CA1156434A - Hydrogen peroxide synthesis - Google Patents
Hydrogen peroxide synthesisInfo
- Publication number
- CA1156434A CA1156434A CA000386025A CA386025A CA1156434A CA 1156434 A CA1156434 A CA 1156434A CA 000386025 A CA000386025 A CA 000386025A CA 386025 A CA386025 A CA 386025A CA 1156434 A CA1156434 A CA 1156434A
- Authority
- CA
- Canada
- Prior art keywords
- palladium
- hydrogen peroxide
- catalyst
- hydrogen
- aldehyde
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 title claims abstract description 113
- 238000003786 synthesis reaction Methods 0.000 title description 6
- 230000015572 biosynthetic process Effects 0.000 title description 5
- 239000003054 catalyst Substances 0.000 claims abstract description 76
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims abstract description 45
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims abstract description 36
- 239000001257 hydrogen Substances 0.000 claims abstract description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 28
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 26
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 24
- 238000000354 decomposition reaction Methods 0.000 claims abstract description 22
- 150000001299 aldehydes Chemical class 0.000 claims abstract description 17
- 150000002576 ketones Chemical class 0.000 claims abstract description 17
- 239000007788 liquid Substances 0.000 claims abstract description 13
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 9
- 239000001301 oxygen Substances 0.000 claims abstract description 9
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 9
- 230000002401 inhibitory effect Effects 0.000 claims abstract description 8
- 230000006872 improvement Effects 0.000 claims abstract description 7
- 239000000203 mixture Substances 0.000 claims abstract description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 91
- 229910052763 palladium Inorganic materials 0.000 claims description 33
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 15
- 230000009467 reduction Effects 0.000 claims description 15
- 230000008569 process Effects 0.000 claims description 14
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 238000001035 drying Methods 0.000 claims description 5
- 239000007789 gas Substances 0.000 claims description 4
- 238000005470 impregnation Methods 0.000 claims description 3
- 239000003381 stabilizer Substances 0.000 claims description 3
- 239000000243 solution Substances 0.000 claims 5
- 239000007864 aqueous solution Substances 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 abstract description 4
- 150000002941 palladium compounds Chemical class 0.000 abstract description 4
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 abstract 1
- 239000000843 powder Substances 0.000 abstract 1
- 229960000443 hydrochloric acid Drugs 0.000 description 16
- 235000011167 hydrochloric acid Nutrition 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 239000002904 solvent Substances 0.000 description 8
- 238000005984 hydrogenation reaction Methods 0.000 description 7
- 239000002609 medium Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000002978 peroxides Chemical class 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- 239000006229 carbon black Substances 0.000 description 4
- 235000019241 carbon black Nutrition 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 238000000151 deposition Methods 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 150000002940 palladium Chemical class 0.000 description 4
- 230000007928 solubilization Effects 0.000 description 4
- 238000005063 solubilization Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 230000008021 deposition Effects 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 3
- 239000012286 potassium permanganate Substances 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 238000004448 titration Methods 0.000 description 3
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000012018 catalyst precursor Substances 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000006184 cosolvent Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000286904 Leptothecata Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 238000004847 absorption spectroscopy Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- -1 e.g. Inorganic materials 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 239000006066 glass batch Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- SWELZOZIOHGSPA-UHFFFAOYSA-N palladium silver Chemical compound [Pd].[Ag] SWELZOZIOHGSPA-UHFFFAOYSA-N 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/029—Preparation from hydrogen and oxygen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA000439702A CA1177225A (en) | 1980-10-10 | 1983-10-25 | Hydrogen peroxide synthesis |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US195,829 | 1980-10-10 | ||
| US06/195,829 US4379778A (en) | 1980-10-10 | 1980-10-10 | Hydrogen peroxide synthesis |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000439702A Division CA1177225A (en) | 1980-10-10 | 1983-10-25 | Hydrogen peroxide synthesis |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1156434A true CA1156434A (en) | 1983-11-08 |
Family
ID=22722995
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000386025A Expired CA1156434A (en) | 1980-10-10 | 1981-09-16 | Hydrogen peroxide synthesis |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4379778A (OSRAM) |
| EP (2) | EP0049810B1 (OSRAM) |
| JP (1) | JPS5792504A (OSRAM) |
| CA (1) | CA1156434A (OSRAM) |
| DE (1) | DE3169270D1 (OSRAM) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4681751A (en) * | 1983-06-22 | 1987-07-21 | E. I. Du Pont De Nemours And Company | Catalytic process for making H2 O2 from hydrogen and oxygen |
| ATE25839T1 (de) * | 1983-06-22 | 1987-03-15 | Du Pont | Verfahren zur katalytischen herstellung von wasserstoffperoxid aus sauerstoff und wasserstoff. |
| US4772458A (en) * | 1986-11-19 | 1988-09-20 | E. I. Du Pont De Nemours And Company | Catalytic process for making hydrogen peroxide from hydrogen and oxygen employing a bromide promoter |
| JP2533596B2 (ja) * | 1988-01-26 | 1996-09-11 | 三井東圧化学株式会社 | 過酸化水素の製造法 |
| US4889705A (en) * | 1988-05-13 | 1989-12-26 | E. I. Du Pont De Nemours And Company | Hydrogen peroxide method using optimized H+ and BR- concentrations |
| CA1317740C (en) * | 1988-10-24 | 1993-05-18 | Karl T. Chuang | Production of hydrogen peroxide |
| US5128114A (en) * | 1989-04-14 | 1992-07-07 | E. I. Du Pont De Nemours And Company | Silica microspheres, method of improving attrition resistance |
| US5352645A (en) * | 1989-04-14 | 1994-10-04 | E. I. Du Pont De Nemours And Company | Silica microspheres, method of improving attrition resistance and use |
| BE1004650A3 (fr) * | 1991-03-05 | 1993-01-05 | Interox Internat Sa | Synthese directe de peroxyde d'hydrogene par catalyse heterogene, catalyseur pour ladite synthese et procede de preparation dudit catalyseur. |
| EP0504741B1 (en) * | 1991-03-20 | 1994-12-28 | Mitsubishi Gas Chemical Company, Inc. | A method for producing hydrogen peroxide |
| US5352369A (en) * | 1993-04-01 | 1994-10-04 | Fountainhead Technologies, Inc. | Method of treating water |
| US5660802A (en) * | 1994-06-07 | 1997-08-26 | Fountainhead Technologies, Inc. | Water purifier |
| DE69701002T2 (de) * | 1996-01-30 | 2000-07-20 | Sumitomo Chemical Co., Ltd. | Verfahren zur Herstellung von Wasserstoffperoxid |
| SE9602484D0 (sv) * | 1996-06-24 | 1996-06-24 | Eka Chemicals Ab | Method of producing a chemical compound |
| DE19710376A1 (de) * | 1997-03-13 | 1998-09-17 | Clariant Gmbh | Katalysator zur hydrierenden Enthalogenierung von alpha-halogenierten Carbonsäuren sowie ein Verfahren zu seiner Herstellung |
| DE19857137A1 (de) | 1998-12-11 | 2000-06-15 | Bayer Ag | Integriertes Verfahren zur Herstellung von Epoxiden aus Olefinen |
| IT1318550B1 (it) | 2000-06-01 | 2003-08-27 | Eni Spa | Catalizzatore e processo per la sintesi diretta di acqua ossigenata. |
| US6534440B2 (en) * | 2000-11-29 | 2003-03-18 | Council Of Scientific And Industrial Research | Process for the activation of a metallic palladium based catalyst useful for the direct oxidation of hydrogen to hydrogen peroxide |
| US7067103B2 (en) | 2003-03-28 | 2006-06-27 | Headwaters Nanokinetix, Inc. | Direct hydrogen peroxide production using staged hydrogen addition |
| US7045479B2 (en) * | 2003-07-14 | 2006-05-16 | Headwaters Nanokinetix, Inc. | Intermediate precursor compositions used to make supported catalysts having a controlled coordination structure and methods for preparing such compositions |
| US7011807B2 (en) * | 2003-07-14 | 2006-03-14 | Headwaters Nanokinetix, Inc. | Supported catalysts having a controlled coordination structure and methods for preparing such catalysts |
| US7569508B2 (en) * | 2004-11-17 | 2009-08-04 | Headwaters Technology Innovation, Llc | Reforming nanocatalysts and method of making and using such catalysts |
| US7655137B2 (en) | 2003-07-14 | 2010-02-02 | Headwaters Technology Innovation, Llc | Reforming catalysts having a controlled coordination structure and methods for preparing such compositions |
| US7144565B2 (en) * | 2003-07-29 | 2006-12-05 | Headwaters Nanokinetix, Inc. | Process for direct catalytic hydrogen peroxide production |
| US7632775B2 (en) * | 2004-11-17 | 2009-12-15 | Headwaters Technology Innovation, Llc | Multicomponent nanoparticles formed using a dispersing agent |
| US7449423B2 (en) * | 2005-01-14 | 2008-11-11 | Headwaters Technology Innovation, Llc | Heat treatment of anchored nanocatalysts in a non-zero oxidation state and catalysts made by such method |
| US7045481B1 (en) | 2005-04-12 | 2006-05-16 | Headwaters Nanokinetix, Inc. | Nanocatalyst anchored onto acid functionalized solid support and methods of making and using same |
| US20060233695A1 (en) * | 2005-04-18 | 2006-10-19 | Stevens Institute Of Technology | Process for the production of hydrogen peroxide from hydrogen and oxygen |
| GB0514075D0 (en) * | 2005-07-11 | 2005-08-17 | Cardiff University | Improvements in catalysts |
| US7396795B2 (en) * | 2005-08-31 | 2008-07-08 | Headwaters Technology Innovation, Llc | Low temperature preparation of supported nanoparticle catalysts having increased dispersion |
| US7718710B2 (en) * | 2006-03-17 | 2010-05-18 | Headwaters Technology Innovation, Llc | Stable concentrated metal colloids and methods of making same |
| US7632774B2 (en) * | 2006-03-30 | 2009-12-15 | Headwaters Technology Innovation, Llc | Method for manufacturing supported nanocatalysts having an acid-functionalized support |
| US7541309B2 (en) * | 2006-05-16 | 2009-06-02 | Headwaters Technology Innovation, Llc | Reforming nanocatalysts and methods of making and using such catalysts |
| US7563742B2 (en) | 2006-09-22 | 2009-07-21 | Headwaters Technology Innovation, Llc | Supported nickel catalysts having high nickel loading and high metal dispersion and methods of making same |
| US7601668B2 (en) * | 2006-09-29 | 2009-10-13 | Headwaters Technology Innovation, Llc | Methods for manufacturing bi-metallic catalysts having a controlled crystal face exposure |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2285277A (en) * | 1939-11-08 | 1942-06-02 | Du Pont | Noble metal catalyst and process of preparing same |
| US2520038A (en) * | 1948-04-14 | 1950-08-22 | American Cyanamid Co | Process for preparing pyridoxine hydrochloride |
| US2749359A (en) * | 1953-01-06 | 1956-06-05 | Du Pont | Hydrogenation of dicyanobutene in the presence of a neutralized palladium catalyst |
| US2857337A (en) * | 1955-05-10 | 1958-10-21 | Du Pont | Method of preparing hydrogenation catalysts |
| US3138560A (en) * | 1959-12-17 | 1964-06-23 | Engelhard Ind Inc | Process for producing palladium on carbon catalysts |
| NL294400A (OSRAM) * | 1962-06-21 | |||
| US3336112A (en) * | 1963-07-23 | 1967-08-15 | Ici Ltd | Catalytic production of hydrogen peroxide from its elements |
| US3736265A (en) * | 1970-11-06 | 1973-05-29 | Texaco Inc | Stabilized palladium-carbon catalysts |
| US3736266A (en) * | 1971-08-18 | 1973-05-29 | Dart Ind Inc | Preparation of carbon supported palladium catalysts |
| SE392045B (sv) * | 1972-08-17 | 1977-03-14 | Hoechst Ag | Sett att framstella en av finkornigt berarmaterial och palladium bestaende katalysator |
| JPS514097A (en) * | 1974-07-02 | 1976-01-13 | Tokuyama Soda Kk | Kasankasuisono seizohoho |
| DE2509251C3 (de) * | 1975-03-04 | 1978-07-13 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung eines Palladiumkatalysators |
| US4007256A (en) * | 1975-04-11 | 1977-02-08 | Shell Oil Company | Catalytic production of hydrogen peroxide from its elements |
| JPS5271000A (en) * | 1975-12-10 | 1977-06-13 | Tokuyama Soda Co Ltd | Production of hydrogen peroxide |
| US4035260A (en) * | 1976-01-29 | 1977-07-12 | American Cyanamid Company | Process for hydrogenation catalysts of improved distribution of active components |
| DE2850510A1 (de) * | 1978-11-22 | 1980-06-04 | Chinoin Gyogyszer Es Vegyeszet | Verfahren zur herstellung eines nicht-pyrophoren palladium-katalysators |
| DE3166627D1 (en) * | 1980-12-12 | 1984-11-15 | Thomae Gmbh Dr K | Pyrimidones, their preparation and medicines containing them |
-
1980
- 1980-10-10 US US06/195,829 patent/US4379778A/en not_active Expired - Lifetime
-
1981
- 1981-09-16 CA CA000386025A patent/CA1156434A/en not_active Expired
- 1981-09-29 EP EP81107742A patent/EP0049810B1/en not_active Expired
- 1981-09-29 DE DE8181107742T patent/DE3169270D1/de not_active Expired
- 1981-09-29 EP EP83112589A patent/EP0117306B1/en not_active Expired
- 1981-10-09 JP JP56160395A patent/JPS5792504A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5792504A (en) | 1982-06-09 |
| EP0117306B1 (en) | 1988-08-03 |
| US4379778A (en) | 1983-04-12 |
| JPS6331401B2 (OSRAM) | 1988-06-23 |
| EP0049810B1 (en) | 1985-03-13 |
| EP0117306A1 (en) | 1984-09-05 |
| EP0049810A1 (en) | 1982-04-21 |
| DE3169270D1 (en) | 1985-04-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1156434A (en) | Hydrogen peroxide synthesis | |
| US5374748A (en) | Process for preparing silver catalyst for ethylene epoxidation | |
| US4157356A (en) | Process for aromatizing C3 -C8 hydrocarbon feedstocks using a gallium containing catalyst supported on certain silicas | |
| KR0142192B1 (ko) | 알릴 아세테이트의 제조방법 | |
| EP1160196B1 (en) | Catalyst and process for the direct synthesis of hydrogen peroxide | |
| JPH0234938B2 (OSRAM) | ||
| EP1412287B8 (en) | Catalyst and its use in the synthesis of hydrogen peroxide | |
| US4780552A (en) | Preparation of furan by decarbonylation of furfural | |
| US20020103080A1 (en) | Process for the activation of a metallic palladium based catalyst useful for the direct oxidation of hydrogen to hydrogen peroxide | |
| JPH0513704B2 (OSRAM) | ||
| US4476250A (en) | Catalytic process for the production of methanol | |
| US9340423B2 (en) | Catalysts | |
| US4467124A (en) | Preparation of 1,1,1,3,3,3-hexafluoropropane-2-ol by vapor phase catalytic reaction of hexafluoroacetone hydrate with hydrogen | |
| EP1050339A1 (en) | Stable catalysts and processes for making and using the same | |
| CA1177225A (en) | Hydrogen peroxide synthesis | |
| US4510071A (en) | Methanol conversion process | |
| US4060559A (en) | Process for preparing O-phenylphenol | |
| US5177254A (en) | Method for producing an unsaturated glycol diester | |
| US5602070A (en) | Process for preparing silver catalyst | |
| JPS6039653B2 (ja) | 酸素含有炭化水素化合物の製造方法 | |
| US20020115894A1 (en) | Process for the catalytic direct oxidation of unsaturated hydrocarbons in the gas phase | |
| US3390954A (en) | Hydroxylamine | |
| JPH01299253A (ja) | 酢酸アリルの製造法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry | ||
| MKEX | Expiry |
Effective date: 20001108 |