CA1177996A - High impact nylon composition containing copolymer esters and ionic copolymers - Google Patents
High impact nylon composition containing copolymer esters and ionic copolymersInfo
- Publication number
- CA1177996A CA1177996A CA000402232A CA402232A CA1177996A CA 1177996 A CA1177996 A CA 1177996A CA 000402232 A CA000402232 A CA 000402232A CA 402232 A CA402232 A CA 402232A CA 1177996 A CA1177996 A CA 1177996A
- Authority
- CA
- Canada
- Prior art keywords
- percent
- weight
- composition
- copolymer
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001577 copolymer Polymers 0.000 title claims abstract description 88
- 239000000203 mixture Substances 0.000 title claims abstract description 72
- 150000002148 esters Chemical class 0.000 title claims abstract description 10
- 239000004677 Nylon Substances 0.000 title description 5
- 229920001778 nylon Polymers 0.000 title description 5
- 239000004952 Polyamide Substances 0.000 claims abstract description 35
- 229920002647 polyamide Polymers 0.000 claims abstract description 32
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims abstract description 15
- 239000005977 Ethylene Substances 0.000 claims abstract description 15
- 150000001768 cations Chemical class 0.000 claims abstract description 14
- 229910052751 metal Inorganic materials 0.000 claims abstract description 9
- 239000002184 metal Substances 0.000 claims abstract description 9
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims abstract description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- 239000011701 zinc Substances 0.000 claims description 19
- 150000002736 metal compounds Chemical class 0.000 claims description 15
- 229910052725 zinc Inorganic materials 0.000 claims description 15
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 14
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 8
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 7
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 claims description 6
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 6
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 claims description 6
- 150000001735 carboxylic acids Chemical class 0.000 claims description 6
- 239000000395 magnesium oxide Substances 0.000 claims description 6
- 229910021645 metal ion Inorganic materials 0.000 claims description 6
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims description 6
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 5
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 5
- 229920002302 Nylon 6,6 Polymers 0.000 claims description 5
- 229910052791 calcium Inorganic materials 0.000 claims description 5
- 239000011575 calcium Substances 0.000 claims description 5
- 229910052802 copper Inorganic materials 0.000 claims description 5
- 239000010949 copper Substances 0.000 claims description 5
- 229910052744 lithium Inorganic materials 0.000 claims description 5
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 claims description 5
- 150000001242 acetic acid derivatives Chemical class 0.000 claims description 4
- 125000005907 alkyl ester group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052787 antimony Inorganic materials 0.000 claims description 4
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 239000004711 α-olefin Substances 0.000 claims description 4
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 3
- 229910000410 antimony oxide Inorganic materials 0.000 claims description 3
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 claims description 3
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 3
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 claims description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 2
- 239000000945 filler Substances 0.000 claims description 2
- 230000002787 reinforcement Effects 0.000 claims description 2
- 239000003365 glass fiber Substances 0.000 claims 1
- 229940102838 methylmethacrylate Drugs 0.000 claims 1
- 239000000463 material Substances 0.000 abstract description 3
- 229920006244 ethylene-ethyl acrylate Polymers 0.000 description 39
- 229920003182 Surlyn® Polymers 0.000 description 37
- 239000005042 ethylene-ethyl acrylate Substances 0.000 description 33
- 230000000052 comparative effect Effects 0.000 description 13
- 239000000155 melt Substances 0.000 description 13
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N Caprolactam Natural products O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 10
- 229920002292 Nylon 6 Polymers 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 8
- 239000000178 monomer Substances 0.000 description 7
- 238000000465 moulding Methods 0.000 description 7
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical compound [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 7
- QLZJUIZVJLSNDD-UHFFFAOYSA-N 2-(2-methylidenebutanoyloxy)ethyl 2-methylidenebutanoate Chemical compound CCC(=C)C(=O)OCCOC(=O)C(=C)CC QLZJUIZVJLSNDD-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 230000000704 physical effect Effects 0.000 description 6
- -1 piper-odone Chemical compound 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 5
- 229920005648 ethylene methacrylic acid copolymer Polymers 0.000 description 5
- 230000005484 gravity Effects 0.000 description 5
- 235000012245 magnesium oxide Nutrition 0.000 description 5
- 229940063559 methacrylic acid Drugs 0.000 description 5
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 4
- 150000003951 lactams Chemical class 0.000 description 4
- 229960000869 magnesium oxide Drugs 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 239000003607 modifier Substances 0.000 description 4
- 239000006082 mold release agent Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 229920003939 DuPont™ Surlyn® 1650 Polymers 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- GHPGOEFPKIHBNM-UHFFFAOYSA-N antimony(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Sb+3].[Sb+3] GHPGOEFPKIHBNM-UHFFFAOYSA-N 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 235000001055 magnesium Nutrition 0.000 description 3
- 229940091250 magnesium supplement Drugs 0.000 description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 3
- 229910052753 mercury Inorganic materials 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 229920003946 DuPont™ Surlyn® 1706 Polymers 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229940075103 antimony Drugs 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Inorganic materials O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 229910052790 beryllium Inorganic materials 0.000 description 2
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 2
- 229910052793 cadmium Inorganic materials 0.000 description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229920006225 ethylene-methyl acrylate Polymers 0.000 description 2
- 239000005043 ethylene-methyl acrylate Substances 0.000 description 2
- 238000009863 impact test Methods 0.000 description 2
- 229920000554 ionomer Polymers 0.000 description 2
- 239000011133 lead Substances 0.000 description 2
- 229940063557 methacrylate Drugs 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- 150000003751 zinc Chemical class 0.000 description 2
- PZWQOGNTADJZGH-SNAWJCMRSA-N (2e)-2-methylpenta-2,4-dienoic acid Chemical compound OC(=O)C(/C)=C/C=C PZWQOGNTADJZGH-SNAWJCMRSA-N 0.000 description 1
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- WROUWQQRXUBECT-UHFFFAOYSA-N 2-ethylacrylic acid Chemical compound CCC(=C)C(O)=O WROUWQQRXUBECT-UHFFFAOYSA-N 0.000 description 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical group CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- GVNWZKBFMFUVNX-UHFFFAOYSA-N Adipamide Chemical compound NC(=O)CCCCC(N)=O GVNWZKBFMFUVNX-UHFFFAOYSA-N 0.000 description 1
- 229920001342 Bakelite® Polymers 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical class OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001408 amides Chemical group 0.000 description 1
- 229960002684 aminocaproic acid Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000004637 bakelite Substances 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- HPDFFVBPXCTEDN-UHFFFAOYSA-N copper manganese Chemical compound [Mn].[Cu] HPDFFVBPXCTEDN-UHFFFAOYSA-N 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- HGVPOWOAHALJHA-UHFFFAOYSA-N ethene;methyl prop-2-enoate Chemical compound C=C.COC(=O)C=C HGVPOWOAHALJHA-UHFFFAOYSA-N 0.000 description 1
- 229920001038 ethylene copolymer Polymers 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- ZDPHROOEEOARMN-UHFFFAOYSA-N n-hendecanoic acid Natural products CCCCCCCCCCC(O)=O ZDPHROOEEOARMN-UHFFFAOYSA-N 0.000 description 1
- 239000002667 nucleating agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 238000005453 pelletization Methods 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- GGHDAUPFEBTORZ-UHFFFAOYSA-N propane-1,1-diamine Chemical compound CCC(N)N GGHDAUPFEBTORZ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052706 scandium Inorganic materials 0.000 description 1
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 description 1
- 150000003330 sebacic acids Chemical class 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- YEAUATLBSVJFOY-UHFFFAOYSA-N tetraantimony hexaoxide Chemical compound O1[Sb](O2)O[Sb]3O[Sb]1O[Sb]2O3 YEAUATLBSVJFOY-UHFFFAOYSA-N 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L77/00—Compositions of polyamides obtained by reactions forming a carboxylic amide link in the main chain; Compositions of derivatives of such polymers
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45C—PURSES; LUGGAGE; HAND CARRIED BAGS
- A45C11/00—Receptacles for purposes not provided for in groups A45C1/00-A45C9/00
- A45C11/36—Cases for drawing or like instruments
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B44—DECORATIVE ARTS
- B44D—PAINTING OR ARTISTIC DRAWING, NOT OTHERWISE PROVIDED FOR; PRESERVING PAINTINGS; SURFACE TREATMENT TO OBTAIN SPECIAL ARTISTIC SURFACE EFFECTS OR FINISHES
- B44D3/00—Accessories or implements for use in connection with painting or artistic drawing, not otherwise provided for; Methods or devices for colour determination, selection, or synthesis, e.g. use of colour tables
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US262,016 | 1981-05-11 | ||
| US06/262,016 US4404325A (en) | 1981-05-11 | 1981-05-11 | High impact nylon composition containing copolymer esters and ionic copolymers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1177996A true CA1177996A (en) | 1984-11-13 |
Family
ID=22995830
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000402232A Expired CA1177996A (en) | 1981-05-11 | 1982-05-04 | High impact nylon composition containing copolymer esters and ionic copolymers |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4404325A (enExample) |
| EP (1) | EP0069200B2 (enExample) |
| JP (1) | JPS57198748A (enExample) |
| KR (1) | KR860000247B1 (enExample) |
| AU (1) | AU548730B2 (enExample) |
| CA (1) | CA1177996A (enExample) |
| DE (1) | DE3278910D1 (enExample) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5823850A (ja) * | 1981-08-04 | 1983-02-12 | Asahi Chem Ind Co Ltd | 耐衝撃性ポリアミド組成物 |
| US4448934A (en) * | 1982-02-02 | 1984-05-15 | Uniroyal, Inc. | Blends of ionic elastomers and nylon |
| US4508867A (en) * | 1983-11-07 | 1985-04-02 | Polysar Limited | Polymer compositions comprising polyamides, carboxylated (meth)acrylonitrile-butadiene rubber, and nonpolymeric additives |
| US4619962A (en) * | 1983-11-07 | 1986-10-28 | Polysar Limited | Thermoplastic polymer compositions |
| US4602058A (en) * | 1984-07-02 | 1986-07-22 | The Dow Chemical Company | Compatibility and stability of blends of polyamide and ethylene copolymers |
| GB8423026D0 (en) * | 1984-09-12 | 1984-10-17 | Dunlop Ltd | Mouldable compositions |
| GB8520842D0 (en) * | 1985-08-20 | 1985-09-25 | Bip Chemicals Ltd | Thermoplastic polyamide compositions |
| JPS62241938A (ja) * | 1986-04-14 | 1987-10-22 | Tonen Sekiyukagaku Kk | 熱可塑性樹脂組成物の製造方法 |
| JPS62241941A (ja) * | 1986-04-14 | 1987-10-22 | Tonen Sekiyukagaku Kk | 熱可塑性樹脂組成物 |
| US4729923A (en) * | 1986-05-06 | 1988-03-08 | E. I. Du Pont De Nemours And Company | Nylon containing metal salts |
| US4919874A (en) * | 1986-05-06 | 1990-04-24 | E. I. Du Pont De Nemours And Company | Process for preparing a nylon fiber with reduced spherulites |
| US5091478A (en) * | 1986-11-14 | 1992-02-25 | E. I. Du Pont De Nemours And Company | Partially grafted thermoplastic compositions |
| BR8707531A (pt) * | 1986-11-14 | 1989-02-21 | Du Pont | Composicoes termoplasticas parcialmente enxertadas |
| DE3700330A1 (de) * | 1987-01-08 | 1988-07-21 | Basf Ag | Schlagzaehe polyamid-formmassen |
| DK35388A (da) * | 1987-01-27 | 1988-07-28 | Du Pont | Termoplastisk formgiveligt materiale samt anvendelse heraf |
| US4804703A (en) * | 1987-07-12 | 1989-02-14 | E. I. Du Pont De Nemours And Company | Mineral reinforced nylon compositions for blowmolding |
| EP0386113A1 (en) * | 1987-11-05 | 1990-09-12 | AlliedSignal Inc. | Polyamide composition resistant to fluorocarbon and hydrocarbon permeation |
| KR0130822B1 (ko) * | 1988-05-13 | 1998-04-07 | 제임즈 제이 플린 | 그라프팅된, 다층-상의, 열가소성 에라스토머 조성물 및 그의 제조방법 |
| CA1338025C (en) * | 1988-08-29 | 1996-01-30 | Andri Elia Elia | Toughened nylons characterized by low mold deposit |
| CA2033642A1 (en) * | 1990-01-11 | 1991-07-12 | Dilip R. Abayasekara | Graft polymers of epsilon-caprolactam |
| FI922379A7 (fi) * | 1991-06-19 | 1992-12-20 | Chevron Research And Tech Company | Happea poistavia, homogeenisia modifioidun polyolefiinin, hapettuvan polymeerin ja metallisuolan seoksia |
| US5244961A (en) * | 1991-09-19 | 1993-09-14 | Exxon Chemical Patents Inc. | Thermoplastic compositions and process for preparing the same |
| NZ297101A (en) * | 1994-12-14 | 1999-11-29 | Mitsui Du Pont Polychemical | Thermoplastic resin composition and its use |
| US5866658A (en) * | 1996-08-26 | 1999-02-02 | E. I. Du Pont De Nemours And Company | High performance ionomer blends |
| AU750513B2 (en) * | 1996-12-10 | 2002-07-18 | Callaway Golf Company | Nylon compositions for golf ball constructions and method of making same |
| US5886103A (en) * | 1996-12-10 | 1999-03-23 | Lisco, Inc. | Nylon compositions for golf ball constructions and method of making same |
| US5811490A (en) * | 1997-01-13 | 1998-09-22 | Judd Wire, Inc. | Polyamide coating compositions having a balance of resistance properties |
| ATE554924T1 (de) * | 2002-11-21 | 2012-05-15 | Total Petrochemicals Res Feluy | Mehrschichtiges rotationsformen |
| US20090298372A1 (en) * | 2003-06-05 | 2009-12-03 | E. I. Du Pont De Nemours And Company | Article comprising ionomer and polyamide |
| US7767759B2 (en) * | 2004-07-16 | 2010-08-03 | Taylor Made Golf Company, Inc. | Composition for use in golf balls |
| US7175543B2 (en) | 2005-01-26 | 2007-02-13 | Callaway Golf Company | Golf ball and thermoplastic material |
| US7156755B2 (en) | 2005-01-26 | 2007-01-02 | Callaway Golf Company | Golf ball with thermoplastic material |
| US7819761B2 (en) | 2005-01-26 | 2010-10-26 | Taylor Made Golf Company, Inc. | Golf ball having cross-core hardness differential and method for making it |
| US7612134B2 (en) | 2005-02-23 | 2009-11-03 | Callaway Golf Company | Golf ball and thermoplastic material |
| US7312267B2 (en) | 2005-02-23 | 2007-12-25 | Callaway Golf Company | Golf ball and thermoplastic material |
| US8030411B2 (en) | 2005-12-21 | 2011-10-04 | Taylor Made Golf Company, Inc. | Polymer compositions comprising peptizers, sports equipment comprising such compositions, and method for their manufacture |
| US7612135B2 (en) | 2006-02-17 | 2009-11-03 | Callaway Golf Company | Golf ball and thermoplastic material |
| US7915348B2 (en) * | 2006-03-13 | 2011-03-29 | Taylor Made Golf Company, Inc. | Method for making ionomers using amine compounds comprising salt functional groups, ionomers made by the method and sports equipment comprising such ionomers |
| FR2913023B1 (fr) | 2007-02-23 | 2009-04-10 | Rhodia Operations Sas | Composition polymere thermoplastique a base de polyamide |
| US8211976B2 (en) | 2007-12-21 | 2012-07-03 | Taylor Made Golf Company, Inc. | Sports equipment compositions comprising a polyurethane, polyurea or prepolymer thereof and a polyfunctional modifier |
| US8096899B2 (en) | 2007-12-28 | 2012-01-17 | Taylor Made Golf Company, Inc. | Golf ball comprising isocyanate-modified composition |
| US8236880B2 (en) | 2008-04-23 | 2012-08-07 | Taylor Made Golf Company, Inc. | Compositions comprising an amino triazine and ionomer or ionomer precursor |
| US8399566B2 (en) * | 2008-12-23 | 2013-03-19 | Taylor Made Golf Company, Inc. | Modified ionomer composition |
| US20100160081A1 (en) * | 2008-12-23 | 2010-06-24 | Kim Hyun J | Golf ball composition |
| US20100179002A1 (en) * | 2008-12-30 | 2010-07-15 | Kim Hyun J | Golf ball composition |
| US8680204B2 (en) * | 2009-12-23 | 2014-03-25 | Hyun J. Kim | Crosslinked ionomer compositions |
| US8575278B2 (en) | 2009-12-31 | 2013-11-05 | Taylor Made Golf Company, Inc. | Ionomer compositions for golf balls |
| US8629228B2 (en) | 2009-12-31 | 2014-01-14 | Taylor Made Golf Company, Inc. | Ionomer compositions for golf balls |
| US8674023B2 (en) | 2009-12-31 | 2014-03-18 | Taylor Made Golf Company, Inc. | Ionomer compositions for golf balls |
| US20120157230A1 (en) | 2010-12-20 | 2012-06-21 | Robert Blink | Golf ball layers based on polyalkenamer / ionomer / polyamide blends |
| US9155936B2 (en) | 2011-12-19 | 2015-10-13 | Taylor Made Golf Company, Inc. | Golf ball |
| US8858365B2 (en) | 2011-12-23 | 2014-10-14 | Taylor Made Golf Company, Inc. | Multi-layer golf ball construction |
| US9707453B2 (en) * | 2015-07-29 | 2017-07-18 | Acushnet Company | Golf ball compositions |
| US10773132B2 (en) | 2018-04-18 | 2020-09-15 | Acushnet Company | Golf ball incorporating melt processable highly-crosslinked rubber-containing ionomer(s) |
| US10682553B2 (en) | 2018-04-18 | 2020-06-16 | Acushnet Company | Golf ball incorporating melt processable highly-crosslinked ethylene acid copolymer(s) and/or ionomer(s) |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL288151A (enExample) * | 1961-08-31 | 1900-01-01 | ||
| US3373224A (en) * | 1964-06-22 | 1968-03-12 | Continental Can Co | Compositions containing polyamides, polyolefins and ethylene-alpha, beta unsaturatedacid copolymers neutralized with sodium ions |
| US3472916A (en) * | 1965-12-01 | 1969-10-14 | Gulf Oil Corp | Copolymers of ethylene and alkyl acrylates as plasticizers in polycarbonamide resins |
| US3845163A (en) * | 1966-01-24 | 1974-10-29 | Du Pont | Blends of polyamides and ionic copolymer |
| FR2016138A1 (enExample) * | 1968-08-16 | 1970-05-08 | Dart Ind Inc | |
| DE2343693C2 (de) * | 1973-08-30 | 1982-06-16 | Hoechst Ag, 6000 Frankfurt | Thermoplastische Polyamidformmassen |
| FR2291262A1 (fr) * | 1974-11-12 | 1976-06-11 | Toa Gosei Chem Ind | Compositions adhesives pour metaux |
| JPS51125451A (en) * | 1975-04-03 | 1976-11-01 | Asahi Chem Ind Co Ltd | Polyamide composition |
| US4174358A (en) * | 1975-05-23 | 1979-11-13 | E. I. Du Pont De Nemours And Company | Tough thermoplastic nylon compositions |
| US4078014A (en) * | 1976-06-10 | 1978-03-07 | E. I. Du Pont De Nemours And Company | Composition of polyamide, polyethylene ionomer copolymer |
| NL184906C (nl) * | 1976-11-30 | 1989-12-01 | Bayer Ag | Werkwijze voor de bereiding van thermoplastische vormmassa's met een hoge slagsterkte, alsmede gevormd voortbrengsel, dat geheel of ten dele daaruit bestaat. |
| GB1558877A (en) * | 1976-12-11 | 1980-01-09 | British Industrial Plastics | Polyamide moulding compositions |
| US4160790A (en) * | 1977-08-03 | 1979-07-10 | Allied Chemical Corporation | High impact nylon molding compositions |
| US4299744A (en) * | 1980-06-06 | 1981-11-10 | American Hoechst Corporation | High impact polyamides |
-
1981
- 1981-05-11 US US06/262,016 patent/US4404325A/en not_active Expired - Lifetime
-
1982
- 1982-03-24 AU AU81876/82A patent/AU548730B2/en not_active Ceased
- 1982-04-14 DE DE8282103135T patent/DE3278910D1/de not_active Expired
- 1982-04-14 EP EP82103135A patent/EP0069200B2/en not_active Expired - Lifetime
- 1982-05-04 CA CA000402232A patent/CA1177996A/en not_active Expired
- 1982-05-08 KR KR8202008A patent/KR860000247B1/ko not_active Expired
- 1982-05-11 JP JP57079065A patent/JPS57198748A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0216777B2 (enExample) | 1990-04-18 |
| AU548730B2 (en) | 1986-01-02 |
| KR860000247B1 (ko) | 1986-03-21 |
| US4404325A (en) | 1983-09-13 |
| AU8187682A (en) | 1982-11-18 |
| EP0069200B2 (en) | 1994-03-09 |
| JPS57198748A (en) | 1982-12-06 |
| EP0069200B1 (en) | 1988-08-17 |
| KR830010140A (ko) | 1983-12-26 |
| DE3278910D1 (en) | 1988-09-22 |
| EP0069200A1 (en) | 1983-01-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1177996A (en) | High impact nylon composition containing copolymer esters and ionic copolymers | |
| CA1174785A (en) | HIGH IMPACT MOLDING COMPOSITION CONTAINING A POLYAMIDE, ACID AND ESTER COPOLYMERS INCLUDING .alpha.-OLEFIN AND A METAL COMPOUND | |
| US4745143A (en) | Salt resistant polyamide composition | |
| EP0072480B1 (en) | A high impact polyamide composition | |
| EP0218665B1 (fr) | Compositions thermoplastiques multiphases et articles obtenus | |
| JPH0713174B2 (ja) | ポリアセタ−ルの安定化組成物 | |
| EP0574532B1 (en) | Flexible thermoplastic compositions comprising nylon | |
| EP0386110B1 (en) | Polyamide compositions having nitrile rubber and copolymer of ethylene and alpha-olefin therein | |
| US5061757A (en) | High impact strength polyamide blends and method for preparation thereof | |
| US4801633A (en) | Salt resistant polyamide composition | |
| US4160790A (en) | High impact nylon molding compositions | |
| CA1335134C (en) | Polyamide composition resistant to fluorocarbon and hydrocarbon permeation | |
| EP0060579B1 (en) | Use of polyamide moulding compounds in processes for injection moulding objects of high impact strength | |
| JPH06207099A (ja) | 熱可塑性成形材料 | |
| CA1130494A (en) | High impact nylon molding compositions | |
| EP0389479B1 (en) | Polyamide compositions with high impact strength at low temperatures | |
| JP4134338B2 (ja) | ポリアミドをベースとする柔軟な半透明組成物と、その成形方法と、この組成物から得られる製品 | |
| JP3368727B2 (ja) | ポリアミドモノフィラメント | |
| JP2693612B2 (ja) | 吹込成型のための改良ナイロン配合物 | |
| JPH05345854A (ja) | ポリアミド樹脂組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEC | Expiry (correction) | ||
| MKEX | Expiry |