CA1163239A - Pendant supported hydraulic extensible boom - Google Patents
Pendant supported hydraulic extensible boomInfo
- Publication number
- CA1163239A CA1163239A CA000374575A CA374575A CA1163239A CA 1163239 A CA1163239 A CA 1163239A CA 000374575 A CA000374575 A CA 000374575A CA 374575 A CA374575 A CA 374575A CA 1163239 A CA1163239 A CA 1163239A
- Authority
- CA
- Canada
- Prior art keywords
- boom
- pendant
- mast
- section
- drum
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000543 intermediate Substances 0.000 claims description 33
- 230000008093 supporting effect Effects 0.000 claims description 12
- 230000008859 change Effects 0.000 claims description 4
- 230000004044 response Effects 0.000 claims description 4
- 230000006872 improvement Effects 0.000 claims description 3
- 241001052209 Cylinder Species 0.000 claims 1
- 239000012530 fluid Substances 0.000 description 11
- 238000010586 diagram Methods 0.000 description 5
- 235000018936 Vitellaria paradoxa Nutrition 0.000 description 2
- 210000005069 ears Anatomy 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229930192334 Auxin Natural products 0.000 description 1
- 241000347881 Kadua laxiflora Species 0.000 description 1
- 241000283986 Lepus Species 0.000 description 1
- 101100037618 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) ant-1 gene Proteins 0.000 description 1
- 241001307210 Pene Species 0.000 description 1
- WFAULHLDTDDABL-UHFFFAOYSA-N Proxazole citrate Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C=1C=CC=CC=1C(CC)C1=NOC(CCN(CC)CC)=N1 WFAULHLDTDDABL-UHFFFAOYSA-N 0.000 description 1
- 239000002363 auxin Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 1
- PXUQTDZNOHRWLI-OXUVVOBNSA-O malvidin 3-O-beta-D-glucoside Chemical compound COC1=C(O)C(OC)=CC(C=2C(=CC=3C(O)=CC(O)=CC=3[O+]=2)O[C@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)=C1 PXUQTDZNOHRWLI-OXUVVOBNSA-O 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B66—HOISTING; LIFTING; HAULING
- B66C—CRANES; LOAD-ENGAGING ELEMENTS OR DEVICES FOR CRANES, CAPSTANS, WINCHES, OR TACKLES
- B66C23/00—Cranes comprising essentially a beam, boom, or triangular structure acting as a cantilever and mounted for translatory of swinging movements in vertical or horizontal planes or a combination of such movements, e.g. jib-cranes, derricks, tower cranes
- B66C23/62—Constructional features or details
- B66C23/82—Luffing gear
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B66—HOISTING; LIFTING; HAULING
- B66C—CRANES; LOAD-ENGAGING ELEMENTS OR DEVICES FOR CRANES, CAPSTANS, WINCHES, OR TACKLES
- B66C23/00—Cranes comprising essentially a beam, boom, or triangular structure acting as a cantilever and mounted for translatory of swinging movements in vertical or horizontal planes or a combination of such movements, e.g. jib-cranes, derricks, tower cranes
- B66C23/62—Constructional features or details
- B66C23/64—Jibs
- B66C23/70—Jibs constructed of sections adapted to be assembled to form jibs or various lengths
- B66C23/701—Jibs constructed of sections adapted to be assembled to form jibs or various lengths telescopic
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Jib Cranes (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/145,529 US4352434A (en) | 1980-05-01 | 1980-05-01 | Pendant supported hydraulic extensible boom |
| US145,529 | 1980-05-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1163239A true CA1163239A (en) | 1984-03-06 |
Family
ID=22513522
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000374575A Expired CA1163239A (en) | 1980-05-01 | 1981-04-03 | Pendant supported hydraulic extensible boom |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4352434A (enExample) |
| JP (1) | JPS574893A (enExample) |
| BR (1) | BR8102650A (enExample) |
| CA (1) | CA1163239A (enExample) |
| DE (1) | DE3117316A1 (enExample) |
| FR (1) | FR2481687B1 (enExample) |
| IT (1) | IT1200563B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4492311A (en) * | 1981-08-17 | 1985-01-08 | Fmc Corporation | Coupling and latching mechanism for extensible boom |
| US4514939A (en) * | 1981-08-17 | 1985-05-07 | Fmc Corporation | Extensible boom with manual section stored in base |
| US4489838A (en) * | 1981-08-17 | 1984-12-25 | Fmc Corporation | Low droop multi-part pendant supported boom |
| US4592474A (en) * | 1981-08-17 | 1986-06-03 | Fmc Corporation | Coupling and latching mechanism for extensible boom |
| US4635805A (en) * | 1981-11-05 | 1987-01-13 | Kidde, Inc. | Crane boom locking pin insertion indicator and actuator means |
| US4478014A (en) * | 1981-12-14 | 1984-10-23 | Fmc Corporation | Telescopic boom with angled corner construction |
| US4492312A (en) * | 1982-06-30 | 1985-01-08 | Fmc Corporation | External pendant pay-out system with anti-droop control |
| US4557391A (en) * | 1982-06-30 | 1985-12-10 | Fmc Corporation | Method of controlling the angle of a pivotal boom with extensible sections |
| US4491228A (en) * | 1982-06-30 | 1985-01-01 | Fmc Corporation | Floating sheave type pendant pay-out system for pendant supported boom |
| US4467928A (en) * | 1982-06-30 | 1984-08-28 | Fmc Corporation | Pendant supported boom with fixed and live pendant portions |
| US4460098A (en) * | 1982-06-30 | 1984-07-17 | Fmc Corporation | Pendant control system for pendant supported boom |
| US4585132A (en) * | 1984-09-10 | 1986-04-29 | Fmc Corporation | Extensible boom with manual section stored in base |
| EP0334187B1 (de) * | 1988-03-23 | 1991-10-16 | Liebherr-Werk Ehingen GmbH | Fahrzeugkran mit Teleskopausleger |
| US5240129A (en) * | 1990-06-04 | 1993-08-31 | Link-Belt Construction Equip. Co. | Heavy duty crane with self-retracting/erecting live mast |
| DE29720972U1 (de) * | 1997-11-26 | 1999-03-25 | Ec Engineering + Consulting Spezialmaschinen Gmbh, 89079 Ulm | Teleskopierbarer Ausleger |
| DE19814636A1 (de) * | 1998-03-26 | 1999-09-30 | Mannesmann Ag | Ringliftkran |
| WO2001072624A1 (en) * | 2000-03-28 | 2001-10-04 | Higgins David J | Telescoping boom |
| DE202004008083U1 (de) * | 2004-05-19 | 2005-11-10 | Liebherr-Werk Ehingen Gmbh | Mobilkran |
| US8684197B2 (en) * | 2009-05-01 | 2014-04-01 | Manitowoc Crane Companies, Llc | Crane with boom raising assist structure |
| IT201800004537A1 (it) * | 2018-04-16 | 2019-10-16 | Piattaforma aerea | |
| RU2684254C1 (ru) * | 2018-06-26 | 2019-04-04 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Тихоокеанский государственный университет" | Стрела грузоподъемной машины |
Family Cites Families (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1632329A (en) * | 1925-01-12 | 1927-06-14 | Frank W Hake | Derrick crane |
| US1869747A (en) * | 1929-12-26 | 1932-08-02 | Utility Products Company | Automobile truck derrick |
| US1871603A (en) * | 1930-11-25 | 1932-08-16 | Claud D Ginter | Automatic hoist boom |
| US2475963A (en) * | 1943-12-06 | 1949-07-12 | Roy C Howell | Motor truck crane |
| US2819803A (en) * | 1954-10-12 | 1958-01-14 | Leo B Obenchain | Boom for cranes |
| US2868392A (en) * | 1956-09-28 | 1959-01-13 | Glenn L Poffenberger | Boom structure |
| US2999600A (en) * | 1959-09-04 | 1961-09-12 | Gates Earl | Compensating telescopic boom |
| US3194413A (en) * | 1962-10-08 | 1965-07-13 | Louis J Landry | Extendable boom |
| US3308967A (en) * | 1965-10-06 | 1967-03-14 | Byron F Barkley | Extensible boom crane |
| DE1252389B (enExample) * | 1966-01-22 | 1968-07-11 | ||
| US3426917A (en) * | 1966-12-02 | 1969-02-11 | Charles R Siegel | Mobile crane and tow truck |
| US3371799A (en) * | 1967-03-01 | 1968-03-05 | Baldwin Lima Hamilton Corp | Telescopic boom angle control system |
| US3465899A (en) * | 1967-08-03 | 1969-09-09 | Bucyrus Erie Co | Telescoping boom for hydraulic crane |
| US3534867A (en) * | 1968-07-25 | 1970-10-20 | Harnischfeger Corp | Compensating boom hoist cable system for a telescopic boom for cranes or the like |
| DE1803820A1 (de) * | 1968-10-18 | 1970-09-17 | Demag Baumaschinen Gmbh | Laengenveraenderbarer Ausleger fuer Krane,Bagger od.dgl. |
| GB1297961A (enExample) * | 1969-02-12 | 1972-11-29 | ||
| US3648850A (en) * | 1970-03-25 | 1972-03-14 | Tyee Construction Co | Crane with telescopic boom |
| JPS5721503B2 (enExample) * | 1973-05-24 | 1982-05-07 | ||
| US3856151A (en) * | 1973-11-29 | 1974-12-24 | Case Co J I | Telescopic boom and jib assembly with means to maintain a predetermined angular position therebetween |
| DD112631A1 (enExample) * | 1974-04-15 | 1975-04-20 | ||
| US3918592A (en) * | 1974-11-11 | 1975-11-11 | Jim N Paul | Crane hoist attachment for the bed of a truck |
| US3987594A (en) * | 1975-02-06 | 1976-10-26 | Clark Equipment Company | System and method for automatic unstowing and stowing of a crane boom |
| US4011699A (en) * | 1975-08-27 | 1977-03-15 | Fmc Corporation | Telescopic boom quick retract hydraulic circuit |
| US4053058A (en) * | 1976-05-27 | 1977-10-11 | Fmc Corporation | Suspended extensible boom |
| US4049238A (en) * | 1976-09-27 | 1977-09-20 | Brown Harold E | Porta-crane |
| GB1594096A (en) * | 1976-11-11 | 1981-07-30 | Coles Cranes Ltd | Telescopic booms |
| JPS5410131U (enExample) * | 1977-06-24 | 1979-01-23 | ||
| US4166542A (en) * | 1977-12-05 | 1979-09-04 | Bryan John F Jr | Telescoping lattice boom crane |
-
1980
- 1980-05-01 US US06/145,529 patent/US4352434A/en not_active Expired - Lifetime
-
1981
- 1981-04-03 CA CA000374575A patent/CA1163239A/en not_active Expired
- 1981-04-30 BR BR8102650A patent/BR8102650A/pt not_active IP Right Cessation
- 1981-04-30 DE DE19813117316 patent/DE3117316A1/de not_active Withdrawn
- 1981-04-30 FR FR8108711A patent/FR2481687B1/fr not_active Expired
- 1981-05-01 JP JP6677981A patent/JPS574893A/ja active Granted
- 1981-05-04 IT IT21500/81A patent/IT1200563B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| FR2481687B1 (fr) | 1986-10-10 |
| IT1200563B (it) | 1989-01-27 |
| IT8121500A0 (it) | 1981-05-04 |
| US4352434A (en) | 1982-10-05 |
| BR8102650A (pt) | 1982-01-26 |
| JPS574893A (en) | 1982-01-11 |
| DE3117316A1 (de) | 1982-04-15 |
| JPH0134917B2 (enExample) | 1989-07-21 |
| FR2481687A1 (fr) | 1981-11-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1163239A (en) | Pendant supported hydraulic extensible boom | |
| US7762412B2 (en) | Mast raising structure and process for high-capacity mobile lift crane | |
| US5586667A (en) | Mobile crane with main and auxiliary counterweight assemblies | |
| EP2589564B1 (en) | Mobile lift crane with variable position counterweight | |
| JP2716819B2 (ja) | クレーン及びクレーンの吊り上げ能力を増大させる付属装置 | |
| US8622228B2 (en) | Boom hoist transportation system and crane using same | |
| US6089388A (en) | Mobile crane | |
| US8397924B2 (en) | Drum frame system for cranes | |
| US6695158B2 (en) | Crane with self-raising mast | |
| US4976361A (en) | Mobile crane comprising a telescopic boom | |
| US4733598A (en) | Telescopic jib | |
| US5240129A (en) | Heavy duty crane with self-retracting/erecting live mast | |
| US4360111A (en) | Crane with telescopic jib | |
| US6065620A (en) | Movable sheave assembly for a crane | |
| US3479077A (en) | Hydraulically actuated bucket closing means | |
| US4489838A (en) | Low droop multi-part pendant supported boom | |
| US4492312A (en) | External pendant pay-out system with anti-droop control | |
| CA1223843A (en) | Floating sheave-type pendant pay-out system for pendant supported boom | |
| US4514939A (en) | Extensible boom with manual section stored in base | |
| US4544071A (en) | External pendant pay-out system with anti-droop control | |
| GB2108076A (en) | A crane having an extensible boom | |
| US3362549A (en) | Rear mounted log loader |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |