CA1128546A - Acrylamide or methacrylamide alkoxypropyl quaternary compounds - Google Patents
Acrylamide or methacrylamide alkoxypropyl quaternary compoundsInfo
- Publication number
- CA1128546A CA1128546A CA349,370A CA349370A CA1128546A CA 1128546 A CA1128546 A CA 1128546A CA 349370 A CA349370 A CA 349370A CA 1128546 A CA1128546 A CA 1128546A
- Authority
- CA
- Canada
- Prior art keywords
- acrylamide
- methacrylamide
- alkoxypropyl
- alkyl group
- lower alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 title claims abstract description 7
- 150000001875 compounds Chemical class 0.000 title abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 11
- 239000002253 acid Substances 0.000 claims abstract description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 6
- 150000001450 anions Chemical group 0.000 claims abstract description 3
- 239000001257 hydrogen Substances 0.000 claims abstract description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 claims abstract description 3
- 239000011707 mineral Substances 0.000 claims abstract description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims 1
- 239000000178 monomer Substances 0.000 abstract description 13
- -1 class of cationic acrylamides Chemical class 0.000 abstract description 9
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 abstract description 7
- 239000000203 mixture Substances 0.000 abstract description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000000463 material Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 229940117913 acrylamide Drugs 0.000 description 4
- 229960004592 isopropanol Drugs 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 239000000654 additive Substances 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- QHNXEVRKFKHMRL-UHFFFAOYSA-N dimethylazanium;acetate Chemical compound CNC.CC(O)=O QHNXEVRKFKHMRL-UHFFFAOYSA-N 0.000 description 3
- 150000002118 epoxides Chemical class 0.000 description 3
- FLCAEMBIQVZWIF-UHFFFAOYSA-N 6-(dimethylamino)-2-methylhex-2-enamide Chemical compound CN(C)CCCC=C(C)C(N)=O FLCAEMBIQVZWIF-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 230000015271 coagulation Effects 0.000 description 2
- 238000005345 coagulation Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- XPXMKIXDFWLRAA-UHFFFAOYSA-N hydrazinide Chemical compound [NH-]N XPXMKIXDFWLRAA-UHFFFAOYSA-N 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003512 tertiary amines Chemical group 0.000 description 2
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- FECNOIODIVNEKI-UHFFFAOYSA-N 2-[(2-aminobenzoyl)amino]benzoic acid Chemical class NC1=CC=CC=C1C(=O)NC1=CC=CC=C1C(O)=O FECNOIODIVNEKI-UHFFFAOYSA-N 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 102100036883 Cyclin-H Human genes 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 101000713120 Homo sapiens Cyclin-H Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000003926 acrylamides Chemical class 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 238000004873 anchoring Methods 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000701 coagulant Substances 0.000 description 1
- 239000003250 coal slurry Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 230000016615 flocculation Effects 0.000 description 1
- 238000005189 flocculation Methods 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 239000002649 leather substitute Substances 0.000 description 1
- 229940059904 light mineral oil Drugs 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 229940039748 oxalate Drugs 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229920000867 polyelectrolyte Polymers 0.000 description 1
- 229920000582 polyisocyanurate Polymers 0.000 description 1
- 239000011495 polyisocyanurate Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 235000013580 sausages Nutrition 0.000 description 1
- 239000010865 sewage Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/89—Carboxylic acid amides having nitrogen atoms of carboxamide groups quaternised
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Detergent Compositions (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/032,317 US4212820A (en) | 1979-04-23 | 1979-04-23 | Acrylamide or methacrylamide alkoxypropyl quaternary compounds |
| US032,317 | 1979-04-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1128546A true CA1128546A (en) | 1982-07-27 |
Family
ID=21864292
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA349,370A Expired CA1128546A (en) | 1979-04-23 | 1980-04-08 | Acrylamide or methacrylamide alkoxypropyl quaternary compounds |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4212820A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5838423B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE882935A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1128546A (cg-RX-API-DMAC7.html) |
| DE (1) | DE3013067A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2455033A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB2047690B (cg-RX-API-DMAC7.html) |
| NL (1) | NL187162C (cg-RX-API-DMAC7.html) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4495367A (en) * | 1982-07-06 | 1985-01-22 | Celanese Corporation | High charge density, cationic methacrylamide based monomers and their _polymers |
| US4506081A (en) * | 1982-09-02 | 1985-03-19 | Buckman Laboratories, Inc. | Polymeric quaternary ammonium compounds and their uses |
| US4469873A (en) * | 1982-11-04 | 1984-09-04 | Texaco Inc. | Vinyl pyridinium monomers |
| CA1235141A (en) * | 1984-03-28 | 1988-04-12 | Laurence G. Dammann | High charge density, cationic methacrylamide based monomers and their polymers |
| CA2193049A1 (en) | 1995-12-18 | 1997-06-19 | Leonard Michael Haberman | Degreasing compositions |
| PL374040A1 (en) * | 2002-06-04 | 2005-09-19 | Rhodia Inc. | Monomer compound comprising several cationic groups, process for making the same, and polymers comprising units deriving therefrom |
| EP1534760B9 (en) | 2002-08-09 | 2013-07-10 | Akzo Nobel Coatings International BV | Aci-capped quaternised polymer and compositions comprising such polymer |
| US7064232B2 (en) * | 2003-12-08 | 2006-06-20 | Rhodia Inc. | Hydrophobic modified diquaternary monomers and polymers as thickening agents of acidic aqueous compositions |
| CA2863060C (en) | 2012-04-19 | 2015-08-18 | Saltworks Technologies Inc. | Resilient cation exchange membranes prepared by polymerizing ionic surfactant monomers |
| CA2859381C (en) * | 2013-04-08 | 2015-02-10 | Xiangchun Yin | Ion exchange membranes selectively permeable to specific ions |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1060855B (de) * | 1953-10-30 | 1959-07-09 | Ciba Geigy | Verfahren zur Herstellung von polymerisierbaren ungesaettigten monomeren Carbonsaeureestern oder -amiden, die mindestens eine quaternaere Ammoniumgruppe enthalten |
| NL88694C (cg-RX-API-DMAC7.html) * | 1953-11-02 | |||
| US2810713A (en) * | 1955-03-21 | 1957-10-22 | Rohm & Haas | Quaternary ammonium compounds and methods of producing them |
| BE588422A (cg-RX-API-DMAC7.html) * | 1959-03-14 | |||
| US3170901A (en) * | 1960-12-27 | 1965-02-23 | Rohm & Hans Company | Novel quaternary ammonium compounds and polymers thereof |
| BE791133A (fr) * | 1971-11-10 | 1973-05-09 | Calgon Corp | Nouveaux monomeres cationiques et leurs procedes de fabrication |
| GB1359932A (en) * | 1972-03-21 | 1974-07-17 | Lubrizol Corp | N-3-aminoalkyl amides polymers thereof and method for their prepa ration |
| US3878247A (en) * | 1974-01-25 | 1975-04-15 | Jefferson Chem Co Inc | Preparation of n-(tertiaryaminoalkyl) acrylamides |
| US3957869A (en) * | 1974-06-14 | 1976-05-18 | American Cyanamid Company | N-(chloroalkoxymethyl)acrylamides, quaternary ammonium derivatives thereof, and polymers having a content thereof |
| US4031138A (en) * | 1976-03-18 | 1977-06-21 | Texaco Development Corporation | Stable substituted acrylamides or methacrylamides |
| US4134916A (en) * | 1978-02-06 | 1979-01-16 | Texaco Development Corp. | N-polyalkoxyalkyl acrylamides or methacrylamides |
-
1979
- 1979-04-23 US US06/032,317 patent/US4212820A/en not_active Expired - Lifetime
- 1979-11-14 JP JP54146635A patent/JPS5838423B2/ja not_active Expired
-
1980
- 1980-03-21 GB GB8009547A patent/GB2047690B/en not_active Expired
- 1980-04-03 DE DE19803013067 patent/DE3013067A1/de active Granted
- 1980-04-08 CA CA349,370A patent/CA1128546A/en not_active Expired
- 1980-04-09 NL NLAANVRAGE8002066,A patent/NL187162C/xx not_active IP Right Cessation
- 1980-04-22 FR FR8009007A patent/FR2455033A1/fr active Granted
- 1980-04-23 BE BE0/200343A patent/BE882935A/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE3013067A1 (de) | 1980-11-13 |
| BE882935A (fr) | 1980-10-23 |
| GB2047690A (en) | 1980-12-03 |
| DE3013067C2 (cg-RX-API-DMAC7.html) | 1990-02-15 |
| JPS55141454A (en) | 1980-11-05 |
| US4212820A (en) | 1980-07-15 |
| GB2047690B (en) | 1983-03-30 |
| NL187162C (nl) | 1991-06-17 |
| NL8002066A (nl) | 1980-10-27 |
| FR2455033B1 (cg-RX-API-DMAC7.html) | 1983-01-14 |
| FR2455033A1 (fr) | 1980-11-21 |
| JPS5838423B2 (ja) | 1983-08-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1129884A (en) | Acrylamide or methacrylamide quaternary compounds | |
| CA1128546A (en) | Acrylamide or methacrylamide alkoxypropyl quaternary compounds | |
| US3970626A (en) | Ethylene interpolymer compositions and process | |
| CA1057892A (en) | Functional ionene compositions and their use | |
| US5324787A (en) | Modification of poly (vinylamine) | |
| US5124466A (en) | Cationic silicone surfactant and method of its manufacture | |
| US4031138A (en) | Stable substituted acrylamides or methacrylamides | |
| CA1129883A (en) | PREPARATION OF .alpha.,.beta.-UNSATURATED CARBOXYLIC ACID N-SUBSTITUTED-AMIDES, AND POLYMERS THEREOF | |
| JPH0327575B2 (cg-RX-API-DMAC7.html) | ||
| JPS62104839A (ja) | 枝分れポリアミドアミン類 | |
| US3962332A (en) | Bis-quaternary ammonium compounds and polymers | |
| RU2606227C2 (ru) | Способ получения ацилированного полимера, содержащего виниламин, и его применение в качестве добавки при изготовлении бумаги | |
| FR2460971A1 (fr) | Copolymeres d'alcool vinylique contenant des radicaux cationiques, utilisables en papeterie, et procede pour leur preparation | |
| CA1315465C (en) | Polymers of oxyalkylated unsaturated quaternary ammonium salts, their preparation and their use | |
| US4255549A (en) | Process for preparing organosilazanes | |
| EP0066366B1 (en) | Branched polyamidoamines, method for their preparation and method of improving the wet strength of paper using them | |
| CA1069935A (en) | Dichlorobutene/dimethylamine polymer | |
| SU680655A3 (ru) | Способ получени полимерного электролита | |
| KR100515457B1 (ko) | 단독이거나 기타 단량체와 혼합된1,3-비스(디메틸벤질암모늄)이소프로필 아크릴레이트의염화물의 제조방법, 및 상응하는 (공)중합체 | |
| US4297256A (en) | Preparation of water-immiscible, acid-soluble N-(aminomethyl)-α,.beta. | |
| JPS5830917B2 (ja) | ガンフツソケイカイメンカツセイザイ | |
| CN117904897B (zh) | 一种纸浆造纸助剂制备方法 | |
| JPH02188545A (ja) | ポリフルオロアルキルポリオキシアルキレン(メタ)アリルエーテル | |
| US3880709A (en) | Process for fiber treatment | |
| DE802895C (de) | Verfahren zur Herstellung siliciumhaltiger Polykondensationsprodukte |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |