CA1228042A - Aqueous compositions containing stabilized enzymes - Google Patents
Aqueous compositions containing stabilized enzymesInfo
- Publication number
- CA1228042A CA1228042A CA000464809A CA464809A CA1228042A CA 1228042 A CA1228042 A CA 1228042A CA 000464809 A CA000464809 A CA 000464809A CA 464809 A CA464809 A CA 464809A CA 1228042 A CA1228042 A CA 1228042A
- Authority
- CA
- Canada
- Prior art keywords
- composition
- weight
- enzyme
- ester
- cent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 102000004190 Enzymes Human genes 0.000 title claims abstract description 60
- 108090000790 Enzymes Proteins 0.000 title claims abstract description 60
- 239000000203 mixture Substances 0.000 title claims description 67
- 150000002148 esters Chemical class 0.000 claims abstract description 18
- 238000002360 preparation method Methods 0.000 claims abstract description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 5
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 229940088598 enzyme Drugs 0.000 claims description 58
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 18
- 108091005804 Peptidases Proteins 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 239000004365 Protease Substances 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 102000035195 Peptidases Human genes 0.000 claims description 11
- 230000000694 effects Effects 0.000 claims description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical group CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 9
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 claims description 7
- 239000004094 surface-active agent Substances 0.000 claims description 7
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical group [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 6
- 108090000637 alpha-Amylases Proteins 0.000 claims description 6
- 102000004139 alpha-Amylases Human genes 0.000 claims description 6
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 125000000129 anionic group Chemical group 0.000 claims description 5
- 239000000969 carrier Substances 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 4
- 235000011152 sodium sulphate Nutrition 0.000 claims description 4
- 229940072049 amyl acetate Drugs 0.000 claims description 3
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 claims description 3
- 239000003945 anionic surfactant Substances 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 239000007859 condensation product Substances 0.000 claims description 3
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical class CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 claims description 3
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 claims description 3
- 239000011780 sodium chloride Substances 0.000 claims description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 3
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 claims description 2
- JGFBQFKZKSSODQ-UHFFFAOYSA-N Isothiocyanatocyclopropane Chemical compound S=C=NC1CC1 JGFBQFKZKSSODQ-UHFFFAOYSA-N 0.000 claims description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 claims description 2
- PWLNAUNEAKQYLH-UHFFFAOYSA-N butyric acid octyl ester Natural products CCCCCCCCOC(=O)CCC PWLNAUNEAKQYLH-UHFFFAOYSA-N 0.000 claims description 2
- 150000002191 fatty alcohols Chemical class 0.000 claims description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 claims description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 claims description 2
- UUIQMZJEGPQKFD-UHFFFAOYSA-N n-butyric acid methyl ester Natural products CCCC(=O)OC UUIQMZJEGPQKFD-UHFFFAOYSA-N 0.000 claims description 2
- 230000003381 solubilizing effect Effects 0.000 claims description 2
- 239000002736 nonionic surfactant Substances 0.000 claims 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical group [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims 2
- 239000000306 component Substances 0.000 claims 2
- 239000003209 petroleum derivative Substances 0.000 claims 2
- 235000017281 sodium acetate Nutrition 0.000 claims 2
- 239000001632 sodium acetate Substances 0.000 claims 2
- 244000063299 Bacillus subtilis Species 0.000 claims 1
- 235000014469 Bacillus subtilis Nutrition 0.000 claims 1
- DIQMPQMYFZXDAX-UHFFFAOYSA-N Pentyl formate Chemical compound CCCCCOC=O DIQMPQMYFZXDAX-UHFFFAOYSA-N 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 150000003863 ammonium salts Chemical class 0.000 claims 1
- 229940048842 sodium xylenesulfonate Drugs 0.000 claims 1
- QUCDWLYKDRVKMI-UHFFFAOYSA-M sodium;3,4-dimethylbenzenesulfonate Chemical group [Na+].CC1=CC=C(S([O-])(=O)=O)C=C1C QUCDWLYKDRVKMI-UHFFFAOYSA-M 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 abstract description 5
- 239000003599 detergent Substances 0.000 description 10
- 235000019441 ethanol Nutrition 0.000 description 10
- -1 alkoxy alcohol Chemical compound 0.000 description 9
- 235000019419 proteases Nutrition 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- 230000002797 proteolythic effect Effects 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 235000002639 sodium chloride Nutrition 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- 108010056079 Subtilisins Proteins 0.000 description 3
- 102000005158 Subtilisins Human genes 0.000 description 3
- 230000003625 amylolytic effect Effects 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 230000002255 enzymatic effect Effects 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 108010020132 microbial serine proteinases Proteins 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 229940024171 alpha-amylase Drugs 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 229940076134 benzene Drugs 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 230000009849 deactivation Effects 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 108010003855 mesentericopeptidase Proteins 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- HUSXNIFVQFHSEA-UHFFFAOYSA-N 2-hydroxypropanoic acid;hydrochloride Chemical class Cl.CC(O)C(O)=O HUSXNIFVQFHSEA-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- 108091005658 Basic proteases Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- MQJKPEGWNLWLTK-UHFFFAOYSA-N Dapsone Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 MQJKPEGWNLWLTK-UHFFFAOYSA-N 0.000 description 1
- 241001459693 Dipterocarpus zeylanicus Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 101100049053 Mus musculus Vash1 gene Proteins 0.000 description 1
- 108091005507 Neutral proteases Proteins 0.000 description 1
- 241000219492 Quercus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- UATJOMSPNYCXIX-UHFFFAOYSA-N Trinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 UATJOMSPNYCXIX-UHFFFAOYSA-N 0.000 description 1
- ZZXDRXVIRVJQBT-UHFFFAOYSA-M Xylenesulfonate Chemical compound CC1=CC=CC(S([O-])(=O)=O)=C1C ZZXDRXVIRVJQBT-UHFFFAOYSA-M 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005233 alkylalcohol group Chemical group 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 235000001465 calcium Nutrition 0.000 description 1
- 229960005069 calcium Drugs 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 239000004464 cereal grain Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 229940079919 digestives enzyme preparation Drugs 0.000 description 1
- 229960004756 ethanol Drugs 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 235000013882 gravy Nutrition 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004900 laundering Methods 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical class [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229960002668 sodium chloride Drugs 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- CMPGARWFYBADJI-UHFFFAOYSA-L tungstic acid Chemical compound O[W](O)(=O)=O CMPGARWFYBADJI-UHFFFAOYSA-L 0.000 description 1
- 229940071104 xylenesulfonate Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38663—Stabilised liquid enzyme compositions
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S435/00—Chemistry: molecular biology and microbiology
- Y10S435/8215—Microorganisms
- Y10S435/822—Microorganisms using bacteria or actinomycetales
- Y10S435/832—Bacillus
- Y10S435/839—Bacillus subtilis
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Enzymes And Modification Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/539,515 US4548727A (en) | 1983-10-06 | 1983-10-06 | Aqueous compositions containing stabilized enzymes |
| US539,515 | 1983-10-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1228042A true CA1228042A (en) | 1987-10-13 |
Family
ID=24151551
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000464809A Expired CA1228042A (en) | 1983-10-06 | 1984-10-05 | Aqueous compositions containing stabilized enzymes |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4548727A (enExample) |
| JP (1) | JPS6098983A (enExample) |
| AU (1) | AU564203B2 (enExample) |
| BR (1) | BR8405022A (enExample) |
| CA (1) | CA1228042A (enExample) |
| DE (1) | DE3436678A1 (enExample) |
| FR (1) | FR2555604B1 (enExample) |
| GB (1) | GB2147607B (enExample) |
| IE (1) | IE58303B1 (enExample) |
| IT (1) | IT1178011B (enExample) |
| NZ (1) | NZ209731A (enExample) |
| SE (1) | SE462917B (enExample) |
| ZA (1) | ZA847370B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5571446A (en) * | 1995-07-27 | 1996-11-05 | Diversey Corporation | Anionic stabilized enzyme based clean-in-place system |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1263944A (en) * | 1984-09-12 | 1989-12-19 | Barbara H. Munk | Pre-wash compositions containing enzymes |
| EP0385526A3 (en) * | 1989-02-27 | 1991-09-11 | Unilever N.V. | Enzymatic liquid detergent composition |
| US5254283A (en) * | 1991-01-17 | 1993-10-19 | Genencor International, Inc. | Isophthalic polymer coated particles |
| US5531927A (en) * | 1992-03-20 | 1996-07-02 | Bio-Safe Specialty Products, Inc. | Stain removing compositions and methods of using the same |
| US5356800A (en) * | 1992-11-30 | 1994-10-18 | Buckman Laboratories International, Inc. | Stabilized liquid enzymatic compositions |
| CA2120375A1 (en) * | 1993-04-02 | 1994-10-03 | John Klier | A laundry pretreater having enhanced oily soil removal |
| CN1064074C (zh) * | 1993-12-03 | 2001-04-04 | 巴科曼实验室国际公司 | 用嵌段共聚物促使酶稳定 |
| US5474701A (en) * | 1994-01-21 | 1995-12-12 | Buckman Laboratories International, Inc. | Enzymes for recreational water |
| US5565135A (en) * | 1995-01-24 | 1996-10-15 | The Procter & Gamble Company | Highly aqueous, cost effective liquid detergent compositions |
| CA2181125A1 (en) * | 1995-07-14 | 1997-01-15 | Gladys S. Gabriel | Stabilization of enzymes in laundry detergent compositions |
| US6342381B1 (en) | 1998-02-27 | 2002-01-29 | Buckman Laboratories Internationals, Inc. | Enzyme stabilization with pre-superpolyamide or pre-fiber-forming polyamide oligomers |
| GB9914622D0 (en) * | 1999-06-23 | 1999-08-25 | Reckitt & Colman Inc | Improvements in or relating to organic compositions |
| US7153818B2 (en) * | 2000-07-28 | 2006-12-26 | Henkel Kgaa | Amylolytic enzyme extracted from bacillus sp. A 7-7 (DSM 12368) and washing and cleaning agents containing this novel amylolytic enzyme |
| US6881711B1 (en) | 2001-10-26 | 2005-04-19 | Prestone Products Corporation | Low VOC cleaning compositions for hard surfaces |
| WO2005059076A1 (en) * | 2003-12-15 | 2005-06-30 | The Procter & Gamble Company | Compositions for removing cooked-, baked- and burnt-on soils |
| EP2403620B1 (en) * | 2008-10-16 | 2016-04-06 | Scientek LLC | Method and apparatus for producing alcohol or sugar using a commercial-scale bioreactor |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3023168A (en) * | 1958-11-25 | 1962-02-27 | Atlantic Refining Co | Heavy duty liquid detergent |
| US3296094A (en) * | 1966-05-05 | 1967-01-03 | Baxter Laboratories Inc | Stabilized aqueous enzyme solutions |
| US3557002A (en) * | 1967-11-15 | 1971-01-19 | Procter & Gamble | Stabilized aqueous enzyme preparation |
| US3532599A (en) * | 1968-10-23 | 1970-10-06 | Isadore Nathan Cooperman | Process for cleaning with enzymes |
| US3575864A (en) * | 1969-04-17 | 1971-04-20 | Irving Innerfield | Stabilized protease of bacterial origin and method of stabilizing such protease |
| US3600318A (en) * | 1969-06-02 | 1971-08-17 | Procter & Gamble | Enzyme-containing detergent compositions for neutral washing |
| BE759360A (enExample) * | 1969-11-25 | 1971-05-24 | Procter & Gamble Europ | |
| US3844951A (en) * | 1970-01-14 | 1974-10-29 | Henkel & Cie Gmbh | Detergent compositions containing a textile softener |
| US3682842A (en) * | 1970-05-04 | 1972-08-08 | Irving Innerfield | Stabilized enzymic compositions containing protease and alpha amylase of bacterial origin and method of stabilizing such compositions |
| US3746649A (en) * | 1971-10-01 | 1973-07-17 | J Barrett | Stable liquid enzyme product |
| US4169817A (en) * | 1971-12-23 | 1979-10-02 | Midwest Biochemical Corporation | Liquid cleaning composition containing stabilized enzymes |
| BE794713A (fr) * | 1972-01-31 | 1973-07-30 | Procter & Gamble | Compositions detergentes liquides |
| US3974082A (en) * | 1972-08-21 | 1976-08-10 | Colgate-Palmolive Company | Bleaching compositions |
| JPS5014651A (enExample) * | 1973-06-15 | 1975-02-15 | ||
| US4021377A (en) * | 1973-09-11 | 1977-05-03 | Miles Laboratories, Inc. | Liquid detergent composition |
| US3953353A (en) * | 1974-11-08 | 1976-04-27 | Purex Corporation | Laundering pre-spotter and method of production |
| IT1106254B (it) * | 1976-03-08 | 1985-11-11 | Procter & Gamble Europ | Composizione detergente liquida contenente enzimi |
| DE2633601A1 (de) * | 1976-07-27 | 1978-02-02 | Henkel Kgaa | Fluessiges, als wasch- und reinigungsmittel verwendbares, enzymhaltiges konzentrat |
| US4243546A (en) * | 1979-03-23 | 1981-01-06 | The Drackett Company | Stable aqueous compositions containing enzymes |
| US4243543A (en) * | 1979-05-11 | 1981-01-06 | Economics Laboratory, Inc. | Stabilized liquid enzyme-containing detergent compositions |
| US4261868A (en) * | 1979-08-08 | 1981-04-14 | Lever Brothers Company | Stabilized enzymatic liquid detergent composition containing a polyalkanolamine and a boron compound |
| US4318818A (en) * | 1979-11-09 | 1982-03-09 | The Procter & Gamble Company | Stabilized aqueous enzyme composition |
| US4287082A (en) * | 1980-02-22 | 1981-09-01 | The Procter & Gamble Company | Homogeneous enzyme-containing liquid detergent compositions containing saturated acids |
-
1983
- 1983-10-06 US US06/539,515 patent/US4548727A/en not_active Expired - Fee Related
-
1984
- 1984-09-11 AU AU32912/84A patent/AU564203B2/en not_active Ceased
- 1984-09-19 ZA ZA847370A patent/ZA847370B/xx unknown
- 1984-10-01 NZ NZ209731A patent/NZ209731A/en unknown
- 1984-10-02 SE SE8404930A patent/SE462917B/sv not_active IP Right Cessation
- 1984-10-02 IT IT48935/84A patent/IT1178011B/it active
- 1984-10-03 FR FR8415178A patent/FR2555604B1/fr not_active Expired
- 1984-10-04 BR BR8405022A patent/BR8405022A/pt unknown
- 1984-10-05 IE IE255684A patent/IE58303B1/en not_active IP Right Cessation
- 1984-10-05 CA CA000464809A patent/CA1228042A/en not_active Expired
- 1984-10-05 JP JP59208422A patent/JPS6098983A/ja active Granted
- 1984-10-05 DE DE19843436678 patent/DE3436678A1/de not_active Ceased
- 1984-10-05 GB GB08425192A patent/GB2147607B/en not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5571446A (en) * | 1995-07-27 | 1996-11-05 | Diversey Corporation | Anionic stabilized enzyme based clean-in-place system |
| US5783542A (en) * | 1995-07-27 | 1998-07-21 | Diversey Lever, Inc. | Anionic stabilized enzyme based clean-in-place system |
Also Published As
| Publication number | Publication date |
|---|---|
| IT8448935A0 (it) | 1984-10-02 |
| IT8448935A1 (it) | 1986-04-02 |
| ZA847370B (en) | 1985-05-29 |
| GB2147607B (en) | 1987-03-25 |
| SE8404930L (sv) | 1985-04-07 |
| FR2555604A1 (fr) | 1985-05-31 |
| IT1178011B (it) | 1987-09-03 |
| JPS6098983A (ja) | 1985-06-01 |
| AU3291284A (en) | 1985-04-18 |
| SE462917B (sv) | 1990-09-17 |
| IE842556L (en) | 1985-04-06 |
| DE3436678A1 (de) | 1985-04-25 |
| AU564203B2 (en) | 1987-08-06 |
| BR8405022A (pt) | 1985-08-20 |
| SE8404930D0 (sv) | 1984-10-02 |
| GB8425192D0 (en) | 1984-11-14 |
| GB2147607A (en) | 1985-05-15 |
| IE58303B1 (en) | 1993-09-08 |
| US4548727A (en) | 1985-10-22 |
| JPH0555107B2 (enExample) | 1993-08-16 |
| FR2555604B1 (fr) | 1986-12-19 |
| NZ209731A (en) | 1988-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1228042A (en) | Aqueous compositions containing stabilized enzymes | |
| CA1221044B (en) | Stable aqueous compositions containing enzymes | |
| CA1133407A (en) | Liquid detergent compositions | |
| CA1166984A (en) | Stabilized aqueous enzyme composition | |
| CA1277887C (en) | Cleaner - all-purpose concentrate | |
| US4518694A (en) | Aqueous compositions containing stabilized enzymes | |
| JPH0241398A (ja) | 安定化酵素液体洗剤組成物 | |
| EP0240315B1 (en) | Bleaching composition | |
| CA1284446C (en) | Homogeneous concentrated liquid detergent compositions containing ternary surfactant system | |
| CA2054466A1 (en) | Liquid nonaqueous detergent with stable, solubilized peracid | |
| IE47776B1 (en) | Liquid detergent composition | |
| CA2010590A1 (en) | Enzymatic liquid detergent composition | |
| CA1151088A (en) | Aqueous compositions containing stabilized enzymes | |
| CA1297442C (en) | Heavy duty built aqueous liquid detergent composition containing stabilized enzymes | |
| US3781212A (en) | Aerosol enzyme detergents stabilized with carbon dioxide | |
| KR100246656B1 (ko) | 안정한 효소-함유 수성 세탁용 예비얼룩제거 조성물 | |
| CA1208578A (en) | Liquid detergent composition with mixed enzyme formulation | |
| CA2159983A1 (en) | Concentrated liquid detergent containing suspended peroxygen bleach, organic solvent and 5-20% water | |
| EP1141209A1 (en) | Stable aqueous enzyme compositions | |
| JPH0633098A (ja) | 衣料用液体洗浄剤 | |
| CA2422727A1 (en) | Aqueous compositions comprising protease and/or amylase | |
| JPS61133296A (ja) | 酵素含有液体洗剤組成物 | |
| JP2000008099A (ja) | 液体洗浄剤組成物 | |
| JPH11193398A (ja) | 酵素安定化組成物及び液体洗浄剤組成物 | |
| JPH08157868A (ja) | 酵素含有液体洗浄剤組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |