CA1194880A - Antiallergic 4h-furo¬3,2-b|indoles - Google Patents
Antiallergic 4h-furo¬3,2-b|indolesInfo
- Publication number
- CA1194880A CA1194880A CA000426192A CA426192A CA1194880A CA 1194880 A CA1194880 A CA 1194880A CA 000426192 A CA000426192 A CA 000426192A CA 426192 A CA426192 A CA 426192A CA 1194880 A CA1194880 A CA 1194880A
- Authority
- CA
- Canada
- Prior art keywords
- phenyl
- indole
- furo
- compound
- prepared
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000002475 indoles Chemical class 0.000 title abstract 4
- 230000003266 anti-allergic effect Effects 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 67
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 15
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052708 sodium Inorganic materials 0.000 claims abstract description 7
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052744 lithium Inorganic materials 0.000 claims abstract description 5
- 229910052700 potassium Inorganic materials 0.000 claims abstract description 4
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 3
- 150000001768 cations Chemical class 0.000 claims abstract description 3
- 125000005843 halogen group Chemical group 0.000 claims abstract description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims abstract 6
- ODKSFYDXXFIFQN-BYPYZUCNSA-N L-arginine Chemical compound OC(=O)[C@@H](N)CCCN=C(N)N ODKSFYDXXFIFQN-BYPYZUCNSA-N 0.000 claims abstract 5
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims abstract 2
- 239000011575 calcium Substances 0.000 claims abstract 2
- 150000001875 compounds Chemical class 0.000 claims description 68
- 150000003839 salts Chemical class 0.000 claims description 29
- -1 1H-tetrazol-5-yl compound Chemical class 0.000 claims description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- 239000000126 substance Substances 0.000 claims description 22
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 17
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 10
- 150000002148 esters Chemical group 0.000 claims description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 239000011734 sodium Substances 0.000 claims description 6
- FQUMPJZPUCNMHI-UHFFFAOYSA-N 3-ethoxy-7-methoxy-4-phenyl-n-(2h-tetrazol-5-yl)furo[3,2-b]indole-2-carboxamide Chemical compound C1=2C(OCC)=C(C(=O)NC=3NN=NN=3)OC=2C2=CC(OC)=CC=C2N1C1=CC=CC=C1 FQUMPJZPUCNMHI-UHFFFAOYSA-N 0.000 claims description 3
- 239000003153 chemical reaction reagent Substances 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- 150000003053 piperidines Chemical class 0.000 claims description 2
- YCXRJOZNRPGVCN-UHFFFAOYSA-N 3,7-dimethoxy-4-phenyl-n-(2h-tetrazol-5-yl)furo[3,2-b]indole-2-carboxamide Chemical compound C1=2C(OC)=C(C(=O)NC3=NNN=N3)OC=2C2=CC(OC)=CC=C2N1C1=CC=CC=C1 YCXRJOZNRPGVCN-UHFFFAOYSA-N 0.000 claims 4
- LTNCFABAGCHHCV-UHFFFAOYSA-N 3,7-dimethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid Chemical compound C1=2C(OC)=C(C(O)=O)OC=2C2=CC(OC)=CC=C2N1C1=CC=CC=C1 LTNCFABAGCHHCV-UHFFFAOYSA-N 0.000 claims 2
- 230000000875 corresponding effect Effects 0.000 claims 2
- 159000000000 sodium salts Chemical class 0.000 claims 2
- DCEMUONUJXUSHM-UHFFFAOYSA-N 3,7-dimethoxy-4-phenyl-2-(2h-tetrazol-5-yl)furo[3,2-b]indole Chemical compound C1=2C(OC)=C(C=3NN=NN=3)OC=2C2=CC(OC)=CC=C2N1C1=CC=CC=C1 DCEMUONUJXUSHM-UHFFFAOYSA-N 0.000 claims 1
- JOINTFUOXCQRLQ-UHFFFAOYSA-N 3-ethoxy-4-phenyl-2-(2h-tetrazol-5-yl)furo[3,2-b]indole Chemical compound C1=2C(OCC)=C(C=3NN=NN=3)OC=2C2=CC=CC=C2N1C1=CC=CC=C1 JOINTFUOXCQRLQ-UHFFFAOYSA-N 0.000 claims 1
- NDGDVSWGNSXCMK-UHFFFAOYSA-N 3-ethoxy-4-phenyl-n-(2h-tetrazol-5-yl)furo[3,2-b]indole-2-carboxamide Chemical compound C1=2C(OCC)=C(C(=O)NC=3NN=NN=3)OC=2C2=CC=CC=C2N1C1=CC=CC=C1 NDGDVSWGNSXCMK-UHFFFAOYSA-N 0.000 claims 1
- YUEDRIPQRRVFJV-UHFFFAOYSA-N 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid Chemical compound C1=2C(OCC)=C(C(O)=O)OC=2C2=CC=CC=C2N1C1=CC=CC=C1 YUEDRIPQRRVFJV-UHFFFAOYSA-N 0.000 claims 1
- VFWAJXMRCXLCOW-UHFFFAOYSA-N 3-ethoxy-7-methoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid Chemical compound C1=2C(OCC)=C(C(O)=O)OC=2C2=CC(OC)=CC=C2N1C1=CC=CC=C1 VFWAJXMRCXLCOW-UHFFFAOYSA-N 0.000 claims 1
- WZCCJHJBIGMHLJ-UHFFFAOYSA-N 3-methoxy-4-methyl-n-(2h-tetrazol-5-yl)furo[3,2-b]indole-2-carboxamide Chemical compound O1C=2C3=CC=CC=C3N(C)C=2C(OC)=C1C(=O)NC1=NN=NN1 WZCCJHJBIGMHLJ-UHFFFAOYSA-N 0.000 claims 1
- PWSDIAIDLOFYPB-UHFFFAOYSA-N 3-methoxy-4-phenyl-2-(2h-tetrazol-5-yl)furo[3,2-b]indole Chemical compound C1=2C(OC)=C(C=3NN=NN=3)OC=2C2=CC=CC=C2N1C1=CC=CC=C1 PWSDIAIDLOFYPB-UHFFFAOYSA-N 0.000 claims 1
- UOCRBEBVQFQIKZ-UHFFFAOYSA-N 3-methoxy-4-phenyl-n-(2h-tetrazol-5-yl)furo[3,2-b]indole-2-carboxamide Chemical compound C1=2C(OC)=C(C(=O)NC=3NN=NN=3)OC=2C2=CC=CC=C2N1C1=CC=CC=C1 UOCRBEBVQFQIKZ-UHFFFAOYSA-N 0.000 claims 1
- UIUZYXSRFZINPJ-UHFFFAOYSA-N 3-methoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid Chemical compound C1=2C(OC)=C(C(O)=O)OC=2C2=CC=CC=C2N1C1=CC=CC=C1 UIUZYXSRFZINPJ-UHFFFAOYSA-N 0.000 claims 1
- 230000002152 alkylating effect Effects 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- QDMPKKFNRFFSNK-UHFFFAOYSA-N n-(2h-tetrazol-5-yl)formamide Chemical compound O=CNC1=NN=NN1 QDMPKKFNRFFSNK-UHFFFAOYSA-N 0.000 claims 1
- HOOUZIRMRBQJEQ-UHFFFAOYSA-N 4h-furo[3,2-b]indole Chemical class N1C2=CC=CC=C2C2=C1C=CO2 HOOUZIRMRBQJEQ-UHFFFAOYSA-N 0.000 abstract description 3
- 241000124008 Mammalia Species 0.000 abstract description 2
- 206010020751 Hypersensitivity Diseases 0.000 abstract 2
- 230000007815 allergy Effects 0.000 abstract 2
- 239000008194 pharmaceutical composition Substances 0.000 abstract 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 52
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 45
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 40
- 239000002253 acid Substances 0.000 description 26
- 239000000203 mixture Substances 0.000 description 23
- 239000000047 product Substances 0.000 description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- 239000012043 crude product Substances 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 14
- 238000001953 recrystallisation Methods 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- HCUARRIEZVDMPT-UHFFFAOYSA-N Indole-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1 HCUARRIEZVDMPT-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- 239000000243 solution Substances 0.000 description 10
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 9
- 150000001408 amides Chemical class 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 8
- 150000002825 nitriles Chemical class 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- 150000003536 tetrazoles Chemical class 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- VFHUJFBEFDVZPJ-UHFFFAOYSA-N 1h-indole-2-carboxamide Chemical compound C1=CC=C2NC(C(=O)N)=CC2=C1 VFHUJFBEFDVZPJ-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 150000002500 ions Chemical class 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 210000004072 lung Anatomy 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000011282 treatment Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 4
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000000427 antigen Substances 0.000 description 3
- 102000036639 antigens Human genes 0.000 description 3
- 108091007433 antigens Proteins 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 3
- OYFJQPXVCSSHAI-QFPUQLAESA-N enalapril maleate Chemical compound OC(=O)\C=C/C(O)=O.C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 OYFJQPXVCSSHAI-QFPUQLAESA-N 0.000 description 3
- 230000036571 hydration Effects 0.000 description 3
- 238000006703 hydration reaction Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- CBTITARLOCZPDU-UHFFFAOYSA-N 1h-indole-2-carbonitrile Chemical compound C1=CC=C2NC(C#N)=CC2=C1 CBTITARLOCZPDU-UHFFFAOYSA-N 0.000 description 2
- ULRPISSMEBPJLN-UHFFFAOYSA-N 2h-tetrazol-5-amine Chemical compound NC1=NN=NN1 ULRPISSMEBPJLN-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 239000004475 Arginine Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 2
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 241000212342 Sium Species 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 150000003857 carboxamides Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 210000003437 trachea Anatomy 0.000 description 2
- NUMXHEUHHRTBQT-AATRIKPKSA-N 2,4-dimethoxy-1-[(e)-2-nitroethenyl]benzene Chemical compound COC1=CC=C(\C=C\[N+]([O-])=O)C(OC)=C1 NUMXHEUHHRTBQT-AATRIKPKSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- SDTMFDGELKWGFT-UHFFFAOYSA-N 2-methylpropan-2-olate Chemical compound CC(C)(C)[O-] SDTMFDGELKWGFT-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- JVSMPWHQUPKRNV-UHFFFAOYSA-N 2h-tetrazol-5-amine;hydrate Chemical compound O.NC=1N=NNN=1 JVSMPWHQUPKRNV-UHFFFAOYSA-N 0.000 description 1
- JMVAHJOWMMKDFK-UHFFFAOYSA-N 3,7-dimethoxy-4-phenylfuro[3,2-b]indole-2-carbonitrile Chemical compound C1=2C(OC)=C(C#N)OC=2C2=CC(OC)=CC=C2N1C1=CC=CC=C1 JMVAHJOWMMKDFK-UHFFFAOYSA-N 0.000 description 1
- JDJJPIVMJFSLJS-UHFFFAOYSA-N 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxamide Chemical compound C1=2C(OCC)=C(C(N)=O)OC=2C2=CC=CC=C2N1C1=CC=CC=C1 JDJJPIVMJFSLJS-UHFFFAOYSA-N 0.000 description 1
- YPWHLIAQBWWRBW-UHFFFAOYSA-N 3-hydroxy-1-methylindole-2-carboxylic acid Chemical compound C1=CC=C2N(C)C(C(O)=O)=C(O)C2=C1 YPWHLIAQBWWRBW-UHFFFAOYSA-N 0.000 description 1
- ZPWMFKICQTVLOU-UHFFFAOYSA-N 3-methoxy-4-methylfuro[3,2-b]indole-2-carboxylic acid Chemical compound C12=CC=CC=C2N(C)C2=C1OC(C(O)=O)=C2OC ZPWMFKICQTVLOU-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 101100018369 Arabidopsis thaliana ICR3 gene Proteins 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 101710125089 Bindin Proteins 0.000 description 1
- 101100275770 Caenorhabditis elegans cri-3 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- VEDTXTNSFWUXGQ-UHFFFAOYSA-N Carbophenothion Chemical compound CCOP(=S)(OCC)SCSC1=CC=C(Cl)C=C1 VEDTXTNSFWUXGQ-UHFFFAOYSA-N 0.000 description 1
- 102100038916 Caspase-5 Human genes 0.000 description 1
- UDHXJZHVNHGCEC-UHFFFAOYSA-N Chlorophacinone Chemical compound C1=CC(Cl)=CC=C1C(C=1C=CC=CC=1)C(=O)C1C(=O)C2=CC=CC=C2C1=O UDHXJZHVNHGCEC-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 101150039033 Eci2 gene Proteins 0.000 description 1
- VXLCNTLWWUDBSO-UHFFFAOYSA-N Ethiazide Chemical compound ClC1=C(S(N)(=O)=O)C=C2S(=O)(=O)NC(CC)NC2=C1 VXLCNTLWWUDBSO-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 244000228957 Ferula foetida Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 101100112336 Homo sapiens CASP5 gene Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 101100536883 Legionella pneumophila subsp. pneumophila (strain Philadelphia 1 / ATCC 33152 / DSM 7513) thi5 gene Proteins 0.000 description 1
- 101100273286 Mus musculus Casp4 gene Proteins 0.000 description 1
- 108010058846 Ovalbumin Proteins 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- 101150107341 RERE gene Proteins 0.000 description 1
- 101100313003 Rattus norvegicus Tanc1 gene Proteins 0.000 description 1
- PQUGCKBLVKJMNT-UHFFFAOYSA-N SC560 Chemical compound C1=CC(OC)=CC=C1N1C(C=2C=CC(Cl)=CC=2)=CC(C(F)(F)F)=N1 PQUGCKBLVKJMNT-UHFFFAOYSA-N 0.000 description 1
- 241001275899 Salta Species 0.000 description 1
- 101100240664 Schizosaccharomyces pombe (strain 972 / ATCC 24843) nmt1 gene Proteins 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 238000010009 beating Methods 0.000 description 1
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 230000000857 drug effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical compound C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- NQPIEWBAWBFGOB-UHFFFAOYSA-N methyl 1h-indole-2-carboxylate Chemical compound C1=CC=C2NC(C(=O)OC)=CC2=C1 NQPIEWBAWBFGOB-UHFFFAOYSA-N 0.000 description 1
- WIHCDHFIANBLMI-UHFFFAOYSA-N methyl 3-hydroxy-1-phenylindole-2-carboxylate Chemical compound COC(=O)C1=C(O)C2=CC=CC=C2N1C1=CC=CC=C1 WIHCDHFIANBLMI-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- KERBAAIBDHEFDD-UHFFFAOYSA-N n-ethylformamide Chemical compound CCNC=O KERBAAIBDHEFDD-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229940092253 ovalbumin Drugs 0.000 description 1
- 125000003431 oxalo group Chemical group 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- ALDITMKAAPLVJK-UHFFFAOYSA-N prop-1-ene;hydrate Chemical group O.CC=C ALDITMKAAPLVJK-UHFFFAOYSA-N 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical group CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/12—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems
- C07D265/14—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D265/20—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring with hetero atoms directly attached in position 4
- C07D265/22—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/42—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US36944882A | 1982-04-19 | 1982-04-19 | |
| US369,448 | 1982-04-19 | ||
| US456,121 | 1983-01-10 | ||
| US06/456,121 US4503236A (en) | 1982-04-19 | 1983-01-10 | Antiallergic 4Hfuro[3,2-b]indoles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1194880A true CA1194880A (en) | 1985-10-08 |
Family
ID=27004584
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000426192A Expired CA1194880A (en) | 1982-04-19 | 1983-04-19 | Antiallergic 4h-furo¬3,2-b|indoles |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4503236A (Direct) |
| EP (1) | EP0092380B1 (Direct) |
| KR (1) | KR870000933B1 (Direct) |
| AR (1) | AR240457A1 (Direct) |
| AU (1) | AU556487B2 (Direct) |
| CA (1) | CA1194880A (Direct) |
| DE (1) | DE3375396D1 (Direct) |
| DK (1) | DK157025C (Direct) |
| ES (1) | ES521563A0 (Direct) |
| FI (1) | FI77246C (Direct) |
| GR (1) | GR78343B (Direct) |
| HU (1) | HU191209B (Direct) |
| IE (1) | IE54834B1 (Direct) |
| IL (1) | IL68192A (Direct) |
| NO (1) | NO159600C (Direct) |
| NZ (1) | NZ203908A (Direct) |
| PH (1) | PH18914A (Direct) |
| PT (1) | PT76570B (Direct) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4596814A (en) * | 1983-01-10 | 1986-06-24 | Warner-Lambert Company | Tetrazolyl- and carboxamidotetrazolyl-substituted 4H-furo[3,2-b] indoles and anti-allergic use thereof |
| US4748183A (en) * | 1986-06-13 | 1988-05-31 | Warner-Lambert Company | N-1H-tetrazol-5-yl-2-thiophene carboxamides, N-1H-tetrazol-5-yl-2-pyrrole carboxamides, N-1H-tetrazol-5-yl-2-furan carboxamides, and anti-allergic and anti-inflammatory use thereof |
| JPH04217684A (ja) * | 1990-05-30 | 1992-08-07 | Shionogi & Co Ltd | アルド−ス還元酵素阻害物質 |
| GB9110625D0 (en) * | 1991-05-16 | 1991-07-03 | Glaxo Group Ltd | Chemical compounds |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1296469A (Direct) * | 1970-02-05 | 1972-11-15 | ||
| US4028383A (en) * | 1975-09-08 | 1977-06-07 | Warner-Lambert Company | Indolopyrones having antiallergic activity |
| DE2837236A1 (de) * | 1977-09-30 | 1979-04-05 | Warner Lambert Co | Indolopyrone und ihre verwendung |
-
1983
- 1983-01-10 US US06/456,121 patent/US4503236A/en not_active Expired - Lifetime
- 1983-03-21 IE IE612/83A patent/IE54834B1/en not_active IP Right Cessation
- 1983-03-22 IL IL68192A patent/IL68192A/xx unknown
- 1983-04-14 GR GR71084A patent/GR78343B/el unknown
- 1983-04-14 EP EP83302099A patent/EP0092380B1/en not_active Expired
- 1983-04-14 AU AU13511/83A patent/AU556487B2/en not_active Expired
- 1983-04-14 DE DE8383302099T patent/DE3375396D1/de not_active Expired
- 1983-04-15 KR KR1019830001595A patent/KR870000933B1/ko not_active Expired
- 1983-04-15 FI FI831272A patent/FI77246C/fi not_active IP Right Cessation
- 1983-04-15 PH PH28783A patent/PH18914A/en unknown
- 1983-04-18 NZ NZ203908A patent/NZ203908A/en unknown
- 1983-04-18 ES ES521563A patent/ES521563A0/es active Granted
- 1983-04-18 NO NO831364A patent/NO159600C/no not_active IP Right Cessation
- 1983-04-18 HU HU831341A patent/HU191209B/hu not_active IP Right Cessation
- 1983-04-18 DK DK169783A patent/DK157025C/da not_active IP Right Cessation
- 1983-04-19 PT PT76570A patent/PT76570B/pt unknown
- 1983-04-19 CA CA000426192A patent/CA1194880A/en not_active Expired
- 1983-04-19 AR AR292747A patent/AR240457A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| EP0092380A3 (en) | 1984-05-30 |
| FI831272L (fi) | 1983-10-20 |
| NZ203908A (en) | 1985-12-13 |
| PT76570A (en) | 1983-05-01 |
| AR240457A1 (es) | 1990-03-30 |
| KR840004432A (ko) | 1984-10-15 |
| NO159600B (no) | 1988-10-10 |
| EP0092380A2 (en) | 1983-10-26 |
| IE54834B1 (en) | 1990-02-28 |
| HU191209B (en) | 1987-01-28 |
| AU556487B2 (en) | 1986-11-06 |
| KR870000933B1 (ko) | 1987-05-11 |
| DE3375396D1 (en) | 1988-02-25 |
| IL68192A0 (en) | 1983-06-15 |
| PH18914A (en) | 1985-11-06 |
| IE830612L (en) | 1983-10-19 |
| DK157025C (da) | 1990-03-26 |
| DK169783A (da) | 1983-10-20 |
| ES8406486A1 (es) | 1984-07-01 |
| US4503236A (en) | 1985-03-05 |
| DK157025B (da) | 1989-10-30 |
| NO831364L (no) | 1983-10-20 |
| DK169783D0 (da) | 1983-04-18 |
| EP0092380B1 (en) | 1988-01-20 |
| FI77246B (fi) | 1988-10-31 |
| FI831272A0 (fi) | 1983-04-15 |
| FI77246C (fi) | 1989-02-10 |
| PT76570B (pt) | 1985-12-10 |
| NO159600C (no) | 1989-01-18 |
| GR78343B (Direct) | 1984-09-26 |
| AU1351183A (en) | 1983-10-27 |
| ES521563A0 (es) | 1984-07-01 |
| IL68192A (en) | 1985-11-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TWI833829B (zh) | 聯苯類化合物,其中間體,製備方法,藥物組合物及應用 | |
| KR100388345B1 (ko) | 신규헤테로시클릭유도체및이것의의약용도 | |
| US5288743A (en) | Indole carboxylate derivatives which inhibit leukotriene biosynthesis | |
| US4269846A (en) | Heterocyclic compounds useful as anti-allergy agents | |
| BR112021010871A2 (pt) | Composto agonista do receptor thrb e método de preparação e uso do mesmo | |
| MX2008012738A (es) | Heterocompuesto. | |
| JP4986927B2 (ja) | 医薬 | |
| JPWO2003048134A1 (ja) | トリアゾール化合物及びその医薬用途 | |
| US4087444A (en) | Amides as ovulation inhibitors | |
| CA1194880A (en) | Antiallergic 4h-furo¬3,2-b|indoles | |
| JPH06116241A (ja) | アリール基又は複素芳香環基置換アミノキノロン誘導体及びエイズ治療剤 | |
| CA1070311A (en) | N-(1-((1,3-dihydro-1,3-dioxo-2h-benz(de) isoquinolin-2-yl)-alkyl)-4-piperidinyl)-n-phenylalkylamides | |
| IE904448A1 (en) | Carbamoyl derivatives | |
| FI107922B (fi) | Menetelmä terapeuttisesti aktiivisen amorfisen 3-[N-(p-klooribentsyyli)-3-(t-butyylitio)-5-(kinolin-2-yylimetoksi)indol-2-yyli]-2,2-dimetyylipropaanihapon natriumsuolan valmistamiseksi | |
| US5830902A (en) | Quinuclidine derivative having tricyclic hetero condensed ring | |
| CN110668992B (zh) | Ido/hdac双靶点化合物及其合成方法和应用 | |
| Tilley et al. | Antagonists of slow-reacting substance of anaphylaxis. 1. Pyrido [2, 1-b] quinazolinecarboxylic acid derivatives | |
| IE43725B1 (en) | N-/2-(5-methoxy-6-halo-indol-3-yl)ethyl/-amides,methods for their preparation and their use | |
| US4062953A (en) | Various 2-substituted-1H-benz[de]isoquinoline-1,3(2H)-diones | |
| US5057526A (en) | Pharmaceutically active pyridinyl substituted 5,7-dihydropyrrolo-[3,2-f]benzoxazole-6-ones | |
| CA1110249A (en) | Indolopyrones having antiallergic activity | |
| US4421919A (en) | 4-Oximino-1,2,3,4-tetrahydroquinoline derivatives | |
| GB2126230A (en) | Substituted 1-pyridyloxy-3- indolylakylamino-2-propanols, preparation, and use thereof | |
| CN105315275B (zh) | 一类吡唑酮化合物及其用途 | |
| PL163431B1 (pl) | Sposób wytwarzania nowych pochodnych 1-oksa-2-okso-8-azaspiro[4.5]dekanu PL PL |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEC | Expiry (correction) | ||
| MKEX | Expiry |