CA1147198A - Electrophotographic element including a hydrazone derivative in the charge transport layer - Google Patents
Electrophotographic element including a hydrazone derivative in the charge transport layerInfo
- Publication number
- CA1147198A CA1147198A CA000366206A CA366206A CA1147198A CA 1147198 A CA1147198 A CA 1147198A CA 000366206 A CA000366206 A CA 000366206A CA 366206 A CA366206 A CA 366206A CA 1147198 A CA1147198 A CA 1147198A
- Authority
- CA
- Canada
- Prior art keywords
- group
- page
- transport layer
- charge transport
- electrophotographic element
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000007857 hydrazones Chemical class 0.000 title description 6
- -1 hydrazone compound Chemical class 0.000 claims abstract description 24
- 239000000758 substrate Substances 0.000 claims abstract description 10
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 4
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 4
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 4
- 150000002367 halogens Chemical class 0.000 claims abstract description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract 3
- 239000000049 pigment Substances 0.000 claims description 40
- 239000000463 material Substances 0.000 claims description 27
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 10
- 239000011230 binding agent Substances 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 9
- 229910052711 selenium Inorganic materials 0.000 claims description 9
- 239000011669 selenium Substances 0.000 claims description 9
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 claims description 4
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 claims description 4
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 claims description 4
- 239000004952 Polyamide Substances 0.000 claims description 3
- 229920002647 polyamide Polymers 0.000 claims description 3
- 229920000728 polyester Polymers 0.000 claims description 3
- 239000004793 Polystyrene Substances 0.000 claims description 2
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 claims description 2
- 239000003822 epoxy resin Substances 0.000 claims description 2
- YLQWCDOCJODRMT-UHFFFAOYSA-N fluoren-9-one Chemical group C1=CC=C2C(=O)C3=CC=CC=C3C2=C1 YLQWCDOCJODRMT-UHFFFAOYSA-N 0.000 claims description 2
- 239000004417 polycarbonate Substances 0.000 claims description 2
- 229920000515 polycarbonate Polymers 0.000 claims description 2
- 229920000647 polyepoxide Polymers 0.000 claims description 2
- 229920001470 polyketone Polymers 0.000 claims description 2
- 229920002223 polystyrene Polymers 0.000 claims description 2
- 239000004814 polyurethane Substances 0.000 claims description 2
- 229920002635 polyurethane Polymers 0.000 claims description 2
- 229920006215 polyvinyl ketone Polymers 0.000 claims description 2
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical group C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 claims description 2
- 125000006617 triphenylamine group Chemical group 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 3
- NGQSLSMAEVWNPU-UHFFFAOYSA-N 1,2-bis(2-phenylethenyl)benzene Chemical group C=1C=CC=CC=1C=CC1=CC=CC=C1C=CC1=CC=CC=C1 NGQSLSMAEVWNPU-UHFFFAOYSA-N 0.000 claims 2
- 229910045601 alloy Inorganic materials 0.000 claims 2
- 239000000956 alloy Substances 0.000 claims 2
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims 1
- 229920000178 Acrylic resin Polymers 0.000 claims 1
- 239000004925 Acrylic resin Substances 0.000 claims 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 claims 1
- IKJFYINYNJYDTA-UHFFFAOYSA-N dibenzothiophene sulfone Chemical group C1=CC=C2S(=O)(=O)C3=CC=CC=C3C2=C1 IKJFYINYNJYDTA-UHFFFAOYSA-N 0.000 claims 1
- 125000001624 naphthyl group Chemical group 0.000 claims 1
- 239000004615 ingredient Substances 0.000 abstract description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 24
- 238000000034 method Methods 0.000 description 13
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 239000006163 transport media Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 241000243251 Hydra Species 0.000 description 2
- 239000004419 Panlite Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 230000002950 deficient Effects 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000001023 inorganic pigment Substances 0.000 description 2
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 2
- SXQCTESRRZBPHJ-UHFFFAOYSA-M lissamine rhodamine Chemical compound [Na+].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=C(S([O-])(=O)=O)C=C1S([O-])(=O)=O SXQCTESRRZBPHJ-UHFFFAOYSA-M 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000012860 organic pigment Substances 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 239000004431 polycarbonate resin Substances 0.000 description 2
- 229920005668 polycarbonate resin Polymers 0.000 description 2
- 229920006267 polyester film Polymers 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- RNJIWICOCATEFH-WCWDXBQESA-N (2e)-2-(1-oxobenzo[e][1]benzothiol-2-ylidene)benzo[e][1]benzothiol-1-one Chemical compound C1=CC=CC2=C(C(C(=C3/C(C4=C5C=CC=CC5=CC=C4S3)=O)/S3)=O)C3=CC=C21 RNJIWICOCATEFH-WCWDXBQESA-N 0.000 description 1
- HYGLETVERPVXOS-UHFFFAOYSA-N 1-bromopyrene Chemical compound C1=C2C(Br)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 HYGLETVERPVXOS-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 235000000177 Indigofera tinctoria Nutrition 0.000 description 1
- 229920006063 Lamide® Polymers 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 229910001370 Se alloy Inorganic materials 0.000 description 1
- JWGLGQHIGMBQRK-UHFFFAOYSA-N [3-(4-chlorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-phenylmethanone Chemical group C1=CC(Cl)=CC=C1C1N(C(=O)C=2C=CC=CC=2)N=C(C=2SC=CC=2)C1 JWGLGQHIGMBQRK-UHFFFAOYSA-N 0.000 description 1
- SRKRSWKCLVMJRZ-UHFFFAOYSA-N [S-2].S.[SeH2].[Cd+2] Chemical compound [S-2].S.[SeH2].[Cd+2] SRKRSWKCLVMJRZ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000004840 adhesive resin Substances 0.000 description 1
- 229920006223 adhesive resin Polymers 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- IYYZUPMFVPLQIF-ALWQSETLSA-N dibenzothiophene Chemical group C1=CC=CC=2[34S]C3=C(C=21)C=CC=C3 IYYZUPMFVPLQIF-ALWQSETLSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 235000019239 indanthrene blue RS Nutrition 0.000 description 1
- UHOKSCJSTAHBSO-UHFFFAOYSA-N indanthrone blue Chemical compound C1=CC=C2C(=O)C3=CC=C4NC5=C6C(=O)C7=CC=CC=C7C(=O)C6=CC=C5NC4=C3C(=O)C2=C1 UHOKSCJSTAHBSO-UHFFFAOYSA-N 0.000 description 1
- 229940097275 indigo Drugs 0.000 description 1
- COHYTHOBJLSHDF-UHFFFAOYSA-N indigo powder Natural products N1C2=CC=CC=C2C(=O)C1=C1C(=O)C2=CC=CC=C2N1 COHYTHOBJLSHDF-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical group C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- WVIICGIFSIBFOG-UHFFFAOYSA-N pyrylium Chemical class C1=CC=[O+]C=C1 WVIICGIFSIBFOG-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 102220301217 rs146307558 Human genes 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 229910052714 tellurium Inorganic materials 0.000 description 1
- 210000001550 testis Anatomy 0.000 description 1
- 239000000984 vat dye Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0601—Acyclic or carbocyclic compounds
- G03G5/0618—Acyclic or carbocyclic compounds containing oxygen and nitrogen
Landscapes
- Health & Medical Sciences (AREA)
- Emergency Medicine (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP15872579A JPS5681850A (en) | 1979-12-08 | 1979-12-08 | Electrophotographic receptor |
| JP158725/1979 | 1979-12-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1147198A true CA1147198A (en) | 1983-05-31 |
Family
ID=15677966
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000366206A Expired CA1147198A (en) | 1979-12-08 | 1980-12-05 | Electrophotographic element including a hydrazone derivative in the charge transport layer |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4387147A (member.php) |
| JP (1) | JPS5681850A (member.php) |
| CA (1) | CA1147198A (member.php) |
| DE (1) | DE3046240A1 (member.php) |
| FR (1) | FR2471625B1 (member.php) |
| GB (1) | GB2068574B (member.php) |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2088074B (en) * | 1980-09-26 | 1984-12-19 | Copyer Co | Electrophotographic photosensitive member |
| JPS58118658A (ja) * | 1982-01-07 | 1983-07-14 | Mitsubishi Paper Mills Ltd | 積層平版印刷版の製造法 |
| US4599287A (en) * | 1983-11-09 | 1986-07-08 | Konishiroku Photo Industry Co., Ltd. | Positive charging photorecptor |
| JPS61107248A (ja) * | 1984-10-31 | 1986-05-26 | Canon Inc | 積層型電子写真感光体 |
| GB8912279D0 (en) * | 1989-05-27 | 1989-07-12 | Ciba Geigy Japan Ltd | Electrophotographic sensitive materials |
| GB8925903D0 (en) * | 1989-10-16 | 1990-01-04 | Ici Plc | Organic photoconductor |
| JPH0990647A (ja) * | 1995-09-26 | 1997-04-04 | Fuji Electric Co Ltd | 電子写真感光体 |
| US5925486A (en) * | 1997-12-11 | 1999-07-20 | Lexmark International, Inc. | Imaging members with improved wear characteristics |
| JP2002014478A (ja) | 2000-06-30 | 2002-01-18 | Hodogaya Chem Co Ltd | 電子製品材料の精製方法 |
| US6824939B2 (en) | 2001-12-11 | 2004-11-30 | Ricoh Company Limited | Electrophotographic image forming method and apparatus |
| US7018756B2 (en) | 2003-09-05 | 2006-03-28 | Xerox Corporation | Dual charge transport layer and photoconductive imaging member including the same |
| US7541123B2 (en) * | 2005-06-20 | 2009-06-02 | Xerox Corporation | Imaging member |
| US7361440B2 (en) * | 2005-08-09 | 2008-04-22 | Xerox Corporation | Anticurl backing layer for electrostatographic imaging members |
| US7504187B2 (en) * | 2005-09-15 | 2009-03-17 | Xerox Corporation | Mechanically robust imaging member overcoat |
| US7422831B2 (en) * | 2005-09-15 | 2008-09-09 | Xerox Corporation | Anticurl back coating layer electrophotographic imaging members |
| US7462434B2 (en) * | 2005-12-21 | 2008-12-09 | Xerox Corporation | Imaging member with low surface energy polymer in anti-curl back coating layer |
| US7455941B2 (en) * | 2005-12-21 | 2008-11-25 | Xerox Corporation | Imaging member with multilayer anti-curl back coating |
| US7754404B2 (en) * | 2005-12-27 | 2010-07-13 | Xerox Corporation | Imaging member |
| US7517624B2 (en) * | 2005-12-27 | 2009-04-14 | Xerox Corporation | Imaging member |
| US7527906B2 (en) * | 2006-06-20 | 2009-05-05 | Xerox Corporation | Imaging member having adjustable friction anticurl back coating |
| US7524597B2 (en) * | 2006-06-22 | 2009-04-28 | Xerox Corporation | Imaging member having nano-sized phase separation in various layers |
| US7582399B1 (en) | 2006-06-22 | 2009-09-01 | Xerox Corporation | Imaging member having nano polymeric gel particles in various layers |
| US7767373B2 (en) * | 2006-08-23 | 2010-08-03 | Xerox Corporation | Imaging member having high molecular weight binder |
| KR101117006B1 (ko) | 2006-12-26 | 2012-04-12 | 아사히 가세이 케미칼즈 가부시키가이샤 | 인쇄판용 수지 조성물 |
| US7998646B2 (en) | 2008-04-07 | 2011-08-16 | Xerox Corporation | Low friction electrostatographic imaging member |
| US7943278B2 (en) * | 2008-04-07 | 2011-05-17 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8021812B2 (en) * | 2008-04-07 | 2011-09-20 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8007970B2 (en) * | 2008-04-07 | 2011-08-30 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8084173B2 (en) * | 2008-04-07 | 2011-12-27 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8026028B2 (en) | 2008-04-07 | 2011-09-27 | Xerox Corporation | Low friction electrostatographic imaging member |
| US8124305B2 (en) * | 2009-05-01 | 2012-02-28 | Xerox Corporation | Flexible imaging members without anticurl layer |
| US8168356B2 (en) * | 2009-05-01 | 2012-05-01 | Xerox Corporation | Structurally simplified flexible imaging members |
| US8173341B2 (en) * | 2009-05-01 | 2012-05-08 | Xerox Corporation | Flexible imaging members without anticurl layer |
| US20100297544A1 (en) | 2009-05-22 | 2010-11-25 | Xerox Corporation | Flexible imaging members having a plasticized imaging layer |
| US8378972B2 (en) * | 2009-06-01 | 2013-02-19 | Apple Inc. | Keyboard with increased control of backlit keys |
| US8278017B2 (en) * | 2009-06-01 | 2012-10-02 | Xerox Corporation | Crack resistant imaging member preparation and processing method |
| US8241825B2 (en) | 2009-08-31 | 2012-08-14 | Xerox Corporation | Flexible imaging member belts |
| US8003285B2 (en) * | 2009-08-31 | 2011-08-23 | Xerox Corporation | Flexible imaging member belts |
| US20110136049A1 (en) * | 2009-12-08 | 2011-06-09 | Xerox Corporation | Imaging members comprising fluoroketone |
| US8232030B2 (en) | 2010-03-17 | 2012-07-31 | Xerox Corporation | Curl-free imaging members with a slippery surface |
| US8343700B2 (en) | 2010-04-16 | 2013-01-01 | Xerox Corporation | Imaging members having stress/strain free layers |
| US8541151B2 (en) | 2010-04-19 | 2013-09-24 | Xerox Corporation | Imaging members having a novel slippery overcoat layer |
| US8404413B2 (en) | 2010-05-18 | 2013-03-26 | Xerox Corporation | Flexible imaging members having stress-free imaging layer(s) |
| US8470505B2 (en) | 2010-06-10 | 2013-06-25 | Xerox Corporation | Imaging members having improved imaging layers |
| US8394560B2 (en) | 2010-06-25 | 2013-03-12 | Xerox Corporation | Imaging members having an enhanced charge blocking layer |
| US8475983B2 (en) | 2010-06-30 | 2013-07-02 | Xerox Corporation | Imaging members having a chemical resistive overcoat layer |
| US8263298B1 (en) | 2011-02-24 | 2012-09-11 | Xerox Corporation | Electrically tunable and stable imaging members |
| US8465892B2 (en) | 2011-03-18 | 2013-06-18 | Xerox Corporation | Chemically resistive and lubricated overcoat |
| US8877413B2 (en) | 2011-08-23 | 2014-11-04 | Xerox Corporation | Flexible imaging members comprising improved ground strip |
| US9017907B2 (en) | 2013-07-11 | 2015-04-28 | Xerox Corporation | Flexible imaging members having externally plasticized imaging layer(s) |
| US9091949B2 (en) | 2013-08-16 | 2015-07-28 | Xerox Corporation | Imaging members having electrically and mechanically tuned imaging layers |
| US9046798B2 (en) | 2013-08-16 | 2015-06-02 | Xerox Corporation | Imaging members having electrically and mechanically tuned imaging layers |
| US9017908B2 (en) | 2013-08-20 | 2015-04-28 | Xerox Corporation | Photoelectrical stable imaging members |
| US9075327B2 (en) | 2013-09-20 | 2015-07-07 | Xerox Corporation | Imaging members and methods for making the same |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB930288A (en) * | 1961-04-19 | 1963-07-03 | Demag Ag | Rotary metallurgical furnaces |
| US4175960A (en) * | 1974-12-20 | 1979-11-27 | Eastman Kodak Company | Multi-active photoconductive element having an aggregate charge generating layer |
| US4150987A (en) * | 1977-10-17 | 1979-04-24 | International Business Machines Corporation | Hydrazone containing charge transport element and photoconductive process of using same |
| JPS54150128A (en) * | 1978-05-17 | 1979-11-26 | Mitsubishi Chem Ind | Electrophotographic photosensitive member |
-
1979
- 1979-12-08 JP JP15872579A patent/JPS5681850A/ja active Pending
-
1980
- 1980-12-03 US US06/212,306 patent/US4387147A/en not_active Expired - Lifetime
- 1980-12-05 CA CA000366206A patent/CA1147198A/en not_active Expired
- 1980-12-08 FR FR8026015A patent/FR2471625B1/fr not_active Expired
- 1980-12-08 GB GB8039259A patent/GB2068574B/en not_active Expired
- 1980-12-08 DE DE19803046240 patent/DE3046240A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5681850A (en) | 1981-07-04 |
| FR2471625A1 (fr) | 1981-06-19 |
| DE3046240A1 (de) | 1981-09-17 |
| GB2068574B (en) | 1983-12-21 |
| US4387147A (en) | 1983-06-07 |
| DE3046240C2 (member.php) | 1989-12-07 |
| GB2068574A (en) | 1981-08-12 |
| FR2471625B1 (fr) | 1986-07-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1147198A (en) | Electrophotographic element including a hydrazone derivative in the charge transport layer | |
| US4297426A (en) | Electrophotographic element with carbazole hydrazone or anile charge transport compounds | |
| US4365014A (en) | Electrophotographic photoconductor | |
| US4385106A (en) | Charge transfer layer with styryl hydrazones | |
| CA1122844A (en) | Electrophotographic element containing a hydrazone photo conductor in the charge transport layer | |
| US4403025A (en) | Electrophotographic photoreceptor | |
| US5139910A (en) | Photoconductive imaging members with bisazo compositions | |
| JPS6136228B2 (member.php) | ||
| US4314016A (en) | Electrophotographic element having a bisazo photoconductor | |
| US4465753A (en) | Indoline electrophotoconductor | |
| JP2753582B2 (ja) | 電子写真用感光体 | |
| US4451545A (en) | Electrophotographic element with carbazole derivative | |
| JP2813776B2 (ja) | 電子写真用感光体 | |
| JP2812620B2 (ja) | 電子写真感光体 | |
| JP2700231B2 (ja) | 電子写真用感光体 | |
| EP0708374B1 (en) | Electrophotographic photoreceptor | |
| JPH07306536A (ja) | 電子写真用感光体 | |
| JP2951469B2 (ja) | 電子写真感光体 | |
| JP3451278B2 (ja) | 電子写真用感光体 | |
| JPS6255654B2 (member.php) | ||
| JPS6255660B2 (member.php) | ||
| US4388393A (en) | Hydrazone compound, with hydroxyethyl group in charge transfer layer | |
| JPS61210361A (ja) | 正帯電型電子写真感光体 | |
| JPH04186364A (ja) | 電子写真感光体 | |
| JPH0455299B2 (member.php) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |