CA1118362A - Alkali metal lauryl sulphate and anionic surface active agents in clear dentifrice - Google Patents
Alkali metal lauryl sulphate and anionic surface active agents in clear dentifriceInfo
- Publication number
- CA1118362A CA1118362A CA000327896A CA327896A CA1118362A CA 1118362 A CA1118362 A CA 1118362A CA 000327896 A CA000327896 A CA 000327896A CA 327896 A CA327896 A CA 327896A CA 1118362 A CA1118362 A CA 1118362A
- Authority
- CA
- Canada
- Prior art keywords
- alkali metal
- surface active
- dentifrice
- lauryl sulphate
- anionic surface
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000551 dentifrice Substances 0.000 title claims abstract description 49
- -1 Alkali metal lauryl sulphate Chemical class 0.000 title claims abstract description 43
- 229910052783 alkali metal Inorganic materials 0.000 title claims abstract description 30
- 125000000129 anionic group Chemical group 0.000 title claims abstract description 26
- 239000004094 surface-active agent Substances 0.000 title claims abstract description 21
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 19
- 239000000203 mixture Substances 0.000 claims abstract description 18
- 238000005498 polishing Methods 0.000 claims abstract description 14
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 8
- 150000005690 diesters Chemical class 0.000 claims abstract description 7
- 239000007791 liquid phase Substances 0.000 claims abstract description 7
- 229910019142 PO4 Inorganic materials 0.000 claims abstract description 5
- 239000010452 phosphate Substances 0.000 claims abstract description 5
- 229910001515 alkali metal fluoride Inorganic materials 0.000 claims abstract description 4
- 239000007790 solid phase Substances 0.000 claims abstract description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims abstract description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 150000001340 alkali metals Chemical class 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 7
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 claims description 7
- 239000004141 Sodium laurylsulphate Substances 0.000 claims description 7
- 235000011187 glycerol Nutrition 0.000 claims description 7
- 239000002245 particle Substances 0.000 claims description 7
- 235000019333 sodium laurylsulphate Nutrition 0.000 claims description 7
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 239000000600 sorbitol Substances 0.000 claims description 6
- 239000011737 fluorine Substances 0.000 claims description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims description 4
- 229910021653 sulphate ion Inorganic materials 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 3
- 239000003349 gelling agent Substances 0.000 claims description 3
- 239000003906 humectant Substances 0.000 claims description 3
- 239000000377 silicon dioxide Substances 0.000 claims description 3
- 229960004711 sodium monofluorophosphate Drugs 0.000 claims description 3
- 239000002562 thickening agent Substances 0.000 claims description 3
- XGRSAFKZAGGXJV-UHFFFAOYSA-N 3-azaniumyl-3-cyclohexylpropanoate Chemical group OC(=O)CC(N)C1CCCCC1 XGRSAFKZAGGXJV-UHFFFAOYSA-N 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 229910052681 coesite Inorganic materials 0.000 claims description 2
- 229910052906 cristobalite Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 235000012239 silicon dioxide Nutrition 0.000 claims description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 2
- 235000011152 sodium sulphate Nutrition 0.000 claims description 2
- 229910052682 stishovite Inorganic materials 0.000 claims description 2
- 229910052905 tridymite Inorganic materials 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 claims 1
- 229910000503 Na-aluminosilicate Inorganic materials 0.000 claims 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 claims 1
- 239000001768 carboxy methyl cellulose Substances 0.000 claims 1
- 108700004121 sarkosyl Proteins 0.000 claims 1
- 239000000429 sodium aluminium silicate Substances 0.000 claims 1
- 235000012217 sodium aluminium silicate Nutrition 0.000 claims 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical group [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 claims 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 claims 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 claims 1
- KSAVQLQVUXSOCR-UHFFFAOYSA-M sodium lauroyl sarcosinate Chemical group [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O KSAVQLQVUXSOCR-UHFFFAOYSA-M 0.000 claims 1
- 159000000000 sodium salts Chemical class 0.000 claims 1
- 239000002253 acid Substances 0.000 abstract description 11
- 239000011734 sodium Substances 0.000 abstract description 6
- 229910052708 sodium Inorganic materials 0.000 abstract description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 abstract description 4
- 229940074371 monofluorophosphate Drugs 0.000 abstract description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 abstract description 2
- ZBJVLWIYKOAYQH-UHFFFAOYSA-N naphthalen-2-yl 2-hydroxybenzoate Chemical compound OC1=CC=CC=C1C(=O)OC1=CC=C(C=CC=C2)C2=C1 ZBJVLWIYKOAYQH-UHFFFAOYSA-N 0.000 description 11
- 239000000463 material Substances 0.000 description 9
- 239000000499 gel Substances 0.000 description 5
- XCOBTUNSZUJCDH-UHFFFAOYSA-B lithium magnesium sodium silicate Chemical compound [Li+].[Li+].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Na+].[Na+].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3 XCOBTUNSZUJCDH-UHFFFAOYSA-B 0.000 description 5
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 229940094522 laponite Drugs 0.000 description 4
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000606 toothpaste Substances 0.000 description 3
- 229940123208 Biguanide Drugs 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000004411 aluminium Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 210000003298 dental enamel Anatomy 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 210000000214 mouth Anatomy 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 229920001983 poloxamer Polymers 0.000 description 2
- 239000011775 sodium fluoride Substances 0.000 description 2
- 235000013024 sodium fluoride Nutrition 0.000 description 2
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 2
- 229910001948 sodium oxide Inorganic materials 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 229940034610 toothpaste Drugs 0.000 description 2
- OQYNFBPKTVQOKO-UHFFFAOYSA-N 1,1-dichlorooctane Chemical compound CCCCCCCC(Cl)Cl OQYNFBPKTVQOKO-UHFFFAOYSA-N 0.000 description 1
- DTOUUUZOYKYHEP-UHFFFAOYSA-N 1,3-bis(2-ethylhexyl)-5-methyl-1,3-diazinan-5-amine Chemical compound CCCCC(CC)CN1CN(CC(CC)CCCC)CC(C)(N)C1 DTOUUUZOYKYHEP-UHFFFAOYSA-N 0.000 description 1
- PBYSGNVIJLMHLI-UHFFFAOYSA-N 1-[n'-[(4-chlorophenyl)methyl]carbamimidoyl]-2-(3-dodecoxypropyl)guanidine Chemical compound CCCCCCCCCCCCOCCCNC(=N)NC(=N)NCC1=CC=C(Cl)C=C1 PBYSGNVIJLMHLI-UHFFFAOYSA-N 0.000 description 1
- NXAMPWHWXNYVFR-UHFFFAOYSA-N 1-chloro-2-(N'-dodecylcarbamimidoyl)-1-phenylguanidine Chemical compound ClN(C(=N)NC(=N)NCCCCCCCCCCCC)C1=CC=CC=C1 NXAMPWHWXNYVFR-UHFFFAOYSA-N 0.000 description 1
- MBXZPFLUPOKREA-UHFFFAOYSA-N 1-chloro-3-(diaminomethylidene)-1-phenylguanidine Chemical compound NC(N)=NC(=N)N(Cl)C1=CC=CC=C1 MBXZPFLUPOKREA-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-UHFFFAOYSA-N 2-methylbutyric acid Chemical compound CCC(C)C(O)=O WLAMNBDJUVNPJU-UHFFFAOYSA-N 0.000 description 1
- UBLAMKHIFZBBSS-UHFFFAOYSA-N 3-Methylbutyl pentanoate Chemical compound CCCCC(=O)OCCC(C)C UBLAMKHIFZBBSS-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- XNCOSPRUTUOJCJ-UHFFFAOYSA-N Biguanide Chemical compound NC(N)=NC(N)=N XNCOSPRUTUOJCJ-UHFFFAOYSA-N 0.000 description 1
- 241000206575 Chondrus crispus Species 0.000 description 1
- 244000223760 Cinnamomum zeylanicum Species 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- 241000518994 Conta Species 0.000 description 1
- 239000005696 Diammonium phosphate Substances 0.000 description 1
- 239000004150 EU approved colour Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 244000004281 Eucalyptus maculata Species 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 240000001238 Gaultheria procumbens Species 0.000 description 1
- 235000007297 Gaultheria procumbens Nutrition 0.000 description 1
- 244000024873 Mentha crispa Species 0.000 description 1
- 235000014749 Mentha crispa Nutrition 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000016257 Mentha pulegium Nutrition 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- 244000227633 Ocotea pretiosa Species 0.000 description 1
- 235000004263 Ocotea pretiosa Nutrition 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 235000016639 Syzygium aromaticum Nutrition 0.000 description 1
- 244000223014 Syzygium aromaticum Species 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- YHGRTQVZCTXLHO-UHFFFAOYSA-M [[2,3-bis(2-methylpropyl)phenyl]-ethoxy-phenoxymethyl]-ethyl-dimethylazanium;chloride Chemical compound [Cl-].C=1C=CC(CC(C)C)=C(CC(C)C)C=1C([N+](C)(C)CC)(OCC)OC1=CC=CC=C1 YHGRTQVZCTXLHO-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical class C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 description 1
- 235000017803 cinnamon Nutrition 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 229910000388 diammonium phosphate Inorganic materials 0.000 description 1
- 235000019838 diammonium phosphate Nutrition 0.000 description 1
- PFKRTWCFCOUBHS-UHFFFAOYSA-N dimethyl(octadecyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[NH+](C)C PFKRTWCFCOUBHS-UHFFFAOYSA-N 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 229940091249 fluoride supplement Drugs 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 235000001050 hortel pimenta Nutrition 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000000017 hydrogel Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229960001047 methyl salicylate Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229940006093 opthalmologic coloring agent diagnostic Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000006353 oxyethylene group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229960003975 potassium Drugs 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 235000002020 sage Nutrition 0.000 description 1
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical class C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000001587 sorbitan monostearate Substances 0.000 description 1
- 235000011076 sorbitan monostearate Nutrition 0.000 description 1
- 229940035048 sorbitan monostearate Drugs 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/40—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing nitrogen
- A61K8/44—Aminocarboxylic acids or derivatives thereof, e.g. aminocarboxylic acids containing sulfur; Salts; Esters or N-acylated derivatives thereof
- A61K8/442—Aminocarboxylic acids or derivatives thereof, e.g. aminocarboxylic acids containing sulfur; Salts; Esters or N-acylated derivatives thereof substituted by amido group(s)
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/19—Cosmetics or similar toiletry preparations characterised by the composition containing inorganic ingredients
- A61K8/26—Aluminium; Compounds thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/46—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing sulfur
- A61K8/463—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing sulfur containing sulfuric acid derivatives, e.g. sodium lauryl sulfate
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/55—Phosphorus compounds
- A61K8/556—Derivatives containing from 2 to 10 oxyalkylene groups
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/72—Cosmetics or similar toiletry preparations characterised by the composition containing organic macromolecular compounds
- A61K8/73—Polysaccharides
- A61K8/731—Cellulose; Quaternized cellulose derivatives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q11/00—Preparations for care of the teeth, of the oral cavity or of dentures; Dentifrices, e.g. toothpastes; Mouth rinses
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB20758/78A GB1594878A (en) | 1978-05-19 | 1978-05-19 | Dentifrices |
| GB20758/78 | 1978-05-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1118362A true CA1118362A (en) | 1982-02-16 |
Family
ID=10151168
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000327896A Expired CA1118362A (en) | 1978-05-19 | 1979-05-18 | Alkali metal lauryl sulphate and anionic surface active agents in clear dentifrice |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4238476A (show.php) |
| JP (1) | JPS54154536A (show.php) |
| AU (1) | AU524796B2 (show.php) |
| BE (1) | BE876314A (show.php) |
| CA (1) | CA1118362A (show.php) |
| CH (1) | CH641956A5 (show.php) |
| DE (1) | DE2918166A1 (show.php) |
| DK (1) | DK148272C (show.php) |
| FR (1) | FR2425851B1 (show.php) |
| GB (1) | GB1594878A (show.php) |
| IT (1) | IT1116817B (show.php) |
| MX (1) | MX150143A (show.php) |
| MY (1) | MY8300099A (show.php) |
| NZ (1) | NZ190117A (show.php) |
| PH (1) | PH15846A (show.php) |
| SE (1) | SE431394B (show.php) |
| ZA (1) | ZA791585B (show.php) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4362713A (en) * | 1980-07-25 | 1982-12-07 | Johnson & Johnson Products Inc. | Salts of maleic acid copolymers as dental plaque barrier agents |
| US4364924A (en) * | 1980-07-25 | 1982-12-21 | Johnson & Johnson Products, Inc. | Alkali metal salts of poly(vinylbenzoic acid) as dental plaque barrier agents |
| AU555948B2 (en) * | 1980-08-19 | 1986-10-16 | Colgate-Palmolive Pty. Ltd. | Stable dentifrice |
| GB2084463B (en) * | 1980-09-24 | 1984-05-31 | Colgate Palmolive Co | Dentifrices |
| GB2084462B (en) * | 1980-09-24 | 1983-11-09 | Colgate Palmolive Co | Opaque dentifrice |
| GB2098063B (en) * | 1981-05-08 | 1984-12-12 | Colgate Palmolive Co | Dentifrice composition containing anionic phosphate esters |
| US4356168A (en) * | 1981-05-11 | 1982-10-26 | Colgate-Palmolive Company | Opacified dental cream containing a binary fluorine-providing system |
| GB2109683B (en) * | 1981-11-19 | 1985-09-11 | Colgate Palmolive Co | Stable dentifrice |
| US4526778A (en) * | 1981-11-19 | 1985-07-02 | Colgate-Palmolive Company | Stable dentifrice containing neutral siliceouse polishing agent |
| GB2109682B (en) * | 1981-11-19 | 1985-09-11 | Colgate Palmolive Co | Stable dentifrice |
| DE3268725D1 (en) * | 1982-02-15 | 1986-03-13 | Warner Lambert Co | Dental hygiene compositions and their production |
| US4545979A (en) * | 1982-02-22 | 1985-10-08 | Warner-Lambert Company | Dental hygiene compositions |
| JPS58148810A (ja) * | 1982-02-26 | 1983-09-05 | ワ−ナ−−ランバ−ト・コンパニ− | 歯科衛生用組成物 |
| US4419342A (en) * | 1982-03-10 | 1983-12-06 | Colgate-Palmolive Company | Dentifrice preparation |
| US4448766A (en) * | 1982-04-29 | 1984-05-15 | Colgate-Palmolive Company | Dentifrice composition |
| US4540576A (en) * | 1982-08-02 | 1985-09-10 | Johnson & Johnson Dental Products Company | Neutral topical sodium fluoride gel |
| US4455294A (en) * | 1982-11-17 | 1984-06-19 | Colgate-Palmolive Company | Stable dentifrice containing acidic siliceous polishing agent |
| US4550018A (en) * | 1984-02-22 | 1985-10-29 | Warner-Lambert Company | Dental hygiene compositions |
| GB8828018D0 (en) * | 1988-12-01 | 1989-01-05 | Unilever Plc | Topical composition |
| JPH0825861B2 (ja) * | 1989-04-24 | 1996-03-13 | サンスター株式会社 | 歯磨組成物 |
| GB8927213D0 (en) * | 1989-12-01 | 1990-01-31 | Ici Renory Sa | Alkyl sulphate salts |
| US5252313A (en) * | 1991-12-20 | 1993-10-12 | Colgate-Palmolive Company | Visually clear gel dentifrice |
| US20060104931A1 (en) * | 2004-11-12 | 2006-05-18 | Takeshi Fukutome | Cosmetic treatment article comprising substrate and gel composition |
| AU2008266172B2 (en) * | 2007-06-12 | 2014-04-17 | Rhodia Inc. | Mono-, di- and polyol alkoxylate phosphate esters in oral care formulations and methods for using same |
| MX2020006255A (es) | 2017-12-18 | 2020-09-07 | Colgate Palmolive Co | Metodos analiticos. |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR737220A (fr) * | 1931-09-03 | 1932-12-08 | Henkel & Cie Gmbh | Produit dentifrice et d'hygiène buccale |
| US3538230A (en) * | 1966-12-05 | 1970-11-03 | Lever Brothers Ltd | Oral compositions containing silica xerogels as cleaning and polishing agents |
| US3662059A (en) * | 1969-06-02 | 1972-05-09 | Lever Brothers Ltd | Dentifrice composition |
| FR2107827B1 (show.php) * | 1970-09-21 | 1976-06-04 | Colgate Palmolive Co | |
| GB1373003A (en) * | 1971-01-28 | 1974-11-06 | Unilever Ltd | Dentifrice composition |
| ZA722246B (en) * | 1971-04-30 | 1973-11-28 | Colgate Palmolive Co | Clear dentifrice |
| US3927202A (en) * | 1973-01-29 | 1975-12-16 | Colgate Palmolive Co | Dentifrices |
| GB1475252A (en) * | 1975-01-15 | 1977-06-01 | Colgate Palmolive Co | Toothpaste composition |
| GB1475251A (en) * | 1975-01-15 | 1977-06-01 | Colgate Palmolive Co | Oral preparations |
| GB1492660A (en) * | 1975-10-13 | 1977-11-23 | Colgate Palmolive Co | Dentifrices |
| US4130636A (en) * | 1977-07-27 | 1978-12-19 | Colgate-Palmolive Company | Dentifrice |
| US4150151A (en) * | 1977-12-12 | 1979-04-17 | Lever Brothers Company | Mouthwash |
-
1978
- 1978-05-19 GB GB20758/78A patent/GB1594878A/en not_active Expired
-
1979
- 1979-04-03 ZA ZA791585A patent/ZA791585B/xx unknown
- 1979-04-06 NZ NZ190117A patent/NZ190117A/xx unknown
- 1979-04-18 AU AU46189/79A patent/AU524796B2/en not_active Ceased
- 1979-04-18 SE SE7903381A patent/SE431394B/sv not_active IP Right Cessation
- 1979-05-05 DE DE19792918166 patent/DE2918166A1/de not_active Withdrawn
- 1979-05-08 IT IT48970/79A patent/IT1116817B/it active
- 1979-05-10 US US06/037,597 patent/US4238476A/en not_active Expired - Lifetime
- 1979-05-11 FR FR7912035A patent/FR2425851B1/fr not_active Expired
- 1979-05-16 PH PH22506A patent/PH15846A/en unknown
- 1979-05-16 MX MX177679A patent/MX150143A/es unknown
- 1979-05-17 BE BE0/195207A patent/BE876314A/xx not_active IP Right Cessation
- 1979-05-17 JP JP6099479A patent/JPS54154536A/ja active Granted
- 1979-05-18 CH CH470479A patent/CH641956A5/de not_active IP Right Cessation
- 1979-05-18 DK DK205279A patent/DK148272C/da not_active IP Right Cessation
- 1979-05-18 CA CA000327896A patent/CA1118362A/en not_active Expired
-
1983
- 1983-12-30 MY MY99/83A patent/MY8300099A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| MY8300099A (en) | 1983-12-31 |
| FR2425851B1 (fr) | 1985-06-28 |
| IT7948970A0 (it) | 1979-05-08 |
| US4238476A (en) | 1980-12-09 |
| FR2425851A1 (fr) | 1979-12-14 |
| CH641956A5 (de) | 1984-03-30 |
| DE2918166A1 (de) | 1979-11-29 |
| SE431394B (sv) | 1984-02-06 |
| AU4618979A (en) | 1979-11-22 |
| BE876314A (fr) | 1979-09-17 |
| JPS635371B2 (show.php) | 1988-02-03 |
| GB1594878A (en) | 1981-08-05 |
| NZ190117A (en) | 1981-02-11 |
| DK148272B (da) | 1985-05-28 |
| DK148272C (da) | 1985-11-11 |
| ZA791585B (en) | 1980-11-26 |
| JPS54154536A (en) | 1979-12-05 |
| AU524796B2 (en) | 1982-10-07 |
| DK205279A (da) | 1979-11-20 |
| SE7903381L (sv) | 1979-11-20 |
| MX150143A (es) | 1984-03-20 |
| PH15846A (en) | 1983-04-08 |
| IT1116817B (it) | 1986-02-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1118362A (en) | Alkali metal lauryl sulphate and anionic surface active agents in clear dentifrice | |
| US4263276A (en) | Dentifrices | |
| CA1335960C (en) | Oral hygiene composition | |
| US4425322A (en) | Dual-action dentifrice | |
| US4314990A (en) | Toothpaste compositions | |
| US3927201A (en) | Dentifrices | |
| PL172151B1 (pl) | Pasta do zebów PL PL PL PL | |
| CA2265463A1 (en) | Remineralising composition | |
| US4357317A (en) | Dental cream composition | |
| US5028413A (en) | Novel fluoride-containing dentifrice | |
| GB2149661A (en) | Dentifrices | |
| US4455293A (en) | Stable dentifrice containing neutral siliceous polishing agent | |
| US4459283A (en) | Stable dentifrice | |
| NZ200379A (en) | Dentifrice composition | |
| EP1052966A2 (en) | Oral care compositions | |
| US4419342A (en) | Dentifrice preparation | |
| US4455294A (en) | Stable dentifrice containing acidic siliceous polishing agent | |
| US4279889A (en) | Periodontal dental composition | |
| US4526778A (en) | Stable dentifrice containing neutral siliceouse polishing agent | |
| CA1170574A (en) | Opaque dentifrice | |
| GB2084015A (en) | Preventing tube corrosion by dentifrices | |
| GB2109683A (en) | Stable dentifrice | |
| WO2024074664A1 (en) | Dentifrice composition | |
| JPH0259802B2 (show.php) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |