CA1205994A - Foam generating nozzle - Google Patents
Foam generating nozzleInfo
- Publication number
- CA1205994A CA1205994A CA000439180A CA439180A CA1205994A CA 1205994 A CA1205994 A CA 1205994A CA 000439180 A CA000439180 A CA 000439180A CA 439180 A CA439180 A CA 439180A CA 1205994 A CA1205994 A CA 1205994A
- Authority
- CA
- Canada
- Prior art keywords
- solution
- chamber
- foam
- liquid
- gas
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000006260 foam Substances 0.000 title claims abstract description 64
- 239000007788 liquid Substances 0.000 claims abstract description 58
- 238000005187 foaming Methods 0.000 claims abstract description 52
- 239000000758 substrate Substances 0.000 claims abstract description 19
- 239000007787 solid Substances 0.000 claims description 34
- 238000000034 method Methods 0.000 claims description 12
- 238000007599 discharging Methods 0.000 claims description 5
- 230000001154 acute effect Effects 0.000 claims description 3
- 238000013019 agitation Methods 0.000 claims description 3
- 230000003116 impacting effect Effects 0.000 claims description 3
- 230000001939 inductive effect Effects 0.000 claims description 2
- 238000000889 atomisation Methods 0.000 abstract description 9
- 239000000126 substance Substances 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 67
- 239000007789 gas Substances 0.000 description 29
- 239000003973 paint Substances 0.000 description 23
- 238000000576 coating method Methods 0.000 description 19
- 239000011248 coating agent Substances 0.000 description 18
- 239000002904 solvent Substances 0.000 description 12
- 239000004604 Blowing Agent Substances 0.000 description 11
- 206010061876 Obstruction Diseases 0.000 description 11
- 239000007921 spray Substances 0.000 description 9
- 239000008259 solid foam Substances 0.000 description 6
- 230000000712 assembly Effects 0.000 description 4
- 238000000429 assembly Methods 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000012423 maintenance Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000012260 resinous material Substances 0.000 description 3
- 238000004544 sputter deposition Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 2
- 239000004831 Hot glue Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 239000008199 coating composition Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000006193 liquid solution Substances 0.000 description 2
- 239000004620 low density foam Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 241000428533 Rhis Species 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000006261 foam material Substances 0.000 description 1
- -1 for example Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 230000000485 pigmenting effect Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B05—SPRAYING OR ATOMISING IN GENERAL; APPLYING FLUENT MATERIALS TO SURFACES, IN GENERAL
- B05B—SPRAYING APPARATUS; ATOMISING APPARATUS; NOZZLES
- B05B7/00—Spraying apparatus for discharge of liquids or other fluent materials from two or more sources, e.g. of liquid and air, of powder and gas
- B05B7/02—Spray pistols; Apparatus for discharge
- B05B7/08—Spray pistols; Apparatus for discharge with separate outlet orifices, e.g. to form parallel jets, i.e. the axis of the jets being parallel, to form intersecting jets, i.e. the axis of the jets converging but not necessarily intersecting at a point
- B05B7/0807—Spray pistols; Apparatus for discharge with separate outlet orifices, e.g. to form parallel jets, i.e. the axis of the jets being parallel, to form intersecting jets, i.e. the axis of the jets converging but not necessarily intersecting at a point to form intersecting jets
- B05B7/0815—Spray pistols; Apparatus for discharge with separate outlet orifices, e.g. to form parallel jets, i.e. the axis of the jets being parallel, to form intersecting jets, i.e. the axis of the jets converging but not necessarily intersecting at a point to form intersecting jets with at least one gas jet intersecting a jet constituted by a liquid or a mixture containing a liquid for controlling the shape of the latter
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B29—WORKING OF PLASTICS; WORKING OF SUBSTANCES IN A PLASTIC STATE IN GENERAL
- B29B—PREPARATION OR PRETREATMENT OF THE MATERIAL TO BE SHAPED; MAKING GRANULES OR PREFORMS; RECOVERY OF PLASTICS OR OTHER CONSTITUENTS OF WASTE MATERIAL CONTAINING PLASTICS
- B29B7/00—Mixing; Kneading
- B29B7/74—Mixing; Kneading using other mixers or combinations of mixers, e.g. of dissimilar mixers ; Plant
- B29B7/7438—Mixing guns, i.e. hand-held mixing units having dispensing means
- B29B7/7452—Mixing guns, i.e. hand-held mixing units having dispensing means for mixing components by spraying them into each other; for mixing by intersecting sheets
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Nozzles (AREA)
- Application Of Or Painting With Fluid Materials (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/436,012 US4553701A (en) | 1982-10-22 | 1982-10-22 | Foam generating nozzle |
| US436,012 | 1982-10-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1205994A true CA1205994A (en) | 1986-06-17 |
Family
ID=23730741
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000439180A Expired CA1205994A (en) | 1982-10-22 | 1983-10-18 | Foam generating nozzle |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4553701A (enExample) |
| EP (1) | EP0107173B1 (enExample) |
| JP (1) | JPS59123547A (enExample) |
| CA (1) | CA1205994A (enExample) |
| DE (1) | DE3378894D1 (enExample) |
| ES (1) | ES526668A0 (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3442901A1 (de) * | 1984-11-24 | 1986-06-05 | Zeller Plastik Koehn Graebner | Schaumerzeuger |
| US4925101A (en) * | 1988-08-26 | 1990-05-15 | Nordson Corporation | Wax spray gun and nozzle |
| US5114752A (en) * | 1988-12-12 | 1992-05-19 | Nordson Corporation | Method for gas-aided dispensing of liquid materials |
| US4987854A (en) * | 1988-12-12 | 1991-01-29 | Nordson Corporation | Apparatus for gas-aided dispensing of liquid materials |
| US4983424A (en) * | 1989-08-04 | 1991-01-08 | Nordson Corporation | Method for forming a permanent foam coating by atomization onto a substrate |
| US5159894A (en) * | 1989-08-04 | 1992-11-03 | Nordson Corporation | Apparatus for forming a permanent foam coating by atomization onto a substrate |
| US5088443A (en) * | 1989-10-04 | 1992-02-18 | Nordson Corporation | Method and apparatus for spraying a liquid coating containing supercritical fluid or liquified gas |
| US5106659A (en) * | 1989-10-04 | 1992-04-21 | Nordson Corporation | Method and apparatus for spraying a liquid coating containing supercritical fluid or liquified gas |
| US5215253A (en) * | 1990-08-30 | 1993-06-01 | Nordson Corporation | Method and apparatus for forming and dispersing single and multiple phase coating material containing fluid diluent |
| US5197800A (en) * | 1991-06-28 | 1993-03-30 | Nordson Corporation | Method for forming coating material formulations substantially comprised of a saturated resin rich phase |
| DE69317706T2 (de) * | 1992-07-08 | 1998-07-30 | Nordson Corp | Apparat und Verfahren zum Auftrag von diskontinuierlichen Beschichtungen |
| EP0651677B1 (en) * | 1992-07-08 | 1997-10-01 | Nordson Corporation | Apparatus and methods for applying discrete foam coatings |
| CA2098784A1 (en) * | 1992-07-08 | 1994-01-09 | Bentley Boger | Apparatus and methods for applying conformal coatings to electronic circuit boards |
| US5421921A (en) * | 1992-07-08 | 1995-06-06 | Nordson Corporation | Segmented slot die for air spray of fibers |
| US5418009A (en) * | 1992-07-08 | 1995-05-23 | Nordson Corporation | Apparatus and methods for intermittently applying discrete adhesive coatings |
| US5354378A (en) * | 1992-07-08 | 1994-10-11 | Nordson Corporation | Slot nozzle apparatus for applying coatings to bottles |
| US5443796A (en) * | 1992-10-19 | 1995-08-22 | Nordson Corporation | Method and apparatus for preventing the formation of a solid precipitate in a coating material formulation |
| US5490726A (en) * | 1992-12-30 | 1996-02-13 | Nordson Corporation | Apparatus for proportioning two components to form a mixture |
| US5407267A (en) * | 1992-12-30 | 1995-04-18 | Nordson Corporation | Method and apparatus for forming and dispensing coating material containing multiple components |
| WO1994027736A1 (en) * | 1993-05-25 | 1994-12-08 | Nordson Corporation | Vehicle powder coating system |
| US5368233A (en) * | 1993-09-01 | 1994-11-29 | Nordson Corporation | Spray disk for close centerline spacing |
| US5407132A (en) * | 1993-10-20 | 1995-04-18 | Nordson Corporation | Method and apparatus for spraying viscous adhesives |
| US8814070B2 (en) * | 2010-10-20 | 2014-08-26 | Finishing Brands Holdings, Inc. | Fine finish airless spray tip assembly for a spray gun |
| WO2023061799A1 (en) * | 2021-10-11 | 2023-04-20 | Basf Se | Atomizer nozzle |
Family Cites Families (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US576762A (en) * | 1897-02-09 | Nozzle-valve | ||
| US587344A (en) * | 1897-08-03 | Hose-nozzle | ||
| US614883A (en) * | 1898-11-29 | And jonas | ||
| US604873A (en) * | 1898-05-31 | And roscoe bean | ||
| US617472A (en) * | 1899-01-10 | And jonas | ||
| US986201A (en) * | 1909-09-07 | 1911-03-07 | George F Nilsson | Lawn-sprinkler. |
| US1178905A (en) * | 1915-07-09 | 1916-04-11 | Edward F Cogley | Intensifier for spark-plugs. |
| US1886623A (en) * | 1931-07-22 | 1932-11-08 | Swartzbaugh Mfg Company | Liquid dispensing apparatus |
| US2161111A (en) * | 1935-05-25 | 1939-06-06 | Babcock & Wilcox Co | Spray nozzle |
| US2164411A (en) * | 1936-11-21 | 1939-07-04 | Kennedy Van Saun Mfg & Eng | Nozzle |
| US2231782A (en) * | 1939-07-17 | 1941-02-11 | Gertrude Phelps Thompson | Means for atomizing cleaning fluids |
| US2624622A (en) * | 1950-02-04 | 1953-01-06 | Pullman Sales Corp | Gun for delivering a detergent in foam form |
| US2760821A (en) * | 1954-04-05 | 1956-08-28 | Alfred L Kenworthy | Compound spray nozzles |
| US2764452A (en) * | 1954-06-28 | 1956-09-25 | Anderson Denton | Sprayer |
| US2955764A (en) * | 1958-01-24 | 1960-10-11 | Rain Jet Corp | Sprinkler |
| US3051397A (en) * | 1961-04-03 | 1962-08-28 | Grinnell Corp | Foam-water sprinkler device |
| US3446285A (en) * | 1967-08-07 | 1969-05-27 | Norman C Hout | Foam devices for fog nozzles |
| US3547200A (en) * | 1969-05-15 | 1970-12-15 | Norman C Hout | Foam device for fog nozzles |
| US3633795A (en) * | 1969-12-16 | 1972-01-11 | Insta Foam Prod Inc | Foam dispenser |
| US3625436A (en) * | 1969-12-19 | 1971-12-07 | Karl Heinz Wirths | Device for atomizing liquid |
| US3701482A (en) * | 1971-03-17 | 1972-10-31 | Norman H Sachnik | Foam generating nozzle |
| US3797747A (en) * | 1971-09-25 | 1974-03-19 | Hano Grohe Kg Fa | Device for aspirating and admixing additives into a stream |
| US3784111A (en) * | 1972-03-29 | 1974-01-08 | Spraying Systems Co | Foam producing nozzle |
| US3739989A (en) * | 1972-07-19 | 1973-06-19 | Coen Co | Duct burner for operation with liquid or gaseous fuels |
| US3836076A (en) * | 1972-10-10 | 1974-09-17 | Delavan Manufacturing Co | Foam generating nozzle |
| US3814329A (en) * | 1972-12-04 | 1974-06-04 | J Clark | Pressure reducing nozzles for pressure guns |
| US3946947A (en) * | 1973-09-11 | 1976-03-30 | Chemtrust Industries Corporation | Foam generating apparatus |
| US4103876A (en) * | 1975-04-30 | 1978-08-01 | Hasselman Jr Walter J | Method and apparatus for continuously producing and applying foam |
| US3961754A (en) * | 1975-09-12 | 1976-06-08 | Economics Laboratory, Inc. | Spray and foam producing nozzle apparatus |
| DE2619415C2 (de) * | 1976-05-03 | 1986-01-02 | Dietz-Armaturen Gmbh, 5060 Bergisch Gladbach | Schwallbrause zur Erzeugung eines freifallenden Flüssigkeitsflachstrahles |
| US4059714A (en) * | 1976-08-02 | 1977-11-22 | Nordson Corporation | Hot melt thermoplastic adhesive foam system |
| US4247581A (en) * | 1977-10-14 | 1981-01-27 | Nordson Corporation | Method of coating with film-forming solids |
| US4241880A (en) * | 1979-03-16 | 1980-12-30 | Nordson Corporation | Electrostatic spray gun |
| DE7924574U1 (de) * | 1979-08-30 | 1979-11-29 | Brab, Hubert, Ing.(Grad.), 5100 Aachen | Auftragduese mit ventil |
| US4330086A (en) * | 1980-04-30 | 1982-05-18 | Duraclean International | Nozzle and method for generating foam |
| US4349156A (en) * | 1980-08-11 | 1982-09-14 | Spraying Systems Company | Efficiency nozzle |
-
1982
- 1982-10-22 US US06/436,012 patent/US4553701A/en not_active Expired - Fee Related
-
1983
- 1983-10-18 CA CA000439180A patent/CA1205994A/en not_active Expired
- 1983-10-19 EP EP83110398A patent/EP0107173B1/en not_active Expired
- 1983-10-19 DE DE8383110398T patent/DE3378894D1/de not_active Expired
- 1983-10-20 JP JP58195361A patent/JPS59123547A/ja active Granted
- 1983-10-21 ES ES526668A patent/ES526668A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0107173A3 (en) | 1985-11-21 |
| JPS59123547A (ja) | 1984-07-17 |
| DE3378894D1 (en) | 1989-02-16 |
| ES8406227A1 (es) | 1984-08-01 |
| JPH041666B2 (enExample) | 1992-01-13 |
| EP0107173A2 (en) | 1984-05-02 |
| EP0107173B1 (en) | 1989-01-11 |
| ES526668A0 (es) | 1984-08-01 |
| US4553701A (en) | 1985-11-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1205994A (en) | Foam generating nozzle | |
| US4630774A (en) | Foam generating nozzle | |
| US3734406A (en) | Method and apparatus for producing a flat fan paint spray pattern | |
| CA2047860C (en) | Plural component external mix spray gun and method | |
| US3764069A (en) | Method and apparatus for spraying | |
| US3199790A (en) | Spraying apparatus for the production of foamed plastic materials for use as fillers and insulations | |
| US4760956A (en) | Internal mix plural component system | |
| US4927079A (en) | Plural component air spray gun and method | |
| US4967956A (en) | Multi-component spraying system | |
| EP0941144B1 (en) | A colliding stream spray dispensing system with a moldable nozzle | |
| US5074466A (en) | Fluid valve stem for air spray gun | |
| US3759450A (en) | Fluid mixing and spraying apparatus | |
| CN100471583C (zh) | 用于生产一种包括被喷射的聚亚胺酯层的模制物品的方法 | |
| CA2318211A1 (en) | Modular system for atomizing a liquid and method of atomizing a liquid | |
| KR860008803A (ko) | 분말분무 장치 및 방법 | |
| WO1992017279A1 (en) | Spray gun nozzle head | |
| JPH0994494A (ja) | 内部混合気の霧化噴霧用ノズル | |
| KR970005401A (ko) | 액상 제품 분무 방법 및 장치 | |
| KR102646878B1 (ko) | 사전-분무화 협폭부를 구비한 스프레이 노즐, 상기 스프레이 노즐을 포함하는 스프레이 헤드 및 스프레이 장치 | |
| US4928884A (en) | Fluid assist airless spray nozzle | |
| US2895685A (en) | Spray nozzle | |
| KR100433299B1 (ko) | 열경화성플라스틱공급노즐및방법 | |
| HU189932B (en) | Nezzle for atomizing viscous fluids | |
| US4494699A (en) | Adjustable spray nozzle | |
| GB1350794A (en) | Mechanical nebulization device for the product stream from a pressurized dispenser |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |