CA1215976A - New process for the synthesis of imidazo rifamycins - Google Patents
New process for the synthesis of imidazo rifamycinsInfo
- Publication number
- CA1215976A CA1215976A CA000480320A CA480320A CA1215976A CA 1215976 A CA1215976 A CA 1215976A CA 000480320 A CA000480320 A CA 000480320A CA 480320 A CA480320 A CA 480320A CA 1215976 A CA1215976 A CA 1215976A
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- pyridine
- amino
- rifamycin
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 21
- 229930189077 Rifamycin Natural products 0.000 title claims abstract description 9
- BTVYFIMKUHNOBZ-QXMMDKDBSA-N rifamycin s Chemical class O=C1C(C(O)=C2C)=C3C(=O)C=C1NC(=O)\C(C)=C/C=C\C(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C(C)C(OC)\C=C/OC1(C)OC2=C3C1=O BTVYFIMKUHNOBZ-QXMMDKDBSA-N 0.000 title claims abstract description 6
- 229940081192 rifamycins Drugs 0.000 title claims abstract description 6
- 230000015572 biosynthetic process Effects 0.000 title abstract 2
- 238000003786 synthesis reaction Methods 0.000 title abstract 2
- BTVYFIMKUHNOBZ-ZDHWWVNNSA-N Rifamycin S Natural products COC1C=COC2(C)Oc3c(C)c(O)c4C(=O)C(=CC(=O)c4c3C2=O)NC(=O)C(=C/C=C/C(C)C(O)C(C)C(O)C(C)C(OC(=O)C)C1C)C BTVYFIMKUHNOBZ-ZDHWWVNNSA-N 0.000 claims abstract description 24
- BTVYFIMKUHNOBZ-ODRIEIDWSA-N Rifamycin S Chemical compound O=C1C(C(O)=C2C)=C3C(=O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O BTVYFIMKUHNOBZ-ODRIEIDWSA-N 0.000 claims abstract description 24
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 claims abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 13
- 239000001257 hydrogen Substances 0.000 claims abstract description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 13
- -1 nitro, mercapto Chemical class 0.000 claims abstract description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims abstract description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 6
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims abstract description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 4
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 4
- 150000002367 halogens Chemical class 0.000 claims abstract description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 3
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims abstract 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 39
- 239000002904 solvent Substances 0.000 claims description 21
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 229910052740 iodine Inorganic materials 0.000 claims description 19
- 239000011630 iodine Substances 0.000 claims description 19
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 15
- 239000011541 reaction mixture Substances 0.000 claims description 14
- ORLGLBZRQYOWNA-UHFFFAOYSA-N 4-methylpyridin-2-amine Chemical compound CC1=CC=NC(N)=C1 ORLGLBZRQYOWNA-UHFFFAOYSA-N 0.000 claims description 8
- 229950011175 aminopicoline Drugs 0.000 claims description 8
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 239000007800 oxidant agent Substances 0.000 claims description 5
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 claims description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 150000008282 halocarbons Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- OCWBGKZFOYMCCN-UHFFFAOYSA-N 3,5-dichloropyridin-2-amine Chemical compound NC1=NC=C(Cl)C=C1Cl OCWBGKZFOYMCCN-UHFFFAOYSA-N 0.000 claims description 2
- RGDQRXPEZUNWHX-UHFFFAOYSA-N 3-methylpyridin-2-amine Chemical compound CC1=CC=CN=C1N RGDQRXPEZUNWHX-UHFFFAOYSA-N 0.000 claims description 2
- MAXBVGJEFDMHNV-UHFFFAOYSA-N 5-chloropyridin-2-amine Chemical compound NC1=CC=C(Cl)C=N1 MAXBVGJEFDMHNV-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- 239000003638 chemical reducing agent Substances 0.000 claims description 2
- OSILBMSORKFRTB-UHFFFAOYSA-N isoquinolin-1-amine Chemical compound C1=CC=C2C(N)=NC=CC2=C1 OSILBMSORKFRTB-UHFFFAOYSA-N 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- WJMJWMSWJSACSN-UHFFFAOYSA-N 3,5-dibromopyridin-2-amine Chemical compound NC1=NC=C(Br)C=C1Br WJMJWMSWJSACSN-UHFFFAOYSA-N 0.000 claims 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 claims 1
- 235000013350 formula milk Nutrition 0.000 abstract 3
- 239000000047 product Substances 0.000 description 24
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 23
- 150000001875 compounds Chemical class 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- 239000007864 aqueous solution Substances 0.000 description 18
- HJYYPODYNSCCOU-ODRIEIDWSA-N rifamycin SV Chemical compound OC1=C(C(O)=C2C)C3=C(O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O HJYYPODYNSCCOU-ODRIEIDWSA-N 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- 235000010323 ascorbic acid Nutrition 0.000 description 11
- 229960005070 ascorbic acid Drugs 0.000 description 11
- 239000011668 ascorbic acid Substances 0.000 description 11
- 229940109171 rifamycin sv Drugs 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- HJYYPODYNSCCOU-ZDHWWVNNSA-N Rifamycin SV Natural products COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(NC(=O)C(=C/C=C/C(C)C(O)C(C)C(O)C(C)C(OC(=O)C)C1C)C)cc(O)c4c3C2=O HJYYPODYNSCCOU-ZDHWWVNNSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 238000001228 spectrum Methods 0.000 description 8
- 238000010521 absorption reaction Methods 0.000 description 7
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 7
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- 238000001914 filtration Methods 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 241001342522 Vampyrum spectrum Species 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 241000786363 Rhampholeon spectrum Species 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 3
- 229960003292 rifamycin Drugs 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000003927 aminopyridines Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- CIWBSHSKHKDKBQ-DUZGATOHSA-N D-isoascorbic acid Chemical compound OC[C@@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-DUZGATOHSA-N 0.000 description 1
- 241000187724 Micromonospora chalcea Species 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 101150059476 SLC44A3 gene Proteins 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 210000001557 animal structure Anatomy 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 229940120503 dihydroxyacetone Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000010350 erythorbic acid Nutrition 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 229940006461 iodide ion Drugs 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229940026239 isoascorbic acid Drugs 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
Landscapes
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT3464A/84 | 1984-05-15 | ||
| IT03465/84A IT1199376B (it) | 1984-05-15 | 1984-05-15 | Processo per la preparazione di imidazo-rifamicine |
| IT3465A/84 | 1984-05-15 | ||
| IT03464/84A IT1199375B (it) | 1984-05-15 | 1984-05-15 | Processo per la preparazione di imidazo rifamicine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1215976A true CA1215976A (en) | 1986-12-30 |
Family
ID=26325399
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000480320A Expired CA1215976A (en) | 1984-05-15 | 1985-04-29 | New process for the synthesis of imidazo rifamycins |
Country Status (9)
| Country | Link |
|---|---|
| AR (1) | AR242795A1 (enExample) |
| AT (1) | AT386829B (enExample) |
| CA (1) | CA1215976A (enExample) |
| DK (1) | DK160829C (enExample) |
| ES (1) | ES543116A0 (enExample) |
| FI (1) | FI83874C (enExample) |
| GR (1) | GR851146B (enExample) |
| NO (1) | NO164030C (enExample) |
| PT (1) | PT80447B (enExample) |
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7709634B2 (en) | 2007-09-20 | 2010-05-04 | Apotex Pharmachem Inc. | Amorphous form of rifaximin and processes for its preparation |
| WO2010067072A1 (en) | 2008-12-10 | 2010-06-17 | Cipla Limited | Rifaximin complexes |
| US7902206B2 (en) | 2003-11-07 | 2011-03-08 | Alfa Wassermann, S.P.A. | Polymorphic forms α, β and γ of rifaximin |
| US7906542B2 (en) | 2004-11-04 | 2011-03-15 | Alfa Wassermann, S.P.A. | Pharmaceutical compositions comprising polymorphic forms α, β, and γ of rifaximin |
| US7915275B2 (en) | 2003-11-07 | 2011-03-29 | Alfa Wassermann, S.P.A. | Use of polymorphic forms of rifaximin for medical preparations |
| US8193196B2 (en) | 2005-03-03 | 2012-06-05 | Alfa Wassermann, S.P.A. | Polymorphous forms of rifaximin, processes for their production and use thereof in the medicinal preparations |
| US8633234B2 (en) | 2006-09-22 | 2014-01-21 | Cipla Limited | Rifaximin |
| US9452157B2 (en) | 2012-07-06 | 2016-09-27 | Alfa Wassermann S.P.A | Pharmaceutical compositions comprising rifaximin and amino acids, preparation methods and use thereof |
| EP3134415A4 (en) * | 2014-04-19 | 2017-10-25 | Granules India Limited | An improved process for the preparation of rifamycin derivatives |
| US10428086B2 (en) | 2014-05-12 | 2019-10-01 | Alfasigma S.P.A. | Solvated crystal form of rifaximin, production, compositions and uses thereof |
| US10556915B2 (en) | 2014-03-31 | 2020-02-11 | Euticals Spa | Polymorphic mixture of Rifaximin and its use for the preparation of solid formulations |
-
1985
- 1985-04-29 CA CA000480320A patent/CA1215976A/en not_active Expired
- 1985-05-13 GR GR851146A patent/GR851146B/el unknown
- 1985-05-13 PT PT8044785A patent/PT80447B/pt unknown
- 1985-05-14 AT AT145085A patent/AT386829B/de not_active IP Right Cessation
- 1985-05-14 NO NO851920A patent/NO164030C/no unknown
- 1985-05-14 ES ES543116A patent/ES543116A0/es active Granted
- 1985-05-14 DK DK214585A patent/DK160829C/da not_active IP Right Cessation
- 1985-05-14 FI FI851908A patent/FI83874C/fi not_active IP Right Cessation
- 1985-05-15 AR AR30038685A patent/AR242795A1/es active
Cited By (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8173801B2 (en) | 2003-11-07 | 2012-05-08 | Alfa Wassermann, S.P.A. | Processes for the production of polymorphic forms of rifaximin |
| US8404704B2 (en) | 2003-11-07 | 2013-03-26 | Alfa Wassermann S.P.A. | Use of polymorphic forms of rifaximin for medical preparations |
| US7902206B2 (en) | 2003-11-07 | 2011-03-08 | Alfa Wassermann, S.P.A. | Polymorphic forms α, β and γ of rifaximin |
| US7915275B2 (en) | 2003-11-07 | 2011-03-29 | Alfa Wassermann, S.P.A. | Use of polymorphic forms of rifaximin for medical preparations |
| US8158781B2 (en) | 2003-11-07 | 2012-04-17 | Alfa Wassermann, S.P.A. | Polymorphic forms α, β and γ of rifaximin |
| US8158644B2 (en) | 2003-11-07 | 2012-04-17 | Alfa Wassermann, S.P.A. | Pharmaceutical compositions comprising polymorphic forms α, β, and γ of rifaximin |
| US7906542B2 (en) | 2004-11-04 | 2011-03-15 | Alfa Wassermann, S.P.A. | Pharmaceutical compositions comprising polymorphic forms α, β, and γ of rifaximin |
| US8518949B2 (en) | 2005-03-03 | 2013-08-27 | Alfa Wassermann S.P.A. | Polymorphous forms of rifaximin, processes for their production and use thereof in the medicinal preparations |
| US8193196B2 (en) | 2005-03-03 | 2012-06-05 | Alfa Wassermann, S.P.A. | Polymorphous forms of rifaximin, processes for their production and use thereof in the medicinal preparations |
| US10703763B2 (en) | 2005-03-03 | 2020-07-07 | Alfasigma S.P.A. | Polymorphous forms of rifaximin, processes for their production and use thereof in the medicinal preparations |
| US8633234B2 (en) | 2006-09-22 | 2014-01-21 | Cipla Limited | Rifaximin |
| US7709634B2 (en) | 2007-09-20 | 2010-05-04 | Apotex Pharmachem Inc. | Amorphous form of rifaximin and processes for its preparation |
| US8916193B2 (en) | 2008-12-10 | 2014-12-23 | Cipla Limited | Rifaximin complexes |
| WO2010067072A1 (en) | 2008-12-10 | 2010-06-17 | Cipla Limited | Rifaximin complexes |
| US9452157B2 (en) | 2012-07-06 | 2016-09-27 | Alfa Wassermann S.P.A | Pharmaceutical compositions comprising rifaximin and amino acids, preparation methods and use thereof |
| US10556915B2 (en) | 2014-03-31 | 2020-02-11 | Euticals Spa | Polymorphic mixture of Rifaximin and its use for the preparation of solid formulations |
| US10745415B2 (en) | 2014-03-31 | 2020-08-18 | Amri Italy S.R.L. | Polymorphic mixture of Rifaximin and its use for the preparation of solid formulations |
| US10961257B2 (en) | 2014-03-31 | 2021-03-30 | Amri Italy S.R.L. | Polymorphic mixture of rifaximin and its use for the preparation of solid formulations |
| US11739099B2 (en) | 2014-03-31 | 2023-08-29 | Curia Ip Holdings, Llc | Polymorphic mixture of Rifaximin and its use for the preparation of solid formulations |
| EP3134415A4 (en) * | 2014-04-19 | 2017-10-25 | Granules India Limited | An improved process for the preparation of rifamycin derivatives |
| US10428086B2 (en) | 2014-05-12 | 2019-10-01 | Alfasigma S.P.A. | Solvated crystal form of rifaximin, production, compositions and uses thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| FI851908L (fi) | 1985-11-16 |
| DK160829C (da) | 1991-10-07 |
| NO851920L (no) | 1985-11-18 |
| ES8603490A1 (es) | 1986-01-01 |
| NO164030C (no) | 1990-08-22 |
| ATA145085A (de) | 1988-03-15 |
| FI83874C (fi) | 1991-09-10 |
| FI83874B (fi) | 1991-05-31 |
| GR851146B (enExample) | 1985-11-25 |
| ES543116A0 (es) | 1986-01-01 |
| PT80447B (pt) | 1987-11-11 |
| FI851908A0 (fi) | 1985-05-14 |
| PT80447A (en) | 1985-06-01 |
| DK214585A (da) | 1985-11-16 |
| NO164030B (no) | 1990-05-14 |
| AR242795A1 (es) | 1993-05-31 |
| DK160829B (da) | 1991-04-22 |
| DK214585D0 (da) | 1985-05-14 |
| AT386829B (de) | 1988-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4557866A (en) | Process for the synthesis of pyrido-imidazo rifamycins | |
| CA1215976A (en) | New process for the synthesis of imidazo rifamycins | |
| US5026843A (en) | Process for the preparation of ceftriaxone | |
| JP3268530B2 (ja) | 5―メチル―N―(アリール)―1,2,4―トリアゾロ〔1,5―a〕ピリミジン―2―スルホンアミドの水性製造方法 | |
| US3794642A (en) | Oxidation of substituted methanes to the corresponding substituted methanols | |
| CA1218650A (en) | Process for the synthesis of pyrido-imidazo- rifamycins | |
| EP0029202B1 (en) | Novel tetrazole-5-thiol esters and process for preparing cefamandole using same | |
| US4031108A (en) | 2-Hydroxymethyl-3-benzyloxypyridine-6-epoxyethane | |
| US4959495A (en) | Process for the preparation of intermediates used to produce aminothiazoloximino cephalosporins | |
| EP3652158A1 (en) | Method for preparing pyrimidone compound | |
| US4417047A (en) | Novel tetrazole-5-thiol ester and process for preparing cefamandole using same | |
| US4515958A (en) | Process for preparing 1-alkyl-5-mercaptotetrazoles | |
| US3364198A (en) | Process for the production of n6-methyltubercidin and intermediate | |
| US3585184A (en) | 2-amino - 2 - deoxy-d-glucopyrano-d-glucopyranans having the alpha-d-glucose configuration,method,and use | |
| EP0233607B1 (en) | [(2,2,2-Trichloroethoxy) methoxy]amine | |
| CA1197504A (en) | Process and intermediates for 6'-amino penicillanoyloxymethyl penicillanate 1,1 dioxide | |
| KR920004137B1 (ko) | 이미다졸 유도체의 제조방법 | |
| HU198179B (en) | Process for producing n-methyl-1-alkylthio-2-nitroethenamine derivatives | |
| KR970004046B1 (ko) | 세팔로스포린 유도체의 제조방법 | |
| US6051695A (en) | Process for preparing erythromycin derivative, such as roxithromycin, from the corresponding oxime | |
| US3557134A (en) | 5,6-dihydro-5,6-substituted-3h-imidazo-(2,1-c)-1,2,4-dithiazole-3-thiones | |
| KR890002216B1 (ko) | 세팔로스포린 유도체의 제조방법 | |
| KR950000470B1 (ko) | β-치환된-N-카르보벤족시-L-아스파르테이트의 제조방법 | |
| HU197308B (en) | Process for preparing 2,6-bis(hydroxy-methyl)-pyridine-2,6-bis(n-methyl-carbamate) | |
| US5066799A (en) | Intermediates for the preparation of aminothiazoloximino cephalosporins |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |