CA1208615A - Magnetic-tape cassette and system comprising such a cassette - Google Patents
Magnetic-tape cassette and system comprising such a cassetteInfo
- Publication number
- CA1208615A CA1208615A CA000423271A CA423271A CA1208615A CA 1208615 A CA1208615 A CA 1208615A CA 000423271 A CA000423271 A CA 000423271A CA 423271 A CA423271 A CA 423271A CA 1208615 A CA1208615 A CA 1208615A
- Authority
- CA
- Canada
- Prior art keywords
- tape
- housing
- cassette
- magnetic
- reel
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000005291 magnetic effect Effects 0.000 claims abstract description 26
- 238000000605 extraction Methods 0.000 claims abstract description 19
- 229920000136 polysorbate Polymers 0.000 claims description 5
- 238000010276 construction Methods 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 4
- 230000002441 reversible effect Effects 0.000 description 3
- 239000000428 dust Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- 101100173636 Rattus norvegicus Fhl2 gene Proteins 0.000 description 1
- 229910052729 chemical element Inorganic materials 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B23/00—Record carriers not specific to the method of recording or reproducing; Accessories, e.g. containers, specially adapted for co-operation with the recording or reproducing apparatus ; Intermediate mediums; Apparatus or processes specially adapted for their manufacture
- G11B23/02—Containers; Storing means both adapted to cooperate with the recording or reproducing means
- G11B23/04—Magazines; Cassettes for webs or filaments
- G11B23/08—Magazines; Cassettes for webs or filaments for housing webs or filaments having two distinct ends
- G11B23/087—Magazines; Cassettes for webs or filaments for housing webs or filaments having two distinct ends using two different reels or cores
- G11B23/08707—Details
- G11B23/08757—Guiding means
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B23/00—Record carriers not specific to the method of recording or reproducing; Accessories, e.g. containers, specially adapted for co-operation with the recording or reproducing apparatus ; Intermediate mediums; Apparatus or processes specially adapted for their manufacture
- G11B23/02—Containers; Storing means both adapted to cooperate with the recording or reproducing means
- G11B23/04—Magazines; Cassettes for webs or filaments
- G11B23/08—Magazines; Cassettes for webs or filaments for housing webs or filaments having two distinct ends
- G11B23/087—Magazines; Cassettes for webs or filaments for housing webs or filaments having two distinct ends using two different reels or cores
- G11B23/08707—Details
- G11B23/08785—Envelopes
Landscapes
- Packaging Of Annular Or Rod-Shaped Articles, Wearing Apparel, Cassettes, Or The Like (AREA)
- Automatic Tape Cassette Changers (AREA)
- Registering, Tensioning, Guiding Webs, And Rollers Therefor (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE8201009,A NL188771C (nl) | 1982-03-11 | 1982-03-11 | Magneetbandcassette, en een systeem omvattende de magneetbandcassette alsmede een magneetbandcassetteapparaat. |
| NL8201009 | 1982-03-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1208615A true CA1208615A (en) | 1986-07-29 |
Family
ID=19839407
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000423271A Expired CA1208615A (en) | 1982-03-11 | 1983-03-10 | Magnetic-tape cassette and system comprising such a cassette |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4541024A (enExample) |
| JP (2) | JPS58148787U (enExample) |
| AT (1) | AT378077B (enExample) |
| AU (1) | AU555352B2 (enExample) |
| BE (1) | BE896115A (enExample) |
| BR (1) | BR8301185A (enExample) |
| CA (1) | CA1208615A (enExample) |
| CH (1) | CH659338A5 (enExample) |
| DE (1) | DE3308591A1 (enExample) |
| ES (1) | ES279825Y (enExample) |
| FR (1) | FR2523352B1 (enExample) |
| GB (1) | GB2116520B (enExample) |
| HK (1) | HK99186A (enExample) |
| IT (1) | IT1171654B (enExample) |
| NL (1) | NL188771C (enExample) |
| SG (1) | SG76386G (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS61148660A (ja) * | 1984-12-21 | 1986-07-07 | Fujitsu Ltd | テ−プ引き出し機構 |
| US4757399A (en) * | 1986-05-21 | 1988-07-12 | Eastman Kodak Company | Flexible cassette for use with a reel periphery driven transport |
| EP0397436A3 (en) * | 1989-05-09 | 1991-08-21 | Konica Corporation | Tape cassette |
| US5173817A (en) * | 1990-04-12 | 1992-12-22 | R-Byte, Inc. | Tape engagement mechanism for magnetic cassette tape incorporating a bi-directional over running clutch and improved capstan pinch scheme |
| JPH0461082A (ja) * | 1990-06-29 | 1992-02-27 | Sony Corp | テープカセット |
| US5184258A (en) * | 1991-06-10 | 1993-02-02 | Datatape Incorporated | Helical scan magnetic tape recorder with capstan assisted vacuum threading |
| US5359468A (en) * | 1991-08-06 | 1994-10-25 | R-Byte, Inc. | Digital data storage tape formatter |
| US5398140A (en) * | 1991-08-06 | 1995-03-14 | R-Byte, Inc. | Digital data tape storage automatic track follower system |
| US5309300A (en) * | 1991-08-06 | 1994-05-03 | R-Byte, Inc. | Beginning/end of tape detection system |
| US5287233A (en) * | 1991-08-06 | 1994-02-15 | R-Byte Inc. | Digital data storage magnetic tape system comprising a single chip processor to control a tape tension servo, and a head drum servo |
| US5573195A (en) * | 1995-02-24 | 1996-11-12 | Minnesota Mining & Manufacturing Company | Data cartridge with pivoting roller yoke |
| US6535349B1 (en) | 1999-12-02 | 2003-03-18 | Storage Technology Corporation | Tape transfer with laterally moving head |
| US7170710B2 (en) * | 2003-03-18 | 2007-01-30 | Matsushita Electric Industrial Co., Ltd. | Magnetic recording and reproduction apparatus |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE458350A (enExample) * | 1945-03-14 | |||
| US3008661A (en) * | 1959-02-02 | 1961-11-14 | Eastman Kodak Co | Antisnubber arrangement for film handling apparatus |
| US3198450A (en) * | 1962-02-28 | 1965-08-03 | Potter Instrument Co Inc | Tape cartridge |
| US3432111A (en) * | 1966-10-24 | 1969-03-11 | Illinois Tool Works | Web transporting cartridge formed of a pair of identical housing members |
| DE1655985A1 (de) * | 1968-03-06 | 1971-08-26 | Ballu Gabriel Jean Maurice | Hydraulische Vorrichtung zum Antreiben eines Kraftfahrzeugrades |
| GB1307821A (en) * | 1969-03-14 | 1973-02-21 | Rca Corp | Web cartridge |
| US3672603A (en) * | 1970-06-26 | 1972-06-27 | Cartridge Television Inc | Tape cartridge |
| GB1377393A (en) * | 1971-03-29 | 1974-12-18 | Rca Corp | Recording web tension control |
| JPS5220249Y2 (enExample) * | 1972-05-04 | 1977-05-10 | ||
| JPS581903Y2 (ja) * | 1977-06-24 | 1983-01-13 | ソニー株式会社 | レンタル用テ−プカセット |
| NL165598C (nl) * | 1978-05-09 | 1981-04-15 | Philips Nv | Magneetbandcassette. |
| NL7808832A (nl) * | 1978-08-28 | 1980-03-03 | Philips Nv | Magneetbandaandrijfsysteem. |
| US4226511A (en) * | 1979-04-24 | 1980-10-07 | Polaroid Corporation | Film strip/audio tape arrangement for audio-visual cassette |
| IT1144736B (it) * | 1981-06-09 | 1986-10-29 | Fiat Allis Macch Movi | Cinematismo caricatore per una macchina escavatrice |
| JPS57210489A (en) * | 1981-06-22 | 1982-12-24 | Sony Corp | Tape cassette |
| JPS58128069A (ja) * | 1982-01-25 | 1983-07-30 | Sony Corp | テ−プカセツト |
-
1982
- 1982-03-11 NL NLAANVRAGE8201009,A patent/NL188771C/xx not_active IP Right Cessation
-
1983
- 1983-02-28 US US06/470,842 patent/US4541024A/en not_active Expired - Lifetime
- 1983-03-07 GB GB08306226A patent/GB2116520B/en not_active Expired
- 1983-03-08 IT IT19949/83A patent/IT1171654B/it active
- 1983-03-08 JP JP1983032353U patent/JPS58148787U/ja active Granted
- 1983-03-09 ES ES1983279825U patent/ES279825Y/es not_active Expired
- 1983-03-09 AU AU12183/83A patent/AU555352B2/en not_active Expired
- 1983-03-09 CH CH1276/83A patent/CH659338A5/de not_active IP Right Cessation
- 1983-03-09 BR BR8301185A patent/BR8301185A/pt not_active IP Right Cessation
- 1983-03-09 BE BE0/210283A patent/BE896115A/fr not_active IP Right Cessation
- 1983-03-09 FR FR838303850A patent/FR2523352B1/fr not_active Expired
- 1983-03-10 DE DE19833308591 patent/DE3308591A1/de active Granted
- 1983-03-10 CA CA000423271A patent/CA1208615A/en not_active Expired
- 1983-03-11 AT AT0087683A patent/AT378077B/de not_active IP Right Cessation
-
1986
- 1986-09-20 SG SG763/86A patent/SG76386G/en unknown
- 1986-12-18 HK HK991/86A patent/HK99186A/xx not_active IP Right Cessation
-
1988
- 1988-11-01 JP JP63274626A patent/JPH01154381A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IT8319949A1 (it) | 1984-09-08 |
| JPS6338461Y2 (enExample) | 1988-10-11 |
| ES279825Y (es) | 1985-06-01 |
| AT378077B (de) | 1985-06-10 |
| JPH01154381A (ja) | 1989-06-16 |
| HK99186A (en) | 1986-12-24 |
| SG76386G (en) | 1987-02-27 |
| CH659338A5 (de) | 1987-01-15 |
| BE896115A (fr) | 1983-09-09 |
| DE3308591C2 (enExample) | 1992-02-20 |
| NL188771C (nl) | 1992-09-16 |
| AU1218383A (en) | 1983-09-15 |
| AU555352B2 (en) | 1986-09-18 |
| JPS58148787U (ja) | 1983-10-06 |
| US4541024A (en) | 1985-09-10 |
| IT1171654B (it) | 1987-06-10 |
| DE3308591A1 (de) | 1983-10-06 |
| ES279825U (es) | 1984-11-16 |
| FR2523352A1 (fr) | 1983-09-16 |
| FR2523352B1 (fr) | 1989-02-03 |
| NL188771B (nl) | 1992-04-16 |
| GB2116520A (en) | 1983-09-28 |
| GB2116520B (en) | 1986-04-30 |
| ATA87683A (de) | 1984-10-15 |
| BR8301185A (pt) | 1983-11-22 |
| IT8319949A0 (it) | 1983-03-08 |
| GB8306226D0 (en) | 1983-04-13 |
| NL8201009A (nl) | 1983-10-03 |
| JPH0578099B2 (enExample) | 1993-10-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1208615A (en) | Magnetic-tape cassette and system comprising such a cassette | |
| EP0090086B1 (en) | Single reel magnetic tape cartridge | |
| EP0438144B1 (en) | Tape cassette | |
| EP0406943A1 (en) | System for recording/reproducing signals on/from magnetic tape, and apparatus and cassette for use in the system | |
| EP0588219B1 (en) | Single reel cartridge with narrow width, windowed flange | |
| WO1995032503A1 (en) | Tape guides for data cartridges | |
| EP0317297B1 (en) | Tape cassette | |
| US5395064A (en) | Tape cassette having front and inner pivotal lids | |
| AU638028B2 (en) | Magnetic-tape cassette | |
| US4119282A (en) | Magnetic tape magazine | |
| EP0096994B1 (en) | Tape cassette | |
| CA1118888A (en) | Pivotable cassette holder for a magnetic tape recording/playback apparatus | |
| EP0096983B1 (en) | Tape cassette | |
| US4352473A (en) | Tape cassette | |
| US4451864A (en) | Magnetic-tape cassette | |
| EP0478057B1 (en) | Cassette with magnetic tape on two coplanar reels | |
| US4367854A (en) | Tape cassette | |
| US6457664B1 (en) | Hybrid belt-driven data storage tape cartridge | |
| US4813628A (en) | Slack limiter for a magnetic tape cassette | |
| US5454529A (en) | Cassette provided with magnetic tape | |
| EP0443426B1 (en) | Tape guide mechanism for recording and reproducing device | |
| EP0498491A1 (en) | Magnetic-tape cassette | |
| KR200141233Y1 (ko) | 자기기록재생기의 테이프말림 방지장치 | |
| KR0113057Y1 (ko) | 양면 녹화 재생이 가능한 비디오 테이프 카세트 | |
| EP0907179A1 (en) | Belt driven recording tape cartridge |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |