CA1133880A - Technique to reduce the zeolite molecular sieve solubility in an aqueous system - Google Patents
Technique to reduce the zeolite molecular sieve solubility in an aqueous systemInfo
- Publication number
- CA1133880A CA1133880A CA353,340A CA353340A CA1133880A CA 1133880 A CA1133880 A CA 1133880A CA 353340 A CA353340 A CA 353340A CA 1133880 A CA1133880 A CA 1133880A
- Authority
- CA
- Canada
- Prior art keywords
- adsorbent
- further characterized
- mixture
- component
- crystalline aluminosilicate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 85
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 title claims abstract description 66
- 239000010457 zeolite Substances 0.000 title claims description 50
- 229910021536 Zeolite Inorganic materials 0.000 title description 35
- 239000002808 molecular sieve Substances 0.000 title description 6
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 title description 6
- 239000003463 adsorbent Substances 0.000 claims abstract description 205
- 239000000463 material Substances 0.000 claims abstract description 86
- 239000000203 mixture Substances 0.000 claims abstract description 74
- 230000008569 process Effects 0.000 claims abstract description 54
- 229910000323 aluminium silicate Inorganic materials 0.000 claims abstract description 35
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 29
- 239000011230 binding agent Substances 0.000 claims abstract description 23
- 239000000843 powder Substances 0.000 claims abstract description 22
- 229920000620 organic polymer Polymers 0.000 claims abstract description 21
- 239000007864 aqueous solution Substances 0.000 claims abstract description 19
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims abstract description 18
- 229910052710 silicon Inorganic materials 0.000 claims abstract description 18
- 239000010703 silicon Substances 0.000 claims abstract description 18
- 239000007788 liquid Substances 0.000 claims abstract description 15
- 239000000470 constituent Substances 0.000 claims abstract description 10
- 238000004519 manufacturing process Methods 0.000 claims abstract description 9
- 239000003960 organic solvent Substances 0.000 claims abstract description 9
- 238000004090 dissolution Methods 0.000 claims abstract description 7
- 238000010348 incorporation Methods 0.000 claims abstract description 7
- 238000001035 drying Methods 0.000 claims abstract description 5
- 230000006872 improvement Effects 0.000 claims abstract description 5
- 150000001720 carbohydrates Chemical class 0.000 claims abstract description 4
- 238000002156 mixing Methods 0.000 claims abstract description 4
- 239000002491 polymer binding agent Substances 0.000 claims abstract description 4
- 239000000306 component Substances 0.000 claims description 119
- 238000000926 separation method Methods 0.000 claims description 37
- 150000001768 cations Chemical class 0.000 claims description 27
- 239000002245 particle Substances 0.000 claims description 26
- 230000015572 biosynthetic process Effects 0.000 claims description 17
- 238000005755 formation reaction Methods 0.000 claims description 17
- 230000000274 adsorptive effect Effects 0.000 claims description 16
- 239000000243 solution Substances 0.000 claims description 15
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 claims description 11
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 claims description 10
- 125000002091 cationic group Chemical group 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 10
- 229930091371 Fructose Natural products 0.000 claims description 9
- 239000005715 Fructose Substances 0.000 claims description 9
- 239000008103 glucose Substances 0.000 claims description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 8
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 claims description 6
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 6
- 239000000020 Nitrocellulose Substances 0.000 claims description 6
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 229920002678 cellulose Polymers 0.000 claims description 6
- 229920001220 nitrocellulos Polymers 0.000 claims description 6
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 5
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 claims description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 4
- 230000000717 retained effect Effects 0.000 claims description 4
- 238000005406 washing Methods 0.000 claims description 3
- 230000001747 exhibiting effect Effects 0.000 claims description 2
- 238000001125 extrusion Methods 0.000 claims description 2
- 229940032007 methylethyl ketone Drugs 0.000 claims description 2
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 claims description 2
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 claims 1
- 238000011084 recovery Methods 0.000 claims 1
- 238000003795 desorption Methods 0.000 abstract description 15
- 230000000694 effects Effects 0.000 abstract description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 20
- 238000001179 sorption measurement Methods 0.000 description 19
- 238000012360 testing method Methods 0.000 description 18
- 239000000047 product Substances 0.000 description 17
- 239000012530 fluid Substances 0.000 description 13
- 239000011800 void material Substances 0.000 description 13
- 239000004927 clay Substances 0.000 description 10
- 239000000377 silicon dioxide Substances 0.000 description 10
- 229920002301 cellulose acetate Polymers 0.000 description 9
- 229960002737 fructose Drugs 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- -1 hydroxy aldehydes Chemical class 0.000 description 8
- 230000014759 maintenance of location Effects 0.000 description 7
- 150000002772 monosaccharides Chemical class 0.000 description 7
- 150000002482 oligosaccharides Chemical class 0.000 description 7
- 239000011148 porous material Substances 0.000 description 7
- 238000011109 contamination Methods 0.000 description 6
- 229920001542 oligosaccharide Polymers 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 239000006188 syrup Substances 0.000 description 6
- 235000020357 syrup Nutrition 0.000 description 6
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 5
- 229930006000 Sucrose Natural products 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 239000007791 liquid phase Substances 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- 239000000700 radioactive tracer Substances 0.000 description 5
- 230000002829 reductive effect Effects 0.000 description 5
- 239000005720 sucrose Substances 0.000 description 5
- XLYOFNOQVPJJNP-ZSJDYOACSA-N Heavy water Chemical compound [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 4
- 208000007976 Ketosis Diseases 0.000 description 4
- 240000008042 Zea mays Species 0.000 description 4
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 4
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 4
- 150000001323 aldoses Chemical class 0.000 description 4
- 235000005822 corn Nutrition 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 150000002584 ketoses Chemical class 0.000 description 4
- 238000011144 upstream manufacturing Methods 0.000 description 4
- XMBSMMCPKFDGEO-ZETCQYMHSA-N (2s)-2-amino-5-[[amino-(2-methoxyethylamino)methylidene]amino]pentanoic acid Chemical compound COCCNC(=N)NCCC[C@H](N)C(O)=O XMBSMMCPKFDGEO-ZETCQYMHSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000000875 corresponding effect Effects 0.000 description 3
- 239000008367 deionised water Substances 0.000 description 3
- 229910021641 deionized water Inorganic materials 0.000 description 3
- 150000004676 glycans Chemical class 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 229920001282 polysaccharide Polymers 0.000 description 3
- 239000005017 polysaccharide Substances 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 239000002594 sorbent Substances 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 230000003068 static effect Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 235000000346 sugar Nutrition 0.000 description 3
- 150000008163 sugars Chemical class 0.000 description 3
- 230000004580 weight loss Effects 0.000 description 3
- OWEGMIWEEQEYGQ-UHFFFAOYSA-N 100676-05-9 Natural products OC1C(O)C(O)C(CO)OC1OCC1C(O)C(O)C(O)C(OC2C(OC(O)C(O)C2O)CO)O1 OWEGMIWEEQEYGQ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-PICCSMPSSA-N Maltose Natural products O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-PICCSMPSSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 150000002016 disaccharides Chemical class 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 239000013618 particulate matter Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 238000005086 pumping Methods 0.000 description 2
- 238000010926 purge Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- 150000004043 trisaccharides Chemical class 0.000 description 2
- 239000012808 vapor phase Substances 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical group [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- QWIZNVHXZXRPDR-UHFFFAOYSA-N D-melezitose Natural products O1C(CO)C(O)C(O)C(O)C1OC1C(O)C(CO)OC1(CO)OC1OC(CO)C(O)C(O)C1O QWIZNVHXZXRPDR-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 229920002527 Glycogen Polymers 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- LKDRXBCSQODPBY-AMVSKUEXSA-N L-(-)-Sorbose Chemical compound OCC1(O)OC[C@H](O)[C@@H](O)[C@@H]1O LKDRXBCSQODPBY-AMVSKUEXSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- MUPFEKGTMRGPLJ-RMMQSMQOSA-N Raffinose Natural products O(C[C@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O[C@@]2(CO)[C@H](O)[C@@H](O)[C@@H](CO)O2)O1)[C@@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 MUPFEKGTMRGPLJ-RMMQSMQOSA-N 0.000 description 1
- MUPFEKGTMRGPLJ-UHFFFAOYSA-N UNPD196149 Natural products OC1C(O)C(CO)OC1(CO)OC1C(O)C(O)C(O)C(COC2C(C(O)C(O)C(CO)O2)O)O1 MUPFEKGTMRGPLJ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001312 aldohexoses Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- WQZGKKKJIJFFOK-PHYPRBDBSA-N alpha-D-galactose Chemical compound OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-PHYPRBDBSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- GUBGYTABKSRVRQ-QUYVBRFLSA-N beta-maltose Chemical compound OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O GUBGYTABKSRVRQ-QUYVBRFLSA-N 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000012013 faujasite Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 229930182830 galactose Natural products 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229940096919 glycogen Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000002402 hexoses Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 150000002500 ions Chemical group 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002574 ketohexoses Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- QWIZNVHXZXRPDR-WSCXOGSTSA-N melezitose Chemical compound O([C@@]1(O[C@@H]([C@H]([C@@H]1O[C@@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)O)CO)CO)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O QWIZNVHXZXRPDR-WSCXOGSTSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229920005596 polymer binder Polymers 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- MUPFEKGTMRGPLJ-ZQSKZDJDSA-N raffinose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO[C@@H]2[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO)O2)O)O1 MUPFEKGTMRGPLJ-ZQSKZDJDSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001223 reverse osmosis Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 235000021309 simple sugar Nutrition 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 150000004044 tetrasaccharides Chemical class 0.000 description 1
- 230000004304 visual acuity Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J20/00—Solid sorbent compositions or filter aid compositions; Sorbents for chromatography; Processes for preparing, regenerating or reactivating thereof
- B01J20/02—Solid sorbent compositions or filter aid compositions; Sorbents for chromatography; Processes for preparing, regenerating or reactivating thereof comprising inorganic material
- B01J20/10—Solid sorbent compositions or filter aid compositions; Sorbents for chromatography; Processes for preparing, regenerating or reactivating thereof comprising inorganic material comprising silica or silicate
- B01J20/16—Alumino-silicates
- B01J20/18—Synthetic zeolitic molecular sieves
- B01J20/183—Physical conditioning without chemical treatment, e.g. drying, granulating, coating, irradiation
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Analytical Chemistry (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Treatment Of Liquids With Adsorbents In General (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
- Saccharide Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/048,955 US4248737A (en) | 1979-06-15 | 1979-06-15 | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
| US048,955 | 1979-06-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1133880A true CA1133880A (en) | 1982-10-19 |
Family
ID=21957340
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA353,340A Expired CA1133880A (en) | 1979-06-15 | 1980-06-04 | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4248737A (enExample) |
| JP (1) | JPS565135A (enExample) |
| AU (1) | AU538648B2 (enExample) |
| BR (1) | BR8003730A (enExample) |
| CA (1) | CA1133880A (enExample) |
| DD (1) | DD155588A5 (enExample) |
| DE (1) | DE3022008C2 (enExample) |
| ES (1) | ES492357A0 (enExample) |
| FR (1) | FR2459066B1 (enExample) |
| GB (1) | GB2053875B (enExample) |
| IT (1) | IT1131325B (enExample) |
| MX (1) | MX153128A (enExample) |
| NL (1) | NL184170C (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4358322A (en) * | 1976-05-27 | 1982-11-09 | Uop Inc. | Process for separating a ketose from an aldose by selective adsorption |
| GB2059282B (en) * | 1979-09-08 | 1983-07-06 | Engelhard Min & Chem | Catalyst for photolytic production of hydrogen from water |
| US4287001A (en) * | 1980-02-25 | 1981-09-01 | Uop Inc. | Esterified aluminosilicate adsorbent as for resolution of sugar components |
| US4363672A (en) * | 1980-04-11 | 1982-12-14 | Uop Inc. | Separation process using cellulose acetate butyrate bound zeolite adsorbents |
| US4319928A (en) * | 1980-05-02 | 1982-03-16 | Uop Inc. | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
| US4386012A (en) * | 1980-05-02 | 1983-05-31 | Uop Inc. | Zeolite molecular sieve adsorbent for use in an aqueous system |
| US4333769A (en) * | 1980-05-02 | 1982-06-08 | Uop Inc. | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
| US4372876A (en) * | 1980-05-02 | 1983-02-08 | Uop Inc. | Zeolite molecular sieve adsorbent for an aqueous system |
| US4337171A (en) * | 1980-06-18 | 1982-06-29 | Uop Inc. | Organic bound adsorbents |
| US4421567A (en) * | 1980-06-18 | 1983-12-20 | Uop Inc. | Separatory process using organic bound adsorbents |
| US4316819A (en) * | 1980-08-11 | 1982-02-23 | Uop Inc. | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
| US4406819A (en) * | 1980-12-18 | 1983-09-27 | Uop Inc. | Zeolite molecular sieve having reduced solubility in an aqueous system |
| US4333768A (en) * | 1980-12-18 | 1982-06-08 | Uop Inc. | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
| US4405378A (en) * | 1981-02-17 | 1983-09-20 | Uop Inc. | Extraction of sucrose |
| US4486548A (en) * | 1981-09-28 | 1984-12-04 | Uop Inc. | Adsorbent for the extraction of sucrose |
| US4475954A (en) * | 1981-12-09 | 1984-10-09 | Uop Inc. | Separation of sucrose from thick juice |
| US4471114A (en) * | 1982-12-30 | 1984-09-11 | Union Carbide Corporation | Separation of mannose by selective adsorption on zeolitic molecular sieves |
| US4822492A (en) * | 1984-09-28 | 1989-04-18 | Uop | Latex polymer bonded crystalline molecular sieves |
| JPS61205444A (ja) * | 1985-03-07 | 1986-09-11 | Kanegafuchi Chem Ind Co Ltd | 植物蛋白食品の加工法 |
| BR0009262A (pt) * | 1999-03-05 | 2002-02-05 | Toshiba Kk Toshiba Corp | Aparelho de codificação de vìdeo e aparelho de decodificação de vìdeo |
| US6357678B1 (en) | 1999-10-29 | 2002-03-19 | Albermarle Corporation | Process for producing ultra finely-divided zeolite powder |
| US6451723B1 (en) * | 2000-07-07 | 2002-09-17 | Honeywell International Inc. | Polymer-bound nitrogen adsorbent and method of making and using it |
| JP4942243B2 (ja) * | 2000-08-31 | 2012-05-30 | 三菱レイヨン株式会社 | 浄水器用吸着剤およびこれを用いた浄水器 |
| US8092903B2 (en) * | 2004-07-09 | 2012-01-10 | Pbb Gbr | Shaped bodies made of powders or granulated metal, method for the production thereof and their use |
| WO2016154842A1 (en) * | 2015-03-30 | 2016-10-06 | Rohm And Haas Electronic Materials Llc | A transparent pressure sensing film with hybrid particles |
| CN116440855B (zh) * | 2023-06-16 | 2023-09-05 | 格林斯达(北京)环保科技股份有限公司 | 一种净化材料及其制备方法和应用 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE608328A (enExample) * | 1960-09-19 | |||
| US3262890A (en) * | 1960-10-05 | 1966-07-26 | Union Carbide Corp | Manufacture of shaped crystalline zeolitic molecular sieve bodies |
| GB1443545A (en) * | 1972-12-30 | 1976-07-21 | Toyo Jozo Kk | Molecular sieving particleland preparation thereof |
| AU497159B2 (en) * | 1974-02-21 | 1978-12-07 | Commonwealth Scientific And Industrial Research Organization | Removing limonin from citrus fruit juice |
| JPS51110048A (en) * | 1975-02-21 | 1976-09-29 | Toray Industries | Toruino bunrihoho |
-
1979
- 1979-06-15 US US06/048,955 patent/US4248737A/en not_active Expired - Lifetime
-
1980
- 1980-06-04 CA CA353,340A patent/CA1133880A/en not_active Expired
- 1980-06-04 AU AU59051/80A patent/AU538648B2/en not_active Ceased
- 1980-06-12 NL NLAANVRAGE8003422,A patent/NL184170C/xx not_active IP Right Cessation
- 1980-06-12 ES ES492357A patent/ES492357A0/es active Granted
- 1980-06-12 MX MX182743A patent/MX153128A/es unknown
- 1980-06-12 DE DE3022008A patent/DE3022008C2/de not_active Expired
- 1980-06-13 JP JP8009380A patent/JPS565135A/ja active Granted
- 1980-06-13 IT IT22782/80A patent/IT1131325B/it active
- 1980-06-13 GB GB8019389A patent/GB2053875B/en not_active Expired
- 1980-06-16 BR BR8003730A patent/BR8003730A/pt unknown
- 1980-06-16 FR FR8013301A patent/FR2459066B1/fr not_active Expired
- 1980-06-16 DD DD80221870A patent/DD155588A5/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT1131325B (it) | 1986-06-18 |
| US4248737A (en) | 1981-02-03 |
| DE3022008C2 (de) | 1986-06-12 |
| GB2053875B (en) | 1983-06-29 |
| AU538648B2 (en) | 1984-08-23 |
| AU5905180A (en) | 1980-12-18 |
| IT8022782A0 (it) | 1980-06-13 |
| FR2459066B1 (fr) | 1988-05-27 |
| JPS6311052B2 (enExample) | 1988-03-11 |
| DE3022008A1 (de) | 1980-12-18 |
| FR2459066A1 (fr) | 1981-01-09 |
| NL184170C (nl) | 1989-05-01 |
| MX153128A (es) | 1986-08-07 |
| DD155588A5 (de) | 1982-06-23 |
| GB2053875A (en) | 1981-02-11 |
| NL8003422A (nl) | 1980-12-17 |
| NL184170B (nl) | 1988-12-01 |
| JPS565135A (en) | 1981-01-20 |
| ES8105581A1 (es) | 1981-06-16 |
| BR8003730A (pt) | 1981-01-13 |
| ES492357A0 (es) | 1981-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1133880A (en) | Technique to reduce the zeolite molecular sieve solubility in an aqueous system | |
| US4293346A (en) | Simulated countercurrent sorption process employing ion exchange resins with backflushing | |
| US4238243A (en) | Technique to reduce the zeolite molecular sieve solubility in an aqueous system | |
| US4692514A (en) | Process for separating ketoses from alkaline- or pyridine-catalyzed isomerization products | |
| US4372876A (en) | Zeolite molecular sieve adsorbent for an aqueous system | |
| US4295994A (en) | Cellulose acetate butyrate bound zeolite adsorbents | |
| US4319929A (en) | Simulated countercurrent sorption process employing ion exchange resins with periodic backflushing | |
| US4337171A (en) | Organic bound adsorbents | |
| US4431456A (en) | Technique to reduce the zeolite molecular sieve solubility in an aqueous system | |
| US4373025A (en) | Process for the isomerization of glucose | |
| US4316819A (en) | Technique to reduce the zeolite molecular sieve solubility in an aqueous system | |
| US4298501A (en) | Technique to reduce the zeolite molecular sieve solubility in an aqueous system | |
| US4857642A (en) | Process for separating arabinose from a mixture of other aldoses | |
| US4421567A (en) | Separatory process using organic bound adsorbents | |
| US4345946A (en) | Process for use of a zeolite molecular sieve adsorbent in an aqueous system | |
| US4325742A (en) | Rare earth cation exchanged adsorbents for carbohydrate separations | |
| US4287001A (en) | Esterified aluminosilicate adsorbent as for resolution of sugar components | |
| US5000794A (en) | Process for separating glucose and mannose with dealuminated Y zeolites | |
| US4664718A (en) | Process for separating arabinose from a pentose/hexose mixture | |
| US4333768A (en) | Technique to reduce the zeolite molecular sieve solubility in an aqueous system | |
| US4880920A (en) | Process for separating ketoses from alkaline-or pyridine-catalyzed isomerization products | |
| US4319928A (en) | Technique to reduce the zeolite molecular sieve solubility in an aqueous system | |
| US4386012A (en) | Zeolite molecular sieve adsorbent for use in an aqueous system | |
| US4406819A (en) | Zeolite molecular sieve having reduced solubility in an aqueous system | |
| US4363672A (en) | Separation process using cellulose acetate butyrate bound zeolite adsorbents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |