CA1179343A - Benzoxazolinones, substituted in the 6-position by an amino-alcohol chain or amino-ketone chain, their preparation and their use in pharmaceutical preparations - Google Patents
Benzoxazolinones, substituted in the 6-position by an amino-alcohol chain or amino-ketone chain, their preparation and their use in pharmaceutical preparationsInfo
- Publication number
- CA1179343A CA1179343A CA000386770A CA386770A CA1179343A CA 1179343 A CA1179343 A CA 1179343A CA 000386770 A CA000386770 A CA 000386770A CA 386770 A CA386770 A CA 386770A CA 1179343 A CA1179343 A CA 1179343A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- radical
- compound
- methyl
- amino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000002360 preparation method Methods 0.000 title claims description 15
- ASSKVPFEZFQQNQ-UHFFFAOYSA-N 2-benzoxazolinone Chemical class C1=CC=C2OC(O)=NC2=C1 ASSKVPFEZFQQNQ-UHFFFAOYSA-N 0.000 title description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical group NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 title description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical group ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 title description 2
- 239000000825 pharmaceutical preparation Substances 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 93
- -1 hydroxy-methylene Chemical group 0.000 claims abstract description 56
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 40
- 239000001257 hydrogen Substances 0.000 claims abstract description 29
- 150000003839 salts Chemical class 0.000 claims abstract description 23
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 17
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 claims abstract description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 13
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims abstract description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 10
- 125000001302 tertiary amino group Chemical group 0.000 claims abstract description 9
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 5
- 238000000034 method Methods 0.000 claims description 65
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 27
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 23
- 150000001412 amines Chemical class 0.000 claims description 15
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 9
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- ULGZDMOVFRHVEP-RWJQBGPGSA-N Erythromycin Chemical compound O([C@@H]1[C@@H](C)C(=O)O[C@@H]([C@@]([C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@](C)(O)[C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)O)[C@H]1C)(C)O)CC)[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 ULGZDMOVFRHVEP-RWJQBGPGSA-N 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000004193 piperazinyl group Chemical group 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- 229930194542 Keto Natural products 0.000 claims description 6
- 125000003282 alkyl amino group Chemical group 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 238000010438 heat treatment Methods 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 4
- WMALGHVGWLGXGP-UHFFFAOYSA-N 6-(2-bromoacetyl)-3h-1,3-benzoxazol-2-one Chemical compound BrCC(=O)C1=CC=C2NC(=O)OC2=C1 WMALGHVGWLGXGP-UHFFFAOYSA-N 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 4
- 239000004312 hexamethylene tetramine Substances 0.000 claims description 4
- 235000010299 hexamethylene tetramine Nutrition 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 229910052987 metal hydride Inorganic materials 0.000 claims description 4
- 150000004681 metal hydrides Chemical class 0.000 claims description 4
- 229960004011 methenamine Drugs 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 238000005984 hydrogenation reaction Methods 0.000 claims description 3
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 claims description 3
- MGXKBIYKSZJUEO-UHFFFAOYSA-N $l^{2}-azanylmethylbenzene Chemical compound [NH]CC1=CC=CC=C1 MGXKBIYKSZJUEO-UHFFFAOYSA-N 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims 5
- 150000003254 radicals Chemical class 0.000 claims 3
- RKUQQEGIGSEJTO-UHFFFAOYSA-N 6-[1-hydroxy-2-(propan-2-ylamino)ethyl]-3h-1,3-benzoxazol-2-one Chemical compound CC(C)NCC(O)C1=CC=C2NC(=O)OC2=C1 RKUQQEGIGSEJTO-UHFFFAOYSA-N 0.000 claims 2
- 230000002152 alkylating effect Effects 0.000 claims 2
- 125000003277 amino group Chemical group 0.000 claims 2
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 2
- 125000003395 phenylethylamino group Chemical group [H]N(*)C([H])([H])C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 2
- 239000011541 reaction mixture Substances 0.000 claims 2
- VNZLQLYBRIOLFZ-UHFFFAOYSA-N 1-(2-methoxyphenyl)piperazine Chemical compound COC1=CC=CC=C1N1CCNCC1 VNZLQLYBRIOLFZ-UHFFFAOYSA-N 0.000 claims 1
- KKIMDKMETPPURN-UHFFFAOYSA-N 1-(3-(trifluoromethyl)phenyl)piperazine Chemical compound FC(F)(F)C1=CC=CC(N2CCNCC2)=C1 KKIMDKMETPPURN-UHFFFAOYSA-N 0.000 claims 1
- XERIIBQQYDXGKO-UHFFFAOYSA-N 3-methyl-6-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetyl]-1,3-benzoxazol-2-one Chemical compound C1=C2OC(=O)N(C)C2=CC=C1C(=O)CN(CC1)CCN1C1=CC=CC(C(F)(F)F)=C1 XERIIBQQYDXGKO-UHFFFAOYSA-N 0.000 claims 1
- LAUINISNXLVCFD-UHFFFAOYSA-N 6-(2-bromoacetyl)-3-methyl-1,3-benzoxazol-2-one Chemical compound C1=C(C(=O)CBr)C=C2OC(=O)N(C)C2=C1 LAUINISNXLVCFD-UHFFFAOYSA-N 0.000 claims 1
- FZNUNZBIBVEBIL-UHFFFAOYSA-N 6-[1-hydroxy-2-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-1,3-benzoxazol-2-one Chemical compound COC1=C(C=CC=C1)N1CCN(CC1)C(C(O)C1=CC2=C(N(C(O2)=O)C)C=C1)C FZNUNZBIBVEBIL-UHFFFAOYSA-N 0.000 claims 1
- ZGDOZAMLFIQTSK-UHFFFAOYSA-N 6-[1-hydroxy-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-3-methyl-1,3-benzoxazol-2-one Chemical compound FC(C=1C=C(C=CC1)N1CCN(CC1)CC(O)C1=CC2=C(N(C(O2)=O)C)C=C1)(F)F ZGDOZAMLFIQTSK-UHFFFAOYSA-N 0.000 claims 1
- CBONAAMOYZXHCW-UHFFFAOYSA-N 6-[2-(propan-2-ylamino)acetyl]-3h-1,3-benzoxazol-2-one Chemical compound CC(C)NCC(=O)C1=CC=C2NC(=O)OC2=C1 CBONAAMOYZXHCW-UHFFFAOYSA-N 0.000 claims 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 230000000202 analgesic effect Effects 0.000 abstract description 2
- 230000003276 anti-hypertensive effect Effects 0.000 abstract description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 29
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 12
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 8
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 108060003345 Adrenergic Receptor Proteins 0.000 description 5
- 102000017910 Adrenergic receptor Human genes 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 230000000903 blocking effect Effects 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 229960000443 hydrochloric acid Drugs 0.000 description 4
- 235000011167 hydrochloric acid Nutrition 0.000 description 4
- 239000004031 partial agonist Substances 0.000 description 4
- 102000005962 receptors Human genes 0.000 description 4
- 108020003175 receptors Proteins 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 2
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001414 amino alcohols Chemical group 0.000 description 2
- 230000008485 antagonism Effects 0.000 description 2
- 229940124630 bronchodilator Drugs 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 229960001317 isoprenaline Drugs 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 229960002748 norepinephrine Drugs 0.000 description 2
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- KQZLRWGGWXJPOS-NLFPWZOASA-N 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(4S,5R)-4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-5-methylcyclohexen-1-yl]pyrazolo[3,4-b]pyrazine-3-carbonitrile Chemical compound ClC1=C(C=CC(=C1)Cl)[C@@H](C)N1N=C(C=2C1=NC(=CN=2)C1=CC[C@@H]([C@@H](C1)C)N1[C@@H](CCC1)CO)C#N KQZLRWGGWXJPOS-NLFPWZOASA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- ABGXADJDTPFFSZ-UHFFFAOYSA-N 4-benzylpiperidine Chemical compound C=1C=CC=CC=1CC1CCNCC1 ABGXADJDTPFFSZ-UHFFFAOYSA-N 0.000 description 1
- PFSFMCOQPSVFIZ-UHFFFAOYSA-N 6-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]-3-methyl-1,3-benzoxazol-2-one Chemical compound C1=C2OC(=O)N(C)C2=CC=C1C(O)CN(CC1)CCC1CC1=CC=CC=C1 PFSFMCOQPSVFIZ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229940125877 compound 31 Drugs 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000000297 inotrophic effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000010415 tropism Effects 0.000 description 1
- 210000001177 vas deferen Anatomy 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/58—Benzoxazoles; Hydrogenated benzoxazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8020861A FR2491066A1 (fr) | 1980-09-29 | 1980-09-29 | Benzoxazolinones substituees en 6 par une chaine aminoalcool ou aminocetone, leur preparation et leur application en therapeutique |
| FR80.20861 | 1980-09-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1179343A true CA1179343A (en) | 1984-12-11 |
Family
ID=9246379
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000386770A Expired CA1179343A (en) | 1980-09-29 | 1981-09-28 | Benzoxazolinones, substituted in the 6-position by an amino-alcohol chain or amino-ketone chain, their preparation and their use in pharmaceutical preparations |
Country Status (10)
| Country | Link |
|---|---|
| EP (1) | EP0049203A1 (index.php) |
| JP (1) | JPS57501427A (index.php) |
| CA (1) | CA1179343A (index.php) |
| DK (1) | DK49682A (index.php) |
| FR (1) | FR2491066A1 (index.php) |
| GR (1) | GR82309B (index.php) |
| HU (1) | HU185975B (index.php) |
| PT (1) | PT73740B (index.php) |
| WO (1) | WO1982001186A1 (index.php) |
| ZA (1) | ZA816555B (index.php) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0105053B1 (en) * | 1982-10-01 | 1988-01-20 | Merck & Co. Inc. | Aralkylaminoethanol heterocyclic compounds |
| FR2536749A1 (fr) * | 1982-11-25 | 1984-06-01 | Cerm Cent Europ Rech Mauvernay | (amino-2 ethyl)-6 benzoxazolinones substituees, leur preparation et leurs applications en therapeutique |
| GB8325370D0 (en) * | 1983-09-22 | 1983-10-26 | Fujisawa Pharmaceutical Co | Benzoxazoline and benzothiazoline derivatives |
| FR2637286A1 (fr) * | 1988-10-04 | 1990-04-06 | Adir | Nouveaux derives benzoxazolinoniques, leurs procedes de preparation et les compositions pharmaceutiques qui les contiennent |
| IL93473A0 (en) * | 1989-02-28 | 1990-11-29 | Pfizer | Antiinflammatory benzoxazolones |
| US5182278A (en) * | 1989-02-28 | 1993-01-26 | Adir Et Compagnie | Analgesic benzoxazolinones having at the 6-position a 1-hydroxy-3-morpholinopropyl side chain |
| FR2643634A1 (fr) * | 1989-02-28 | 1990-08-31 | Adir | Nouveaux derives benzoxazolinoniques, leurs procedes de preparation et les compositions pharmaceutiques qui les contiennent |
| FR2645149A1 (index.php) * | 1989-03-30 | 1990-10-05 | Adir | |
| FR2646350B1 (fr) * | 1989-04-28 | 1991-06-28 | Adir | Nouveaux derives benzothiazolinoniques, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| US5166353A (en) * | 1989-04-28 | 1992-11-24 | Adir Et Compagnie | Benzothiazolinone compounds |
| FR2663634B1 (fr) * | 1990-06-22 | 1992-09-04 | Adir | Nouvelles acyl benzoxazolinones, leur procede de preparation et les compositions pharmaceutiques qui les contiennent. |
| EP0567090B1 (en) * | 1992-04-24 | 2000-07-26 | Takeda Chemical Industries, Ltd. | Benzoxazepine derivatives as cholinesterase inhibitors |
| AU2006326850A1 (en) * | 2005-12-21 | 2007-06-28 | Cortical Pty Ltd | MIF inhibitors |
| DE102007047737A1 (de) | 2007-10-05 | 2009-04-30 | Merck Patent Gmbh | Piperidin- und Piperazinderivate |
| CN101759665B (zh) | 2008-12-23 | 2012-03-28 | 江苏恩华药业股份有限公司 | 取代苯基哌嗪芳烷醇衍生物及其在制备镇痛药物中的应用 |
| DE102009049211A1 (de) | 2009-10-13 | 2011-04-28 | Merck Patent Gmbh | Sulfoxide |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2244507A1 (en) * | 1973-06-26 | 1975-04-18 | Inst Nat Sante Rech Med | Chalcones and analogues - analgesics having low toxicity |
| CA1041523A (en) * | 1974-06-19 | 1978-10-31 | Queen's University | Preparation of 1-oxapenicillins and novel intermediates therefor |
-
1980
- 1980-09-29 FR FR8020861A patent/FR2491066A1/fr active Granted
-
1981
- 1981-09-21 ZA ZA816555A patent/ZA816555B/xx unknown
- 1981-09-21 HU HU813255A patent/HU185975B/hu unknown
- 1981-09-21 WO PCT/EP1981/000149 patent/WO1982001186A1/en not_active Ceased
- 1981-09-21 JP JP56503061A patent/JPS57501427A/ja active Pending
- 1981-09-28 PT PT73740A patent/PT73740B/pt unknown
- 1981-09-28 CA CA000386770A patent/CA1179343A/en not_active Expired
- 1981-09-28 EP EP81401497A patent/EP0049203A1/fr not_active Withdrawn
- 1981-09-28 GR GR66134A patent/GR82309B/el unknown
-
1982
- 1982-02-05 DK DK49682A patent/DK49682A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| GR82309B (index.php) | 1984-12-13 |
| JPS57501427A (index.php) | 1982-08-12 |
| WO1982001186A1 (en) | 1982-04-15 |
| ZA816555B (en) | 1982-09-29 |
| HU185975B (en) | 1985-04-28 |
| FR2491066B1 (index.php) | 1983-06-17 |
| DK49682A (da) | 1982-04-15 |
| PT73740B (en) | 1982-12-30 |
| FR2491066A1 (fr) | 1982-04-02 |
| EP0049203A1 (fr) | 1982-04-07 |
| PT73740A (en) | 1981-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1179343A (en) | Benzoxazolinones, substituted in the 6-position by an amino-alcohol chain or amino-ketone chain, their preparation and their use in pharmaceutical preparations | |
| AU701420B2 (en) | Novel piperazides derived from arylpiperazine, processes for their preparation, their use as medicaments and pharmaceutical compositions comprising them | |
| US4202896A (en) | N-Benzhydryloxyethyl-N-phenylpropyl-piperazines | |
| US5143916A (en) | Naphthylpiperazines useful as 5-ht1a receptor ligands | |
| AU2659992A (en) | Novel 4-arylpiperazines and 4-arylpiperidines | |
| EP0502169A1 (en) | PIPERAZINE DERIVATIVES. | |
| FI85267B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 1,4-disubstituerade piperazinderivat. | |
| HUP0203645A2 (hu) | Fenilpiperazinil-származékok, ezeket tartalmazó gyógyszerkészítmények és alkalmazásuk | |
| KR101597328B1 (ko) | 페닐 피페라진 화합물, 이를 포함한 약학적 조성물 및 그 용도 | |
| US5569659A (en) | 4-arylpiperazines and 4-arylpiperidines | |
| AU644295B2 (en) | 2-aminopyrimidine-4-carboxamide derivatives, their preparation and their use in therapeutics | |
| EP0481744B1 (en) | Piperazine derivatives | |
| CN101679400A (zh) | 新颖的氨基甲酰氧基芳基链烷芳基哌嗪化合物,含该化合物的药物组合物以及通过给予该化合物治疗疼痛、焦虑和抑郁的方法 | |
| CA1131641A (en) | Piperazinyl-tetrahydronaphthalene derivatives | |
| US5166156A (en) | Naphthyl piperazines useful as 5-HT1A receptor ligands | |
| FI85268C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara benshydrylpiperazin-derivat. | |
| JP2008526706A (ja) | ニトロ置換フェニル−ピペラジン化合物、それらの調製及び薬剤におけるそれらの使用 | |
| GB2120234A (en) | Triazole and imidazole derivates having fungicidal and plant-growth regulating activity | |
| IE921319A1 (en) | 2-aminopyrimidine-4-carboxamide derivatives, their¹preparation and their application in therapy | |
| CA2307905A1 (en) | 3-aminoalkylamino-2h-1,4-benzoxazines and 3-aminoalkylamino- 2h-1,4-benzothiazines: dopamine receptor subtype specific ligands | |
| CA1235417A (en) | 2-(n-pyrrolidino)-3-isobutoxy-n-substituted phenyl-n- benzyl-propylamines, their preparation and pharmaceutical use | |
| US4048322A (en) | Bronchially effective xanthene-9-carboxylates | |
| US5166157A (en) | Naphthyl piperazines useful as 5-HT1A receptor ligands | |
| US5330985A (en) | 2-amino-N-[[4-(aminocarbonyl)pyrimidin-2-yl]amino]-alkyl]pyrimidine-4-carboxamide derivatives, their preparation and pharmaceutical compositions containing them | |
| GB2123410A (en) | New derivatives of 1,2,3,4-tetrahydronaphthalene, process for their preparation and associated pharmaceutical compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |