CA1188911A - Silver halide emulsions containing aromatic latent image stabilizing compounds - Google Patents
Silver halide emulsions containing aromatic latent image stabilizing compoundsInfo
- Publication number
- CA1188911A CA1188911A CA000427264A CA427264A CA1188911A CA 1188911 A CA1188911 A CA 1188911A CA 000427264 A CA000427264 A CA 000427264A CA 427264 A CA427264 A CA 427264A CA 1188911 A CA1188911 A CA 1188911A
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- latent image
- silver halide
- hydrogen
- halide emulsion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052709 silver Inorganic materials 0.000 title claims abstract description 39
- 239000004332 silver Substances 0.000 title claims abstract description 39
- 150000001875 compounds Chemical class 0.000 title claims abstract description 37
- -1 Silver halide Chemical class 0.000 title claims abstract description 30
- 239000000839 emulsion Substances 0.000 title claims abstract description 26
- 230000000087 stabilizing effect Effects 0.000 title claims abstract description 17
- 125000003118 aryl group Chemical group 0.000 title claims abstract description 11
- 150000002500 ions Chemical class 0.000 claims abstract description 31
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 27
- 239000001257 hydrogen Substances 0.000 claims abstract description 26
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 24
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 12
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 9
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 8
- 150000001768 cations Chemical class 0.000 claims abstract description 8
- 229910052798 chalcogen Inorganic materials 0.000 claims abstract description 8
- 150000001787 chalcogens Chemical class 0.000 claims abstract description 8
- 238000005562 fading Methods 0.000 claims abstract description 5
- 229910021645 metal ion Inorganic materials 0.000 claims abstract description 5
- 150000004010 onium ions Chemical class 0.000 claims abstract description 5
- 125000004429 atom Chemical group 0.000 claims abstract description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract 4
- 150000002431 hydrogen Chemical group 0.000 claims description 14
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 8
- 239000011701 zinc Substances 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 239000011575 calcium Substances 0.000 claims description 4
- 238000011161 development Methods 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- 229910052725 zinc Inorganic materials 0.000 claims description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 239000011248 coating agent Substances 0.000 claims description 3
- 238000000576 coating method Methods 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- WLZRMCYVCSSEQC-UHFFFAOYSA-N cadmium(2+) Chemical compound [Cd+2] WLZRMCYVCSSEQC-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 230000006872 improvement Effects 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims 2
- 125000006678 phenoxycarbonyl group Chemical group 0.000 claims 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims 1
- 206010070834 Sensitisation Diseases 0.000 claims 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims 1
- 229910052797 bismuth Inorganic materials 0.000 claims 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims 1
- 229910052793 cadmium Inorganic materials 0.000 claims 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims 1
- 229940006463 cadmium cation Drugs 0.000 claims 1
- 229910052749 magnesium Inorganic materials 0.000 claims 1
- 239000011777 magnesium Substances 0.000 claims 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- 239000011591 potassium Substances 0.000 claims 1
- 230000008313 sensitization Effects 0.000 claims 1
- 230000003595 spectral effect Effects 0.000 claims 1
- 229910052712 strontium Inorganic materials 0.000 claims 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims 1
- 229940006486 zinc cation Drugs 0.000 claims 1
- 150000004820 halides Chemical class 0.000 description 16
- 239000000463 material Substances 0.000 description 6
- 239000003381 stabilizer Substances 0.000 description 6
- 230000000737 periodic effect Effects 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 241000282320 Panthera leo Species 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 229940125797 compound 12 Drugs 0.000 description 2
- 229940126214 compound 3 Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 2
- 229910052737 gold Inorganic materials 0.000 description 2
- 239000010931 gold Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- CBEQRNSPHCCXSH-UHFFFAOYSA-N iodine monobromide Chemical compound IBr CBEQRNSPHCCXSH-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- 229910052714 tellurium Inorganic materials 0.000 description 2
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 2
- OPFTUNCRGUEPRZ-UHFFFAOYSA-N (+)-beta-Elemen Natural products CC(=C)C1CCC(C)(C=C)C(C(C)=C)C1 OPFTUNCRGUEPRZ-UHFFFAOYSA-N 0.000 description 1
- OPFTUNCRGUEPRZ-QLFBSQMISA-N (-)-beta-elemene Chemical compound CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 1
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 1
- RYYXDZDBXNUPOG-UHFFFAOYSA-N 4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;dihydrochloride Chemical compound Cl.Cl.C1C(N)CCC2=C1SC(N)=N2 RYYXDZDBXNUPOG-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 229910002975 Cd Pb Inorganic materials 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- 101100536354 Drosophila melanogaster tant gene Proteins 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 235000010804 Maranta arundinacea Nutrition 0.000 description 1
- 240000007673 Origanum vulgare Species 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 244000145580 Thalia geniculata Species 0.000 description 1
- 235000012419 Thalia geniculata Nutrition 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 229920002494 Zein Polymers 0.000 description 1
- 240000000038 Ziziphus mauritiana Species 0.000 description 1
- 235000006545 Ziziphus mauritiana Nutrition 0.000 description 1
- HOLVRJRSWZOAJU-UHFFFAOYSA-N [Ag].ICl Chemical compound [Ag].ICl HOLVRJRSWZOAJU-UHFFFAOYSA-N 0.000 description 1
- 150000001260 acyclic compounds Chemical class 0.000 description 1
- JYZIHLWOWKMNNX-UHFFFAOYSA-N benzimidazole Chemical compound C1=C[CH]C2=NC=NC2=C1 JYZIHLWOWKMNNX-UHFFFAOYSA-N 0.000 description 1
- KXNQKOAQSGJCQU-UHFFFAOYSA-N benzo[e][1,3]benzothiazole Chemical class C1=CC=C2C(N=CS3)=C3C=CC2=C1 KXNQKOAQSGJCQU-UHFFFAOYSA-N 0.000 description 1
- 235000021028 berry Nutrition 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000298 carbocyanine Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- KOWWOODYPWDWOJ-LVBPXUMQSA-N elatine Chemical compound C([C@]12CN(C3[C@@]45OCO[C@]44[C@H]6[C@@H](OC)[C@@H]([C@H](C4)OC)C[C@H]6[C@@]3([C@@H]1[C@@H]5OC)[C@@H](OC)CC2)CC)OC(=O)C1=CC=CC=C1N1C(=O)CC(C)C1=O KOWWOODYPWDWOJ-LVBPXUMQSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- DWYMPOCYEZONEA-UHFFFAOYSA-L fluoridophosphate Chemical compound [O-]P([O-])(F)=O DWYMPOCYEZONEA-UHFFFAOYSA-L 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000008676 import Effects 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000014786 phosphorus Nutrition 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 239000005019 zein Substances 0.000 description 1
- 229940093612 zein Drugs 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/06—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein with non-macromolecular additives
- G03C1/34—Fog-inhibitors; Stabilisers; Agents inhibiting latent image regression
- G03C1/346—Organic derivatives of bivalent sulfur, selenium or tellurium
Landscapes
- Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/392,043 US4423140A (en) | 1982-06-25 | 1982-06-25 | Silver halide emulsions containing aromatic latent image stabilizing compounds |
| US392,043 | 1989-08-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1188911A true CA1188911A (en) | 1985-06-18 |
Family
ID=23549018
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000427264A Expired CA1188911A (en) | 1982-06-25 | 1983-05-03 | Silver halide emulsions containing aromatic latent image stabilizing compounds |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4423140A (https=) |
| EP (1) | EP0098213B1 (https=) |
| JP (1) | JPS5926731A (https=) |
| CA (1) | CA1188911A (https=) |
| DE (1) | DE3370548D1 (https=) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58134636A (ja) * | 1982-02-05 | 1983-08-10 | Konishiroku Photo Ind Co Ltd | ハロゲン化銀写真感光材料処理用画像安定化液 |
| US4578348A (en) * | 1985-03-18 | 1986-03-25 | Eastman Kodak Company | Hydrolyzed azolium speed enhancing/fog-inhibiting agents for silver halide photography |
| IT1204319B (it) * | 1986-04-28 | 1989-03-01 | Minnesota Mining & Mfg | Emulsione agli alogenuri d'argento contenente un sale di n-alchenil-tiazolio 2-non-sostituito come stabilizzatore dell'immagine latente ed elementi fotografici che contengono detta emulsione |
| JPH0778611B2 (ja) * | 1988-11-15 | 1995-08-23 | 富士写真フイルム株式会社 | ハロゲン化銀写真乳剤 |
| US4948721A (en) * | 1989-07-26 | 1990-08-14 | Eastman Kodak Company | Photographic recording materials with enhanced latent image stability |
| IT1245856B (it) * | 1991-04-03 | 1994-10-25 | Minnesota Mining & Mfg | Materiale fotografico a colori a piu' strati agli alogenuri d'argento comprendente un supersensibilizzatore disolfurico |
| US5620837A (en) * | 1995-12-28 | 1997-04-15 | Eastman Kodak Company | Color photographic element containing benzazolium compounds |
| US6713240B2 (en) * | 2002-07-11 | 2004-03-30 | Eastman Kodak Company | Black-and-white aqueous photothermographic materials containing mercaptotriazole toners |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2131038A (en) * | 1932-05-26 | 1938-09-27 | Eastman Kodak Co | Photographic emulsion containing alkyl quaternary salts of thiazoles and the like asantifoggants |
| GB522997A (en) | 1938-09-23 | 1940-07-03 | Kodak Ltd | Improvements in photographic emulsions |
| USRE28668E (en) | 1971-05-03 | 1975-12-30 | Silver halide emulsions containing alkyl selenols and thiols as antifoggants | |
| US3732103A (en) * | 1971-05-03 | 1973-05-08 | Eastman Kodak Co | Silver halide emulsions containing alkyl selenols and thiols as antifoggants |
| JPS5512581B2 (https=) * | 1973-12-21 | 1980-04-02 | ||
| US4131470A (en) * | 1976-12-21 | 1978-12-26 | Veb Filmfabrik Wolfen | Process for the stabilization and antifogging of photographic silver halide emulsions |
| US4374196A (en) * | 1981-02-20 | 1983-02-15 | Eastman Kodak Company | Silver halide emulsions containing latent image stabilizing compounds |
-
1982
- 1982-06-25 US US06/392,043 patent/US4423140A/en not_active Ceased
-
1983
- 1983-05-03 CA CA000427264A patent/CA1188911A/en not_active Expired
- 1983-06-23 EP EP83401298A patent/EP0098213B1/en not_active Expired
- 1983-06-23 DE DE8383401298T patent/DE3370548D1/de not_active Expired
- 1983-06-24 JP JP58112955A patent/JPS5926731A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0098213A2 (en) | 1984-01-11 |
| EP0098213B1 (en) | 1987-03-25 |
| JPH0434732B2 (https=) | 1992-06-08 |
| DE3370548D1 (en) | 1987-04-30 |
| US4423140A (en) | 1983-12-27 |
| EP0098213A3 (en) | 1984-12-27 |
| JPS5926731A (ja) | 1984-02-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1188911A (en) | Silver halide emulsions containing aromatic latent image stabilizing compounds | |
| EP0517889B1 (en) | Thiosulfonate-sulfinate stabilizers for photosensitive emulsions | |
| US4374196A (en) | Silver halide emulsions containing latent image stabilizing compounds | |
| EP0573854B1 (en) | Color photographic materials and methods with stabilized silver chloride emulsions | |
| US5413905A (en) | Photographic sensitivity increasing alkynylamine compounds and photographic elements | |
| US5399479A (en) | Photographic element exhibiting improved speed and stability | |
| JP3597624B2 (ja) | 写真要素および写真要素の生成方法 | |
| US5693460A (en) | Silver halide photographic elements containing dioxide compunds a stabilizers | |
| EP0658803B1 (en) | A class of compounds which increases and stabilizes photographic speed | |
| US4861703A (en) | Cyclic dichalcogenide fog inhibiting agents for silver halide photography | |
| EP0196927B1 (en) | Divalent chalcogenide fog-inhibiting agents for silver halide photography | |
| EP0488030B1 (en) | Photographic materials with enhanced latent image stability | |
| EP0410752B1 (en) | Photographic recording materials with enhanced latent image stability | |
| USRE32195E (en) | Silver halide emulsions containing aromatic latent image stabilizing compounds | |
| EP0490297B1 (en) | Photographic materials with enhanced latent image stability | |
| US5601970A (en) | Photographic elements exhibiting improved stability | |
| US4581330A (en) | Tellurium salt fog inhibiting agents for silver halide photography | |
| US5429919A (en) | Silver halide photographic elements with increased contrast | |
| JPH0365946A (ja) | 潜像安定性を有する写真記録材料 | |
| US5415992A (en) | Heat stabilized silver chloride photographic emulsions containing phosphine compounds | |
| US5652090A (en) | Silver halide photographic elements containing dithiolone compounds | |
| EP0775936B1 (en) | Silver halide photographic elements containing dioxide compounds as stabilizers | |
| JPH10161261A (ja) | 写真用ハロゲン化銀乳剤 | |
| US5925509A (en) | Photographic material having a red sensitized silver halide emulsion layer with improved heat sensitivity | |
| JPH07199395A (ja) | ハロゲン化銀写真要素及びハロゲン化銀乳剤の製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEC | Expiry (correction) | ||
| MKEX | Expiry |