CA1180017A - Sulfur-substituted phenoxypyridines having antiviral activity - Google Patents
Sulfur-substituted phenoxypyridines having antiviral activityInfo
- Publication number
- CA1180017A CA1180017A CA000409151A CA409151A CA1180017A CA 1180017 A CA1180017 A CA 1180017A CA 000409151 A CA000409151 A CA 000409151A CA 409151 A CA409151 A CA 409151A CA 1180017 A CA1180017 A CA 1180017A
- Authority
- CA
- Canada
- Prior art keywords
- bromo
- chloro
- pyridine
- fluoro
- phenoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 Sulfur-substituted phenoxypyridines Chemical class 0.000 title claims abstract description 74
- 230000000840 anti-viral effect Effects 0.000 title abstract description 17
- 238000000034 method Methods 0.000 claims abstract description 42
- 239000000203 mixture Substances 0.000 claims abstract description 35
- 150000001875 compounds Chemical class 0.000 claims description 95
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 64
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 26
- 229910052739 hydrogen Inorganic materials 0.000 claims description 25
- 239000001257 hydrogen Substances 0.000 claims description 25
- 125000001246 bromo group Chemical group Br* 0.000 claims description 24
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 24
- 125000001424 substituent group Chemical group 0.000 claims description 24
- 125000000217 alkyl group Chemical group 0.000 claims description 23
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 23
- 239000000047 product Substances 0.000 claims description 21
- 150000002431 hydrogen Chemical class 0.000 claims description 19
- 230000008569 process Effects 0.000 claims description 16
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 15
- 125000001153 fluoro group Chemical group F* 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 12
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 12
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 239000012954 diazonium Substances 0.000 claims description 11
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 10
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- 239000002585 base Substances 0.000 claims description 9
- 150000001989 diazonium salts Chemical class 0.000 claims description 9
- 229910052700 potassium Inorganic materials 0.000 claims description 9
- 239000011591 potassium Substances 0.000 claims description 9
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 8
- 125000002346 iodo group Chemical group I* 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical group CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 claims description 6
- 239000012991 xanthate Substances 0.000 claims description 6
- WDNBURPWRNALGP-UHFFFAOYSA-N 3,4-Dichlorophenol Chemical compound OC1=CC=C(Cl)C(Cl)=C1 WDNBURPWRNALGP-UHFFFAOYSA-N 0.000 claims description 5
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 239000007800 oxidant agent Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 125000004434 sulfur atom Chemical group 0.000 claims description 5
- 150000003573 thiols Chemical class 0.000 claims description 5
- DITIKLITWMCCSH-UHFFFAOYSA-N 2,5-bis(ethylsulfonyl)pyridine Chemical compound CCS(=O)(=O)C1=CC=C(S(=O)(=O)CC)N=C1 DITIKLITWMCCSH-UHFFFAOYSA-N 0.000 claims description 4
- IBEOGICJOHYRCR-UHFFFAOYSA-N 2,5-bis(methylsulfonyl)pyridine Chemical compound CS(=O)(=O)C1=CC=C(S(C)(=O)=O)N=C1 IBEOGICJOHYRCR-UHFFFAOYSA-N 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 150000002989 phenols Chemical class 0.000 claims description 4
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 claims description 4
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- XUUNNDIYQMQICF-UHFFFAOYSA-N 2,3-disulfonylpyridine Chemical compound O=S(=O)=C1C=CC=NC1=S(=O)=O XUUNNDIYQMQICF-UHFFFAOYSA-N 0.000 claims description 3
- LSEYIQDGKZQLHT-UHFFFAOYSA-N 2-(3,4-dichlorophenoxy)-5-ethylsulfonylpyridine Chemical compound N1=CC(S(=O)(=O)CC)=CC=C1OC1=CC=C(Cl)C(Cl)=C1 LSEYIQDGKZQLHT-UHFFFAOYSA-N 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 claims description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 claims description 2
- 150000001350 alkyl halides Chemical class 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 239000012467 final product Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- JCBJVAJGLKENNC-UHFFFAOYSA-M potassium ethyl xanthate Chemical compound [K+].CCOC([S-])=S JCBJVAJGLKENNC-UHFFFAOYSA-M 0.000 claims description 2
- OTZXJTPXQYLTDA-UHFFFAOYSA-N 2-(3,4-dichlorophenoxy)-5-methylsulfonylpyridine Chemical compound N1=CC(S(=O)(=O)C)=CC=C1OC1=CC=C(Cl)C(Cl)=C1 OTZXJTPXQYLTDA-UHFFFAOYSA-N 0.000 claims 2
- SORJEUJLZYDSFX-UHFFFAOYSA-N 2-(4-chlorophenoxy)-5-ethylsulfonylpyridine Chemical compound N1=CC(S(=O)(=O)CC)=CC=C1OC1=CC=C(Cl)C=C1 SORJEUJLZYDSFX-UHFFFAOYSA-N 0.000 claims 2
- MBLWJZNIXCZAHS-UHFFFAOYSA-N 2-(4-chlorophenoxy)-5-methylsulfonylpyridine Chemical compound N1=CC(S(=O)(=O)C)=CC=C1OC1=CC=C(Cl)C=C1 MBLWJZNIXCZAHS-UHFFFAOYSA-N 0.000 claims 2
- NPFYZDNDJHZQKY-UHFFFAOYSA-N 4-Hydroxybenzophenone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 NPFYZDNDJHZQKY-UHFFFAOYSA-N 0.000 claims 2
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 claims 2
- 150000003222 pyridines Chemical class 0.000 claims 2
- 230000000911 decarboxylating effect Effects 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 66
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 39
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 25
- 241000700605 Viruses Species 0.000 description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- 239000000243 solution Substances 0.000 description 21
- 238000012360 testing method Methods 0.000 description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 18
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 18
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- 235000019441 ethanol Nutrition 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- 238000001953 recrystallisation Methods 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 9
- 235000007686 potassium Nutrition 0.000 description 8
- 229960003975 potassium Drugs 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 241001465754 Metazoa Species 0.000 description 7
- 241000699670 Mus sp. Species 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 6
- 241000709661 Enterovirus Species 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 239000002609 medium Substances 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000000023 Kugelrohr distillation Methods 0.000 description 5
- 238000004113 cell culture Methods 0.000 description 5
- 238000006114 decarboxylation reaction Methods 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 4
- 241000709664 Picornaviridae Species 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- 230000000120 cytopathologic effect Effects 0.000 description 4
- 239000003937 drug carrier Substances 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 230000003612 virological effect Effects 0.000 description 4
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- 229920003091 Methocel™ Polymers 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002178 crystalline material Substances 0.000 description 3
- 230000034994 death Effects 0.000 description 3
- 231100000517 death Toxicity 0.000 description 3
- 239000012894 fetal calf serum Substances 0.000 description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 3
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 238000004448 titration Methods 0.000 description 3
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 3
- UMPSXRYVXUPCOS-UHFFFAOYSA-N 2,3-dichlorophenol Chemical compound OC1=CC=CC(Cl)=C1Cl UMPSXRYVXUPCOS-UHFFFAOYSA-N 0.000 description 2
- KLMRASZQFFHFAE-UHFFFAOYSA-N 2,5-bis(cyclohexylsulfonyl)pyridine Chemical compound C=1C=C(S(=O)(=O)C2CCCCC2)N=CC=1S(=O)(=O)C1CCCCC1 KLMRASZQFFHFAE-UHFFFAOYSA-N 0.000 description 2
- QYQDDPYRQILZLY-UHFFFAOYSA-N 2-(3,4-dichlorophenoxy)-4-methylsulfonylpyridine Chemical compound CS(=O)(=O)C1=CC=NC(OC=2C=C(Cl)C(Cl)=CC=2)=C1 QYQDDPYRQILZLY-UHFFFAOYSA-N 0.000 description 2
- PCLKVJBRTCQNDU-UHFFFAOYSA-N 2-methylsulfonylpyridine Chemical compound CS(=O)(=O)C1=CC=CC=N1 PCLKVJBRTCQNDU-UHFFFAOYSA-N 0.000 description 2
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 2
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LUSZGTFNYDARNI-UHFFFAOYSA-N Sesamol Chemical compound OC1=CC=C2OCOC2=C1 LUSZGTFNYDARNI-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000037213 diet Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 229940093956 potassium carbonate Drugs 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OFRWPNXPCRZKFK-UHFFFAOYSA-N 1-[4-(5-propan-2-ylsulfonylpyridin-2-yl)oxyphenyl]ethanone Chemical compound N1=CC(S(=O)(=O)C(C)C)=CC=C1OC1=CC=C(C(C)=O)C=C1 OFRWPNXPCRZKFK-UHFFFAOYSA-N 0.000 description 1
- LHJGJYXLEPZJPM-UHFFFAOYSA-N 2,4,5-trichlorophenol Chemical compound OC1=CC(Cl)=C(Cl)C=C1Cl LHJGJYXLEPZJPM-UHFFFAOYSA-N 0.000 description 1
- YRVMIQVQCOLSIM-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)pyridine Chemical compound CS(=O)(=O)C1=CC=NC(S(C)(=O)=O)=C1 YRVMIQVQCOLSIM-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- 125000006183 2,4-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C(=C1[H])C([H])([H])*)C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- NMLDTRGKJIBUIC-UHFFFAOYSA-N 2,5-bis(benzenesulfonyl)pyridine Chemical compound C=1C=C(S(=O)(=O)C=2C=CC=CC=2)N=CC=1S(=O)(=O)C1=CC=CC=C1 NMLDTRGKJIBUIC-UHFFFAOYSA-N 0.000 description 1
- WKAAHMMVNKWLHA-UHFFFAOYSA-N 2,5-bis(benzylsulfonyl)pyridine Chemical compound C=1C=C(S(=O)(=O)CC=2C=CC=CC=2)N=CC=1S(=O)(=O)CC1=CC=CC=C1 WKAAHMMVNKWLHA-UHFFFAOYSA-N 0.000 description 1
- KJNQZEWPJOTPCI-UHFFFAOYSA-N 2,5-bis(hexylsulfonyl)pyridine Chemical compound CCCCCCS(=O)(=O)C1=CC=C(S(=O)(=O)CCCCCC)N=C1 KJNQZEWPJOTPCI-UHFFFAOYSA-N 0.000 description 1
- WZVMWAUGHRPLTI-UHFFFAOYSA-N 2-(3,4-dichlorophenoxy)-5-methylsulfanylpyridine Chemical compound N1=CC(SC)=CC=C1OC1=CC=C(Cl)C(Cl)=C1 WZVMWAUGHRPLTI-UHFFFAOYSA-N 0.000 description 1
- IXZOUXZKBAMFFP-UHFFFAOYSA-N 2-(3,4-dichlorophenoxy)-5-methylsulfinylpyridine Chemical compound N1=CC(S(=O)C)=CC=C1OC1=CC=C(Cl)C(Cl)=C1 IXZOUXZKBAMFFP-UHFFFAOYSA-N 0.000 description 1
- HCKRVDMELMIVRX-UHFFFAOYSA-N 2-(4-bromophenoxy)-5-cyclohexylsulfonylpyridine Chemical compound C1=CC(Br)=CC=C1OC1=CC=C(S(=O)(=O)C2CCCCC2)C=N1 HCKRVDMELMIVRX-UHFFFAOYSA-N 0.000 description 1
- XMHVDYNFJIXDFV-UHFFFAOYSA-N 2-(4-bromophenoxy)-6-methylsulfonylpyridine Chemical compound CS(=O)(=O)C1=CC=CC(OC=2C=CC(Br)=CC=2)=N1 XMHVDYNFJIXDFV-UHFFFAOYSA-N 0.000 description 1
- IHQMHYURKNHPAD-UHFFFAOYSA-N 2-(4-tert-butylphenoxy)-5-methylsulfonylpyridine Chemical compound C1=CC(C(C)(C)C)=CC=C1OC1=CC=C(S(C)(=O)=O)C=N1 IHQMHYURKNHPAD-UHFFFAOYSA-N 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004362 3,4,5-trichlorophenyl group Chemical group [H]C1=C(Cl)C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- AQWUQMZNAPOQIC-UHFFFAOYSA-N 3-(3,4-dichlorophenoxy)-5-methylsulfanylpyridine Chemical compound CSC1=CN=CC(OC=2C=C(Cl)C(Cl)=CC=2)=C1 AQWUQMZNAPOQIC-UHFFFAOYSA-N 0.000 description 1
- HGPYRUVUVCZCKE-UHFFFAOYSA-N 3-(3,4-dichlorophenoxy)-5-methylsulfanylpyridine-2-carboxylic acid Chemical compound CSC1=CN=C(C(O)=O)C(OC=2C=C(Cl)C(Cl)=CC=2)=C1 HGPYRUVUVCZCKE-UHFFFAOYSA-N 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- JAGVCPHIQXGPHB-UHFFFAOYSA-N 3-ethylsulfanylpyridine Chemical compound CCSC1=CC=CN=C1 JAGVCPHIQXGPHB-UHFFFAOYSA-N 0.000 description 1
- WKRFAZABSKCRJU-UHFFFAOYSA-N 3-ethylsulfonylpyridine Chemical compound CCS(=O)(=O)C1=CC=CN=C1 WKRFAZABSKCRJU-UHFFFAOYSA-N 0.000 description 1
- CPNKUVGTJZODLT-UHFFFAOYSA-N 4-(5-methylsulfonylpyridin-2-yl)oxybenzonitrile Chemical compound N1=CC(S(=O)(=O)C)=CC=C1OC1=CC=C(C#N)C=C1 CPNKUVGTJZODLT-UHFFFAOYSA-N 0.000 description 1
- YYCPTWHVKSATQK-UHFFFAOYSA-N 4-(trifluoromethylsulfanyl)phenol Chemical compound OC1=CC=C(SC(F)(F)F)C=C1 YYCPTWHVKSATQK-UHFFFAOYSA-N 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- MLCWUSOMHMJHJR-UHFFFAOYSA-N 5-benzylsulfonyl-2-(3,4-dichlorophenoxy)pyridine Chemical compound C1=C(Cl)C(Cl)=CC=C1OC1=CC=C(S(=O)(=O)CC=2C=CC=CC=2)C=N1 MLCWUSOMHMJHJR-UHFFFAOYSA-N 0.000 description 1
- DMAWDKBGWYWIPZ-UHFFFAOYSA-N 5-ethylsulfonyl-2-(2,4,5-trichlorophenoxy)pyridine Chemical compound N1=CC(S(=O)(=O)CC)=CC=C1OC1=CC(Cl)=C(Cl)C=C1Cl DMAWDKBGWYWIPZ-UHFFFAOYSA-N 0.000 description 1
- XKEIYUZOZPKZGA-UHFFFAOYSA-N 5-methylsulfonyl-2-(4-phenoxyphenoxy)pyridine Chemical compound N1=CC(S(=O)(=O)C)=CC=C1OC(C=C1)=CC=C1OC1=CC=CC=C1 XKEIYUZOZPKZGA-UHFFFAOYSA-N 0.000 description 1
- MCPITRXNROMMGT-UHFFFAOYSA-N 5-methylsulfonyl-2-[4-(trifluoromethylsulfanyl)phenoxy]pyridine Chemical compound N1=CC(S(=O)(=O)C)=CC=C1OC1=CC=C(SC(F)(F)F)C=C1 MCPITRXNROMMGT-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000709687 Coxsackievirus Species 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- LHHUUXXSNNAXGY-UHFFFAOYSA-N [4-(5-methylsulfonylpyridin-2-yl)oxyphenyl]-phenylmethanone Chemical compound N1=CC(S(=O)(=O)C)=CC=C1OC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1 LHHUUXXSNNAXGY-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 229940121357 antivirals Drugs 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000002306 biochemical method Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 125000006006 difluoroethoxy group Chemical group 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000006052 feed supplement Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000000727 fraction Substances 0.000 description 1
- 239000012737 fresh medium Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 239000011551 heat transfer agent Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 230000001524 infective effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000005265 lung cell Anatomy 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 1
- CKJNUZNMWOVDFN-UHFFFAOYSA-N methanone Chemical compound O=[CH-] CKJNUZNMWOVDFN-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 231100000299 mutagenicity Toxicity 0.000 description 1
- 230000007886 mutagenicity Effects 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000006137 n-hexyl sulfonyl group Chemical group 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- ZGJADVGJIVEEGF-UHFFFAOYSA-M potassium;phenoxide Chemical compound [K+].[O-]C1=CC=CC=C1 ZGJADVGJIVEEGF-UHFFFAOYSA-M 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 238000012956 testing procedure Methods 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Communicable Diseases (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Virology (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/292,467 US4371537A (en) | 1981-08-13 | 1981-08-13 | Sulfur-substituted phenoxypyridines having antiviral activity |
| US292,467 | 1988-12-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1180017A true CA1180017A (en) | 1984-12-27 |
Family
ID=23124804
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000409151A Expired CA1180017A (en) | 1981-08-13 | 1982-08-10 | Sulfur-substituted phenoxypyridines having antiviral activity |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4371537A (enExample) |
| EP (1) | EP0072529B1 (enExample) |
| JP (1) | JPS5841868A (enExample) |
| KR (1) | KR890001148B1 (enExample) |
| AT (1) | ATE17719T1 (enExample) |
| AU (1) | AU551683B2 (enExample) |
| CA (1) | CA1180017A (enExample) |
| DE (1) | DE3268816D1 (enExample) |
| DK (1) | DK157297C (enExample) |
| ES (3) | ES514940A0 (enExample) |
| GB (1) | GB2103619B (enExample) |
| GR (1) | GR76894B (enExample) |
| IE (1) | IE53713B1 (enExample) |
| IL (1) | IL66496A0 (enExample) |
| NO (1) | NO159851C (enExample) |
| NZ (1) | NZ201550A (enExample) |
| PH (1) | PH19150A (enExample) |
| ZA (1) | ZA825762B (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4616087A (en) * | 1982-05-21 | 1986-10-07 | The Dow Chemical Company | 2,5-bis alkyl sulfonyl and 2,5-bis alkyl thio substituted-pyridines |
| CA1215067A (en) * | 1982-10-18 | 1986-12-09 | Sudarshan K. Malhotra | 2-(6-phenoxy-3-nitro-2-pyridinoxy)-propionate compounds |
| US4588733A (en) * | 1984-10-19 | 1986-05-13 | Merrell Dow Pharmaceuticals Inc. | 2-phenylpyrano[2,3-b]pyridines and their use in inhibiting viruses |
| NZ228003A (en) * | 1988-02-29 | 1992-04-28 | Colgate Palmolive Co | Dispensing device with pump and removable container: nozzle has open and closed positions |
| WO1992006683A1 (en) * | 1990-10-22 | 1992-04-30 | Research Corporation Technologies, Inc. | Aryl and heteroaryl compounds having anti-retrovirus activity |
| TW231258B (enExample) * | 1992-05-27 | 1994-10-01 | Shell Internat Res Schappej B V | |
| WO1995004045A1 (en) * | 1993-07-28 | 1995-02-09 | Rhone-Poulenc Rorer Limited | Compounds as pde iv and tnf inhibitors |
| AU2395095A (en) | 1994-04-29 | 1995-11-29 | G.D. Searle & Co. | Method of using (h+/k+) atpase inhibitors as antiviral agents |
| DE19817264A1 (de) * | 1998-04-18 | 1999-10-21 | Bayer Ag | Neue Dihydropyrimidine |
| WO2000032573A1 (en) * | 1998-11-30 | 2000-06-08 | Ishihara Sangyo Kaisha, Ltd. | A meta-nitro phenol derivative and a process for producing it |
| US7064139B2 (en) * | 2001-10-29 | 2006-06-20 | Uniroyal Chemical Company, Inc. | Method for treating retroviral infections |
| MX2011005120A (es) * | 2008-11-17 | 2011-05-30 | Hoffmann La Roche | Acidos naftilaceticos. |
| RU2011124149A (ru) * | 2008-11-17 | 2012-12-27 | Ф.Хоффманн-Ля Рош Аг | Нафтилуксусные кислоты |
| CN102216273A (zh) * | 2008-11-17 | 2011-10-12 | 霍夫曼-拉罗奇有限公司 | 用作crth2拮抗剂或部分激动剂的萘乙酸 |
| US8470884B2 (en) | 2011-11-09 | 2013-06-25 | Hoffmann-La Roche Inc. | Alkenyl naphthylacetic acids |
| US9000044B2 (en) | 2012-02-28 | 2015-04-07 | Hoffmann-La Roche Inc. | Substituted naphthylacetic acids |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH434868A (de) * | 1964-02-10 | 1967-04-30 | Ciba Geigy | Schädlingsbekämpfungsmittel |
| US3528987A (en) * | 1964-07-31 | 1970-09-15 | Geigy Chem Corp | N-(substituted pyridyl)rinolamides and -linolenamides |
| US3535328A (en) * | 1967-09-01 | 1970-10-20 | Exxon Research Engineering Co | Certain substituted aminothioethoxy pyridines |
| US3549647A (en) * | 1968-12-03 | 1970-12-22 | Dow Chemical Co | Bis- and tris-(thio-,sulfinyl- and sulfonyl)pyridines |
| US3732234A (en) * | 1969-09-26 | 1973-05-08 | Dow Chemical Co | (thio-,sulfinyl-and sulfonyl)containing pyridine compounds |
| US3639413A (en) * | 1969-09-26 | 1972-02-01 | Dow Chemical Co | (thio- sulfinyl- and sulfonyl) containing pyridine compounds |
| BE758759A (fr) * | 1969-11-12 | 1971-05-10 | Merck & Co Inc | Pyridones anti-inflammatoires |
| US3687959A (en) * | 1970-05-28 | 1972-08-29 | Exxon Research Engineering Co | Alkaryl-alkoxy, aryl-amido derivatives of pyridine |
| US3655897A (en) * | 1971-01-25 | 1972-04-11 | Merck & Co Inc | Anti-inflammatory agents |
| US3719682A (en) * | 1971-05-17 | 1973-03-06 | Dow Chemical Co | (thio-,sulfinyl-and sulfonyl)containing pyridine compounds |
| US3980659A (en) * | 1972-06-22 | 1976-09-14 | Cassella Farbwerke Mainkur Aktiengesellschaft | Certain 6-amino-4-hydrocarbyl-nicotinamides |
| US3954782A (en) * | 1972-06-22 | 1976-05-04 | Cassella Farbwerke Mainkur Aktiengesellschaft | 2,6-Hydrazino-3-pyridine carboxyamides |
| US3956294A (en) * | 1972-06-22 | 1976-05-11 | Cassella Farbwerke Mainkur Aktiengesellschaft | Substituted pyridine compounds |
| US3931201A (en) * | 1974-01-22 | 1976-01-06 | The Dow Chemical Company | Substituted pyridinyloxy(thio)phenyl -acetamides, -ureas and urea derivatives |
| US3962265A (en) * | 1974-01-22 | 1976-06-08 | The Dow Chemical Company | H'-(4-((6-chloro-2-pyridinyl)oxy)phenyl)-n-methyl-n-(1-methyl-2-propynyl)urea |
| US4003733A (en) * | 1974-01-22 | 1977-01-18 | The Dow Chemical Company | Substituted pyridinyloxy(thio)phenyl -acetamides, -ureas and urea derivatives |
| US4055650A (en) * | 1974-04-17 | 1977-10-25 | A. Christiaens Societe Anonyme | Certain 4-phenoxy(or phenylthio)-3-n-acylated-sulfonamido-pyridines |
| NL7612668A (nl) * | 1976-01-06 | 1977-07-08 | Dow Chemical Co | Werkwijze voor het bereiden van nieuwe organo- fosforusverbindingen. |
| US4132784A (en) * | 1976-12-02 | 1979-01-02 | The Dow Chemical Company | (Substituted pyridyl)phenoxy phosphorus compounds and their use as insecticides |
| US4067983A (en) * | 1976-12-17 | 1978-01-10 | Parke, Davis & Company | Pharmaceutical compositions and methods |
| EP0000176B1 (de) * | 1977-06-29 | 1981-09-16 | Ciba-Geigy Ag | Pyridyloxy-phenoxy-alkancarbonsäurederivate, Verfahren zu deren Herstellung, und deren Verwendung als Herbizide oder als pflanzenwachstumsregulierende Mittel |
| US4212980A (en) * | 1978-11-13 | 1980-07-15 | Warner-Lambert Company | 5-Phenoxy-2-pyridinecarbonitrile compounds and methods for their production |
| US4229457A (en) * | 1979-09-27 | 1980-10-21 | Warner-Lambert Company | 3-(3-Substituted aryloxy)-2-yridinecarbonitriles, pharmaceutical compositions and methods for their production |
-
1981
- 1981-08-13 US US06/292,467 patent/US4371537A/en not_active Expired - Lifetime
-
1982
- 1982-08-09 ZA ZA825762A patent/ZA825762B/xx unknown
- 1982-08-09 PH PH27694A patent/PH19150A/en unknown
- 1982-08-09 IL IL66496A patent/IL66496A0/xx not_active IP Right Cessation
- 1982-08-10 NZ NZ201550A patent/NZ201550A/en unknown
- 1982-08-10 CA CA000409151A patent/CA1180017A/en not_active Expired
- 1982-08-11 EP EP82107263A patent/EP0072529B1/en not_active Expired
- 1982-08-11 GR GR69017A patent/GR76894B/el unknown
- 1982-08-11 DE DE8282107263T patent/DE3268816D1/de not_active Expired
- 1982-08-11 AT AT82107263T patent/ATE17719T1/de not_active IP Right Cessation
- 1982-08-11 AU AU87078/82A patent/AU551683B2/en not_active Ceased
- 1982-08-11 GB GB08223098A patent/GB2103619B/en not_active Expired
- 1982-08-12 JP JP57139277A patent/JPS5841868A/ja active Granted
- 1982-08-12 NO NO822751A patent/NO159851C/no unknown
- 1982-08-12 IE IE1956/82A patent/IE53713B1/en not_active IP Right Cessation
- 1982-08-12 ES ES514940A patent/ES514940A0/es active Granted
- 1982-08-12 DK DK362882A patent/DK157297C/da not_active IP Right Cessation
- 1982-08-12 KR KR8203627A patent/KR890001148B1/ko not_active Expired
-
1983
- 1983-06-28 ES ES523661A patent/ES8503656A1/es not_active Expired
- 1983-06-28 ES ES523660A patent/ES523660A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4371537A (en) | 1983-02-01 |
| DK362882A (da) | 1983-02-14 |
| ES8503658A1 (es) | 1985-04-01 |
| AU8707882A (en) | 1983-05-12 |
| ES8308852A1 (es) | 1983-10-16 |
| NO822751L (no) | 1983-02-14 |
| GR76894B (enExample) | 1984-09-04 |
| IE821956L (en) | 1983-02-13 |
| JPH0414107B2 (enExample) | 1992-03-11 |
| IE53713B1 (en) | 1989-01-18 |
| ES514940A0 (es) | 1983-10-16 |
| GB2103619A (en) | 1983-02-23 |
| ES523661A0 (es) | 1985-03-16 |
| JPS5841868A (ja) | 1983-03-11 |
| GB2103619B (en) | 1985-02-27 |
| AU551683B2 (en) | 1986-05-08 |
| NO159851B (no) | 1988-11-07 |
| ATE17719T1 (de) | 1986-02-15 |
| PH19150A (en) | 1986-01-15 |
| ZA825762B (en) | 1983-06-29 |
| NO159851C (no) | 1989-02-15 |
| KR890001148B1 (ko) | 1989-04-25 |
| EP0072529A1 (en) | 1983-02-23 |
| ES8503656A1 (es) | 1985-03-16 |
| DK157297B (da) | 1989-12-04 |
| DE3268816D1 (en) | 1986-03-13 |
| IL66496A0 (en) | 1982-12-31 |
| KR840001137A (ko) | 1984-03-28 |
| ES523660A0 (es) | 1985-04-01 |
| EP0072529B1 (en) | 1986-01-29 |
| DK157297C (da) | 1990-05-07 |
| NZ201550A (en) | 1985-07-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1180017A (en) | Sulfur-substituted phenoxypyridines having antiviral activity | |
| DK171340B1 (da) | Substituerede 2-((4-fluoralkoxypyrid-2-yl)metyltio eller metylsulfinyl)benzimidazoler, fremgangsmåde til fremstilling deraf og farmaceutisk præparat indeholdende en sådan forbindelse | |
| US4171365A (en) | Antiviral aryloxyalkylpyrazoles | |
| Markley et al. | Antipicornavirus activity of substituted phenoxybenzenes and phenoxypyridines | |
| SK284805B6 (sk) | Spôsob syntézy 3,5-disubstituovaných-2-(fenyl alebo pyridyl)-pyridínov | |
| CZ288797B6 (cs) | Způsob výroby fenylheterocyklických sloučenin | |
| IE61578B1 (en) | Fungicides | |
| DK162521B (da) | Quinoxalinyloxyphenylderivater til anvendelse som mellemprodukter til fremstilling af herbicide quinoxalinyloxyphenoxyalkancarboxylsyrederivater | |
| CA1124724A (en) | Indanyl derivatives, process for their preparation and pharmaceutical preparations containing them | |
| CA1256875A (en) | Alkene, alkyne or cycloalkylene derivatives | |
| IE59321B1 (en) | Semicarbazones and thiosemicarbazones | |
| PL190265B1 (pl) | Sposób wytwarzania związków 2-arylo-3-arylopirydynowych | |
| US4234725A (en) | 4-[6-(2-Chloro-4-methoxyphenoxy)hexyl]-3,5-diethyl-1-[4-(4-morpholinyl)-1-oxobutyl]-1H-pyrazole | |
| US4616087A (en) | 2,5-bis alkyl sulfonyl and 2,5-bis alkyl thio substituted-pyridines | |
| US4505929A (en) | Sulfur-substituted diphenyl ethers having antiviral activity | |
| US4349568A (en) | Sulfur-substituted diphenyl ethers having antiviral activity | |
| CA1159470A (en) | Substituted benzonitriles having antiviral activity | |
| US5039810A (en) | Pyridyl propenoate compound | |
| EP0307101B1 (en) | Chemical process | |
| US4558134A (en) | Certain phenoxy-pyridine-carbonitriles having antiviral activity | |
| Shaw et al. | Reactions of some 2-aminophenyl-and 2-and 4-nitrophenyl sulfones in aqueous sodium hydroxide solution | |
| JP2001163854A (ja) | チオアルキルアミン誘導体及びその製造方法 | |
| JPS5910351B2 (ja) | 3−オキシ−1,2,4−トリアゾ−ル誘導体の製造方法 | |
| US4410701A (en) | Process for making pyridyloxyphenol compounds | |
| Shridhar et al. | New 5-substituted-2-furaldehydes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEC | Expiry (correction) | ||
| MKEX | Expiry | ||
| MKEX | Expiry |
Effective date: 20020810 |