases Proteins 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- DSLZVSRJTYRBFB-LLEIAEIESA-N D-glucaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O DSLZVSRJTYRBFB-LLEIAEIESA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 208000001836 Firesetting Behavior Diseases 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 208000037062 Polyps Diseases 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 102000004139 alpha-Amylases Human genes 0.000 description 1
- 108090000637 alpha-Amylases Proteins 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000001461 cytolytic effect Effects 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 235000015114 espresso Nutrition 0.000 description 1
- MJEMIOXXNCZZFK-UHFFFAOYSA-N ethylone Chemical compound CCNC(C)C(=O)C1=CC=C2OCOC2=C1 MJEMIOXXNCZZFK-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 230000035807 sensation Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- ZDQYSKICYIVCPN-UHFFFAOYSA-L sodium succinate (anhydrous) Chemical compound [Na+].[Na+].[O-]C(=O)CCC([O-])=O ZDQYSKICYIVCPN-UHFFFAOYSA-L 0.000 description 1
- HFQQZARZPUDIFP-UHFFFAOYSA-M sodium;2-dodecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O HFQQZARZPUDIFP-UHFFFAOYSA-M 0.000 description 1
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 238000005494 tarnishing Methods 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 230000003442 weekly effect Effects 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38663—Stabilised liquid enzyme compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Enzymes And Modification Thereof (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8311314 | 1983-04-26 | ||
| GB838311314A GB8311314D0 (en) | 1983-04-26 | 1983-04-26 | Aqueous enzyme-containing compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1231652A true CA1231652A (en) | 1988-01-19 |
Family
ID=10541698
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000452693A Expired CA1231652A (en) | 1983-04-26 | 1984-04-25 | Aqueous enzyme-containing compositions with improved stability |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4532064A (enFirst) |
| EP (1) | EP0126505B1 (enFirst) |
| JP (1) | JPS59217799A (enFirst) |
| AT (1) | ATE24740T1 (enFirst) |
| AU (1) | AU555127B2 (enFirst) |
| BR (1) | BR8401898A (enFirst) |
| CA (1) | CA1231652A (enFirst) |
| DE (1) | DE3461936D1 (enFirst) |
| DK (1) | DK207484A (enFirst) |
| GB (1) | GB8311314D0 (enFirst) |
| GR (1) | GR80000B (enFirst) |
| NO (1) | NO158427C (enFirst) |
| NZ (1) | NZ207918A (enFirst) |
| PT (1) | PT78474B (enFirst) |
| ZA (1) | ZA843057B (enFirst) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4529525A (en) * | 1982-08-30 | 1985-07-16 | Colgate-Palmolive Co. | Stabilized enzyme-containing detergent compositions |
| US4537707A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid and formate to stabilize enzymes |
| US4537706A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid to stabilize enzymes |
| GR851574B (enFirst) * | 1984-06-28 | 1985-11-25 | Procter & Gamble | |
| JPS61266671A (ja) * | 1985-05-14 | 1986-11-26 | 三菱鉱業セメント株式会社 | 曇り防止用テイツシユ |
| NZ216792A (en) * | 1985-07-26 | 1989-04-26 | Colgate Palmolive Co | Stabilised,fabric-softening built detergent compositions containing enzymes and swelling bentonite clay |
| US4900475A (en) * | 1985-07-26 | 1990-02-13 | Colgate-Palmolive Co. | Stabilized built liquid detergent composition containing enzyme |
| ZA865095B (en) * | 1985-07-26 | 1988-02-24 | Colgate Palmolive Co | Fabric softening liquid detergent |
| US4842769A (en) * | 1985-07-26 | 1989-06-27 | Colgate-Palmolive Co. | Stabilized fabric softening built detergent composition containing enzymes |
| NZ216791A (en) * | 1985-07-26 | 1988-07-28 | Colgate Palmolive Co | Stabilised, built, enzyme-containing liquid detergents |
| US4797225A (en) * | 1986-09-08 | 1989-01-10 | Colgate-Palmolive Company | Nonaqueous liquid nonionic laundry detergent composition containing an alkali metal dithionite or sulfite reduction bleaching agent and method of use |
| US4935158A (en) * | 1986-10-30 | 1990-06-19 | Aszman Harry W | Solid detergent cleaning composition, reusable cleaning pad containing same and method of manufacture |
| US4842758A (en) * | 1986-10-31 | 1989-06-27 | Colgate-Palmolive Company | Stabilized enzyme system for use in aqueous liquid built detergent compositions |
| US4759865A (en) * | 1986-11-06 | 1988-07-26 | Colgate-Palmolive Company | Pasty acid detergent composition |
| GB2200132B (en) * | 1986-12-15 | 1991-09-18 | Colgate Palmolive Co | Stabilised enzyme systems and compositions containing them |
| US4800037A (en) * | 1987-06-05 | 1989-01-24 | Lever Brothers Company | Process for making a heavy duty liquid detergent composition |
| PT89702B (pt) | 1988-02-11 | 1994-04-29 | Gist Brocades Nv | Processo para a preparacao de novos enzimas proteoliticos e de detergentes que os contem |
| US6287841B1 (en) | 1988-02-11 | 2001-09-11 | Genencor International, Inc. | High alkaline serine protease |
| AU3667189A (en) * | 1988-06-23 | 1990-01-04 | Unilever Plc | Enzyme-containing liquid detergents |
| US5156761A (en) * | 1988-07-20 | 1992-10-20 | Dorrit Aaslyng | Method of stabilizing an enzymatic liquid detergent composition |
| GB8900496D0 (en) * | 1989-01-10 | 1989-03-08 | Procter & Gamble | Liquid detergent composition containing enzyme and enzyme stabilization system |
| US5275753A (en) * | 1989-01-10 | 1994-01-04 | The Procter & Gamble Company | Stabilized alkaline liquid detergent compositions containing enzyme and peroxygen bleach |
| US4959179A (en) * | 1989-01-30 | 1990-09-25 | Lever Brothers Company | Stabilized enzymes liquid detergent composition containing lipase and protease |
| US5089163A (en) * | 1989-01-30 | 1992-02-18 | Lever Brothers Company, Division Of Conopco, Inc. | Enzymatic liquid detergent composition |
| JPH0344036U (enFirst) * | 1989-09-09 | 1991-04-24 | ||
| ES2095240T3 (es) * | 1989-11-30 | 1997-02-16 | Clorox Co | Detergente oxidante acuoso liquido estable. |
| US5221495A (en) * | 1990-04-13 | 1993-06-22 | Colgate-Palmolive Company | Enzyme stabilizing composition and stabilized enzyme containing built detergent compositions |
| US5364553A (en) * | 1990-04-13 | 1994-11-15 | Colgate-Palmolive Company | Stabilized built aqueous liquid softergent compositions |
| JPH06507198A (ja) * | 1991-04-30 | 1994-08-11 | ザ、プロクター、エンド、ギャンブル、カンパニー | アリールボロン酸を含有する液体洗浄剤 |
| PL170474B1 (pl) * | 1991-04-30 | 1996-12-31 | Procter & Gamble | C iekla kom pozycja detergentow a PL PL PL |
| US5442100A (en) * | 1992-08-14 | 1995-08-15 | The Procter & Gamble Company | β-aminoalkyl and β-N-peptidylaminoalkyl boronic acids |
| JP3839470B2 (ja) * | 1993-06-21 | 2006-11-01 | ロシュ ダイアグノスティックス コーポレーション | 診断用試薬安定剤 |
| US5672213A (en) * | 1995-08-18 | 1997-09-30 | Alcon Laboratories, Inc. | Liquid enzyme compositions containing aromatic acid derivatives |
| US6342381B1 (en) | 1998-02-27 | 2002-01-29 | Buckman Laboratories Internationals, Inc. | Enzyme stabilization with pre-superpolyamide or pre-fiber-forming polyamide oligomers |
| TR200101716T2 (tr) * | 1998-12-16 | 2002-05-21 | Uvilever N.V. | Saydam şişelerin içinde bulunan ve antioksidan ihtiva eden şeffaf/yarı şeffaf sıvı enzim bileşimleri. |
| ATE278755T1 (de) * | 1999-09-02 | 2004-10-15 | Colgate Palmolive Co | Zusammensetzungen zur textilpflege enthaltend polymere polycarboxylate und harnstoff-derivate |
| US6537958B1 (en) | 1999-11-10 | 2003-03-25 | The Procter & Gamble Company | Bleaching compositions |
| ATE254166T1 (de) | 2000-06-15 | 2003-11-15 | Unilever Nv | Konzentriertes flüssiges reinigungsmittel |
| US6546583B1 (en) | 2000-07-11 | 2003-04-15 | Bamed Ag | Toothbrush |
| US7153818B2 (en) | 2000-07-28 | 2006-12-26 | Henkel Kgaa | Amylolytic enzyme extracted from bacillus sp. A 7-7 (DSM 12368) and washing and cleaning agents containing this novel amylolytic enzyme |
| DE10153792A1 (de) | 2001-10-31 | 2003-05-22 | Henkel Kgaa | Neue Alkalische Protease-Varianten und Wasch- und Reinigungsmittel enthaltend diese neuen Alkalischen Protease-Varianten |
| DE10162727A1 (de) | 2001-12-20 | 2003-07-10 | Henkel Kgaa | Neue Alkalische Protease aus Bacillus gibsonii (DSM 14391) und Wasch-und Reinigungsmittel enthaltend diese neue Alkalische Protease |
| DE10162728A1 (de) | 2001-12-20 | 2003-07-10 | Henkel Kgaa | Neue Alkalische Protease aus Bacillus gibsonii (DSM 14393) und Wasch-und Reinigungsmittel enthaltend diese neue Alkalische Protease |
| DE10163884A1 (de) | 2001-12-22 | 2003-07-10 | Henkel Kgaa | Neue Alkalische Protease aus Bacillus sp. (DSM 14392) und Wasch- und Reinigungsmittel enthaltend diese neue Alkalische Protease |
| DE10257387A1 (de) | 2002-12-06 | 2004-06-24 | Henkel Kgaa | Mehrkomponenten-Flüssigwaschmittel |
| US7448556B2 (en) | 2002-08-16 | 2008-11-11 | Henkel Kgaa | Dispenser bottle for at least two active fluids |
| US7332315B2 (en) * | 2005-08-17 | 2008-02-19 | Colgate-Palmolive Company | Method to remove bisulfite by-products from enzyme compositions |
| JP4871672B2 (ja) * | 2006-08-03 | 2012-02-08 | 花王株式会社 | 粉末洗剤用増強剤 |
| EP2242831B2 (en) * | 2008-01-04 | 2023-05-17 | The Procter & Gamble Company | A laundry detergent composition comprising glycosyl hydrolase |
| CN102472757B (zh) * | 2009-07-15 | 2014-12-17 | 松下健康医疗器械株式会社 | 分析用试剂 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3634266A (en) * | 1969-07-23 | 1972-01-11 | Procter & Gamble | Liquid detergent compositions containing amylolytic enzymes |
| CH540335A (de) * | 1970-09-28 | 1973-08-15 | Kronwitter & Co | Flüssiges biologisches Wasch-, Reinigungs- und Geschirrspülmittel |
| FI61715C (fi) * | 1976-11-01 | 1982-09-10 | Unilever Nv | Enzymer innehaollande stabiliserad flytande detergentkomposition |
| US4238345A (en) * | 1978-05-22 | 1980-12-09 | Economics Laboratory, Inc. | Stabilized liquid enzyme-containing detergent compositions |
| US4243546A (en) * | 1979-03-23 | 1981-01-06 | The Drackett Company | Stable aqueous compositions containing enzymes |
| US4243543A (en) * | 1979-05-11 | 1981-01-06 | Economics Laboratory, Inc. | Stabilized liquid enzyme-containing detergent compositions |
| US4261868A (en) * | 1979-08-08 | 1981-04-14 | Lever Brothers Company | Stabilized enzymatic liquid detergent composition containing a polyalkanolamine and a boron compound |
| IT1129814B (it) * | 1980-07-02 | 1986-06-11 | Unilever Nv | Composizione detergente enzimatica liquida |
| EP0080748B1 (en) * | 1981-11-13 | 1985-07-10 | Unilever N.V. | Enzymatic liquid cleaning composition |
| US4462922A (en) * | 1981-11-19 | 1984-07-31 | Lever Brothers Company | Enzymatic liquid detergent composition |
| US4529525A (en) * | 1982-08-30 | 1985-07-16 | Colgate-Palmolive Co. | Stabilized enzyme-containing detergent compositions |
-
1983
- 1983-04-26 GB GB838311314A patent/GB8311314D0/en active Pending
-
1984
- 1984-04-09 US US06/597,942 patent/US4532064A/en not_active Expired - Lifetime
- 1984-04-19 AU AU27080/84A patent/AU555127B2/en not_active Ceased
- 1984-04-19 NZ NZ207918A patent/NZ207918A/en unknown
- 1984-04-24 BR BR8401898A patent/BR8401898A/pt not_active IP Right Cessation
- 1984-04-24 PT PT78474A patent/PT78474B/pt unknown
- 1984-04-25 EP EP84200584A patent/EP0126505B1/en not_active Expired
- 1984-04-25 ZA ZA843057A patent/ZA843057B/xx unknown
- 1984-04-25 JP JP59083619A patent/JPS59217799A/ja active Granted
- 1984-04-25 GR GR74501A patent/GR80000B/el unknown
- 1984-04-25 DK DK207484A patent/DK207484A/da not_active Application Discontinuation
- 1984-04-25 NO NO841629A patent/NO158427C/no not_active IP Right Cessation
- 1984-04-25 DE DE8484200584T patent/DE3461936D1/de not_active Expired
- 1984-04-25 AT AT84200584T patent/ATE24740T1/de not_active IP Right Cessation
- 1984-04-25 CA CA000452693A patent/CA1231652A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB8311314D0 (en) | 1983-06-02 |
| DK207484A (da) | 1984-10-27 |
| DK207484D0 (da) | 1984-04-25 |
| AU2708084A (en) | 1984-11-01 |
| NO158427C (no) | 1988-09-14 |
| AU555127B2 (en) | 1986-09-11 |
| NZ207918A (en) | 1986-06-11 |
| DE3461936D1 (en) | 1987-02-12 |
| NO841629L (no) | 1984-10-29 |
| GR80000B (enFirst) | 1984-10-31 |
| US4532064A (en) | 1985-07-30 |
| EP0126505B1 (en) | 1987-01-07 |
| NO158427B (no) | 1988-05-30 |
| PT78474B (en) | 1986-08-28 |
| EP0126505A1 (en) | 1984-11-28 |
| ATE24740T1 (de) | 1987-01-15 |
| JPS6125757B2 (enFirst) | 1986-06-17 |
| BR8401898A (pt) | 1984-12-04 |
| PT78474A (en) | 1984-05-01 |
| ZA843057B (en) | 1985-11-27 |
| JPS59217799A (ja) | 1984-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1231652A (en) | Aqueous enzyme-containing compositions with improved stability | |
| EP0080223B1 (en) | Enzymatic liquid detergent composition | |
| CA1179955A (en) | Enzymatic liquid cleaning composition | |
| CA1163218A (en) | Liquid enzymatic detergent composition | |
| EP0139329B1 (en) | Dishwashing compositions | |
| US4261868A (en) | Stabilized enzymatic liquid detergent composition containing a polyalkanolamine and a boron compound | |
| FI61715C (fi) | Enzymer innehaollande stabiliserad flytande detergentkomposition | |
| US5039446A (en) | Liquid detergent with stabilized enzyme | |
| US5089163A (en) | Enzymatic liquid detergent composition | |
| AU616781B2 (en) | Enzymatic dishwashing and rinsing composition | |
| PT791046E (pt) | Composicoes detergentes contendo lipase e protease | |
| EP0348183A2 (en) | Enzyme-containing liquid detergents | |
| CA1092037A (en) | Enzymatic liquid detergent composition | |
| US5501820A (en) | Aqueous enzymatic detergent compositions | |
| MXPA98000746A (en) | Compositions detergents with enzyme amilasa paralimpieza de telas percudi | |
| ES2309071T3 (es) | Composiciones para el lavado de ropa. | |
| DE10023580A1 (de) | Verhinderung von Textilschäden beim Waschen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |