CA1168247A - Preparation of saccharin - Google Patents
Preparation of saccharinInfo
- Publication number
- CA1168247A CA1168247A CA000390267A CA390267A CA1168247A CA 1168247 A CA1168247 A CA 1168247A CA 000390267 A CA000390267 A CA 000390267A CA 390267 A CA390267 A CA 390267A CA 1168247 A CA1168247 A CA 1168247A
- Authority
- CA
- Canada
- Prior art keywords
- aqueous
- diazonium salt
- saccharin
- phase
- sulfur dioxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 title claims abstract description 25
- 229940081974 saccharin Drugs 0.000 title claims abstract description 25
- 235000019204 saccharin Nutrition 0.000 title claims abstract description 25
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 title claims abstract description 25
- 238000002360 preparation method Methods 0.000 title claims abstract description 7
- 238000000034 method Methods 0.000 claims abstract description 36
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims abstract description 32
- 150000001989 diazonium salts Chemical class 0.000 claims abstract description 25
- 239000012954 diazonium Substances 0.000 claims abstract description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims abstract description 17
- 239000008346 aqueous phase Substances 0.000 claims abstract description 15
- 239000000243 solution Substances 0.000 claims abstract description 15
- 239000003054 catalyst Substances 0.000 claims abstract description 14
- 238000000354 decomposition reaction Methods 0.000 claims abstract description 14
- 239000012074 organic phase Substances 0.000 claims abstract description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims abstract description 11
- 239000007800 oxidant agent Substances 0.000 claims abstract description 9
- 239000011541 reaction mixture Substances 0.000 claims abstract description 9
- 239000003960 organic solvent Substances 0.000 claims abstract description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000002253 acid Substances 0.000 claims abstract description 5
- 238000006053 organic reaction Methods 0.000 claims abstract description 3
- KWSYAQIUNJVRCA-UHFFFAOYSA-M 2-methoxycarbonylbenzenediazonium;chloride Chemical compound [Cl-].COC(=O)C1=CC=CC=C1[N+]#N KWSYAQIUNJVRCA-UHFFFAOYSA-M 0.000 claims abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 6
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 150000001879 copper Chemical class 0.000 claims description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 2
- 229940099408 Oxidizing agent Drugs 0.000 claims 3
- 229910021592 Copper(II) chloride Inorganic materials 0.000 claims 1
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 claims 1
- 239000002904 solvent Substances 0.000 description 16
- VAMXMNNIEUEQDV-UHFFFAOYSA-N methyl anthranilate Chemical compound COC(=O)C1=CC=CC=C1N VAMXMNNIEUEQDV-UHFFFAOYSA-N 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- -1 anthranilic acid ester Chemical class 0.000 description 7
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical class OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 229940102398 methyl anthranilate Drugs 0.000 description 6
- 238000006193 diazotization reaction Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- RWZYAGGXGHYGMB-UHFFFAOYSA-N o-aminobenzenecarboxylic acid Natural products NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- YKYONYBAUNKHLG-UHFFFAOYSA-N propyl acetate Chemical compound CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical class CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- AVGQTJUPLKNPQP-UHFFFAOYSA-N 1,1,1-trichloropropane Chemical class CCC(Cl)(Cl)Cl AVGQTJUPLKNPQP-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical class CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- NCYNKWQXFADUOZ-UHFFFAOYSA-N 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one Chemical compound C1=CC=C2C(=O)OS(=O)(=O)C2=C1 NCYNKWQXFADUOZ-UHFFFAOYSA-N 0.000 description 1
- ZEOVXNVKXIPWMS-UHFFFAOYSA-N 2,2-dichloropropane Chemical class CC(C)(Cl)Cl ZEOVXNVKXIPWMS-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- RIFBCJROYYDUNQ-UHFFFAOYSA-N 2-methoxycarbonylbenzenediazonium Chemical compound COC(=O)C1=CC=CC=C1[N+]#N RIFBCJROYYDUNQ-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- VBIIFPGSPJYLRR-UHFFFAOYSA-M Stearyltrimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)C VBIIFPGSPJYLRR-UHFFFAOYSA-M 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- OAYGUTJTMLRJHU-UHFFFAOYSA-N anisole;sulfurochloridic acid Chemical compound OS(Cl)(=O)=O.COC1=CC=CC=C1 OAYGUTJTMLRJHU-UHFFFAOYSA-N 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- YOUGRGFIHBUKRS-UHFFFAOYSA-N benzyl(trimethyl)azanium Chemical class C[N+](C)(C)CC1=CC=CC=C1 YOUGRGFIHBUKRS-UHFFFAOYSA-N 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000004816 dichlorobenzenes Chemical class 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical class CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical class CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical class CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000003021 water soluble solvent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
- C07D275/06—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to the ring sulfur atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Diaphragms For Electromechanical Transducers (AREA)
- Carbon And Carbon Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803044112 DE3044112A1 (de) | 1980-11-24 | 1980-11-24 | Verfahren zur herstellung von saccharin |
| DEP3044112.4 | 1980-11-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1168247A true CA1168247A (en) | 1984-05-29 |
Family
ID=6117377
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000390267A Expired CA1168247A (en) | 1980-11-24 | 1981-11-17 | Preparation of saccharin |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4464537A (enExample) |
| EP (1) | EP0052750B1 (enExample) |
| JP (1) | JPS57109773A (enExample) |
| KR (1) | KR870001000B1 (enExample) |
| AT (1) | ATE6860T1 (enExample) |
| AU (1) | AU541065B2 (enExample) |
| CA (1) | CA1168247A (enExample) |
| DD (1) | DD201898A5 (enExample) |
| DE (2) | DE3044112A1 (enExample) |
| ES (1) | ES8300728A1 (enExample) |
| HU (1) | HU183697B (enExample) |
| IL (1) | IL64093A (enExample) |
| IN (1) | IN154617B (enExample) |
| MX (1) | MX5762E (enExample) |
| SU (1) | SU1128836A3 (enExample) |
| ZA (1) | ZA818101B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN101130524B (zh) * | 2006-08-23 | 2011-03-30 | 上海港福化工技术咨询有限公司 | 糖精的制造方法 |
| CN105732441B (zh) * | 2016-02-25 | 2017-12-15 | 浙江工业大学 | 连续化制备2‑(氯磺酰基)苯甲酸甲酯的方法及其装置 |
| CN105949091A (zh) * | 2016-03-17 | 2016-09-21 | 田子馨 | 一种苯酐尿素制备2-氯磺酰基苯甲酸甲酯的方法 |
| KR101877778B1 (ko) * | 2017-12-26 | 2018-07-12 | 한국화학연구원 | 톨루엔 술폰아미드의 개선된 산화공정을 이용한 사카린의 제조방법 |
| CN111689831A (zh) * | 2020-07-10 | 2020-09-22 | 天津大学 | 糖精钠生产过程中的甲苯废液的回收方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD4564A (enExample) * | ||||
| GB190012585A (en) * | 1900-07-12 | 1900-08-18 | Oliver Imray | Improved Manufacture of Saccharine and of Intermediate Products therefor. |
| US2667503A (en) * | 1951-07-27 | 1954-01-26 | Maumee Dev Company | Method of preparing ortho sulfonyl chloride benzoic acid esters |
| NL7103967A (enExample) * | 1970-04-01 | 1971-10-05 | ||
| US4259499A (en) * | 1972-10-17 | 1981-03-31 | James River Graphics Inc. | Method for preparing 2-sulfochloride benzoates and the use of same in the preparation of saccharin |
| US4042600A (en) * | 1972-10-17 | 1977-08-16 | Scott Paper Company | Pyrolysis of 2-sulfochloride benzoates |
| GB1499084A (en) * | 1975-06-11 | 1978-01-25 | Ihara Chemical Ind Co | Process for producing 1,2-benzothiazole-3-one-1,1-dioxide derivatives |
| US4076721A (en) * | 1975-06-11 | 1978-02-28 | Ihara Chemical Industry Co., Ltd. | Process for producing saccharin |
| US4145349A (en) * | 1977-12-19 | 1979-03-20 | Commercial Organics Limited | Process for the production of saccharine |
-
1980
- 1980-11-23 ZA ZA818101A patent/ZA818101B/xx unknown
- 1980-11-24 DE DE19803044112 patent/DE3044112A1/de not_active Withdrawn
-
1981
- 1981-10-19 DE DE8181108480T patent/DE3162904D1/de not_active Expired
- 1981-10-19 AT AT81108480T patent/ATE6860T1/de not_active IP Right Cessation
- 1981-10-19 EP EP81108480A patent/EP0052750B1/de not_active Expired
- 1981-10-21 IL IL64093A patent/IL64093A/xx unknown
- 1981-10-28 IN IN1202/CAL/81A patent/IN154617B/en unknown
- 1981-11-09 JP JP56178479A patent/JPS57109773A/ja active Granted
- 1981-11-12 US US06/320,333 patent/US4464537A/en not_active Expired - Fee Related
- 1981-11-13 DD DD81234828A patent/DD201898A5/de unknown
- 1981-11-17 CA CA000390267A patent/CA1168247A/en not_active Expired
- 1981-11-17 MX MX819765U patent/MX5762E/es unknown
- 1981-11-19 KR KR1019810004482A patent/KR870001000B1/ko not_active Expired
- 1981-11-23 HU HU813494A patent/HU183697B/hu unknown
- 1981-11-23 ES ES507369A patent/ES8300728A1/es not_active Expired
- 1981-11-23 AU AU77761/81A patent/AU541065B2/en not_active Ceased
- 1981-11-23 SU SU813355736A patent/SU1128836A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| MX5762E (es) | 1984-06-28 |
| US4464537A (en) | 1984-08-07 |
| AU7776181A (en) | 1982-06-03 |
| DD201898A5 (de) | 1983-08-17 |
| IL64093A0 (en) | 1982-01-31 |
| IN154617B (enExample) | 1984-11-17 |
| ATE6860T1 (de) | 1984-04-15 |
| SU1128836A3 (ru) | 1984-12-07 |
| DE3162904D1 (en) | 1984-05-03 |
| ZA818101B (en) | 1982-11-24 |
| JPH0160028B2 (enExample) | 1989-12-20 |
| EP0052750B1 (de) | 1984-03-28 |
| ES507369A0 (es) | 1982-11-01 |
| KR830007598A (ko) | 1983-11-04 |
| KR870001000B1 (ko) | 1987-05-18 |
| AU541065B2 (en) | 1984-12-13 |
| IL64093A (en) | 1984-09-30 |
| HU183697B (en) | 1984-05-28 |
| JPS57109773A (en) | 1982-07-08 |
| ES8300728A1 (es) | 1982-11-01 |
| EP0052750A1 (de) | 1982-06-02 |
| DE3044112A1 (de) | 1982-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4970337A (en) | Process for the preparation of trifluoromethanesulphonyl chloride | |
| CA1168247A (en) | Preparation of saccharin | |
| CA1177848A (en) | Preparation of aromatic sulfohalides | |
| WO1996037458A1 (en) | Process for the preparation of a halosubstituted aromatic acid | |
| US4855501A (en) | Process for preparation of monomethylhydrazine | |
| US6156906A (en) | Process for the preparation of 5,5'-bi-1H-tetrazole salt | |
| US7378546B2 (en) | Method for producing 2-amino-5-iodobenzoic acid | |
| US4057555A (en) | Process for producing saccharin | |
| CA1255332A (en) | Process for the preparation of 4,4'-dinitrodibenzyls | |
| US4235812A (en) | Process for preparing thiourea dioxide | |
| KR860001908B1 (ko) | 디안트라퀴논-n,n'-디히드라진 및 그의 염소화 생성물의 제조방법 | |
| JPS61282355A (ja) | 4,4’−ジニトロスチルベン−2,2’−ジスルホン酸塩の製造法 | |
| US4987266A (en) | Process for the manufacture of nitrophenetole | |
| US3410900A (en) | Production of phenylhydrazine | |
| US4076721A (en) | Process for producing saccharin | |
| US6040453A (en) | Method for preparing 5,5'-bi-1H-tetrazole salt | |
| CA1067908A (en) | Manufacture of echinenone | |
| EP1035118A1 (en) | Method for preparing 5,5'-bi-1H-tetrazole salt | |
| EP1136476B1 (en) | Process for the preparation of 5,5'-bi-1H-Tetrazolediammonium salts using hydrazine hydrate and dicyan as starting materials | |
| JPH0580464B2 (enExample) | ||
| EP0151835B1 (en) | Process for producing pentachloronitrobenzene from hexachlorobenzene | |
| US5329027A (en) | Oxidative dehalogenation process for the production of perchlorinated quinones | |
| US6706934B2 (en) | Method for producing 2,3,4,5-tetrachlorobenzotrifluoride | |
| US4454362A (en) | Process for producing pentachloronitrobenzene | |
| EP0197633A1 (en) | Method for the production of m-aminophenol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |