CA1126729A - [1,2] anellated-7-phenyl-1,4-benzodiazepine and pharmaceutical compositions thereof and processes for their preparation - Google Patents
[1,2] anellated-7-phenyl-1,4-benzodiazepine and pharmaceutical compositions thereof and processes for their preparationInfo
- Publication number
- CA1126729A CA1126729A CA333,936A CA333936A CA1126729A CA 1126729 A CA1126729 A CA 1126729A CA 333936 A CA333936 A CA 333936A CA 1126729 A CA1126729 A CA 1126729A
- Authority
- CA
- Canada
- Prior art keywords
- chloro
- methyl
- phenyl
- benzodiazepine
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 37
- 238000002360 preparation method Methods 0.000 title abstract description 4
- 239000008194 pharmaceutical composition Substances 0.000 title abstract description 3
- -1 3,4-methylenedioxy Chemical group 0.000 claims abstract description 49
- 150000001875 compounds Chemical class 0.000 claims abstract description 45
- 229940049706 benzodiazepine Drugs 0.000 claims abstract description 29
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 20
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 17
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 11
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 10
- 150000002367 halogens Chemical group 0.000 claims abstract description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 9
- 150000003839 salts Chemical class 0.000 claims abstract description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 8
- 239000002253 acid Substances 0.000 claims abstract description 6
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 4
- 239000001301 oxygen Substances 0.000 claims abstract description 4
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 4
- 239000011593 sulfur Chemical group 0.000 claims abstract description 4
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims abstract 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract 2
- GUJAGMICFDYKNR-UHFFFAOYSA-N 1,4-benzodiazepine Chemical group N1C=CN=CC2=CC=CC=C12 GUJAGMICFDYKNR-UHFFFAOYSA-N 0.000 claims description 36
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 239000000126 substance Substances 0.000 claims description 20
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- 125000001246 bromo group Chemical group Br* 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 claims description 2
- 241000790917 Dioxys <bee> Species 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 229910052977 alkali metal sulfide Inorganic materials 0.000 claims description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims 26
- 150000002431 hydrogen Chemical class 0.000 claims 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 4
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 claims 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims 2
- 239000005977 Ethylene Substances 0.000 claims 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 claims 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract description 2
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 24
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 24
- 229910001868 water Inorganic materials 0.000 description 23
- 208000025865 Ulcer Diseases 0.000 description 18
- 238000002844 melting Methods 0.000 description 18
- 231100000397 ulcer Toxicity 0.000 description 18
- 230000008018 melting Effects 0.000 description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 230000000694 effects Effects 0.000 description 15
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- 239000000243 solution Substances 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 7
- 238000006467 substitution reaction Methods 0.000 description 7
- 239000013543 active substance Substances 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 5
- 229940024548 aluminum oxide Drugs 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 5
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 210000003169 central nervous system Anatomy 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 229960000905 indomethacin Drugs 0.000 description 4
- 229940073584 methylene chloride Drugs 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 229940083608 sodium hydroxide Drugs 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 238000002560 therapeutic procedure Methods 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 210000003205 muscle Anatomy 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- ZFYIQPIHXRFFCZ-QMMMGPOBSA-N (2s)-2-(cyclohexylamino)butanedioic acid Chemical compound OC(=O)C[C@@H](C(O)=O)NC1CCCCC1 ZFYIQPIHXRFFCZ-QMMMGPOBSA-N 0.000 description 2
- PNHMRDQZIYCAPU-MFOYZWKCSA-N (Z)-2-(9-chloro-7-phenyl-2,4,4a,5-tetrahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepin-1-yl)but-2-enedioic acid Chemical compound C1C2COCC(N2C3=C(C=C(C=C3)Cl)C(=N1)C4=CC=CC=C4)/C(=C/C(=O)O)/C(=O)O PNHMRDQZIYCAPU-MFOYZWKCSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- SLPUGTRSHPWDLZ-UHFFFAOYSA-N 5-phenyl-1,4-benzodiazepin-2-one Chemical compound C=12C=CC=CC2=NC(=O)C=NC=1C1=CC=CC=C1 SLPUGTRSHPWDLZ-UHFFFAOYSA-N 0.000 description 2
- JRLTTZUODKEYDH-UHFFFAOYSA-N 8-methylquinoline Chemical group C1=CN=C2C(C)=CC=CC2=C1 JRLTTZUODKEYDH-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 229910002016 Aerosil® 200 Inorganic materials 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- QXKHYNVANLEOEG-UHFFFAOYSA-N Methoxsalen Chemical group C1=CC(=O)OC2=C1C=C1C=COC1=C2OC QXKHYNVANLEOEG-UHFFFAOYSA-N 0.000 description 2
- 229920000715 Mucilage Polymers 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 206010042220 Stress ulcer Diseases 0.000 description 2
- 239000002250 absorbent Substances 0.000 description 2
- 230000002745 absorbent Effects 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000011097 chromatography purification Methods 0.000 description 2
- 239000013065 commercial product Substances 0.000 description 2
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate trihydrate Substances [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 229940099112 cornstarch Drugs 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 2
- 208000000718 duodenal ulcer Diseases 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- BMFVGAAISNGQNM-UHFFFAOYSA-N isopentylamine Chemical compound CC(C)CCN BMFVGAAISNGQNM-UHFFFAOYSA-N 0.000 description 2
- 230000007170 pathology Effects 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000002831 pharmacologic agent Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 150000003459 sulfonic acid esters Chemical class 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 238000012345 traction test Methods 0.000 description 2
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 1
- KYRVDFBYINNTBR-UHFFFAOYSA-N 1,3,5,2,4-trioxadithiepane 2,2,4,4-tetraoxide Chemical compound O=S1(=O)OCCOS(=O)(=O)O1 KYRVDFBYINNTBR-UHFFFAOYSA-N 0.000 description 1
- JTYRIICDQHNSNN-UHFFFAOYSA-N 1,5-benzodiazocine Chemical class N1=CC=CN=CC2=CC=CC=C21 JTYRIICDQHNSNN-UHFFFAOYSA-N 0.000 description 1
- CNJVWIUTZAJDAI-UHFFFAOYSA-N 10-methoxy-3-methyl-7-phenyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine Chemical compound COC1=CC2=C(C(=NCC3N2CCN(C3)C)C2=CC=CC=C2)C=C1 CNJVWIUTZAJDAI-UHFFFAOYSA-N 0.000 description 1
- NZVMVWOBAQFVSU-UHFFFAOYSA-N 10-methyl-7-phenyl-2,4,4a,5-tetrahydro-1h-[1,4]oxazino[4,3-a][1,4]benzodiazepine Chemical compound C=1C(C)=CC=C2C=1N1CCOCC1CN=C2C1=CC=CC=C1 NZVMVWOBAQFVSU-UHFFFAOYSA-N 0.000 description 1
- XDIAMRVROCPPBK-UHFFFAOYSA-N 2,2-dimethylpropan-1-amine Chemical compound CC(C)(C)CN XDIAMRVROCPPBK-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- KZGIKBDGFRQLNN-UHFFFAOYSA-N 3,10-dimethyl-7-phenyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine Chemical compound CN1CC2N(C3=C(C(=NC2)C2=CC=CC=C2)C=CC(=C3)C)CC1 KZGIKBDGFRQLNN-UHFFFAOYSA-N 0.000 description 1
- WGTASENVNYJZBK-UHFFFAOYSA-N 3,4,5-trimethoxyamphetamine Chemical compound COC1=CC(CC(C)N)=CC(OC)=C1OC WGTASENVNYJZBK-UHFFFAOYSA-N 0.000 description 1
- HTWPBCGBKVFWDO-UHFFFAOYSA-N 3,9,10-trimethyl-7-phenyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine Chemical compound CN1CC2N(C3=C(C(=NC2)C2=CC=CC=C2)C=C(C(=C3)C)C)CC1 HTWPBCGBKVFWDO-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- FYTPYKNNZBHZSO-UHFFFAOYSA-N 3-methyl-9-nitro-7-phenyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine Chemical compound [N+](=O)([O-])C=1C=CC2=C(C(=NCC3N2CCN(C3)C)C2=CC=CC=C2)C=1 FYTPYKNNZBHZSO-UHFFFAOYSA-N 0.000 description 1
- YNHGHPCGMBEGEU-UHFFFAOYSA-N 5-phenyl-1h-1,4-benzodiazepine Chemical compound C12=CC=CC=C2NC=CN=C1C1=CC=CC=C1 YNHGHPCGMBEGEU-UHFFFAOYSA-N 0.000 description 1
- JTXKOFKWABSCKJ-UHFFFAOYSA-N 7-(2-fluorophenyl)-2,4,4a,5-tetrahydro-1h-[1,4]thiazino[4,3-a][1,4]benzodiazepine Chemical compound FC1=CC=CC=C1C(C1=CC=CC=C11)=NCC2N1CCSC2 JTXKOFKWABSCKJ-UHFFFAOYSA-N 0.000 description 1
- VWPWKXZYSJONRH-UHFFFAOYSA-N 7-phenyl-2,4,4a,5-tetrahydro-1h-[1,4]oxazino[4,3-a][1,4]benzodiazepine Chemical compound C1OCCN(C2=CC=CC=C22)C1CN=C2C1=CC=CC=C1 VWPWKXZYSJONRH-UHFFFAOYSA-N 0.000 description 1
- UZOUKRMMSQJZIW-UHFFFAOYSA-N 9,10-dichloro-3-methyl-7-phenyl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine Chemical compound ClC=1C(=CC2=C(C(=NCC3N2CCN(C3)C)C2=CC=CC=C2)C=1)Cl UZOUKRMMSQJZIW-UHFFFAOYSA-N 0.000 description 1
- QKCZQTQGYHTWFM-UHFFFAOYSA-N 9,10-dichloro-7-phenyl-2,4,4a,5-tetrahydro-1h-[1,4]oxazino[4,3-a][1,4]benzodiazepine Chemical compound C1=2C=C(Cl)C(Cl)=CC=2N2CCOCC2CN=C1C1=CC=CC=C1 QKCZQTQGYHTWFM-UHFFFAOYSA-N 0.000 description 1
- NWWLYYUTJAUNMC-UHFFFAOYSA-N 9-chloro-3-[2-(3,4-dimethoxyphenyl)ethyl]-7-phenyl-2,4,4a,5-tetrahydro-1h-pyrazino[1,2-a][1,4]benzodiazepine;dihydrate;dihydrochloride Chemical compound O.O.Cl.Cl.C1=C(OC)C(OC)=CC=C1CCN1CC(CN=C(C=2C=CC=CC=2)C=2C3=CC=C(Cl)C=2)N3CC1 NWWLYYUTJAUNMC-UHFFFAOYSA-N 0.000 description 1
- MAOFJHWQHUHBSY-UHFFFAOYSA-N 9-chloro-7-phenyl-1,2,3,4,4a,5-hexahydropyrazino[1,2-a][1,4]benzodiazepine Chemical compound C12=CC(Cl)=CC=C2N2CCNCC2CN=C1C1=CC=CC=C1 MAOFJHWQHUHBSY-UHFFFAOYSA-N 0.000 description 1
- CBNKDVVYLNXTDK-UHFFFAOYSA-N 9-chloro-7-phenyl-3-(2-phenylethyl)-2,4,4a,5-tetrahydro-1h-pyrazino[1,2-a][1,4]benzodiazepine Chemical compound C1C2CN=C(C=3C=CC=CC=3)C3=CC(Cl)=CC=C3N2CCN1CCC1=CC=CC=C1 CBNKDVVYLNXTDK-UHFFFAOYSA-N 0.000 description 1
- GPVWFCMYTICFMU-UHFFFAOYSA-N 9-chloro-7-phenyl-3-propan-2-yl-2,4,4a,5-tetrahydro-1h-pyrazino[1,2-a][1,4]benzodiazepine;dihydrochloride Chemical compound Cl.Cl.C1N(C(C)C)CCN(C2=CC=C(Cl)C=C22)C1CN=C2C1=CC=CC=C1 GPVWFCMYTICFMU-UHFFFAOYSA-N 0.000 description 1
- KKXVKYDBAIFEEE-UHFFFAOYSA-N 9-methyl-7-phenyl-2,4,4a,5-tetrahydro-1h-[1,4]thiazino[4,3-a][1,4]benzodiazepine Chemical compound C12=CC(C)=CC=C2N2CCSCC2CN=C1C1=CC=CC=C1 KKXVKYDBAIFEEE-UHFFFAOYSA-N 0.000 description 1
- DDTSYRBXKLDUCV-UHFFFAOYSA-N 9-nitro-7-phenyl-2,4,4a,5-tetrahydro-1h-[1,4]oxazino[4,3-a][1,4]benzodiazepine Chemical compound C12=CC([N+](=O)[O-])=CC=C2N2CCOCC2CN=C1C1=CC=CC=C1 DDTSYRBXKLDUCV-UHFFFAOYSA-N 0.000 description 1
- FRFMIZBABBRIKH-UHFFFAOYSA-N 9-nitro-7-phenyl-2,4,4a,5-tetrahydro-1h-[1,4]thiazino[4,3-a][1,4]benzodiazepine Chemical compound C12=CC([N+](=O)[O-])=CC=C2N2CCSCC2CN=C1C1=CC=CC=C1 FRFMIZBABBRIKH-UHFFFAOYSA-N 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- HEUXRMRTGPUNAI-UHFFFAOYSA-N Cl.Cl.C1=C(Cl)C(Cl)=CC=C1C(C1=CC(Br)=CC=C11)=NCC2N1CCNC2 Chemical compound Cl.Cl.C1=C(Cl)C(Cl)=CC=C1C(C1=CC(Br)=CC=C11)=NCC2N1CCNC2 HEUXRMRTGPUNAI-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010022714 Intestinal ulcer Diseases 0.000 description 1
- 206010022998 Irritability Diseases 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 206010039897 Sedation Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 150000001557 benzodiazepines Chemical class 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 229960003529 diazepam Drugs 0.000 description 1
- 229960004132 diethyl ether Drugs 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- XNFVGEUMTFIVHQ-UHFFFAOYSA-N disodium;sulfide;hydrate Chemical compound O.[Na+].[Na+].[S-2] XNFVGEUMTFIVHQ-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 210000001198 duodenum Anatomy 0.000 description 1
- 230000002857 effect on ulcer Effects 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 210000004877 mucosa Anatomy 0.000 description 1
- 230000003170 musculotropic effect Effects 0.000 description 1
- PWBJWDKDPAPGED-UHFFFAOYSA-N n'-chlorobutanediamide Chemical compound NC(=O)CCC(=O)NCl PWBJWDKDPAPGED-UHFFFAOYSA-N 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000001003 psychopharmacologic effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000036280 sedation Effects 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 230000004622 sleep time Effects 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- JBJWASZNUJCEKT-UHFFFAOYSA-M sodium;hydroxide;hydrate Chemical compound O.[OH-].[Na+] JBJWASZNUJCEKT-UHFFFAOYSA-M 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 230000000153 supplemental effect Effects 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 125000001680 trimethoxyphenyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/20—Hypnotics; Sedatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Anesthesiology (AREA)
- Biomedical Technology (AREA)
- Neurosurgery (AREA)
- Neurology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782835708 DE2835708A1 (de) | 1978-08-16 | 1978-08-16 | Neue eckige klammer auf 1,2 eckige klammer zu-anellierte 7-phenyl-1,4-benzodiazepinderivate, verfahren zu deren herstellung und arzneimittel |
| DEP2835708.6 | 1978-08-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1126729A true CA1126729A (en) | 1982-06-29 |
Family
ID=6047065
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA333,936A Expired CA1126729A (en) | 1978-08-16 | 1979-08-16 | [1,2] anellated-7-phenyl-1,4-benzodiazepine and pharmaceutical compositions thereof and processes for their preparation |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4338314A (enExample) |
| EP (1) | EP0008045B1 (enExample) |
| JP (1) | JPS5559189A (enExample) |
| AT (1) | ATE260T1 (enExample) |
| AU (1) | AU530949B2 (enExample) |
| CA (1) | CA1126729A (enExample) |
| DE (2) | DE2835708A1 (enExample) |
| DK (1) | DK154432C (enExample) |
| ES (1) | ES483387A1 (enExample) |
| FI (1) | FI65431C (enExample) |
| GR (1) | GR82414B (enExample) |
| HU (1) | HU178256B (enExample) |
| IE (1) | IE48800B1 (enExample) |
| IL (1) | IL57922A (enExample) |
| NO (1) | NO151121C (enExample) |
| NZ (1) | NZ191311A (enExample) |
| PH (1) | PH16155A (enExample) |
| PT (1) | PT70006A (enExample) |
| SU (1) | SU904526A3 (enExample) |
| ZA (1) | ZA794234B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3151597A1 (de) * | 1981-12-28 | 1983-07-07 | Kali-Chemie Pharma Gmbh, 3000 Hannover | (1,2)-anellierte 1,4-benzodiazepin-verbindungen sowie verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| FR2521563A1 (fr) * | 1982-02-17 | 1983-08-19 | Lipha | Benzodiazepines-1,3 condensees, procedes de preparation et medicaments les contenant |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1695211U (de) | 1954-08-04 | 1955-03-24 | Bertram Fa Ludwig | Kaiserschnitt-tuch fuer schweine. |
| US3523947A (en) * | 1966-11-23 | 1970-08-11 | Hoffmann La Roche | 1-cyclic amidine-5-aryl-1,4-benzodiazepine and process |
| US3734912A (en) * | 1971-05-04 | 1973-05-22 | Upjohn Co | Certain pyrimido(1,2-a)(1,4)benzodiazepin-1(5h)-ones |
| NL7107667A (enExample) | 1971-06-04 | 1972-12-06 | ||
| BE790356A (fr) * | 1971-10-21 | 1973-04-20 | Takeda Chemical Industries Ltd | Derives de benzodiazepine |
| BE790508A (fr) | 1971-10-26 | 1973-04-25 | Hoffmann La Roche | Derives de benzodiazepine |
| US3822259A (en) * | 1971-11-02 | 1974-07-02 | Upjohn Co | 7-phenyl-1h(1,3)-oxazino(3,2-a)(1,4)benzodiazepine-1,3(2h)-diones |
| US3875181A (en) * | 1971-12-20 | 1975-04-01 | Hoffmann La Roche | 3-Acetyl-(1,2 -a)imidazo-1,4-benzodiazepines |
| DE2265371C3 (de) * | 1972-05-03 | 1980-12-11 | Kali-Chemie Ag, 3000 Hannover | N-(3-Benzoylaminopropyl)-aniline |
| DE2520937C3 (de) * | 1975-05-10 | 1978-10-12 | Kali-Chemie Ag, 3000 Hannover | 7-Brom-1 -methyl^-alkoxymethyl-S-(2-halogenphenyl)-lH-23-dihydro-l,4benzodiazepinderivate, deren Säureadditionssalze und pharmazeutische Präparate |
| CH567031A5 (enExample) * | 1972-05-18 | 1975-09-30 | Ciba Geigy Ag | |
| CH586225A5 (enExample) * | 1972-11-13 | 1977-03-31 | Takeda Chemical Industries Ltd | |
| US4006135A (en) * | 1974-06-19 | 1977-02-01 | Ddsa Pharmaceuticals | Hydroxymethyl benzodiazepine derivatives |
-
1978
- 1978-08-16 DE DE19782835708 patent/DE2835708A1/de not_active Withdrawn
-
1979
- 1979-07-27 DE DE7979102678T patent/DE2961136D1/de not_active Expired
- 1979-07-27 AT AT79102678T patent/ATE260T1/de not_active IP Right Cessation
- 1979-07-27 EP EP79102678A patent/EP0008045B1/de not_active Expired
- 1979-07-30 IL IL57922A patent/IL57922A/xx unknown
- 1979-07-31 PT PT70006A patent/PT70006A/pt unknown
- 1979-08-07 PH PH22874A patent/PH16155A/en unknown
- 1979-08-07 SU SU792798349A patent/SU904526A3/ru active
- 1979-08-10 IE IE1538/79A patent/IE48800B1/en unknown
- 1979-08-10 HU HU79KA1534A patent/HU178256B/hu unknown
- 1979-08-13 ZA ZA00794234A patent/ZA794234B/xx unknown
- 1979-08-13 GR GR59829A patent/GR82414B/el unknown
- 1979-08-14 NZ NZ191311A patent/NZ191311A/xx unknown
- 1979-08-14 FI FI792524A patent/FI65431C/fi not_active IP Right Cessation
- 1979-08-14 ES ES483387A patent/ES483387A1/es not_active Expired
- 1979-08-15 NO NO792671A patent/NO151121C/no unknown
- 1979-08-15 DK DK341479A patent/DK154432C/da not_active IP Right Cessation
- 1979-08-15 AU AU49941/79A patent/AU530949B2/en not_active Ceased
- 1979-08-16 JP JP10362679A patent/JPS5559189A/ja active Granted
- 1979-08-16 CA CA333,936A patent/CA1126729A/en not_active Expired
- 1979-08-16 US US06/067,146 patent/US4338314A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AU530949B2 (en) | 1983-08-04 |
| ATE260T1 (de) | 1981-10-15 |
| EP0008045B1 (de) | 1981-09-30 |
| IL57922A (en) | 1982-12-31 |
| SU904526A3 (ru) | 1982-02-07 |
| EP0008045A1 (de) | 1980-02-20 |
| HU178256B (en) | 1982-04-28 |
| IE48800B1 (en) | 1985-05-15 |
| ES483387A1 (es) | 1980-04-16 |
| US4338314A (en) | 1982-07-06 |
| NO151121B (no) | 1984-11-05 |
| PH16155A (en) | 1983-07-12 |
| IE791538L (en) | 1980-02-16 |
| FI65431C (fi) | 1984-05-10 |
| JPS634545B2 (enExample) | 1988-01-29 |
| NO151121C (no) | 1985-02-13 |
| JPS5559189A (en) | 1980-05-02 |
| DK154432B (da) | 1988-11-14 |
| FI792524A7 (fi) | 1980-02-17 |
| GR82414B (enExample) | 1984-12-13 |
| DE2961136D1 (en) | 1981-12-10 |
| NZ191311A (en) | 1982-03-16 |
| IL57922A0 (en) | 1979-11-30 |
| PT70006A (en) | 1979-08-01 |
| NO792671L (no) | 1980-02-19 |
| DE2835708A1 (de) | 1980-03-06 |
| ZA794234B (en) | 1980-08-27 |
| DK154432C (da) | 1989-04-10 |
| FI65431B (fi) | 1984-01-31 |
| DK341479A (da) | 1980-02-17 |
| AU4994179A (en) | 1980-02-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3763183A (en) | 1,2,3,10,11,11a-hexahydro-5h-pyrrolo (2,1-c)(1,4)benzodiazepines | |
| US4746655A (en) | Fused aromatic-spiropiperidine oxazepinones(and thiones) | |
| GB2093842A (en) | Imidazodiazepines | |
| CA1126729A (en) | [1,2] anellated-7-phenyl-1,4-benzodiazepine and pharmaceutical compositions thereof and processes for their preparation | |
| US3732212A (en) | 1,2,3,10,11,11a-hexahydro-5h-pyrrolo(2,1-c)(1,4)benzodiazepine-5,11-diones | |
| NZ203217A (en) | Pyridobenzodiazepinone derivatives and pharmaceutical compositions | |
| US4587245A (en) | Method of treating neuropsychic disturbances by benzodiazepine derivatives and composition therefor | |
| PL80112B1 (enExample) | ||
| US3903103A (en) | 4-Amino-s-triazolo-{8 4,3-a{9 {8 1,4{9 benzodiazepine | |
| US3717654A (en) | 2,5,6,7-tetrahydro-3h-s-triazolo(4,3-d)(1,4)benzodiazepin-3-one compounds and their production | |
| KR100382998B1 (ko) | 6-메톡시-1h-벤조트리아졸-5-카르복사미드유도체,그제조방법및그것을함유하는의약조성물 | |
| US3499003A (en) | 3-(2-(3-aminopyrrolidinyl)-ethyl)-indoles | |
| US3882112A (en) | 7-Phenyl-3-{8 2-(dialkylamino)-alkyl{9 -3,4-dihydroas-triazino{8 4,3-a{9 {8 1,4{9 benzodiazepin-2(1h)-ones | |
| US3573324A (en) | 2,3,4,5,10,10a-hexahydroazepino(2,3-b)indoles | |
| US3825533A (en) | N-carboxymethyl-n-substituted glycinate esters of 3-hydroxy-1,4-benzo-diazepin-2-ones | |
| IE53693B1 (en) | Triazolobenzaepines, process and intermediate compounds for their manufacture and medicaments containing them | |
| HU177901B (en) | Process for preparing 8- and/or 9-substituted 2,3,4,5-tetrahydro-1h-2-benzazepine derivatives | |
| US3840558A (en) | Thieno(2,3-epsilon)(1,4)diazepine compounds | |
| US4694003A (en) | Method of treating depression with 5-(aminoalkyl)-11-phenyl-5H-dibenzo(b,e)(1,4) diazepines | |
| GB2154584A (en) | Diazepinoindoles | |
| US3859285A (en) | 10, 11-dihydro-5h-benzo (4,5) cyclohepta (1,2-b) pyrazines | |
| EP0172692B1 (en) | Hexahydroindolizine compounds, pharmaceutical compositions and methods and intermediates | |
| US3857854A (en) | 6-phenyl-1h,4h-{8 1,2,4{9 oxadiazalo{8 4,3-2{9 {8 1,4{9 benzodiazepin-1-ones | |
| US3294817A (en) | Octahydroindolobenzazepines and compounds intermediate thereto | |
| NZ203194A (en) | Dibenzodiazepinone derivatives and pharmaceutical compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |